41519 lines
1.5 MiB
Vendored
41519 lines
1.5 MiB
Vendored
/******/ (() => { // webpackBootstrap
|
|
/******/ var __webpack_modules__ = ({
|
|
|
|
/***/ "./node_modules/@vue/compiler-core/dist/compiler-core.esm-bundler.js":
|
|
/*!***************************************************************************!*\
|
|
!*** ./node_modules/@vue/compiler-core/dist/compiler-core.esm-bundler.js ***!
|
|
\***************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "generateCodeFrame": () => (/* reexport safe */ _vue_shared__WEBPACK_IMPORTED_MODULE_0__.generateCodeFrame),
|
|
/* harmony export */ "BASE_TRANSITION": () => (/* binding */ BASE_TRANSITION),
|
|
/* harmony export */ "CAMELIZE": () => (/* binding */ CAMELIZE),
|
|
/* harmony export */ "CAPITALIZE": () => (/* binding */ CAPITALIZE),
|
|
/* harmony export */ "CREATE_BLOCK": () => (/* binding */ CREATE_BLOCK),
|
|
/* harmony export */ "CREATE_COMMENT": () => (/* binding */ CREATE_COMMENT),
|
|
/* harmony export */ "CREATE_ELEMENT_BLOCK": () => (/* binding */ CREATE_ELEMENT_BLOCK),
|
|
/* harmony export */ "CREATE_ELEMENT_VNODE": () => (/* binding */ CREATE_ELEMENT_VNODE),
|
|
/* harmony export */ "CREATE_SLOTS": () => (/* binding */ CREATE_SLOTS),
|
|
/* harmony export */ "CREATE_STATIC": () => (/* binding */ CREATE_STATIC),
|
|
/* harmony export */ "CREATE_TEXT": () => (/* binding */ CREATE_TEXT),
|
|
/* harmony export */ "CREATE_VNODE": () => (/* binding */ CREATE_VNODE),
|
|
/* harmony export */ "FRAGMENT": () => (/* binding */ FRAGMENT),
|
|
/* harmony export */ "GUARD_REACTIVE_PROPS": () => (/* binding */ GUARD_REACTIVE_PROPS),
|
|
/* harmony export */ "IS_MEMO_SAME": () => (/* binding */ IS_MEMO_SAME),
|
|
/* harmony export */ "IS_REF": () => (/* binding */ IS_REF),
|
|
/* harmony export */ "KEEP_ALIVE": () => (/* binding */ KEEP_ALIVE),
|
|
/* harmony export */ "MERGE_PROPS": () => (/* binding */ MERGE_PROPS),
|
|
/* harmony export */ "NORMALIZE_CLASS": () => (/* binding */ NORMALIZE_CLASS),
|
|
/* harmony export */ "NORMALIZE_PROPS": () => (/* binding */ NORMALIZE_PROPS),
|
|
/* harmony export */ "NORMALIZE_STYLE": () => (/* binding */ NORMALIZE_STYLE),
|
|
/* harmony export */ "OPEN_BLOCK": () => (/* binding */ OPEN_BLOCK),
|
|
/* harmony export */ "POP_SCOPE_ID": () => (/* binding */ POP_SCOPE_ID),
|
|
/* harmony export */ "PUSH_SCOPE_ID": () => (/* binding */ PUSH_SCOPE_ID),
|
|
/* harmony export */ "RENDER_LIST": () => (/* binding */ RENDER_LIST),
|
|
/* harmony export */ "RENDER_SLOT": () => (/* binding */ RENDER_SLOT),
|
|
/* harmony export */ "RESOLVE_COMPONENT": () => (/* binding */ RESOLVE_COMPONENT),
|
|
/* harmony export */ "RESOLVE_DIRECTIVE": () => (/* binding */ RESOLVE_DIRECTIVE),
|
|
/* harmony export */ "RESOLVE_DYNAMIC_COMPONENT": () => (/* binding */ RESOLVE_DYNAMIC_COMPONENT),
|
|
/* harmony export */ "RESOLVE_FILTER": () => (/* binding */ RESOLVE_FILTER),
|
|
/* harmony export */ "SET_BLOCK_TRACKING": () => (/* binding */ SET_BLOCK_TRACKING),
|
|
/* harmony export */ "SUSPENSE": () => (/* binding */ SUSPENSE),
|
|
/* harmony export */ "TELEPORT": () => (/* binding */ TELEPORT),
|
|
/* harmony export */ "TO_DISPLAY_STRING": () => (/* binding */ TO_DISPLAY_STRING),
|
|
/* harmony export */ "TO_HANDLERS": () => (/* binding */ TO_HANDLERS),
|
|
/* harmony export */ "TO_HANDLER_KEY": () => (/* binding */ TO_HANDLER_KEY),
|
|
/* harmony export */ "UNREF": () => (/* binding */ UNREF),
|
|
/* harmony export */ "WITH_CTX": () => (/* binding */ WITH_CTX),
|
|
/* harmony export */ "WITH_DIRECTIVES": () => (/* binding */ WITH_DIRECTIVES),
|
|
/* harmony export */ "WITH_MEMO": () => (/* binding */ WITH_MEMO),
|
|
/* harmony export */ "WITH_SCOPE_ID": () => (/* binding */ WITH_SCOPE_ID),
|
|
/* harmony export */ "advancePositionWithClone": () => (/* binding */ advancePositionWithClone),
|
|
/* harmony export */ "advancePositionWithMutation": () => (/* binding */ advancePositionWithMutation),
|
|
/* harmony export */ "assert": () => (/* binding */ assert),
|
|
/* harmony export */ "baseCompile": () => (/* binding */ baseCompile),
|
|
/* harmony export */ "baseParse": () => (/* binding */ baseParse),
|
|
/* harmony export */ "buildProps": () => (/* binding */ buildProps),
|
|
/* harmony export */ "buildSlots": () => (/* binding */ buildSlots),
|
|
/* harmony export */ "checkCompatEnabled": () => (/* binding */ checkCompatEnabled),
|
|
/* harmony export */ "createArrayExpression": () => (/* binding */ createArrayExpression),
|
|
/* harmony export */ "createAssignmentExpression": () => (/* binding */ createAssignmentExpression),
|
|
/* harmony export */ "createBlockStatement": () => (/* binding */ createBlockStatement),
|
|
/* harmony export */ "createCacheExpression": () => (/* binding */ createCacheExpression),
|
|
/* harmony export */ "createCallExpression": () => (/* binding */ createCallExpression),
|
|
/* harmony export */ "createCompilerError": () => (/* binding */ createCompilerError),
|
|
/* harmony export */ "createCompoundExpression": () => (/* binding */ createCompoundExpression),
|
|
/* harmony export */ "createConditionalExpression": () => (/* binding */ createConditionalExpression),
|
|
/* harmony export */ "createForLoopParams": () => (/* binding */ createForLoopParams),
|
|
/* harmony export */ "createFunctionExpression": () => (/* binding */ createFunctionExpression),
|
|
/* harmony export */ "createIfStatement": () => (/* binding */ createIfStatement),
|
|
/* harmony export */ "createInterpolation": () => (/* binding */ createInterpolation),
|
|
/* harmony export */ "createObjectExpression": () => (/* binding */ createObjectExpression),
|
|
/* harmony export */ "createObjectProperty": () => (/* binding */ createObjectProperty),
|
|
/* harmony export */ "createReturnStatement": () => (/* binding */ createReturnStatement),
|
|
/* harmony export */ "createRoot": () => (/* binding */ createRoot),
|
|
/* harmony export */ "createSequenceExpression": () => (/* binding */ createSequenceExpression),
|
|
/* harmony export */ "createSimpleExpression": () => (/* binding */ createSimpleExpression),
|
|
/* harmony export */ "createStructuralDirectiveTransform": () => (/* binding */ createStructuralDirectiveTransform),
|
|
/* harmony export */ "createTemplateLiteral": () => (/* binding */ createTemplateLiteral),
|
|
/* harmony export */ "createTransformContext": () => (/* binding */ createTransformContext),
|
|
/* harmony export */ "createVNodeCall": () => (/* binding */ createVNodeCall),
|
|
/* harmony export */ "extractIdentifiers": () => (/* binding */ extractIdentifiers),
|
|
/* harmony export */ "findDir": () => (/* binding */ findDir),
|
|
/* harmony export */ "findProp": () => (/* binding */ findProp),
|
|
/* harmony export */ "generate": () => (/* binding */ generate),
|
|
/* harmony export */ "getBaseTransformPreset": () => (/* binding */ getBaseTransformPreset),
|
|
/* harmony export */ "getInnerRange": () => (/* binding */ getInnerRange),
|
|
/* harmony export */ "getMemoedVNodeCall": () => (/* binding */ getMemoedVNodeCall),
|
|
/* harmony export */ "getVNodeBlockHelper": () => (/* binding */ getVNodeBlockHelper),
|
|
/* harmony export */ "getVNodeHelper": () => (/* binding */ getVNodeHelper),
|
|
/* harmony export */ "hasDynamicKeyVBind": () => (/* binding */ hasDynamicKeyVBind),
|
|
/* harmony export */ "hasScopeRef": () => (/* binding */ hasScopeRef),
|
|
/* harmony export */ "helperNameMap": () => (/* binding */ helperNameMap),
|
|
/* harmony export */ "injectProp": () => (/* binding */ injectProp),
|
|
/* harmony export */ "isBindKey": () => (/* binding */ isBindKey),
|
|
/* harmony export */ "isBuiltInType": () => (/* binding */ isBuiltInType),
|
|
/* harmony export */ "isCoreComponent": () => (/* binding */ isCoreComponent),
|
|
/* harmony export */ "isFunctionType": () => (/* binding */ isFunctionType),
|
|
/* harmony export */ "isInDestructureAssignment": () => (/* binding */ isInDestructureAssignment),
|
|
/* harmony export */ "isMemberExpression": () => (/* binding */ isMemberExpression),
|
|
/* harmony export */ "isReferencedIdentifier": () => (/* binding */ isReferencedIdentifier),
|
|
/* harmony export */ "isSimpleIdentifier": () => (/* binding */ isSimpleIdentifier),
|
|
/* harmony export */ "isSlotOutlet": () => (/* binding */ isSlotOutlet),
|
|
/* harmony export */ "isStaticExp": () => (/* binding */ isStaticExp),
|
|
/* harmony export */ "isStaticProperty": () => (/* binding */ isStaticProperty),
|
|
/* harmony export */ "isStaticPropertyKey": () => (/* binding */ isStaticPropertyKey),
|
|
/* harmony export */ "isTemplateNode": () => (/* binding */ isTemplateNode),
|
|
/* harmony export */ "isText": () => (/* binding */ isText),
|
|
/* harmony export */ "isVSlot": () => (/* binding */ isVSlot),
|
|
/* harmony export */ "locStub": () => (/* binding */ locStub),
|
|
/* harmony export */ "makeBlock": () => (/* binding */ makeBlock),
|
|
/* harmony export */ "noopDirectiveTransform": () => (/* binding */ noopDirectiveTransform),
|
|
/* harmony export */ "processExpression": () => (/* binding */ processExpression),
|
|
/* harmony export */ "processFor": () => (/* binding */ processFor),
|
|
/* harmony export */ "processIf": () => (/* binding */ processIf),
|
|
/* harmony export */ "processSlotOutlet": () => (/* binding */ processSlotOutlet),
|
|
/* harmony export */ "registerRuntimeHelpers": () => (/* binding */ registerRuntimeHelpers),
|
|
/* harmony export */ "resolveComponentType": () => (/* binding */ resolveComponentType),
|
|
/* harmony export */ "toValidAssetId": () => (/* binding */ toValidAssetId),
|
|
/* harmony export */ "trackSlotScopes": () => (/* binding */ trackSlotScopes),
|
|
/* harmony export */ "trackVForSlotScopes": () => (/* binding */ trackVForSlotScopes),
|
|
/* harmony export */ "transform": () => (/* binding */ transform),
|
|
/* harmony export */ "transformBind": () => (/* binding */ transformBind),
|
|
/* harmony export */ "transformElement": () => (/* binding */ transformElement),
|
|
/* harmony export */ "transformExpression": () => (/* binding */ transformExpression),
|
|
/* harmony export */ "transformModel": () => (/* binding */ transformModel),
|
|
/* harmony export */ "transformOn": () => (/* binding */ transformOn),
|
|
/* harmony export */ "traverseNode": () => (/* binding */ traverseNode),
|
|
/* harmony export */ "walkBlockDeclarations": () => (/* binding */ walkBlockDeclarations),
|
|
/* harmony export */ "walkFunctionParams": () => (/* binding */ walkFunctionParams),
|
|
/* harmony export */ "walkIdentifiers": () => (/* binding */ walkIdentifiers),
|
|
/* harmony export */ "warnDeprecation": () => (/* binding */ warnDeprecation)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _vue_shared__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @vue/shared */ "./node_modules/@vue/shared/dist/shared.esm-bundler.js");
|
|
|
|
|
|
|
|
function defaultOnError(error) {
|
|
throw error;
|
|
}
|
|
function defaultOnWarn(msg) {
|
|
( true) && console.warn(`[Vue warn] ${msg.message}`);
|
|
}
|
|
function createCompilerError(code, loc, messages, additionalMessage) {
|
|
const msg = true
|
|
? (messages || errorMessages)[code] + (additionalMessage || ``)
|
|
: 0;
|
|
const error = new SyntaxError(String(msg));
|
|
error.code = code;
|
|
error.loc = loc;
|
|
return error;
|
|
}
|
|
const errorMessages = {
|
|
// parse errors
|
|
[0 /* ABRUPT_CLOSING_OF_EMPTY_COMMENT */]: 'Illegal comment.',
|
|
[1 /* CDATA_IN_HTML_CONTENT */]: 'CDATA section is allowed only in XML context.',
|
|
[2 /* DUPLICATE_ATTRIBUTE */]: 'Duplicate attribute.',
|
|
[3 /* END_TAG_WITH_ATTRIBUTES */]: 'End tag cannot have attributes.',
|
|
[4 /* END_TAG_WITH_TRAILING_SOLIDUS */]: "Illegal '/' in tags.",
|
|
[5 /* EOF_BEFORE_TAG_NAME */]: 'Unexpected EOF in tag.',
|
|
[6 /* EOF_IN_CDATA */]: 'Unexpected EOF in CDATA section.',
|
|
[7 /* EOF_IN_COMMENT */]: 'Unexpected EOF in comment.',
|
|
[8 /* EOF_IN_SCRIPT_HTML_COMMENT_LIKE_TEXT */]: 'Unexpected EOF in script.',
|
|
[9 /* EOF_IN_TAG */]: 'Unexpected EOF in tag.',
|
|
[10 /* INCORRECTLY_CLOSED_COMMENT */]: 'Incorrectly closed comment.',
|
|
[11 /* INCORRECTLY_OPENED_COMMENT */]: 'Incorrectly opened comment.',
|
|
[12 /* INVALID_FIRST_CHARACTER_OF_TAG_NAME */]: "Illegal tag name. Use '<' to print '<'.",
|
|
[13 /* MISSING_ATTRIBUTE_VALUE */]: 'Attribute value was expected.',
|
|
[14 /* MISSING_END_TAG_NAME */]: 'End tag name was expected.',
|
|
[15 /* MISSING_WHITESPACE_BETWEEN_ATTRIBUTES */]: 'Whitespace was expected.',
|
|
[16 /* NESTED_COMMENT */]: "Unexpected '<!--' in comment.",
|
|
[17 /* UNEXPECTED_CHARACTER_IN_ATTRIBUTE_NAME */]: 'Attribute name cannot contain U+0022 ("), U+0027 (\'), and U+003C (<).',
|
|
[18 /* UNEXPECTED_CHARACTER_IN_UNQUOTED_ATTRIBUTE_VALUE */]: 'Unquoted attribute value cannot contain U+0022 ("), U+0027 (\'), U+003C (<), U+003D (=), and U+0060 (`).',
|
|
[19 /* UNEXPECTED_EQUALS_SIGN_BEFORE_ATTRIBUTE_NAME */]: "Attribute name cannot start with '='.",
|
|
[21 /* UNEXPECTED_QUESTION_MARK_INSTEAD_OF_TAG_NAME */]: "'<?' is allowed only in XML context.",
|
|
[20 /* UNEXPECTED_NULL_CHARACTER */]: `Unexpected null cahracter.`,
|
|
[22 /* UNEXPECTED_SOLIDUS_IN_TAG */]: "Illegal '/' in tags.",
|
|
// Vue-specific parse errors
|
|
[23 /* X_INVALID_END_TAG */]: 'Invalid end tag.',
|
|
[24 /* X_MISSING_END_TAG */]: 'Element is missing end tag.',
|
|
[25 /* X_MISSING_INTERPOLATION_END */]: 'Interpolation end sign was not found.',
|
|
[26 /* X_MISSING_DYNAMIC_DIRECTIVE_ARGUMENT_END */]: 'End bracket for dynamic directive argument was not found. ' +
|
|
'Note that dynamic directive argument cannot contain spaces.',
|
|
// transform errors
|
|
[27 /* X_V_IF_NO_EXPRESSION */]: `v-if/v-else-if is missing expression.`,
|
|
[28 /* X_V_IF_SAME_KEY */]: `v-if/else branches must use unique keys.`,
|
|
[29 /* X_V_ELSE_NO_ADJACENT_IF */]: `v-else/v-else-if has no adjacent v-if.`,
|
|
[30 /* X_V_FOR_NO_EXPRESSION */]: `v-for is missing expression.`,
|
|
[31 /* X_V_FOR_MALFORMED_EXPRESSION */]: `v-for has invalid expression.`,
|
|
[32 /* X_V_FOR_TEMPLATE_KEY_PLACEMENT */]: `<template v-for> key should be placed on the <template> tag.`,
|
|
[33 /* X_V_BIND_NO_EXPRESSION */]: `v-bind is missing expression.`,
|
|
[34 /* X_V_ON_NO_EXPRESSION */]: `v-on is missing expression.`,
|
|
[35 /* X_V_SLOT_UNEXPECTED_DIRECTIVE_ON_SLOT_OUTLET */]: `Unexpected custom directive on <slot> outlet.`,
|
|
[36 /* X_V_SLOT_MIXED_SLOT_USAGE */]: `Mixed v-slot usage on both the component and nested <template>.` +
|
|
`When there are multiple named slots, all slots should use <template> ` +
|
|
`syntax to avoid scope ambiguity.`,
|
|
[37 /* X_V_SLOT_DUPLICATE_SLOT_NAMES */]: `Duplicate slot names found. `,
|
|
[38 /* X_V_SLOT_EXTRANEOUS_DEFAULT_SLOT_CHILDREN */]: `Extraneous children found when component already has explicitly named ` +
|
|
`default slot. These children will be ignored.`,
|
|
[39 /* X_V_SLOT_MISPLACED */]: `v-slot can only be used on components or <template> tags.`,
|
|
[40 /* X_V_MODEL_NO_EXPRESSION */]: `v-model is missing expression.`,
|
|
[41 /* X_V_MODEL_MALFORMED_EXPRESSION */]: `v-model value must be a valid JavaScript member expression.`,
|
|
[42 /* X_V_MODEL_ON_SCOPE_VARIABLE */]: `v-model cannot be used on v-for or v-slot scope variables because they are not writable.`,
|
|
[43 /* X_INVALID_EXPRESSION */]: `Error parsing JavaScript expression: `,
|
|
[44 /* X_KEEP_ALIVE_INVALID_CHILDREN */]: `<KeepAlive> expects exactly one child component.`,
|
|
// generic errors
|
|
[45 /* X_PREFIX_ID_NOT_SUPPORTED */]: `"prefixIdentifiers" option is not supported in this build of compiler.`,
|
|
[46 /* X_MODULE_MODE_NOT_SUPPORTED */]: `ES module mode is not supported in this build of compiler.`,
|
|
[47 /* X_CACHE_HANDLER_NOT_SUPPORTED */]: `"cacheHandlers" option is only supported when the "prefixIdentifiers" option is enabled.`,
|
|
[48 /* X_SCOPE_ID_NOT_SUPPORTED */]: `"scopeId" option is only supported in module mode.`,
|
|
// just to fullfill types
|
|
[49 /* __EXTEND_POINT__ */]: ``
|
|
};
|
|
|
|
const FRAGMENT = Symbol(( true) ? `Fragment` : 0);
|
|
const TELEPORT = Symbol(( true) ? `Teleport` : 0);
|
|
const SUSPENSE = Symbol(( true) ? `Suspense` : 0);
|
|
const KEEP_ALIVE = Symbol(( true) ? `KeepAlive` : 0);
|
|
const BASE_TRANSITION = Symbol(( true) ? `BaseTransition` : 0);
|
|
const OPEN_BLOCK = Symbol(( true) ? `openBlock` : 0);
|
|
const CREATE_BLOCK = Symbol(( true) ? `createBlock` : 0);
|
|
const CREATE_ELEMENT_BLOCK = Symbol(( true) ? `createElementBlock` : 0);
|
|
const CREATE_VNODE = Symbol(( true) ? `createVNode` : 0);
|
|
const CREATE_ELEMENT_VNODE = Symbol(( true) ? `createElementVNode` : 0);
|
|
const CREATE_COMMENT = Symbol(( true) ? `createCommentVNode` : 0);
|
|
const CREATE_TEXT = Symbol(( true) ? `createTextVNode` : 0);
|
|
const CREATE_STATIC = Symbol(( true) ? `createStaticVNode` : 0);
|
|
const RESOLVE_COMPONENT = Symbol(( true) ? `resolveComponent` : 0);
|
|
const RESOLVE_DYNAMIC_COMPONENT = Symbol(( true) ? `resolveDynamicComponent` : 0);
|
|
const RESOLVE_DIRECTIVE = Symbol(( true) ? `resolveDirective` : 0);
|
|
const RESOLVE_FILTER = Symbol(( true) ? `resolveFilter` : 0);
|
|
const WITH_DIRECTIVES = Symbol(( true) ? `withDirectives` : 0);
|
|
const RENDER_LIST = Symbol(( true) ? `renderList` : 0);
|
|
const RENDER_SLOT = Symbol(( true) ? `renderSlot` : 0);
|
|
const CREATE_SLOTS = Symbol(( true) ? `createSlots` : 0);
|
|
const TO_DISPLAY_STRING = Symbol(( true) ? `toDisplayString` : 0);
|
|
const MERGE_PROPS = Symbol(( true) ? `mergeProps` : 0);
|
|
const NORMALIZE_CLASS = Symbol(( true) ? `normalizeClass` : 0);
|
|
const NORMALIZE_STYLE = Symbol(( true) ? `normalizeStyle` : 0);
|
|
const NORMALIZE_PROPS = Symbol(( true) ? `normalizeProps` : 0);
|
|
const GUARD_REACTIVE_PROPS = Symbol(( true) ? `guardReactiveProps` : 0);
|
|
const TO_HANDLERS = Symbol(( true) ? `toHandlers` : 0);
|
|
const CAMELIZE = Symbol(( true) ? `camelize` : 0);
|
|
const CAPITALIZE = Symbol(( true) ? `capitalize` : 0);
|
|
const TO_HANDLER_KEY = Symbol(( true) ? `toHandlerKey` : 0);
|
|
const SET_BLOCK_TRACKING = Symbol(( true) ? `setBlockTracking` : 0);
|
|
const PUSH_SCOPE_ID = Symbol(( true) ? `pushScopeId` : 0);
|
|
const POP_SCOPE_ID = Symbol(( true) ? `popScopeId` : 0);
|
|
const WITH_SCOPE_ID = Symbol(( true) ? `withScopeId` : 0);
|
|
const WITH_CTX = Symbol(( true) ? `withCtx` : 0);
|
|
const UNREF = Symbol(( true) ? `unref` : 0);
|
|
const IS_REF = Symbol(( true) ? `isRef` : 0);
|
|
const WITH_MEMO = Symbol(( true) ? `withMemo` : 0);
|
|
const IS_MEMO_SAME = Symbol(( true) ? `isMemoSame` : 0);
|
|
// Name mapping for runtime helpers that need to be imported from 'vue' in
|
|
// generated code. Make sure these are correctly exported in the runtime!
|
|
// Using `any` here because TS doesn't allow symbols as index type.
|
|
const helperNameMap = {
|
|
[FRAGMENT]: `Fragment`,
|
|
[TELEPORT]: `Teleport`,
|
|
[SUSPENSE]: `Suspense`,
|
|
[KEEP_ALIVE]: `KeepAlive`,
|
|
[BASE_TRANSITION]: `BaseTransition`,
|
|
[OPEN_BLOCK]: `openBlock`,
|
|
[CREATE_BLOCK]: `createBlock`,
|
|
[CREATE_ELEMENT_BLOCK]: `createElementBlock`,
|
|
[CREATE_VNODE]: `createVNode`,
|
|
[CREATE_ELEMENT_VNODE]: `createElementVNode`,
|
|
[CREATE_COMMENT]: `createCommentVNode`,
|
|
[CREATE_TEXT]: `createTextVNode`,
|
|
[CREATE_STATIC]: `createStaticVNode`,
|
|
[RESOLVE_COMPONENT]: `resolveComponent`,
|
|
[RESOLVE_DYNAMIC_COMPONENT]: `resolveDynamicComponent`,
|
|
[RESOLVE_DIRECTIVE]: `resolveDirective`,
|
|
[RESOLVE_FILTER]: `resolveFilter`,
|
|
[WITH_DIRECTIVES]: `withDirectives`,
|
|
[RENDER_LIST]: `renderList`,
|
|
[RENDER_SLOT]: `renderSlot`,
|
|
[CREATE_SLOTS]: `createSlots`,
|
|
[TO_DISPLAY_STRING]: `toDisplayString`,
|
|
[MERGE_PROPS]: `mergeProps`,
|
|
[NORMALIZE_CLASS]: `normalizeClass`,
|
|
[NORMALIZE_STYLE]: `normalizeStyle`,
|
|
[NORMALIZE_PROPS]: `normalizeProps`,
|
|
[GUARD_REACTIVE_PROPS]: `guardReactiveProps`,
|
|
[TO_HANDLERS]: `toHandlers`,
|
|
[CAMELIZE]: `camelize`,
|
|
[CAPITALIZE]: `capitalize`,
|
|
[TO_HANDLER_KEY]: `toHandlerKey`,
|
|
[SET_BLOCK_TRACKING]: `setBlockTracking`,
|
|
[PUSH_SCOPE_ID]: `pushScopeId`,
|
|
[POP_SCOPE_ID]: `popScopeId`,
|
|
[WITH_SCOPE_ID]: `withScopeId`,
|
|
[WITH_CTX]: `withCtx`,
|
|
[UNREF]: `unref`,
|
|
[IS_REF]: `isRef`,
|
|
[WITH_MEMO]: `withMemo`,
|
|
[IS_MEMO_SAME]: `isMemoSame`
|
|
};
|
|
function registerRuntimeHelpers(helpers) {
|
|
Object.getOwnPropertySymbols(helpers).forEach(s => {
|
|
helperNameMap[s] = helpers[s];
|
|
});
|
|
}
|
|
|
|
// AST Utilities ---------------------------------------------------------------
|
|
// Some expressions, e.g. sequence and conditional expressions, are never
|
|
// associated with template nodes, so their source locations are just a stub.
|
|
// Container types like CompoundExpression also don't need a real location.
|
|
const locStub = {
|
|
source: '',
|
|
start: { line: 1, column: 1, offset: 0 },
|
|
end: { line: 1, column: 1, offset: 0 }
|
|
};
|
|
function createRoot(children, loc = locStub) {
|
|
return {
|
|
type: 0 /* ROOT */,
|
|
children,
|
|
helpers: [],
|
|
components: [],
|
|
directives: [],
|
|
hoists: [],
|
|
imports: [],
|
|
cached: 0,
|
|
temps: 0,
|
|
codegenNode: undefined,
|
|
loc
|
|
};
|
|
}
|
|
function createVNodeCall(context, tag, props, children, patchFlag, dynamicProps, directives, isBlock = false, disableTracking = false, isComponent = false, loc = locStub) {
|
|
if (context) {
|
|
if (isBlock) {
|
|
context.helper(OPEN_BLOCK);
|
|
context.helper(getVNodeBlockHelper(context.inSSR, isComponent));
|
|
}
|
|
else {
|
|
context.helper(getVNodeHelper(context.inSSR, isComponent));
|
|
}
|
|
if (directives) {
|
|
context.helper(WITH_DIRECTIVES);
|
|
}
|
|
}
|
|
return {
|
|
type: 13 /* VNODE_CALL */,
|
|
tag,
|
|
props,
|
|
children,
|
|
patchFlag,
|
|
dynamicProps,
|
|
directives,
|
|
isBlock,
|
|
disableTracking,
|
|
isComponent,
|
|
loc
|
|
};
|
|
}
|
|
function createArrayExpression(elements, loc = locStub) {
|
|
return {
|
|
type: 17 /* JS_ARRAY_EXPRESSION */,
|
|
loc,
|
|
elements
|
|
};
|
|
}
|
|
function createObjectExpression(properties, loc = locStub) {
|
|
return {
|
|
type: 15 /* JS_OBJECT_EXPRESSION */,
|
|
loc,
|
|
properties
|
|
};
|
|
}
|
|
function createObjectProperty(key, value) {
|
|
return {
|
|
type: 16 /* JS_PROPERTY */,
|
|
loc: locStub,
|
|
key: (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(key) ? createSimpleExpression(key, true) : key,
|
|
value
|
|
};
|
|
}
|
|
function createSimpleExpression(content, isStatic = false, loc = locStub, constType = 0 /* NOT_CONSTANT */) {
|
|
return {
|
|
type: 4 /* SIMPLE_EXPRESSION */,
|
|
loc,
|
|
content,
|
|
isStatic,
|
|
constType: isStatic ? 3 /* CAN_STRINGIFY */ : constType
|
|
};
|
|
}
|
|
function createInterpolation(content, loc) {
|
|
return {
|
|
type: 5 /* INTERPOLATION */,
|
|
loc,
|
|
content: (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(content)
|
|
? createSimpleExpression(content, false, loc)
|
|
: content
|
|
};
|
|
}
|
|
function createCompoundExpression(children, loc = locStub) {
|
|
return {
|
|
type: 8 /* COMPOUND_EXPRESSION */,
|
|
loc,
|
|
children
|
|
};
|
|
}
|
|
function createCallExpression(callee, args = [], loc = locStub) {
|
|
return {
|
|
type: 14 /* JS_CALL_EXPRESSION */,
|
|
loc,
|
|
callee,
|
|
arguments: args
|
|
};
|
|
}
|
|
function createFunctionExpression(params, returns = undefined, newline = false, isSlot = false, loc = locStub) {
|
|
return {
|
|
type: 18 /* JS_FUNCTION_EXPRESSION */,
|
|
params,
|
|
returns,
|
|
newline,
|
|
isSlot,
|
|
loc
|
|
};
|
|
}
|
|
function createConditionalExpression(test, consequent, alternate, newline = true) {
|
|
return {
|
|
type: 19 /* JS_CONDITIONAL_EXPRESSION */,
|
|
test,
|
|
consequent,
|
|
alternate,
|
|
newline,
|
|
loc: locStub
|
|
};
|
|
}
|
|
function createCacheExpression(index, value, isVNode = false) {
|
|
return {
|
|
type: 20 /* JS_CACHE_EXPRESSION */,
|
|
index,
|
|
value,
|
|
isVNode,
|
|
loc: locStub
|
|
};
|
|
}
|
|
function createBlockStatement(body) {
|
|
return {
|
|
type: 21 /* JS_BLOCK_STATEMENT */,
|
|
body,
|
|
loc: locStub
|
|
};
|
|
}
|
|
function createTemplateLiteral(elements) {
|
|
return {
|
|
type: 22 /* JS_TEMPLATE_LITERAL */,
|
|
elements,
|
|
loc: locStub
|
|
};
|
|
}
|
|
function createIfStatement(test, consequent, alternate) {
|
|
return {
|
|
type: 23 /* JS_IF_STATEMENT */,
|
|
test,
|
|
consequent,
|
|
alternate,
|
|
loc: locStub
|
|
};
|
|
}
|
|
function createAssignmentExpression(left, right) {
|
|
return {
|
|
type: 24 /* JS_ASSIGNMENT_EXPRESSION */,
|
|
left,
|
|
right,
|
|
loc: locStub
|
|
};
|
|
}
|
|
function createSequenceExpression(expressions) {
|
|
return {
|
|
type: 25 /* JS_SEQUENCE_EXPRESSION */,
|
|
expressions,
|
|
loc: locStub
|
|
};
|
|
}
|
|
function createReturnStatement(returns) {
|
|
return {
|
|
type: 26 /* JS_RETURN_STATEMENT */,
|
|
returns,
|
|
loc: locStub
|
|
};
|
|
}
|
|
|
|
const isStaticExp = (p) => p.type === 4 /* SIMPLE_EXPRESSION */ && p.isStatic;
|
|
const isBuiltInType = (tag, expected) => tag === expected || tag === (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.hyphenate)(expected);
|
|
function isCoreComponent(tag) {
|
|
if (isBuiltInType(tag, 'Teleport')) {
|
|
return TELEPORT;
|
|
}
|
|
else if (isBuiltInType(tag, 'Suspense')) {
|
|
return SUSPENSE;
|
|
}
|
|
else if (isBuiltInType(tag, 'KeepAlive')) {
|
|
return KEEP_ALIVE;
|
|
}
|
|
else if (isBuiltInType(tag, 'BaseTransition')) {
|
|
return BASE_TRANSITION;
|
|
}
|
|
}
|
|
const nonIdentifierRE = /^\d|[^\$\w]/;
|
|
const isSimpleIdentifier = (name) => !nonIdentifierRE.test(name);
|
|
const validFirstIdentCharRE = /[A-Za-z_$\xA0-\uFFFF]/;
|
|
const validIdentCharRE = /[\.\?\w$\xA0-\uFFFF]/;
|
|
const whitespaceRE = /\s+[.[]\s*|\s*[.[]\s+/g;
|
|
/**
|
|
* Simple lexer to check if an expression is a member expression. This is
|
|
* lax and only checks validity at the root level (i.e. does not validate exps
|
|
* inside square brackets), but it's ok since these are only used on template
|
|
* expressions and false positives are invalid expressions in the first place.
|
|
*/
|
|
const isMemberExpression = (path) => {
|
|
// remove whitespaces around . or [ first
|
|
path = path.trim().replace(whitespaceRE, s => s.trim());
|
|
let state = 0 /* inMemberExp */;
|
|
let stateStack = [];
|
|
let currentOpenBracketCount = 0;
|
|
let currentOpenParensCount = 0;
|
|
let currentStringType = null;
|
|
for (let i = 0; i < path.length; i++) {
|
|
const char = path.charAt(i);
|
|
switch (state) {
|
|
case 0 /* inMemberExp */:
|
|
if (char === '[') {
|
|
stateStack.push(state);
|
|
state = 1 /* inBrackets */;
|
|
currentOpenBracketCount++;
|
|
}
|
|
else if (char === '(') {
|
|
stateStack.push(state);
|
|
state = 2 /* inParens */;
|
|
currentOpenParensCount++;
|
|
}
|
|
else if (!(i === 0 ? validFirstIdentCharRE : validIdentCharRE).test(char)) {
|
|
return false;
|
|
}
|
|
break;
|
|
case 1 /* inBrackets */:
|
|
if (char === `'` || char === `"` || char === '`') {
|
|
stateStack.push(state);
|
|
state = 3 /* inString */;
|
|
currentStringType = char;
|
|
}
|
|
else if (char === `[`) {
|
|
currentOpenBracketCount++;
|
|
}
|
|
else if (char === `]`) {
|
|
if (!--currentOpenBracketCount) {
|
|
state = stateStack.pop();
|
|
}
|
|
}
|
|
break;
|
|
case 2 /* inParens */:
|
|
if (char === `'` || char === `"` || char === '`') {
|
|
stateStack.push(state);
|
|
state = 3 /* inString */;
|
|
currentStringType = char;
|
|
}
|
|
else if (char === `(`) {
|
|
currentOpenParensCount++;
|
|
}
|
|
else if (char === `)`) {
|
|
// if the exp ends as a call then it should not be considered valid
|
|
if (i === path.length - 1) {
|
|
return false;
|
|
}
|
|
if (!--currentOpenParensCount) {
|
|
state = stateStack.pop();
|
|
}
|
|
}
|
|
break;
|
|
case 3 /* inString */:
|
|
if (char === currentStringType) {
|
|
state = stateStack.pop();
|
|
currentStringType = null;
|
|
}
|
|
break;
|
|
}
|
|
}
|
|
return !currentOpenBracketCount && !currentOpenParensCount;
|
|
};
|
|
function getInnerRange(loc, offset, length) {
|
|
const source = loc.source.substr(offset, length);
|
|
const newLoc = {
|
|
source,
|
|
start: advancePositionWithClone(loc.start, loc.source, offset),
|
|
end: loc.end
|
|
};
|
|
if (length != null) {
|
|
newLoc.end = advancePositionWithClone(loc.start, loc.source, offset + length);
|
|
}
|
|
return newLoc;
|
|
}
|
|
function advancePositionWithClone(pos, source, numberOfCharacters = source.length) {
|
|
return advancePositionWithMutation((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.extend)({}, pos), source, numberOfCharacters);
|
|
}
|
|
// advance by mutation without cloning (for performance reasons), since this
|
|
// gets called a lot in the parser
|
|
function advancePositionWithMutation(pos, source, numberOfCharacters = source.length) {
|
|
let linesCount = 0;
|
|
let lastNewLinePos = -1;
|
|
for (let i = 0; i < numberOfCharacters; i++) {
|
|
if (source.charCodeAt(i) === 10 /* newline char code */) {
|
|
linesCount++;
|
|
lastNewLinePos = i;
|
|
}
|
|
}
|
|
pos.offset += numberOfCharacters;
|
|
pos.line += linesCount;
|
|
pos.column =
|
|
lastNewLinePos === -1
|
|
? pos.column + numberOfCharacters
|
|
: numberOfCharacters - lastNewLinePos;
|
|
return pos;
|
|
}
|
|
function assert(condition, msg) {
|
|
/* istanbul ignore if */
|
|
if (!condition) {
|
|
throw new Error(msg || `unexpected compiler condition`);
|
|
}
|
|
}
|
|
function findDir(node, name, allowEmpty = false) {
|
|
for (let i = 0; i < node.props.length; i++) {
|
|
const p = node.props[i];
|
|
if (p.type === 7 /* DIRECTIVE */ &&
|
|
(allowEmpty || p.exp) &&
|
|
((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(name) ? p.name === name : name.test(p.name))) {
|
|
return p;
|
|
}
|
|
}
|
|
}
|
|
function findProp(node, name, dynamicOnly = false, allowEmpty = false) {
|
|
for (let i = 0; i < node.props.length; i++) {
|
|
const p = node.props[i];
|
|
if (p.type === 6 /* ATTRIBUTE */) {
|
|
if (dynamicOnly)
|
|
continue;
|
|
if (p.name === name && (p.value || allowEmpty)) {
|
|
return p;
|
|
}
|
|
}
|
|
else if (p.name === 'bind' &&
|
|
(p.exp || allowEmpty) &&
|
|
isBindKey(p.arg, name)) {
|
|
return p;
|
|
}
|
|
}
|
|
}
|
|
function isBindKey(arg, name) {
|
|
return !!(arg && isStaticExp(arg) && arg.content === name);
|
|
}
|
|
function hasDynamicKeyVBind(node) {
|
|
return node.props.some(p => p.type === 7 /* DIRECTIVE */ &&
|
|
p.name === 'bind' &&
|
|
(!p.arg || // v-bind="obj"
|
|
p.arg.type !== 4 /* SIMPLE_EXPRESSION */ || // v-bind:[_ctx.foo]
|
|
!p.arg.isStatic) // v-bind:[foo]
|
|
);
|
|
}
|
|
function isText(node) {
|
|
return node.type === 5 /* INTERPOLATION */ || node.type === 2 /* TEXT */;
|
|
}
|
|
function isVSlot(p) {
|
|
return p.type === 7 /* DIRECTIVE */ && p.name === 'slot';
|
|
}
|
|
function isTemplateNode(node) {
|
|
return (node.type === 1 /* ELEMENT */ && node.tagType === 3 /* TEMPLATE */);
|
|
}
|
|
function isSlotOutlet(node) {
|
|
return node.type === 1 /* ELEMENT */ && node.tagType === 2 /* SLOT */;
|
|
}
|
|
function getVNodeHelper(ssr, isComponent) {
|
|
return ssr || isComponent ? CREATE_VNODE : CREATE_ELEMENT_VNODE;
|
|
}
|
|
function getVNodeBlockHelper(ssr, isComponent) {
|
|
return ssr || isComponent ? CREATE_BLOCK : CREATE_ELEMENT_BLOCK;
|
|
}
|
|
const propsHelperSet = new Set([NORMALIZE_PROPS, GUARD_REACTIVE_PROPS]);
|
|
function getUnnormalizedProps(props, callPath = []) {
|
|
if (props &&
|
|
!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(props) &&
|
|
props.type === 14 /* JS_CALL_EXPRESSION */) {
|
|
const callee = props.callee;
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(callee) && propsHelperSet.has(callee)) {
|
|
return getUnnormalizedProps(props.arguments[0], callPath.concat(props));
|
|
}
|
|
}
|
|
return [props, callPath];
|
|
}
|
|
function injectProp(node, prop, context) {
|
|
let propsWithInjection;
|
|
const originalProps = node.type === 13 /* VNODE_CALL */ ? node.props : node.arguments[2];
|
|
/**
|
|
* 1. mergeProps(...)
|
|
* 2. toHandlers(...)
|
|
* 3. normalizeProps(...)
|
|
* 4. normalizeProps(guardReactiveProps(...))
|
|
*
|
|
* we need to get the real props before normalization
|
|
*/
|
|
let props = originalProps;
|
|
let callPath = [];
|
|
let parentCall;
|
|
if (props &&
|
|
!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(props) &&
|
|
props.type === 14 /* JS_CALL_EXPRESSION */) {
|
|
const ret = getUnnormalizedProps(props);
|
|
props = ret[0];
|
|
callPath = ret[1];
|
|
parentCall = callPath[callPath.length - 1];
|
|
}
|
|
if (props == null || (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(props)) {
|
|
propsWithInjection = createObjectExpression([prop]);
|
|
}
|
|
else if (props.type === 14 /* JS_CALL_EXPRESSION */) {
|
|
// merged props... add ours
|
|
// only inject key to object literal if it's the first argument so that
|
|
// if doesn't override user provided keys
|
|
const first = props.arguments[0];
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(first) && first.type === 15 /* JS_OBJECT_EXPRESSION */) {
|
|
first.properties.unshift(prop);
|
|
}
|
|
else {
|
|
if (props.callee === TO_HANDLERS) {
|
|
// #2366
|
|
propsWithInjection = createCallExpression(context.helper(MERGE_PROPS), [
|
|
createObjectExpression([prop]),
|
|
props
|
|
]);
|
|
}
|
|
else {
|
|
props.arguments.unshift(createObjectExpression([prop]));
|
|
}
|
|
}
|
|
!propsWithInjection && (propsWithInjection = props);
|
|
}
|
|
else if (props.type === 15 /* JS_OBJECT_EXPRESSION */) {
|
|
let alreadyExists = false;
|
|
// check existing key to avoid overriding user provided keys
|
|
if (prop.key.type === 4 /* SIMPLE_EXPRESSION */) {
|
|
const propKeyName = prop.key.content;
|
|
alreadyExists = props.properties.some(p => p.key.type === 4 /* SIMPLE_EXPRESSION */ &&
|
|
p.key.content === propKeyName);
|
|
}
|
|
if (!alreadyExists) {
|
|
props.properties.unshift(prop);
|
|
}
|
|
propsWithInjection = props;
|
|
}
|
|
else {
|
|
// single v-bind with expression, return a merged replacement
|
|
propsWithInjection = createCallExpression(context.helper(MERGE_PROPS), [
|
|
createObjectExpression([prop]),
|
|
props
|
|
]);
|
|
// in the case of nested helper call, e.g. `normalizeProps(guardReactiveProps(props))`,
|
|
// it will be rewritten as `normalizeProps(mergeProps({ key: 0 }, props))`,
|
|
// the `guardReactiveProps` will no longer be needed
|
|
if (parentCall && parentCall.callee === GUARD_REACTIVE_PROPS) {
|
|
parentCall = callPath[callPath.length - 2];
|
|
}
|
|
}
|
|
if (node.type === 13 /* VNODE_CALL */) {
|
|
if (parentCall) {
|
|
parentCall.arguments[0] = propsWithInjection;
|
|
}
|
|
else {
|
|
node.props = propsWithInjection;
|
|
}
|
|
}
|
|
else {
|
|
if (parentCall) {
|
|
parentCall.arguments[0] = propsWithInjection;
|
|
}
|
|
else {
|
|
node.arguments[2] = propsWithInjection;
|
|
}
|
|
}
|
|
}
|
|
function toValidAssetId(name, type) {
|
|
// see issue#4422, we need adding identifier on validAssetId if variable `name` has specific character
|
|
return `_${type}_${name.replace(/[^\w]/g, (searchValue, replaceValue) => {
|
|
return searchValue === '-' ? '_' : name.charCodeAt(replaceValue).toString();
|
|
})}`;
|
|
}
|
|
// Check if a node contains expressions that reference current context scope ids
|
|
function hasScopeRef(node, ids) {
|
|
if (!node || Object.keys(ids).length === 0) {
|
|
return false;
|
|
}
|
|
switch (node.type) {
|
|
case 1 /* ELEMENT */:
|
|
for (let i = 0; i < node.props.length; i++) {
|
|
const p = node.props[i];
|
|
if (p.type === 7 /* DIRECTIVE */ &&
|
|
(hasScopeRef(p.arg, ids) || hasScopeRef(p.exp, ids))) {
|
|
return true;
|
|
}
|
|
}
|
|
return node.children.some(c => hasScopeRef(c, ids));
|
|
case 11 /* FOR */:
|
|
if (hasScopeRef(node.source, ids)) {
|
|
return true;
|
|
}
|
|
return node.children.some(c => hasScopeRef(c, ids));
|
|
case 9 /* IF */:
|
|
return node.branches.some(b => hasScopeRef(b, ids));
|
|
case 10 /* IF_BRANCH */:
|
|
if (hasScopeRef(node.condition, ids)) {
|
|
return true;
|
|
}
|
|
return node.children.some(c => hasScopeRef(c, ids));
|
|
case 4 /* SIMPLE_EXPRESSION */:
|
|
return (!node.isStatic &&
|
|
isSimpleIdentifier(node.content) &&
|
|
!!ids[node.content]);
|
|
case 8 /* COMPOUND_EXPRESSION */:
|
|
return node.children.some(c => (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isObject)(c) && hasScopeRef(c, ids));
|
|
case 5 /* INTERPOLATION */:
|
|
case 12 /* TEXT_CALL */:
|
|
return hasScopeRef(node.content, ids);
|
|
case 2 /* TEXT */:
|
|
case 3 /* COMMENT */:
|
|
return false;
|
|
default:
|
|
if ((true)) ;
|
|
return false;
|
|
}
|
|
}
|
|
function getMemoedVNodeCall(node) {
|
|
if (node.type === 14 /* JS_CALL_EXPRESSION */ && node.callee === WITH_MEMO) {
|
|
return node.arguments[1].returns;
|
|
}
|
|
else {
|
|
return node;
|
|
}
|
|
}
|
|
function makeBlock(node, { helper, removeHelper, inSSR }) {
|
|
if (!node.isBlock) {
|
|
node.isBlock = true;
|
|
removeHelper(getVNodeHelper(inSSR, node.isComponent));
|
|
helper(OPEN_BLOCK);
|
|
helper(getVNodeBlockHelper(inSSR, node.isComponent));
|
|
}
|
|
}
|
|
|
|
const deprecationData = {
|
|
["COMPILER_IS_ON_ELEMENT" /* COMPILER_IS_ON_ELEMENT */]: {
|
|
message: `Platform-native elements with "is" prop will no longer be ` +
|
|
`treated as components in Vue 3 unless the "is" value is explicitly ` +
|
|
`prefixed with "vue:".`,
|
|
link: `https://v3.vuejs.org/guide/migration/custom-elements-interop.html`
|
|
},
|
|
["COMPILER_V_BIND_SYNC" /* COMPILER_V_BIND_SYNC */]: {
|
|
message: key => `.sync modifier for v-bind has been removed. Use v-model with ` +
|
|
`argument instead. \`v-bind:${key}.sync\` should be changed to ` +
|
|
`\`v-model:${key}\`.`,
|
|
link: `https://v3.vuejs.org/guide/migration/v-model.html`
|
|
},
|
|
["COMPILER_V_BIND_PROP" /* COMPILER_V_BIND_PROP */]: {
|
|
message: `.prop modifier for v-bind has been removed and no longer necessary. ` +
|
|
`Vue 3 will automatically set a binding as DOM property when appropriate.`
|
|
},
|
|
["COMPILER_V_BIND_OBJECT_ORDER" /* COMPILER_V_BIND_OBJECT_ORDER */]: {
|
|
message: `v-bind="obj" usage is now order sensitive and behaves like JavaScript ` +
|
|
`object spread: it will now overwrite an existing non-mergeable attribute ` +
|
|
`that appears before v-bind in the case of conflict. ` +
|
|
`To retain 2.x behavior, move v-bind to make it the first attribute. ` +
|
|
`You can also suppress this warning if the usage is intended.`,
|
|
link: `https://v3.vuejs.org/guide/migration/v-bind.html`
|
|
},
|
|
["COMPILER_V_ON_NATIVE" /* COMPILER_V_ON_NATIVE */]: {
|
|
message: `.native modifier for v-on has been removed as is no longer necessary.`,
|
|
link: `https://v3.vuejs.org/guide/migration/v-on-native-modifier-removed.html`
|
|
},
|
|
["COMPILER_V_IF_V_FOR_PRECEDENCE" /* COMPILER_V_IF_V_FOR_PRECEDENCE */]: {
|
|
message: `v-if / v-for precedence when used on the same element has changed ` +
|
|
`in Vue 3: v-if now takes higher precedence and will no longer have ` +
|
|
`access to v-for scope variables. It is best to avoid the ambiguity ` +
|
|
`with <template> tags or use a computed property that filters v-for ` +
|
|
`data source.`,
|
|
link: `https://v3.vuejs.org/guide/migration/v-if-v-for.html`
|
|
},
|
|
["COMPILER_V_FOR_REF" /* COMPILER_V_FOR_REF */]: {
|
|
message: `Ref usage on v-for no longer creates array ref values in Vue 3. ` +
|
|
`Consider using function refs or refactor to avoid ref usage altogether.`,
|
|
link: `https://v3.vuejs.org/guide/migration/array-refs.html`
|
|
},
|
|
["COMPILER_NATIVE_TEMPLATE" /* COMPILER_NATIVE_TEMPLATE */]: {
|
|
message: `<template> with no special directives will render as a native template ` +
|
|
`element instead of its inner content in Vue 3.`
|
|
},
|
|
["COMPILER_INLINE_TEMPLATE" /* COMPILER_INLINE_TEMPLATE */]: {
|
|
message: `"inline-template" has been removed in Vue 3.`,
|
|
link: `https://v3.vuejs.org/guide/migration/inline-template-attribute.html`
|
|
},
|
|
["COMPILER_FILTER" /* COMPILER_FILTERS */]: {
|
|
message: `filters have been removed in Vue 3. ` +
|
|
`The "|" symbol will be treated as native JavaScript bitwise OR operator. ` +
|
|
`Use method calls or computed properties instead.`,
|
|
link: `https://v3.vuejs.org/guide/migration/filters.html`
|
|
}
|
|
};
|
|
function getCompatValue(key, context) {
|
|
const config = context.options
|
|
? context.options.compatConfig
|
|
: context.compatConfig;
|
|
const value = config && config[key];
|
|
if (key === 'MODE') {
|
|
return value || 3; // compiler defaults to v3 behavior
|
|
}
|
|
else {
|
|
return value;
|
|
}
|
|
}
|
|
function isCompatEnabled(key, context) {
|
|
const mode = getCompatValue('MODE', context);
|
|
const value = getCompatValue(key, context);
|
|
// in v3 mode, only enable if explicitly set to true
|
|
// otherwise enable for any non-false value
|
|
return mode === 3 ? value === true : value !== false;
|
|
}
|
|
function checkCompatEnabled(key, context, loc, ...args) {
|
|
const enabled = isCompatEnabled(key, context);
|
|
if (( true) && enabled) {
|
|
warnDeprecation(key, context, loc, ...args);
|
|
}
|
|
return enabled;
|
|
}
|
|
function warnDeprecation(key, context, loc, ...args) {
|
|
const val = getCompatValue(key, context);
|
|
if (val === 'suppress-warning') {
|
|
return;
|
|
}
|
|
const { message, link } = deprecationData[key];
|
|
const msg = `(deprecation ${key}) ${typeof message === 'function' ? message(...args) : message}${link ? `\n Details: ${link}` : ``}`;
|
|
const err = new SyntaxError(msg);
|
|
err.code = key;
|
|
if (loc)
|
|
err.loc = loc;
|
|
context.onWarn(err);
|
|
}
|
|
|
|
// The default decoder only provides escapes for characters reserved as part of
|
|
// the template syntax, and is only used if the custom renderer did not provide
|
|
// a platform-specific decoder.
|
|
const decodeRE = /&(gt|lt|amp|apos|quot);/g;
|
|
const decodeMap = {
|
|
gt: '>',
|
|
lt: '<',
|
|
amp: '&',
|
|
apos: "'",
|
|
quot: '"'
|
|
};
|
|
const defaultParserOptions = {
|
|
delimiters: [`{{`, `}}`],
|
|
getNamespace: () => 0 /* HTML */,
|
|
getTextMode: () => 0 /* DATA */,
|
|
isVoidTag: _vue_shared__WEBPACK_IMPORTED_MODULE_0__.NO,
|
|
isPreTag: _vue_shared__WEBPACK_IMPORTED_MODULE_0__.NO,
|
|
isCustomElement: _vue_shared__WEBPACK_IMPORTED_MODULE_0__.NO,
|
|
decodeEntities: (rawText) => rawText.replace(decodeRE, (_, p1) => decodeMap[p1]),
|
|
onError: defaultOnError,
|
|
onWarn: defaultOnWarn,
|
|
comments: ("development" !== 'production')
|
|
};
|
|
function baseParse(content, options = {}) {
|
|
const context = createParserContext(content, options);
|
|
const start = getCursor(context);
|
|
return createRoot(parseChildren(context, 0 /* DATA */, []), getSelection(context, start));
|
|
}
|
|
function createParserContext(content, rawOptions) {
|
|
const options = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.extend)({}, defaultParserOptions);
|
|
let key;
|
|
for (key in rawOptions) {
|
|
// @ts-ignore
|
|
options[key] =
|
|
rawOptions[key] === undefined
|
|
? defaultParserOptions[key]
|
|
: rawOptions[key];
|
|
}
|
|
return {
|
|
options,
|
|
column: 1,
|
|
line: 1,
|
|
offset: 0,
|
|
originalSource: content,
|
|
source: content,
|
|
inPre: false,
|
|
inVPre: false,
|
|
onWarn: options.onWarn
|
|
};
|
|
}
|
|
function parseChildren(context, mode, ancestors) {
|
|
const parent = last(ancestors);
|
|
const ns = parent ? parent.ns : 0 /* HTML */;
|
|
const nodes = [];
|
|
while (!isEnd(context, mode, ancestors)) {
|
|
const s = context.source;
|
|
let node = undefined;
|
|
if (mode === 0 /* DATA */ || mode === 1 /* RCDATA */) {
|
|
if (!context.inVPre && startsWith(s, context.options.delimiters[0])) {
|
|
// '{{'
|
|
node = parseInterpolation(context, mode);
|
|
}
|
|
else if (mode === 0 /* DATA */ && s[0] === '<') {
|
|
// https://html.spec.whatwg.org/multipage/parsing.html#tag-open-state
|
|
if (s.length === 1) {
|
|
emitError(context, 5 /* EOF_BEFORE_TAG_NAME */, 1);
|
|
}
|
|
else if (s[1] === '!') {
|
|
// https://html.spec.whatwg.org/multipage/parsing.html#markup-declaration-open-state
|
|
if (startsWith(s, '<!--')) {
|
|
node = parseComment(context);
|
|
}
|
|
else if (startsWith(s, '<!DOCTYPE')) {
|
|
// Ignore DOCTYPE by a limitation.
|
|
node = parseBogusComment(context);
|
|
}
|
|
else if (startsWith(s, '<![CDATA[')) {
|
|
if (ns !== 0 /* HTML */) {
|
|
node = parseCDATA(context, ancestors);
|
|
}
|
|
else {
|
|
emitError(context, 1 /* CDATA_IN_HTML_CONTENT */);
|
|
node = parseBogusComment(context);
|
|
}
|
|
}
|
|
else {
|
|
emitError(context, 11 /* INCORRECTLY_OPENED_COMMENT */);
|
|
node = parseBogusComment(context);
|
|
}
|
|
}
|
|
else if (s[1] === '/') {
|
|
// https://html.spec.whatwg.org/multipage/parsing.html#end-tag-open-state
|
|
if (s.length === 2) {
|
|
emitError(context, 5 /* EOF_BEFORE_TAG_NAME */, 2);
|
|
}
|
|
else if (s[2] === '>') {
|
|
emitError(context, 14 /* MISSING_END_TAG_NAME */, 2);
|
|
advanceBy(context, 3);
|
|
continue;
|
|
}
|
|
else if (/[a-z]/i.test(s[2])) {
|
|
emitError(context, 23 /* X_INVALID_END_TAG */);
|
|
parseTag(context, 1 /* End */, parent);
|
|
continue;
|
|
}
|
|
else {
|
|
emitError(context, 12 /* INVALID_FIRST_CHARACTER_OF_TAG_NAME */, 2);
|
|
node = parseBogusComment(context);
|
|
}
|
|
}
|
|
else if (/[a-z]/i.test(s[1])) {
|
|
node = parseElement(context, ancestors);
|
|
// 2.x <template> with no directive compat
|
|
if (isCompatEnabled("COMPILER_NATIVE_TEMPLATE" /* COMPILER_NATIVE_TEMPLATE */, context) &&
|
|
node &&
|
|
node.tag === 'template' &&
|
|
!node.props.some(p => p.type === 7 /* DIRECTIVE */ &&
|
|
isSpecialTemplateDirective(p.name))) {
|
|
( true) &&
|
|
warnDeprecation("COMPILER_NATIVE_TEMPLATE" /* COMPILER_NATIVE_TEMPLATE */, context, node.loc);
|
|
node = node.children;
|
|
}
|
|
}
|
|
else if (s[1] === '?') {
|
|
emitError(context, 21 /* UNEXPECTED_QUESTION_MARK_INSTEAD_OF_TAG_NAME */, 1);
|
|
node = parseBogusComment(context);
|
|
}
|
|
else {
|
|
emitError(context, 12 /* INVALID_FIRST_CHARACTER_OF_TAG_NAME */, 1);
|
|
}
|
|
}
|
|
}
|
|
if (!node) {
|
|
node = parseText(context, mode);
|
|
}
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(node)) {
|
|
for (let i = 0; i < node.length; i++) {
|
|
pushNode(nodes, node[i]);
|
|
}
|
|
}
|
|
else {
|
|
pushNode(nodes, node);
|
|
}
|
|
}
|
|
// Whitespace handling strategy like v2
|
|
let removedWhitespace = false;
|
|
if (mode !== 2 /* RAWTEXT */ && mode !== 1 /* RCDATA */) {
|
|
const shouldCondense = context.options.whitespace !== 'preserve';
|
|
for (let i = 0; i < nodes.length; i++) {
|
|
const node = nodes[i];
|
|
if (!context.inPre && node.type === 2 /* TEXT */) {
|
|
if (!/[^\t\r\n\f ]/.test(node.content)) {
|
|
const prev = nodes[i - 1];
|
|
const next = nodes[i + 1];
|
|
// Remove if:
|
|
// - the whitespace is the first or last node, or:
|
|
// - (condense mode) the whitespace is adjacent to a comment, or:
|
|
// - (condense mode) the whitespace is between two elements AND contains newline
|
|
if (!prev ||
|
|
!next ||
|
|
(shouldCondense &&
|
|
(prev.type === 3 /* COMMENT */ ||
|
|
next.type === 3 /* COMMENT */ ||
|
|
(prev.type === 1 /* ELEMENT */ &&
|
|
next.type === 1 /* ELEMENT */ &&
|
|
/[\r\n]/.test(node.content))))) {
|
|
removedWhitespace = true;
|
|
nodes[i] = null;
|
|
}
|
|
else {
|
|
// Otherwise, the whitespace is condensed into a single space
|
|
node.content = ' ';
|
|
}
|
|
}
|
|
else if (shouldCondense) {
|
|
// in condense mode, consecutive whitespaces in text are condensed
|
|
// down to a single space.
|
|
node.content = node.content.replace(/[\t\r\n\f ]+/g, ' ');
|
|
}
|
|
}
|
|
// Remove comment nodes if desired by configuration.
|
|
else if (node.type === 3 /* COMMENT */ && !context.options.comments) {
|
|
removedWhitespace = true;
|
|
nodes[i] = null;
|
|
}
|
|
}
|
|
if (context.inPre && parent && context.options.isPreTag(parent.tag)) {
|
|
// remove leading newline per html spec
|
|
// https://html.spec.whatwg.org/multipage/grouping-content.html#the-pre-element
|
|
const first = nodes[0];
|
|
if (first && first.type === 2 /* TEXT */) {
|
|
first.content = first.content.replace(/^\r?\n/, '');
|
|
}
|
|
}
|
|
}
|
|
return removedWhitespace ? nodes.filter(Boolean) : nodes;
|
|
}
|
|
function pushNode(nodes, node) {
|
|
if (node.type === 2 /* TEXT */) {
|
|
const prev = last(nodes);
|
|
// Merge if both this and the previous node are text and those are
|
|
// consecutive. This happens for cases like "a < b".
|
|
if (prev &&
|
|
prev.type === 2 /* TEXT */ &&
|
|
prev.loc.end.offset === node.loc.start.offset) {
|
|
prev.content += node.content;
|
|
prev.loc.end = node.loc.end;
|
|
prev.loc.source += node.loc.source;
|
|
return;
|
|
}
|
|
}
|
|
nodes.push(node);
|
|
}
|
|
function parseCDATA(context, ancestors) {
|
|
advanceBy(context, 9);
|
|
const nodes = parseChildren(context, 3 /* CDATA */, ancestors);
|
|
if (context.source.length === 0) {
|
|
emitError(context, 6 /* EOF_IN_CDATA */);
|
|
}
|
|
else {
|
|
advanceBy(context, 3);
|
|
}
|
|
return nodes;
|
|
}
|
|
function parseComment(context) {
|
|
const start = getCursor(context);
|
|
let content;
|
|
// Regular comment.
|
|
const match = /--(\!)?>/.exec(context.source);
|
|
if (!match) {
|
|
content = context.source.slice(4);
|
|
advanceBy(context, context.source.length);
|
|
emitError(context, 7 /* EOF_IN_COMMENT */);
|
|
}
|
|
else {
|
|
if (match.index <= 3) {
|
|
emitError(context, 0 /* ABRUPT_CLOSING_OF_EMPTY_COMMENT */);
|
|
}
|
|
if (match[1]) {
|
|
emitError(context, 10 /* INCORRECTLY_CLOSED_COMMENT */);
|
|
}
|
|
content = context.source.slice(4, match.index);
|
|
// Advancing with reporting nested comments.
|
|
const s = context.source.slice(0, match.index);
|
|
let prevIndex = 1, nestedIndex = 0;
|
|
while ((nestedIndex = s.indexOf('<!--', prevIndex)) !== -1) {
|
|
advanceBy(context, nestedIndex - prevIndex + 1);
|
|
if (nestedIndex + 4 < s.length) {
|
|
emitError(context, 16 /* NESTED_COMMENT */);
|
|
}
|
|
prevIndex = nestedIndex + 1;
|
|
}
|
|
advanceBy(context, match.index + match[0].length - prevIndex + 1);
|
|
}
|
|
return {
|
|
type: 3 /* COMMENT */,
|
|
content,
|
|
loc: getSelection(context, start)
|
|
};
|
|
}
|
|
function parseBogusComment(context) {
|
|
const start = getCursor(context);
|
|
const contentStart = context.source[1] === '?' ? 1 : 2;
|
|
let content;
|
|
const closeIndex = context.source.indexOf('>');
|
|
if (closeIndex === -1) {
|
|
content = context.source.slice(contentStart);
|
|
advanceBy(context, context.source.length);
|
|
}
|
|
else {
|
|
content = context.source.slice(contentStart, closeIndex);
|
|
advanceBy(context, closeIndex + 1);
|
|
}
|
|
return {
|
|
type: 3 /* COMMENT */,
|
|
content,
|
|
loc: getSelection(context, start)
|
|
};
|
|
}
|
|
function parseElement(context, ancestors) {
|
|
// Start tag.
|
|
const wasInPre = context.inPre;
|
|
const wasInVPre = context.inVPre;
|
|
const parent = last(ancestors);
|
|
const element = parseTag(context, 0 /* Start */, parent);
|
|
const isPreBoundary = context.inPre && !wasInPre;
|
|
const isVPreBoundary = context.inVPre && !wasInVPre;
|
|
if (element.isSelfClosing || context.options.isVoidTag(element.tag)) {
|
|
// #4030 self-closing <pre> tag
|
|
if (isPreBoundary) {
|
|
context.inPre = false;
|
|
}
|
|
if (isVPreBoundary) {
|
|
context.inVPre = false;
|
|
}
|
|
return element;
|
|
}
|
|
// Children.
|
|
ancestors.push(element);
|
|
const mode = context.options.getTextMode(element, parent);
|
|
const children = parseChildren(context, mode, ancestors);
|
|
ancestors.pop();
|
|
// 2.x inline-template compat
|
|
{
|
|
const inlineTemplateProp = element.props.find(p => p.type === 6 /* ATTRIBUTE */ && p.name === 'inline-template');
|
|
if (inlineTemplateProp &&
|
|
checkCompatEnabled("COMPILER_INLINE_TEMPLATE" /* COMPILER_INLINE_TEMPLATE */, context, inlineTemplateProp.loc)) {
|
|
const loc = getSelection(context, element.loc.end);
|
|
inlineTemplateProp.value = {
|
|
type: 2 /* TEXT */,
|
|
content: loc.source,
|
|
loc
|
|
};
|
|
}
|
|
}
|
|
element.children = children;
|
|
// End tag.
|
|
if (startsWithEndTagOpen(context.source, element.tag)) {
|
|
parseTag(context, 1 /* End */, parent);
|
|
}
|
|
else {
|
|
emitError(context, 24 /* X_MISSING_END_TAG */, 0, element.loc.start);
|
|
if (context.source.length === 0 && element.tag.toLowerCase() === 'script') {
|
|
const first = children[0];
|
|
if (first && startsWith(first.loc.source, '<!--')) {
|
|
emitError(context, 8 /* EOF_IN_SCRIPT_HTML_COMMENT_LIKE_TEXT */);
|
|
}
|
|
}
|
|
}
|
|
element.loc = getSelection(context, element.loc.start);
|
|
if (isPreBoundary) {
|
|
context.inPre = false;
|
|
}
|
|
if (isVPreBoundary) {
|
|
context.inVPre = false;
|
|
}
|
|
return element;
|
|
}
|
|
const isSpecialTemplateDirective = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.makeMap)(`if,else,else-if,for,slot`);
|
|
function parseTag(context, type, parent) {
|
|
// Tag open.
|
|
const start = getCursor(context);
|
|
const match = /^<\/?([a-z][^\t\r\n\f />]*)/i.exec(context.source);
|
|
const tag = match[1];
|
|
const ns = context.options.getNamespace(tag, parent);
|
|
advanceBy(context, match[0].length);
|
|
advanceSpaces(context);
|
|
// save current state in case we need to re-parse attributes with v-pre
|
|
const cursor = getCursor(context);
|
|
const currentSource = context.source;
|
|
// check <pre> tag
|
|
if (context.options.isPreTag(tag)) {
|
|
context.inPre = true;
|
|
}
|
|
// Attributes.
|
|
let props = parseAttributes(context, type);
|
|
// check v-pre
|
|
if (type === 0 /* Start */ &&
|
|
!context.inVPre &&
|
|
props.some(p => p.type === 7 /* DIRECTIVE */ && p.name === 'pre')) {
|
|
context.inVPre = true;
|
|
// reset context
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.extend)(context, cursor);
|
|
context.source = currentSource;
|
|
// re-parse attrs and filter out v-pre itself
|
|
props = parseAttributes(context, type).filter(p => p.name !== 'v-pre');
|
|
}
|
|
// Tag close.
|
|
let isSelfClosing = false;
|
|
if (context.source.length === 0) {
|
|
emitError(context, 9 /* EOF_IN_TAG */);
|
|
}
|
|
else {
|
|
isSelfClosing = startsWith(context.source, '/>');
|
|
if (type === 1 /* End */ && isSelfClosing) {
|
|
emitError(context, 4 /* END_TAG_WITH_TRAILING_SOLIDUS */);
|
|
}
|
|
advanceBy(context, isSelfClosing ? 2 : 1);
|
|
}
|
|
if (type === 1 /* End */) {
|
|
return;
|
|
}
|
|
// 2.x deprecation checks
|
|
if (( true) &&
|
|
isCompatEnabled("COMPILER_V_IF_V_FOR_PRECEDENCE" /* COMPILER_V_IF_V_FOR_PRECEDENCE */, context)) {
|
|
let hasIf = false;
|
|
let hasFor = false;
|
|
for (let i = 0; i < props.length; i++) {
|
|
const p = props[i];
|
|
if (p.type === 7 /* DIRECTIVE */) {
|
|
if (p.name === 'if') {
|
|
hasIf = true;
|
|
}
|
|
else if (p.name === 'for') {
|
|
hasFor = true;
|
|
}
|
|
}
|
|
if (hasIf && hasFor) {
|
|
warnDeprecation("COMPILER_V_IF_V_FOR_PRECEDENCE" /* COMPILER_V_IF_V_FOR_PRECEDENCE */, context, getSelection(context, start));
|
|
}
|
|
}
|
|
}
|
|
let tagType = 0 /* ELEMENT */;
|
|
if (!context.inVPre) {
|
|
if (tag === 'slot') {
|
|
tagType = 2 /* SLOT */;
|
|
}
|
|
else if (tag === 'template') {
|
|
if (props.some(p => p.type === 7 /* DIRECTIVE */ && isSpecialTemplateDirective(p.name))) {
|
|
tagType = 3 /* TEMPLATE */;
|
|
}
|
|
}
|
|
else if (isComponent(tag, props, context)) {
|
|
tagType = 1 /* COMPONENT */;
|
|
}
|
|
}
|
|
return {
|
|
type: 1 /* ELEMENT */,
|
|
ns,
|
|
tag,
|
|
tagType,
|
|
props,
|
|
isSelfClosing,
|
|
children: [],
|
|
loc: getSelection(context, start),
|
|
codegenNode: undefined // to be created during transform phase
|
|
};
|
|
}
|
|
function isComponent(tag, props, context) {
|
|
const options = context.options;
|
|
if (options.isCustomElement(tag)) {
|
|
return false;
|
|
}
|
|
if (tag === 'component' ||
|
|
/^[A-Z]/.test(tag) ||
|
|
isCoreComponent(tag) ||
|
|
(options.isBuiltInComponent && options.isBuiltInComponent(tag)) ||
|
|
(options.isNativeTag && !options.isNativeTag(tag))) {
|
|
return true;
|
|
}
|
|
// at this point the tag should be a native tag, but check for potential "is"
|
|
// casting
|
|
for (let i = 0; i < props.length; i++) {
|
|
const p = props[i];
|
|
if (p.type === 6 /* ATTRIBUTE */) {
|
|
if (p.name === 'is' && p.value) {
|
|
if (p.value.content.startsWith('vue:')) {
|
|
return true;
|
|
}
|
|
else if (checkCompatEnabled("COMPILER_IS_ON_ELEMENT" /* COMPILER_IS_ON_ELEMENT */, context, p.loc)) {
|
|
return true;
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
// directive
|
|
// v-is (TODO Deprecate)
|
|
if (p.name === 'is') {
|
|
return true;
|
|
}
|
|
else if (
|
|
// :is on plain element - only treat as component in compat mode
|
|
p.name === 'bind' &&
|
|
isBindKey(p.arg, 'is') &&
|
|
true &&
|
|
checkCompatEnabled("COMPILER_IS_ON_ELEMENT" /* COMPILER_IS_ON_ELEMENT */, context, p.loc)) {
|
|
return true;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
function parseAttributes(context, type) {
|
|
const props = [];
|
|
const attributeNames = new Set();
|
|
while (context.source.length > 0 &&
|
|
!startsWith(context.source, '>') &&
|
|
!startsWith(context.source, '/>')) {
|
|
if (startsWith(context.source, '/')) {
|
|
emitError(context, 22 /* UNEXPECTED_SOLIDUS_IN_TAG */);
|
|
advanceBy(context, 1);
|
|
advanceSpaces(context);
|
|
continue;
|
|
}
|
|
if (type === 1 /* End */) {
|
|
emitError(context, 3 /* END_TAG_WITH_ATTRIBUTES */);
|
|
}
|
|
const attr = parseAttribute(context, attributeNames);
|
|
if (type === 0 /* Start */) {
|
|
props.push(attr);
|
|
}
|
|
if (/^[^\t\r\n\f />]/.test(context.source)) {
|
|
emitError(context, 15 /* MISSING_WHITESPACE_BETWEEN_ATTRIBUTES */);
|
|
}
|
|
advanceSpaces(context);
|
|
}
|
|
return props;
|
|
}
|
|
function parseAttribute(context, nameSet) {
|
|
// Name.
|
|
const start = getCursor(context);
|
|
const match = /^[^\t\r\n\f />][^\t\r\n\f />=]*/.exec(context.source);
|
|
const name = match[0];
|
|
if (nameSet.has(name)) {
|
|
emitError(context, 2 /* DUPLICATE_ATTRIBUTE */);
|
|
}
|
|
nameSet.add(name);
|
|
if (name[0] === '=') {
|
|
emitError(context, 19 /* UNEXPECTED_EQUALS_SIGN_BEFORE_ATTRIBUTE_NAME */);
|
|
}
|
|
{
|
|
const pattern = /["'<]/g;
|
|
let m;
|
|
while ((m = pattern.exec(name))) {
|
|
emitError(context, 17 /* UNEXPECTED_CHARACTER_IN_ATTRIBUTE_NAME */, m.index);
|
|
}
|
|
}
|
|
advanceBy(context, name.length);
|
|
// Value
|
|
let value = undefined;
|
|
if (/^[\t\r\n\f ]*=/.test(context.source)) {
|
|
advanceSpaces(context);
|
|
advanceBy(context, 1);
|
|
advanceSpaces(context);
|
|
value = parseAttributeValue(context);
|
|
if (!value) {
|
|
emitError(context, 13 /* MISSING_ATTRIBUTE_VALUE */);
|
|
}
|
|
}
|
|
const loc = getSelection(context, start);
|
|
if (!context.inVPre && /^(v-|:|\.|@|#)/.test(name)) {
|
|
const match = /(?:^v-([a-z0-9-]+))?(?:(?::|^\.|^@|^#)(\[[^\]]+\]|[^\.]+))?(.+)?$/i.exec(name);
|
|
let isPropShorthand = startsWith(name, '.');
|
|
let dirName = match[1] ||
|
|
(isPropShorthand || startsWith(name, ':')
|
|
? 'bind'
|
|
: startsWith(name, '@')
|
|
? 'on'
|
|
: 'slot');
|
|
let arg;
|
|
if (match[2]) {
|
|
const isSlot = dirName === 'slot';
|
|
const startOffset = name.lastIndexOf(match[2]);
|
|
const loc = getSelection(context, getNewPosition(context, start, startOffset), getNewPosition(context, start, startOffset + match[2].length + ((isSlot && match[3]) || '').length));
|
|
let content = match[2];
|
|
let isStatic = true;
|
|
if (content.startsWith('[')) {
|
|
isStatic = false;
|
|
if (!content.endsWith(']')) {
|
|
emitError(context, 26 /* X_MISSING_DYNAMIC_DIRECTIVE_ARGUMENT_END */);
|
|
}
|
|
content = content.substr(1, content.length - 2);
|
|
}
|
|
else if (isSlot) {
|
|
// #1241 special case for v-slot: vuetify relies extensively on slot
|
|
// names containing dots. v-slot doesn't have any modifiers and Vue 2.x
|
|
// supports such usage so we are keeping it consistent with 2.x.
|
|
content += match[3] || '';
|
|
}
|
|
arg = {
|
|
type: 4 /* SIMPLE_EXPRESSION */,
|
|
content,
|
|
isStatic,
|
|
constType: isStatic
|
|
? 3 /* CAN_STRINGIFY */
|
|
: 0 /* NOT_CONSTANT */,
|
|
loc
|
|
};
|
|
}
|
|
if (value && value.isQuoted) {
|
|
const valueLoc = value.loc;
|
|
valueLoc.start.offset++;
|
|
valueLoc.start.column++;
|
|
valueLoc.end = advancePositionWithClone(valueLoc.start, value.content);
|
|
valueLoc.source = valueLoc.source.slice(1, -1);
|
|
}
|
|
const modifiers = match[3] ? match[3].substr(1).split('.') : [];
|
|
if (isPropShorthand)
|
|
modifiers.push('prop');
|
|
// 2.x compat v-bind:foo.sync -> v-model:foo
|
|
if (dirName === 'bind' && arg) {
|
|
if (modifiers.includes('sync') &&
|
|
checkCompatEnabled("COMPILER_V_BIND_SYNC" /* COMPILER_V_BIND_SYNC */, context, loc, arg.loc.source)) {
|
|
dirName = 'model';
|
|
modifiers.splice(modifiers.indexOf('sync'), 1);
|
|
}
|
|
if (( true) && modifiers.includes('prop')) {
|
|
checkCompatEnabled("COMPILER_V_BIND_PROP" /* COMPILER_V_BIND_PROP */, context, loc);
|
|
}
|
|
}
|
|
return {
|
|
type: 7 /* DIRECTIVE */,
|
|
name: dirName,
|
|
exp: value && {
|
|
type: 4 /* SIMPLE_EXPRESSION */,
|
|
content: value.content,
|
|
isStatic: false,
|
|
// Treat as non-constant by default. This can be potentially set to
|
|
// other values by `transformExpression` to make it eligible for hoisting.
|
|
constType: 0 /* NOT_CONSTANT */,
|
|
loc: value.loc
|
|
},
|
|
arg,
|
|
modifiers,
|
|
loc
|
|
};
|
|
}
|
|
return {
|
|
type: 6 /* ATTRIBUTE */,
|
|
name,
|
|
value: value && {
|
|
type: 2 /* TEXT */,
|
|
content: value.content,
|
|
loc: value.loc
|
|
},
|
|
loc
|
|
};
|
|
}
|
|
function parseAttributeValue(context) {
|
|
const start = getCursor(context);
|
|
let content;
|
|
const quote = context.source[0];
|
|
const isQuoted = quote === `"` || quote === `'`;
|
|
if (isQuoted) {
|
|
// Quoted value.
|
|
advanceBy(context, 1);
|
|
const endIndex = context.source.indexOf(quote);
|
|
if (endIndex === -1) {
|
|
content = parseTextData(context, context.source.length, 4 /* ATTRIBUTE_VALUE */);
|
|
}
|
|
else {
|
|
content = parseTextData(context, endIndex, 4 /* ATTRIBUTE_VALUE */);
|
|
advanceBy(context, 1);
|
|
}
|
|
}
|
|
else {
|
|
// Unquoted
|
|
const match = /^[^\t\r\n\f >]+/.exec(context.source);
|
|
if (!match) {
|
|
return undefined;
|
|
}
|
|
const unexpectedChars = /["'<=`]/g;
|
|
let m;
|
|
while ((m = unexpectedChars.exec(match[0]))) {
|
|
emitError(context, 18 /* UNEXPECTED_CHARACTER_IN_UNQUOTED_ATTRIBUTE_VALUE */, m.index);
|
|
}
|
|
content = parseTextData(context, match[0].length, 4 /* ATTRIBUTE_VALUE */);
|
|
}
|
|
return { content, isQuoted, loc: getSelection(context, start) };
|
|
}
|
|
function parseInterpolation(context, mode) {
|
|
const [open, close] = context.options.delimiters;
|
|
const closeIndex = context.source.indexOf(close, open.length);
|
|
if (closeIndex === -1) {
|
|
emitError(context, 25 /* X_MISSING_INTERPOLATION_END */);
|
|
return undefined;
|
|
}
|
|
const start = getCursor(context);
|
|
advanceBy(context, open.length);
|
|
const innerStart = getCursor(context);
|
|
const innerEnd = getCursor(context);
|
|
const rawContentLength = closeIndex - open.length;
|
|
const rawContent = context.source.slice(0, rawContentLength);
|
|
const preTrimContent = parseTextData(context, rawContentLength, mode);
|
|
const content = preTrimContent.trim();
|
|
const startOffset = preTrimContent.indexOf(content);
|
|
if (startOffset > 0) {
|
|
advancePositionWithMutation(innerStart, rawContent, startOffset);
|
|
}
|
|
const endOffset = rawContentLength - (preTrimContent.length - content.length - startOffset);
|
|
advancePositionWithMutation(innerEnd, rawContent, endOffset);
|
|
advanceBy(context, close.length);
|
|
return {
|
|
type: 5 /* INTERPOLATION */,
|
|
content: {
|
|
type: 4 /* SIMPLE_EXPRESSION */,
|
|
isStatic: false,
|
|
// Set `isConstant` to false by default and will decide in transformExpression
|
|
constType: 0 /* NOT_CONSTANT */,
|
|
content,
|
|
loc: getSelection(context, innerStart, innerEnd)
|
|
},
|
|
loc: getSelection(context, start)
|
|
};
|
|
}
|
|
function parseText(context, mode) {
|
|
const endTokens = ['<', context.options.delimiters[0]];
|
|
if (mode === 3 /* CDATA */) {
|
|
endTokens.push(']]>');
|
|
}
|
|
let endIndex = context.source.length;
|
|
for (let i = 0; i < endTokens.length; i++) {
|
|
const index = context.source.indexOf(endTokens[i], 1);
|
|
if (index !== -1 && endIndex > index) {
|
|
endIndex = index;
|
|
}
|
|
}
|
|
const start = getCursor(context);
|
|
const content = parseTextData(context, endIndex, mode);
|
|
return {
|
|
type: 2 /* TEXT */,
|
|
content,
|
|
loc: getSelection(context, start)
|
|
};
|
|
}
|
|
/**
|
|
* Get text data with a given length from the current location.
|
|
* This translates HTML entities in the text data.
|
|
*/
|
|
function parseTextData(context, length, mode) {
|
|
const rawText = context.source.slice(0, length);
|
|
advanceBy(context, length);
|
|
if (mode === 2 /* RAWTEXT */ ||
|
|
mode === 3 /* CDATA */ ||
|
|
rawText.indexOf('&') === -1) {
|
|
return rawText;
|
|
}
|
|
else {
|
|
// DATA or RCDATA containing "&"". Entity decoding required.
|
|
return context.options.decodeEntities(rawText, mode === 4 /* ATTRIBUTE_VALUE */);
|
|
}
|
|
}
|
|
function getCursor(context) {
|
|
const { column, line, offset } = context;
|
|
return { column, line, offset };
|
|
}
|
|
function getSelection(context, start, end) {
|
|
end = end || getCursor(context);
|
|
return {
|
|
start,
|
|
end,
|
|
source: context.originalSource.slice(start.offset, end.offset)
|
|
};
|
|
}
|
|
function last(xs) {
|
|
return xs[xs.length - 1];
|
|
}
|
|
function startsWith(source, searchString) {
|
|
return source.startsWith(searchString);
|
|
}
|
|
function advanceBy(context, numberOfCharacters) {
|
|
const { source } = context;
|
|
advancePositionWithMutation(context, source, numberOfCharacters);
|
|
context.source = source.slice(numberOfCharacters);
|
|
}
|
|
function advanceSpaces(context) {
|
|
const match = /^[\t\r\n\f ]+/.exec(context.source);
|
|
if (match) {
|
|
advanceBy(context, match[0].length);
|
|
}
|
|
}
|
|
function getNewPosition(context, start, numberOfCharacters) {
|
|
return advancePositionWithClone(start, context.originalSource.slice(start.offset, numberOfCharacters), numberOfCharacters);
|
|
}
|
|
function emitError(context, code, offset, loc = getCursor(context)) {
|
|
if (offset) {
|
|
loc.offset += offset;
|
|
loc.column += offset;
|
|
}
|
|
context.options.onError(createCompilerError(code, {
|
|
start: loc,
|
|
end: loc,
|
|
source: ''
|
|
}));
|
|
}
|
|
function isEnd(context, mode, ancestors) {
|
|
const s = context.source;
|
|
switch (mode) {
|
|
case 0 /* DATA */:
|
|
if (startsWith(s, '</')) {
|
|
// TODO: probably bad performance
|
|
for (let i = ancestors.length - 1; i >= 0; --i) {
|
|
if (startsWithEndTagOpen(s, ancestors[i].tag)) {
|
|
return true;
|
|
}
|
|
}
|
|
}
|
|
break;
|
|
case 1 /* RCDATA */:
|
|
case 2 /* RAWTEXT */: {
|
|
const parent = last(ancestors);
|
|
if (parent && startsWithEndTagOpen(s, parent.tag)) {
|
|
return true;
|
|
}
|
|
break;
|
|
}
|
|
case 3 /* CDATA */:
|
|
if (startsWith(s, ']]>')) {
|
|
return true;
|
|
}
|
|
break;
|
|
}
|
|
return !s;
|
|
}
|
|
function startsWithEndTagOpen(source, tag) {
|
|
return (startsWith(source, '</') &&
|
|
source.substr(2, tag.length).toLowerCase() === tag.toLowerCase() &&
|
|
/[\t\r\n\f />]/.test(source[2 + tag.length] || '>'));
|
|
}
|
|
|
|
function hoistStatic(root, context) {
|
|
walk(root, context,
|
|
// Root node is unfortunately non-hoistable due to potential parent
|
|
// fallthrough attributes.
|
|
isSingleElementRoot(root, root.children[0]));
|
|
}
|
|
function isSingleElementRoot(root, child) {
|
|
const { children } = root;
|
|
return (children.length === 1 &&
|
|
child.type === 1 /* ELEMENT */ &&
|
|
!isSlotOutlet(child));
|
|
}
|
|
function walk(node, context, doNotHoistNode = false) {
|
|
// Some transforms, e.g. transformAssetUrls from @vue/compiler-sfc, replaces
|
|
// static bindings with expressions. These expressions are guaranteed to be
|
|
// constant so they are still eligible for hoisting, but they are only
|
|
// available at runtime and therefore cannot be evaluated ahead of time.
|
|
// This is only a concern for pre-stringification (via transformHoist by
|
|
// @vue/compiler-dom), but doing it here allows us to perform only one full
|
|
// walk of the AST and allow `stringifyStatic` to stop walking as soon as its
|
|
// stringficiation threshold is met.
|
|
let canStringify = true;
|
|
const { children } = node;
|
|
const originalCount = children.length;
|
|
let hoistedCount = 0;
|
|
for (let i = 0; i < children.length; i++) {
|
|
const child = children[i];
|
|
// only plain elements & text calls are eligible for hoisting.
|
|
if (child.type === 1 /* ELEMENT */ &&
|
|
child.tagType === 0 /* ELEMENT */) {
|
|
const constantType = doNotHoistNode
|
|
? 0 /* NOT_CONSTANT */
|
|
: getConstantType(child, context);
|
|
if (constantType > 0 /* NOT_CONSTANT */) {
|
|
if (constantType < 3 /* CAN_STRINGIFY */) {
|
|
canStringify = false;
|
|
}
|
|
if (constantType >= 2 /* CAN_HOIST */) {
|
|
child.codegenNode.patchFlag =
|
|
-1 /* HOISTED */ + (( true) ? ` /* HOISTED */` : 0);
|
|
child.codegenNode = context.hoist(child.codegenNode);
|
|
hoistedCount++;
|
|
continue;
|
|
}
|
|
}
|
|
else {
|
|
// node may contain dynamic children, but its props may be eligible for
|
|
// hoisting.
|
|
const codegenNode = child.codegenNode;
|
|
if (codegenNode.type === 13 /* VNODE_CALL */) {
|
|
const flag = getPatchFlag(codegenNode);
|
|
if ((!flag ||
|
|
flag === 512 /* NEED_PATCH */ ||
|
|
flag === 1 /* TEXT */) &&
|
|
getGeneratedPropsConstantType(child, context) >=
|
|
2 /* CAN_HOIST */) {
|
|
const props = getNodeProps(child);
|
|
if (props) {
|
|
codegenNode.props = context.hoist(props);
|
|
}
|
|
}
|
|
if (codegenNode.dynamicProps) {
|
|
codegenNode.dynamicProps = context.hoist(codegenNode.dynamicProps);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
else if (child.type === 12 /* TEXT_CALL */) {
|
|
const contentType = getConstantType(child.content, context);
|
|
if (contentType > 0) {
|
|
if (contentType < 3 /* CAN_STRINGIFY */) {
|
|
canStringify = false;
|
|
}
|
|
if (contentType >= 2 /* CAN_HOIST */) {
|
|
child.codegenNode = context.hoist(child.codegenNode);
|
|
hoistedCount++;
|
|
}
|
|
}
|
|
}
|
|
// walk further
|
|
if (child.type === 1 /* ELEMENT */) {
|
|
const isComponent = child.tagType === 1 /* COMPONENT */;
|
|
if (isComponent) {
|
|
context.scopes.vSlot++;
|
|
}
|
|
walk(child, context);
|
|
if (isComponent) {
|
|
context.scopes.vSlot--;
|
|
}
|
|
}
|
|
else if (child.type === 11 /* FOR */) {
|
|
// Do not hoist v-for single child because it has to be a block
|
|
walk(child, context, child.children.length === 1);
|
|
}
|
|
else if (child.type === 9 /* IF */) {
|
|
for (let i = 0; i < child.branches.length; i++) {
|
|
// Do not hoist v-if single child because it has to be a block
|
|
walk(child.branches[i], context, child.branches[i].children.length === 1);
|
|
}
|
|
}
|
|
}
|
|
if (canStringify && hoistedCount && context.transformHoist) {
|
|
context.transformHoist(children, context, node);
|
|
}
|
|
// all children were hoisted - the entire children array is hoistable.
|
|
if (hoistedCount &&
|
|
hoistedCount === originalCount &&
|
|
node.type === 1 /* ELEMENT */ &&
|
|
node.tagType === 0 /* ELEMENT */ &&
|
|
node.codegenNode &&
|
|
node.codegenNode.type === 13 /* VNODE_CALL */ &&
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(node.codegenNode.children)) {
|
|
node.codegenNode.children = context.hoist(createArrayExpression(node.codegenNode.children));
|
|
}
|
|
}
|
|
function getConstantType(node, context) {
|
|
const { constantCache } = context;
|
|
switch (node.type) {
|
|
case 1 /* ELEMENT */:
|
|
if (node.tagType !== 0 /* ELEMENT */) {
|
|
return 0 /* NOT_CONSTANT */;
|
|
}
|
|
const cached = constantCache.get(node);
|
|
if (cached !== undefined) {
|
|
return cached;
|
|
}
|
|
const codegenNode = node.codegenNode;
|
|
if (codegenNode.type !== 13 /* VNODE_CALL */) {
|
|
return 0 /* NOT_CONSTANT */;
|
|
}
|
|
const flag = getPatchFlag(codegenNode);
|
|
if (!flag) {
|
|
let returnType = 3 /* CAN_STRINGIFY */;
|
|
// Element itself has no patch flag. However we still need to check:
|
|
// 1. Even for a node with no patch flag, it is possible for it to contain
|
|
// non-hoistable expressions that refers to scope variables, e.g. compiler
|
|
// injected keys or cached event handlers. Therefore we need to always
|
|
// check the codegenNode's props to be sure.
|
|
const generatedPropsType = getGeneratedPropsConstantType(node, context);
|
|
if (generatedPropsType === 0 /* NOT_CONSTANT */) {
|
|
constantCache.set(node, 0 /* NOT_CONSTANT */);
|
|
return 0 /* NOT_CONSTANT */;
|
|
}
|
|
if (generatedPropsType < returnType) {
|
|
returnType = generatedPropsType;
|
|
}
|
|
// 2. its children.
|
|
for (let i = 0; i < node.children.length; i++) {
|
|
const childType = getConstantType(node.children[i], context);
|
|
if (childType === 0 /* NOT_CONSTANT */) {
|
|
constantCache.set(node, 0 /* NOT_CONSTANT */);
|
|
return 0 /* NOT_CONSTANT */;
|
|
}
|
|
if (childType < returnType) {
|
|
returnType = childType;
|
|
}
|
|
}
|
|
// 3. if the type is not already CAN_SKIP_PATCH which is the lowest non-0
|
|
// type, check if any of the props can cause the type to be lowered
|
|
// we can skip can_patch because it's guaranteed by the absence of a
|
|
// patchFlag.
|
|
if (returnType > 1 /* CAN_SKIP_PATCH */) {
|
|
for (let i = 0; i < node.props.length; i++) {
|
|
const p = node.props[i];
|
|
if (p.type === 7 /* DIRECTIVE */ && p.name === 'bind' && p.exp) {
|
|
const expType = getConstantType(p.exp, context);
|
|
if (expType === 0 /* NOT_CONSTANT */) {
|
|
constantCache.set(node, 0 /* NOT_CONSTANT */);
|
|
return 0 /* NOT_CONSTANT */;
|
|
}
|
|
if (expType < returnType) {
|
|
returnType = expType;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
// only svg/foreignObject could be block here, however if they are
|
|
// static then they don't need to be blocks since there will be no
|
|
// nested updates.
|
|
if (codegenNode.isBlock) {
|
|
context.removeHelper(OPEN_BLOCK);
|
|
context.removeHelper(getVNodeBlockHelper(context.inSSR, codegenNode.isComponent));
|
|
codegenNode.isBlock = false;
|
|
context.helper(getVNodeHelper(context.inSSR, codegenNode.isComponent));
|
|
}
|
|
constantCache.set(node, returnType);
|
|
return returnType;
|
|
}
|
|
else {
|
|
constantCache.set(node, 0 /* NOT_CONSTANT */);
|
|
return 0 /* NOT_CONSTANT */;
|
|
}
|
|
case 2 /* TEXT */:
|
|
case 3 /* COMMENT */:
|
|
return 3 /* CAN_STRINGIFY */;
|
|
case 9 /* IF */:
|
|
case 11 /* FOR */:
|
|
case 10 /* IF_BRANCH */:
|
|
return 0 /* NOT_CONSTANT */;
|
|
case 5 /* INTERPOLATION */:
|
|
case 12 /* TEXT_CALL */:
|
|
return getConstantType(node.content, context);
|
|
case 4 /* SIMPLE_EXPRESSION */:
|
|
return node.constType;
|
|
case 8 /* COMPOUND_EXPRESSION */:
|
|
let returnType = 3 /* CAN_STRINGIFY */;
|
|
for (let i = 0; i < node.children.length; i++) {
|
|
const child = node.children[i];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(child) || (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isSymbol)(child)) {
|
|
continue;
|
|
}
|
|
const childType = getConstantType(child, context);
|
|
if (childType === 0 /* NOT_CONSTANT */) {
|
|
return 0 /* NOT_CONSTANT */;
|
|
}
|
|
else if (childType < returnType) {
|
|
returnType = childType;
|
|
}
|
|
}
|
|
return returnType;
|
|
default:
|
|
if ((true)) ;
|
|
return 0 /* NOT_CONSTANT */;
|
|
}
|
|
}
|
|
const allowHoistedHelperSet = new Set([
|
|
NORMALIZE_CLASS,
|
|
NORMALIZE_STYLE,
|
|
NORMALIZE_PROPS,
|
|
GUARD_REACTIVE_PROPS
|
|
]);
|
|
function getConstantTypeOfHelperCall(value, context) {
|
|
if (value.type === 14 /* JS_CALL_EXPRESSION */ &&
|
|
!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(value.callee) &&
|
|
allowHoistedHelperSet.has(value.callee)) {
|
|
const arg = value.arguments[0];
|
|
if (arg.type === 4 /* SIMPLE_EXPRESSION */) {
|
|
return getConstantType(arg, context);
|
|
}
|
|
else if (arg.type === 14 /* JS_CALL_EXPRESSION */) {
|
|
// in the case of nested helper call, e.g. `normalizeProps(guardReactiveProps(exp))`
|
|
return getConstantTypeOfHelperCall(arg, context);
|
|
}
|
|
}
|
|
return 0 /* NOT_CONSTANT */;
|
|
}
|
|
function getGeneratedPropsConstantType(node, context) {
|
|
let returnType = 3 /* CAN_STRINGIFY */;
|
|
const props = getNodeProps(node);
|
|
if (props && props.type === 15 /* JS_OBJECT_EXPRESSION */) {
|
|
const { properties } = props;
|
|
for (let i = 0; i < properties.length; i++) {
|
|
const { key, value } = properties[i];
|
|
const keyType = getConstantType(key, context);
|
|
if (keyType === 0 /* NOT_CONSTANT */) {
|
|
return keyType;
|
|
}
|
|
if (keyType < returnType) {
|
|
returnType = keyType;
|
|
}
|
|
let valueType;
|
|
if (value.type === 4 /* SIMPLE_EXPRESSION */) {
|
|
valueType = getConstantType(value, context);
|
|
}
|
|
else if (value.type === 14 /* JS_CALL_EXPRESSION */) {
|
|
// some helper calls can be hoisted,
|
|
// such as the `normalizeProps` generated by the compiler for pre-normalize class,
|
|
// in this case we need to respect the ConstanType of the helper's argments
|
|
valueType = getConstantTypeOfHelperCall(value, context);
|
|
}
|
|
else {
|
|
valueType = 0 /* NOT_CONSTANT */;
|
|
}
|
|
if (valueType === 0 /* NOT_CONSTANT */) {
|
|
return valueType;
|
|
}
|
|
if (valueType < returnType) {
|
|
returnType = valueType;
|
|
}
|
|
}
|
|
}
|
|
return returnType;
|
|
}
|
|
function getNodeProps(node) {
|
|
const codegenNode = node.codegenNode;
|
|
if (codegenNode.type === 13 /* VNODE_CALL */) {
|
|
return codegenNode.props;
|
|
}
|
|
}
|
|
function getPatchFlag(node) {
|
|
const flag = node.patchFlag;
|
|
return flag ? parseInt(flag, 10) : undefined;
|
|
}
|
|
|
|
function createTransformContext(root, { filename = '', prefixIdentifiers = false, hoistStatic = false, cacheHandlers = false, nodeTransforms = [], directiveTransforms = {}, transformHoist = null, isBuiltInComponent = _vue_shared__WEBPACK_IMPORTED_MODULE_0__.NOOP, isCustomElement = _vue_shared__WEBPACK_IMPORTED_MODULE_0__.NOOP, expressionPlugins = [], scopeId = null, slotted = true, ssr = false, inSSR = false, ssrCssVars = ``, bindingMetadata = _vue_shared__WEBPACK_IMPORTED_MODULE_0__.EMPTY_OBJ, inline = false, isTS = false, onError = defaultOnError, onWarn = defaultOnWarn, compatConfig }) {
|
|
const nameMatch = filename.replace(/\?.*$/, '').match(/([^/\\]+)\.\w+$/);
|
|
const context = {
|
|
// options
|
|
selfName: nameMatch && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.capitalize)((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.camelize)(nameMatch[1])),
|
|
prefixIdentifiers,
|
|
hoistStatic,
|
|
cacheHandlers,
|
|
nodeTransforms,
|
|
directiveTransforms,
|
|
transformHoist,
|
|
isBuiltInComponent,
|
|
isCustomElement,
|
|
expressionPlugins,
|
|
scopeId,
|
|
slotted,
|
|
ssr,
|
|
inSSR,
|
|
ssrCssVars,
|
|
bindingMetadata,
|
|
inline,
|
|
isTS,
|
|
onError,
|
|
onWarn,
|
|
compatConfig,
|
|
// state
|
|
root,
|
|
helpers: new Map(),
|
|
components: new Set(),
|
|
directives: new Set(),
|
|
hoists: [],
|
|
imports: [],
|
|
constantCache: new Map(),
|
|
temps: 0,
|
|
cached: 0,
|
|
identifiers: Object.create(null),
|
|
scopes: {
|
|
vFor: 0,
|
|
vSlot: 0,
|
|
vPre: 0,
|
|
vOnce: 0
|
|
},
|
|
parent: null,
|
|
currentNode: root,
|
|
childIndex: 0,
|
|
inVOnce: false,
|
|
// methods
|
|
helper(name) {
|
|
const count = context.helpers.get(name) || 0;
|
|
context.helpers.set(name, count + 1);
|
|
return name;
|
|
},
|
|
removeHelper(name) {
|
|
const count = context.helpers.get(name);
|
|
if (count) {
|
|
const currentCount = count - 1;
|
|
if (!currentCount) {
|
|
context.helpers.delete(name);
|
|
}
|
|
else {
|
|
context.helpers.set(name, currentCount);
|
|
}
|
|
}
|
|
},
|
|
helperString(name) {
|
|
return `_${helperNameMap[context.helper(name)]}`;
|
|
},
|
|
replaceNode(node) {
|
|
/* istanbul ignore if */
|
|
if ((true)) {
|
|
if (!context.currentNode) {
|
|
throw new Error(`Node being replaced is already removed.`);
|
|
}
|
|
if (!context.parent) {
|
|
throw new Error(`Cannot replace root node.`);
|
|
}
|
|
}
|
|
context.parent.children[context.childIndex] = context.currentNode = node;
|
|
},
|
|
removeNode(node) {
|
|
if (( true) && !context.parent) {
|
|
throw new Error(`Cannot remove root node.`);
|
|
}
|
|
const list = context.parent.children;
|
|
const removalIndex = node
|
|
? list.indexOf(node)
|
|
: context.currentNode
|
|
? context.childIndex
|
|
: -1;
|
|
/* istanbul ignore if */
|
|
if (( true) && removalIndex < 0) {
|
|
throw new Error(`node being removed is not a child of current parent`);
|
|
}
|
|
if (!node || node === context.currentNode) {
|
|
// current node removed
|
|
context.currentNode = null;
|
|
context.onNodeRemoved();
|
|
}
|
|
else {
|
|
// sibling node removed
|
|
if (context.childIndex > removalIndex) {
|
|
context.childIndex--;
|
|
context.onNodeRemoved();
|
|
}
|
|
}
|
|
context.parent.children.splice(removalIndex, 1);
|
|
},
|
|
onNodeRemoved: () => { },
|
|
addIdentifiers(exp) {
|
|
},
|
|
removeIdentifiers(exp) {
|
|
},
|
|
hoist(exp) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(exp))
|
|
exp = createSimpleExpression(exp);
|
|
context.hoists.push(exp);
|
|
const identifier = createSimpleExpression(`_hoisted_${context.hoists.length}`, false, exp.loc, 2 /* CAN_HOIST */);
|
|
identifier.hoisted = exp;
|
|
return identifier;
|
|
},
|
|
cache(exp, isVNode = false) {
|
|
return createCacheExpression(context.cached++, exp, isVNode);
|
|
}
|
|
};
|
|
{
|
|
context.filters = new Set();
|
|
}
|
|
return context;
|
|
}
|
|
function transform(root, options) {
|
|
const context = createTransformContext(root, options);
|
|
traverseNode(root, context);
|
|
if (options.hoistStatic) {
|
|
hoistStatic(root, context);
|
|
}
|
|
if (!options.ssr) {
|
|
createRootCodegen(root, context);
|
|
}
|
|
// finalize meta information
|
|
root.helpers = [...context.helpers.keys()];
|
|
root.components = [...context.components];
|
|
root.directives = [...context.directives];
|
|
root.imports = context.imports;
|
|
root.hoists = context.hoists;
|
|
root.temps = context.temps;
|
|
root.cached = context.cached;
|
|
{
|
|
root.filters = [...context.filters];
|
|
}
|
|
}
|
|
function createRootCodegen(root, context) {
|
|
const { helper } = context;
|
|
const { children } = root;
|
|
if (children.length === 1) {
|
|
const child = children[0];
|
|
// if the single child is an element, turn it into a block.
|
|
if (isSingleElementRoot(root, child) && child.codegenNode) {
|
|
// single element root is never hoisted so codegenNode will never be
|
|
// SimpleExpressionNode
|
|
const codegenNode = child.codegenNode;
|
|
if (codegenNode.type === 13 /* VNODE_CALL */) {
|
|
makeBlock(codegenNode, context);
|
|
}
|
|
root.codegenNode = codegenNode;
|
|
}
|
|
else {
|
|
// - single <slot/>, IfNode, ForNode: already blocks.
|
|
// - single text node: always patched.
|
|
// root codegen falls through via genNode()
|
|
root.codegenNode = child;
|
|
}
|
|
}
|
|
else if (children.length > 1) {
|
|
// root has multiple nodes - return a fragment block.
|
|
let patchFlag = 64 /* STABLE_FRAGMENT */;
|
|
let patchFlagText = _vue_shared__WEBPACK_IMPORTED_MODULE_0__.PatchFlagNames[64];
|
|
// check if the fragment actually contains a single valid child with
|
|
// the rest being comments
|
|
if (( true) &&
|
|
children.filter(c => c.type !== 3 /* COMMENT */).length === 1) {
|
|
patchFlag |= 2048 /* DEV_ROOT_FRAGMENT */;
|
|
patchFlagText += `, ${_vue_shared__WEBPACK_IMPORTED_MODULE_0__.PatchFlagNames[2048]}`;
|
|
}
|
|
root.codegenNode = createVNodeCall(context, helper(FRAGMENT), undefined, root.children, patchFlag + (( true) ? ` /* ${patchFlagText} */` : 0), undefined, undefined, true, undefined, false /* isComponent */);
|
|
}
|
|
else ;
|
|
}
|
|
function traverseChildren(parent, context) {
|
|
let i = 0;
|
|
const nodeRemoved = () => {
|
|
i--;
|
|
};
|
|
for (; i < parent.children.length; i++) {
|
|
const child = parent.children[i];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(child))
|
|
continue;
|
|
context.parent = parent;
|
|
context.childIndex = i;
|
|
context.onNodeRemoved = nodeRemoved;
|
|
traverseNode(child, context);
|
|
}
|
|
}
|
|
function traverseNode(node, context) {
|
|
context.currentNode = node;
|
|
// apply transform plugins
|
|
const { nodeTransforms } = context;
|
|
const exitFns = [];
|
|
for (let i = 0; i < nodeTransforms.length; i++) {
|
|
const onExit = nodeTransforms[i](node, context);
|
|
if (onExit) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(onExit)) {
|
|
exitFns.push(...onExit);
|
|
}
|
|
else {
|
|
exitFns.push(onExit);
|
|
}
|
|
}
|
|
if (!context.currentNode) {
|
|
// node was removed
|
|
return;
|
|
}
|
|
else {
|
|
// node may have been replaced
|
|
node = context.currentNode;
|
|
}
|
|
}
|
|
switch (node.type) {
|
|
case 3 /* COMMENT */:
|
|
if (!context.ssr) {
|
|
// inject import for the Comment symbol, which is needed for creating
|
|
// comment nodes with `createVNode`
|
|
context.helper(CREATE_COMMENT);
|
|
}
|
|
break;
|
|
case 5 /* INTERPOLATION */:
|
|
// no need to traverse, but we need to inject toString helper
|
|
if (!context.ssr) {
|
|
context.helper(TO_DISPLAY_STRING);
|
|
}
|
|
break;
|
|
// for container types, further traverse downwards
|
|
case 9 /* IF */:
|
|
for (let i = 0; i < node.branches.length; i++) {
|
|
traverseNode(node.branches[i], context);
|
|
}
|
|
break;
|
|
case 10 /* IF_BRANCH */:
|
|
case 11 /* FOR */:
|
|
case 1 /* ELEMENT */:
|
|
case 0 /* ROOT */:
|
|
traverseChildren(node, context);
|
|
break;
|
|
}
|
|
// exit transforms
|
|
context.currentNode = node;
|
|
let i = exitFns.length;
|
|
while (i--) {
|
|
exitFns[i]();
|
|
}
|
|
}
|
|
function createStructuralDirectiveTransform(name, fn) {
|
|
const matches = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(name)
|
|
? (n) => n === name
|
|
: (n) => name.test(n);
|
|
return (node, context) => {
|
|
if (node.type === 1 /* ELEMENT */) {
|
|
const { props } = node;
|
|
// structural directive transforms are not concerned with slots
|
|
// as they are handled separately in vSlot.ts
|
|
if (node.tagType === 3 /* TEMPLATE */ && props.some(isVSlot)) {
|
|
return;
|
|
}
|
|
const exitFns = [];
|
|
for (let i = 0; i < props.length; i++) {
|
|
const prop = props[i];
|
|
if (prop.type === 7 /* DIRECTIVE */ && matches(prop.name)) {
|
|
// structural directives are removed to avoid infinite recursion
|
|
// also we remove them *before* applying so that it can further
|
|
// traverse itself in case it moves the node around
|
|
props.splice(i, 1);
|
|
i--;
|
|
const onExit = fn(node, prop, context);
|
|
if (onExit)
|
|
exitFns.push(onExit);
|
|
}
|
|
}
|
|
return exitFns;
|
|
}
|
|
};
|
|
}
|
|
|
|
const PURE_ANNOTATION = `/*#__PURE__*/`;
|
|
function createCodegenContext(ast, { mode = 'function', prefixIdentifiers = mode === 'module', sourceMap = false, filename = `template.vue.html`, scopeId = null, optimizeImports = false, runtimeGlobalName = `Vue`, runtimeModuleName = `vue`, ssr = false, isTS = false, inSSR = false }) {
|
|
const context = {
|
|
mode,
|
|
prefixIdentifiers,
|
|
sourceMap,
|
|
filename,
|
|
scopeId,
|
|
optimizeImports,
|
|
runtimeGlobalName,
|
|
runtimeModuleName,
|
|
ssr,
|
|
isTS,
|
|
inSSR,
|
|
source: ast.loc.source,
|
|
code: ``,
|
|
column: 1,
|
|
line: 1,
|
|
offset: 0,
|
|
indentLevel: 0,
|
|
pure: false,
|
|
map: undefined,
|
|
helper(key) {
|
|
return `_${helperNameMap[key]}`;
|
|
},
|
|
push(code, node) {
|
|
context.code += code;
|
|
},
|
|
indent() {
|
|
newline(++context.indentLevel);
|
|
},
|
|
deindent(withoutNewLine = false) {
|
|
if (withoutNewLine) {
|
|
--context.indentLevel;
|
|
}
|
|
else {
|
|
newline(--context.indentLevel);
|
|
}
|
|
},
|
|
newline() {
|
|
newline(context.indentLevel);
|
|
}
|
|
};
|
|
function newline(n) {
|
|
context.push('\n' + ` `.repeat(n));
|
|
}
|
|
return context;
|
|
}
|
|
function generate(ast, options = {}) {
|
|
const context = createCodegenContext(ast, options);
|
|
if (options.onContextCreated)
|
|
options.onContextCreated(context);
|
|
const { mode, push, prefixIdentifiers, indent, deindent, newline, scopeId, ssr } = context;
|
|
const hasHelpers = ast.helpers.length > 0;
|
|
const useWithBlock = !prefixIdentifiers && mode !== 'module';
|
|
// preambles
|
|
// in setup() inline mode, the preamble is generated in a sub context
|
|
// and returned separately.
|
|
const preambleContext = context;
|
|
{
|
|
genFunctionPreamble(ast, preambleContext);
|
|
}
|
|
// enter render function
|
|
const functionName = ssr ? `ssrRender` : `render`;
|
|
const args = ssr ? ['_ctx', '_push', '_parent', '_attrs'] : ['_ctx', '_cache'];
|
|
const signature = args.join(', ');
|
|
{
|
|
push(`function ${functionName}(${signature}) {`);
|
|
}
|
|
indent();
|
|
if (useWithBlock) {
|
|
push(`with (_ctx) {`);
|
|
indent();
|
|
// function mode const declarations should be inside with block
|
|
// also they should be renamed to avoid collision with user properties
|
|
if (hasHelpers) {
|
|
push(`const { ${ast.helpers
|
|
.map(s => `${helperNameMap[s]}: _${helperNameMap[s]}`)
|
|
.join(', ')} } = _Vue`);
|
|
push(`\n`);
|
|
newline();
|
|
}
|
|
}
|
|
// generate asset resolution statements
|
|
if (ast.components.length) {
|
|
genAssets(ast.components, 'component', context);
|
|
if (ast.directives.length || ast.temps > 0) {
|
|
newline();
|
|
}
|
|
}
|
|
if (ast.directives.length) {
|
|
genAssets(ast.directives, 'directive', context);
|
|
if (ast.temps > 0) {
|
|
newline();
|
|
}
|
|
}
|
|
if (ast.filters && ast.filters.length) {
|
|
newline();
|
|
genAssets(ast.filters, 'filter', context);
|
|
newline();
|
|
}
|
|
if (ast.temps > 0) {
|
|
push(`let `);
|
|
for (let i = 0; i < ast.temps; i++) {
|
|
push(`${i > 0 ? `, ` : ``}_temp${i}`);
|
|
}
|
|
}
|
|
if (ast.components.length || ast.directives.length || ast.temps) {
|
|
push(`\n`);
|
|
newline();
|
|
}
|
|
// generate the VNode tree expression
|
|
if (!ssr) {
|
|
push(`return `);
|
|
}
|
|
if (ast.codegenNode) {
|
|
genNode(ast.codegenNode, context);
|
|
}
|
|
else {
|
|
push(`null`);
|
|
}
|
|
if (useWithBlock) {
|
|
deindent();
|
|
push(`}`);
|
|
}
|
|
deindent();
|
|
push(`}`);
|
|
return {
|
|
ast,
|
|
code: context.code,
|
|
preamble: ``,
|
|
// SourceMapGenerator does have toJSON() method but it's not in the types
|
|
map: context.map ? context.map.toJSON() : undefined
|
|
};
|
|
}
|
|
function genFunctionPreamble(ast, context) {
|
|
const { ssr, prefixIdentifiers, push, newline, runtimeModuleName, runtimeGlobalName } = context;
|
|
const VueBinding = runtimeGlobalName;
|
|
const aliasHelper = (s) => `${helperNameMap[s]}: _${helperNameMap[s]}`;
|
|
// Generate const declaration for helpers
|
|
// In prefix mode, we place the const declaration at top so it's done
|
|
// only once; But if we not prefixing, we place the declaration inside the
|
|
// with block so it doesn't incur the `in` check cost for every helper access.
|
|
if (ast.helpers.length > 0) {
|
|
{
|
|
// "with" mode.
|
|
// save Vue in a separate variable to avoid collision
|
|
push(`const _Vue = ${VueBinding}\n`);
|
|
// in "with" mode, helpers are declared inside the with block to avoid
|
|
// has check cost, but hoists are lifted out of the function - we need
|
|
// to provide the helper here.
|
|
if (ast.hoists.length) {
|
|
const staticHelpers = [
|
|
CREATE_VNODE,
|
|
CREATE_ELEMENT_VNODE,
|
|
CREATE_COMMENT,
|
|
CREATE_TEXT,
|
|
CREATE_STATIC
|
|
]
|
|
.filter(helper => ast.helpers.includes(helper))
|
|
.map(aliasHelper)
|
|
.join(', ');
|
|
push(`const { ${staticHelpers} } = _Vue\n`);
|
|
}
|
|
}
|
|
}
|
|
genHoists(ast.hoists, context);
|
|
newline();
|
|
push(`return `);
|
|
}
|
|
function genAssets(assets, type, { helper, push, newline, isTS }) {
|
|
const resolver = helper(type === 'filter'
|
|
? RESOLVE_FILTER
|
|
: type === 'component'
|
|
? RESOLVE_COMPONENT
|
|
: RESOLVE_DIRECTIVE);
|
|
for (let i = 0; i < assets.length; i++) {
|
|
let id = assets[i];
|
|
// potential component implicit self-reference inferred from SFC filename
|
|
const maybeSelfReference = id.endsWith('__self');
|
|
if (maybeSelfReference) {
|
|
id = id.slice(0, -6);
|
|
}
|
|
push(`const ${toValidAssetId(id, type)} = ${resolver}(${JSON.stringify(id)}${maybeSelfReference ? `, true` : ``})${isTS ? `!` : ``}`);
|
|
if (i < assets.length - 1) {
|
|
newline();
|
|
}
|
|
}
|
|
}
|
|
function genHoists(hoists, context) {
|
|
if (!hoists.length) {
|
|
return;
|
|
}
|
|
context.pure = true;
|
|
const { push, newline, helper, scopeId, mode } = context;
|
|
newline();
|
|
hoists.forEach((exp, i) => {
|
|
if (exp) {
|
|
push(`const _hoisted_${i + 1} = `);
|
|
genNode(exp, context);
|
|
newline();
|
|
}
|
|
});
|
|
context.pure = false;
|
|
}
|
|
function isText$1(n) {
|
|
return ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(n) ||
|
|
n.type === 4 /* SIMPLE_EXPRESSION */ ||
|
|
n.type === 2 /* TEXT */ ||
|
|
n.type === 5 /* INTERPOLATION */ ||
|
|
n.type === 8 /* COMPOUND_EXPRESSION */);
|
|
}
|
|
function genNodeListAsArray(nodes, context) {
|
|
const multilines = nodes.length > 3 ||
|
|
((( true)) && nodes.some(n => (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(n) || !isText$1(n)));
|
|
context.push(`[`);
|
|
multilines && context.indent();
|
|
genNodeList(nodes, context, multilines);
|
|
multilines && context.deindent();
|
|
context.push(`]`);
|
|
}
|
|
function genNodeList(nodes, context, multilines = false, comma = true) {
|
|
const { push, newline } = context;
|
|
for (let i = 0; i < nodes.length; i++) {
|
|
const node = nodes[i];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(node)) {
|
|
push(node);
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(node)) {
|
|
genNodeListAsArray(node, context);
|
|
}
|
|
else {
|
|
genNode(node, context);
|
|
}
|
|
if (i < nodes.length - 1) {
|
|
if (multilines) {
|
|
comma && push(',');
|
|
newline();
|
|
}
|
|
else {
|
|
comma && push(', ');
|
|
}
|
|
}
|
|
}
|
|
}
|
|
function genNode(node, context) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(node)) {
|
|
context.push(node);
|
|
return;
|
|
}
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isSymbol)(node)) {
|
|
context.push(context.helper(node));
|
|
return;
|
|
}
|
|
switch (node.type) {
|
|
case 1 /* ELEMENT */:
|
|
case 9 /* IF */:
|
|
case 11 /* FOR */:
|
|
( true) &&
|
|
assert(node.codegenNode != null, `Codegen node is missing for element/if/for node. ` +
|
|
`Apply appropriate transforms first.`);
|
|
genNode(node.codegenNode, context);
|
|
break;
|
|
case 2 /* TEXT */:
|
|
genText(node, context);
|
|
break;
|
|
case 4 /* SIMPLE_EXPRESSION */:
|
|
genExpression(node, context);
|
|
break;
|
|
case 5 /* INTERPOLATION */:
|
|
genInterpolation(node, context);
|
|
break;
|
|
case 12 /* TEXT_CALL */:
|
|
genNode(node.codegenNode, context);
|
|
break;
|
|
case 8 /* COMPOUND_EXPRESSION */:
|
|
genCompoundExpression(node, context);
|
|
break;
|
|
case 3 /* COMMENT */:
|
|
genComment(node, context);
|
|
break;
|
|
case 13 /* VNODE_CALL */:
|
|
genVNodeCall(node, context);
|
|
break;
|
|
case 14 /* JS_CALL_EXPRESSION */:
|
|
genCallExpression(node, context);
|
|
break;
|
|
case 15 /* JS_OBJECT_EXPRESSION */:
|
|
genObjectExpression(node, context);
|
|
break;
|
|
case 17 /* JS_ARRAY_EXPRESSION */:
|
|
genArrayExpression(node, context);
|
|
break;
|
|
case 18 /* JS_FUNCTION_EXPRESSION */:
|
|
genFunctionExpression(node, context);
|
|
break;
|
|
case 19 /* JS_CONDITIONAL_EXPRESSION */:
|
|
genConditionalExpression(node, context);
|
|
break;
|
|
case 20 /* JS_CACHE_EXPRESSION */:
|
|
genCacheExpression(node, context);
|
|
break;
|
|
case 21 /* JS_BLOCK_STATEMENT */:
|
|
genNodeList(node.body, context, true, false);
|
|
break;
|
|
// SSR only types
|
|
case 22 /* JS_TEMPLATE_LITERAL */:
|
|
break;
|
|
case 23 /* JS_IF_STATEMENT */:
|
|
break;
|
|
case 24 /* JS_ASSIGNMENT_EXPRESSION */:
|
|
break;
|
|
case 25 /* JS_SEQUENCE_EXPRESSION */:
|
|
break;
|
|
case 26 /* JS_RETURN_STATEMENT */:
|
|
break;
|
|
/* istanbul ignore next */
|
|
case 10 /* IF_BRANCH */:
|
|
// noop
|
|
break;
|
|
default:
|
|
if ((true)) {
|
|
assert(false, `unhandled codegen node type: ${node.type}`);
|
|
// make sure we exhaust all possible types
|
|
const exhaustiveCheck = node;
|
|
return exhaustiveCheck;
|
|
}
|
|
}
|
|
}
|
|
function genText(node, context) {
|
|
context.push(JSON.stringify(node.content), node);
|
|
}
|
|
function genExpression(node, context) {
|
|
const { content, isStatic } = node;
|
|
context.push(isStatic ? JSON.stringify(content) : content, node);
|
|
}
|
|
function genInterpolation(node, context) {
|
|
const { push, helper, pure } = context;
|
|
if (pure)
|
|
push(PURE_ANNOTATION);
|
|
push(`${helper(TO_DISPLAY_STRING)}(`);
|
|
genNode(node.content, context);
|
|
push(`)`);
|
|
}
|
|
function genCompoundExpression(node, context) {
|
|
for (let i = 0; i < node.children.length; i++) {
|
|
const child = node.children[i];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(child)) {
|
|
context.push(child);
|
|
}
|
|
else {
|
|
genNode(child, context);
|
|
}
|
|
}
|
|
}
|
|
function genExpressionAsPropertyKey(node, context) {
|
|
const { push } = context;
|
|
if (node.type === 8 /* COMPOUND_EXPRESSION */) {
|
|
push(`[`);
|
|
genCompoundExpression(node, context);
|
|
push(`]`);
|
|
}
|
|
else if (node.isStatic) {
|
|
// only quote keys if necessary
|
|
const text = isSimpleIdentifier(node.content)
|
|
? node.content
|
|
: JSON.stringify(node.content);
|
|
push(text, node);
|
|
}
|
|
else {
|
|
push(`[${node.content}]`, node);
|
|
}
|
|
}
|
|
function genComment(node, context) {
|
|
const { push, helper, pure } = context;
|
|
if (pure) {
|
|
push(PURE_ANNOTATION);
|
|
}
|
|
push(`${helper(CREATE_COMMENT)}(${JSON.stringify(node.content)})`, node);
|
|
}
|
|
function genVNodeCall(node, context) {
|
|
const { push, helper, pure } = context;
|
|
const { tag, props, children, patchFlag, dynamicProps, directives, isBlock, disableTracking, isComponent } = node;
|
|
if (directives) {
|
|
push(helper(WITH_DIRECTIVES) + `(`);
|
|
}
|
|
if (isBlock) {
|
|
push(`(${helper(OPEN_BLOCK)}(${disableTracking ? `true` : ``}), `);
|
|
}
|
|
if (pure) {
|
|
push(PURE_ANNOTATION);
|
|
}
|
|
const callHelper = isBlock
|
|
? getVNodeBlockHelper(context.inSSR, isComponent)
|
|
: getVNodeHelper(context.inSSR, isComponent);
|
|
push(helper(callHelper) + `(`, node);
|
|
genNodeList(genNullableArgs([tag, props, children, patchFlag, dynamicProps]), context);
|
|
push(`)`);
|
|
if (isBlock) {
|
|
push(`)`);
|
|
}
|
|
if (directives) {
|
|
push(`, `);
|
|
genNode(directives, context);
|
|
push(`)`);
|
|
}
|
|
}
|
|
function genNullableArgs(args) {
|
|
let i = args.length;
|
|
while (i--) {
|
|
if (args[i] != null)
|
|
break;
|
|
}
|
|
return args.slice(0, i + 1).map(arg => arg || `null`);
|
|
}
|
|
// JavaScript
|
|
function genCallExpression(node, context) {
|
|
const { push, helper, pure } = context;
|
|
const callee = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(node.callee) ? node.callee : helper(node.callee);
|
|
if (pure) {
|
|
push(PURE_ANNOTATION);
|
|
}
|
|
push(callee + `(`, node);
|
|
genNodeList(node.arguments, context);
|
|
push(`)`);
|
|
}
|
|
function genObjectExpression(node, context) {
|
|
const { push, indent, deindent, newline } = context;
|
|
const { properties } = node;
|
|
if (!properties.length) {
|
|
push(`{}`, node);
|
|
return;
|
|
}
|
|
const multilines = properties.length > 1 ||
|
|
((( true)) &&
|
|
properties.some(p => p.value.type !== 4 /* SIMPLE_EXPRESSION */));
|
|
push(multilines ? `{` : `{ `);
|
|
multilines && indent();
|
|
for (let i = 0; i < properties.length; i++) {
|
|
const { key, value } = properties[i];
|
|
// key
|
|
genExpressionAsPropertyKey(key, context);
|
|
push(`: `);
|
|
// value
|
|
genNode(value, context);
|
|
if (i < properties.length - 1) {
|
|
// will only reach this if it's multilines
|
|
push(`,`);
|
|
newline();
|
|
}
|
|
}
|
|
multilines && deindent();
|
|
push(multilines ? `}` : ` }`);
|
|
}
|
|
function genArrayExpression(node, context) {
|
|
genNodeListAsArray(node.elements, context);
|
|
}
|
|
function genFunctionExpression(node, context) {
|
|
const { push, indent, deindent } = context;
|
|
const { params, returns, body, newline, isSlot } = node;
|
|
if (isSlot) {
|
|
// wrap slot functions with owner context
|
|
push(`_${helperNameMap[WITH_CTX]}(`);
|
|
}
|
|
push(`(`, node);
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(params)) {
|
|
genNodeList(params, context);
|
|
}
|
|
else if (params) {
|
|
genNode(params, context);
|
|
}
|
|
push(`) => `);
|
|
if (newline || body) {
|
|
push(`{`);
|
|
indent();
|
|
}
|
|
if (returns) {
|
|
if (newline) {
|
|
push(`return `);
|
|
}
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(returns)) {
|
|
genNodeListAsArray(returns, context);
|
|
}
|
|
else {
|
|
genNode(returns, context);
|
|
}
|
|
}
|
|
else if (body) {
|
|
genNode(body, context);
|
|
}
|
|
if (newline || body) {
|
|
deindent();
|
|
push(`}`);
|
|
}
|
|
if (isSlot) {
|
|
if (node.isNonScopedSlot) {
|
|
push(`, undefined, true`);
|
|
}
|
|
push(`)`);
|
|
}
|
|
}
|
|
function genConditionalExpression(node, context) {
|
|
const { test, consequent, alternate, newline: needNewline } = node;
|
|
const { push, indent, deindent, newline } = context;
|
|
if (test.type === 4 /* SIMPLE_EXPRESSION */) {
|
|
const needsParens = !isSimpleIdentifier(test.content);
|
|
needsParens && push(`(`);
|
|
genExpression(test, context);
|
|
needsParens && push(`)`);
|
|
}
|
|
else {
|
|
push(`(`);
|
|
genNode(test, context);
|
|
push(`)`);
|
|
}
|
|
needNewline && indent();
|
|
context.indentLevel++;
|
|
needNewline || push(` `);
|
|
push(`? `);
|
|
genNode(consequent, context);
|
|
context.indentLevel--;
|
|
needNewline && newline();
|
|
needNewline || push(` `);
|
|
push(`: `);
|
|
const isNested = alternate.type === 19 /* JS_CONDITIONAL_EXPRESSION */;
|
|
if (!isNested) {
|
|
context.indentLevel++;
|
|
}
|
|
genNode(alternate, context);
|
|
if (!isNested) {
|
|
context.indentLevel--;
|
|
}
|
|
needNewline && deindent(true /* without newline */);
|
|
}
|
|
function genCacheExpression(node, context) {
|
|
const { push, helper, indent, deindent, newline } = context;
|
|
push(`_cache[${node.index}] || (`);
|
|
if (node.isVNode) {
|
|
indent();
|
|
push(`${helper(SET_BLOCK_TRACKING)}(-1),`);
|
|
newline();
|
|
}
|
|
push(`_cache[${node.index}] = `);
|
|
genNode(node.value, context);
|
|
if (node.isVNode) {
|
|
push(`,`);
|
|
newline();
|
|
push(`${helper(SET_BLOCK_TRACKING)}(1),`);
|
|
newline();
|
|
push(`_cache[${node.index}]`);
|
|
deindent();
|
|
}
|
|
push(`)`);
|
|
}
|
|
|
|
function walkIdentifiers(root, onIdentifier, includeAll = false, parentStack = [], knownIds = Object.create(null)) {
|
|
{
|
|
return;
|
|
}
|
|
}
|
|
function isReferencedIdentifier(id, parent, parentStack) {
|
|
{
|
|
return false;
|
|
}
|
|
}
|
|
function isInDestructureAssignment(parent, parentStack) {
|
|
if (parent &&
|
|
(parent.type === 'ObjectProperty' || parent.type === 'ArrayPattern')) {
|
|
let i = parentStack.length;
|
|
while (i--) {
|
|
const p = parentStack[i];
|
|
if (p.type === 'AssignmentExpression') {
|
|
return true;
|
|
}
|
|
else if (p.type !== 'ObjectProperty' && !p.type.endsWith('Pattern')) {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
function walkFunctionParams(node, onIdent) {
|
|
for (const p of node.params) {
|
|
for (const id of extractIdentifiers(p)) {
|
|
onIdent(id);
|
|
}
|
|
}
|
|
}
|
|
function walkBlockDeclarations(block, onIdent) {
|
|
for (const stmt of block.body) {
|
|
if (stmt.type === 'VariableDeclaration') {
|
|
if (stmt.declare)
|
|
continue;
|
|
for (const decl of stmt.declarations) {
|
|
for (const id of extractIdentifiers(decl.id)) {
|
|
onIdent(id);
|
|
}
|
|
}
|
|
}
|
|
else if (stmt.type === 'FunctionDeclaration' ||
|
|
stmt.type === 'ClassDeclaration') {
|
|
if (stmt.declare || !stmt.id)
|
|
continue;
|
|
onIdent(stmt.id);
|
|
}
|
|
}
|
|
}
|
|
function extractIdentifiers(param, nodes = []) {
|
|
switch (param.type) {
|
|
case 'Identifier':
|
|
nodes.push(param);
|
|
break;
|
|
case 'MemberExpression':
|
|
let object = param;
|
|
while (object.type === 'MemberExpression') {
|
|
object = object.object;
|
|
}
|
|
nodes.push(object);
|
|
break;
|
|
case 'ObjectPattern':
|
|
for (const prop of param.properties) {
|
|
if (prop.type === 'RestElement') {
|
|
extractIdentifiers(prop.argument, nodes);
|
|
}
|
|
else {
|
|
extractIdentifiers(prop.value, nodes);
|
|
}
|
|
}
|
|
break;
|
|
case 'ArrayPattern':
|
|
param.elements.forEach(element => {
|
|
if (element)
|
|
extractIdentifiers(element, nodes);
|
|
});
|
|
break;
|
|
case 'RestElement':
|
|
extractIdentifiers(param.argument, nodes);
|
|
break;
|
|
case 'AssignmentPattern':
|
|
extractIdentifiers(param.left, nodes);
|
|
break;
|
|
}
|
|
return nodes;
|
|
}
|
|
const isFunctionType = (node) => {
|
|
return /Function(?:Expression|Declaration)$|Method$/.test(node.type);
|
|
};
|
|
const isStaticProperty = (node) => node &&
|
|
(node.type === 'ObjectProperty' || node.type === 'ObjectMethod') &&
|
|
!node.computed;
|
|
const isStaticPropertyKey = (node, parent) => isStaticProperty(parent) && parent.key === node;
|
|
|
|
// these keywords should not appear inside expressions, but operators like
|
|
// typeof, instanceof and in are allowed
|
|
const prohibitedKeywordRE = new RegExp('\\b' +
|
|
('do,if,for,let,new,try,var,case,else,with,await,break,catch,class,const,' +
|
|
'super,throw,while,yield,delete,export,import,return,switch,default,' +
|
|
'extends,finally,continue,debugger,function,arguments,typeof,void')
|
|
.split(',')
|
|
.join('\\b|\\b') +
|
|
'\\b');
|
|
// strip strings in expressions
|
|
const stripStringRE = /'(?:[^'\\]|\\.)*'|"(?:[^"\\]|\\.)*"|`(?:[^`\\]|\\.)*\$\{|\}(?:[^`\\]|\\.)*`|`(?:[^`\\]|\\.)*`/g;
|
|
/**
|
|
* Validate a non-prefixed expression.
|
|
* This is only called when using the in-browser runtime compiler since it
|
|
* doesn't prefix expressions.
|
|
*/
|
|
function validateBrowserExpression(node, context, asParams = false, asRawStatements = false) {
|
|
const exp = node.content;
|
|
// empty expressions are validated per-directive since some directives
|
|
// do allow empty expressions.
|
|
if (!exp.trim()) {
|
|
return;
|
|
}
|
|
try {
|
|
new Function(asRawStatements
|
|
? ` ${exp} `
|
|
: `return ${asParams ? `(${exp}) => {}` : `(${exp})`}`);
|
|
}
|
|
catch (e) {
|
|
let message = e.message;
|
|
const keywordMatch = exp
|
|
.replace(stripStringRE, '')
|
|
.match(prohibitedKeywordRE);
|
|
if (keywordMatch) {
|
|
message = `avoid using JavaScript keyword as property name: "${keywordMatch[0]}"`;
|
|
}
|
|
context.onError(createCompilerError(43 /* X_INVALID_EXPRESSION */, node.loc, undefined, message));
|
|
}
|
|
}
|
|
|
|
const transformExpression = (node, context) => {
|
|
if (node.type === 5 /* INTERPOLATION */) {
|
|
node.content = processExpression(node.content, context);
|
|
}
|
|
else if (node.type === 1 /* ELEMENT */) {
|
|
// handle directives on element
|
|
for (let i = 0; i < node.props.length; i++) {
|
|
const dir = node.props[i];
|
|
// do not process for v-on & v-for since they are special handled
|
|
if (dir.type === 7 /* DIRECTIVE */ && dir.name !== 'for') {
|
|
const exp = dir.exp;
|
|
const arg = dir.arg;
|
|
// do not process exp if this is v-on:arg - we need special handling
|
|
// for wrapping inline statements.
|
|
if (exp &&
|
|
exp.type === 4 /* SIMPLE_EXPRESSION */ &&
|
|
!(dir.name === 'on' && arg)) {
|
|
dir.exp = processExpression(exp, context,
|
|
// slot args must be processed as function params
|
|
dir.name === 'slot');
|
|
}
|
|
if (arg && arg.type === 4 /* SIMPLE_EXPRESSION */ && !arg.isStatic) {
|
|
dir.arg = processExpression(arg, context);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
};
|
|
// Important: since this function uses Node.js only dependencies, it should
|
|
// always be used with a leading !true check so that it can be
|
|
// tree-shaken from the browser build.
|
|
function processExpression(node, context,
|
|
// some expressions like v-slot props & v-for aliases should be parsed as
|
|
// function params
|
|
asParams = false,
|
|
// v-on handler values may contain multiple statements
|
|
asRawStatements = false) {
|
|
{
|
|
if ((true)) {
|
|
// simple in-browser validation (same logic in 2.x)
|
|
validateBrowserExpression(node, context, asParams, asRawStatements);
|
|
}
|
|
return node;
|
|
}
|
|
}
|
|
|
|
const transformIf = createStructuralDirectiveTransform(/^(if|else|else-if)$/, (node, dir, context) => {
|
|
return processIf(node, dir, context, (ifNode, branch, isRoot) => {
|
|
// #1587: We need to dynamically increment the key based on the current
|
|
// node's sibling nodes, since chained v-if/else branches are
|
|
// rendered at the same depth
|
|
const siblings = context.parent.children;
|
|
let i = siblings.indexOf(ifNode);
|
|
let key = 0;
|
|
while (i-- >= 0) {
|
|
const sibling = siblings[i];
|
|
if (sibling && sibling.type === 9 /* IF */) {
|
|
key += sibling.branches.length;
|
|
}
|
|
}
|
|
// Exit callback. Complete the codegenNode when all children have been
|
|
// transformed.
|
|
return () => {
|
|
if (isRoot) {
|
|
ifNode.codegenNode = createCodegenNodeForBranch(branch, key, context);
|
|
}
|
|
else {
|
|
// attach this branch's codegen node to the v-if root.
|
|
const parentCondition = getParentCondition(ifNode.codegenNode);
|
|
parentCondition.alternate = createCodegenNodeForBranch(branch, key + ifNode.branches.length - 1, context);
|
|
}
|
|
};
|
|
});
|
|
});
|
|
// target-agnostic transform used for both Client and SSR
|
|
function processIf(node, dir, context, processCodegen) {
|
|
if (dir.name !== 'else' &&
|
|
(!dir.exp || !dir.exp.content.trim())) {
|
|
const loc = dir.exp ? dir.exp.loc : node.loc;
|
|
context.onError(createCompilerError(27 /* X_V_IF_NO_EXPRESSION */, dir.loc));
|
|
dir.exp = createSimpleExpression(`true`, false, loc);
|
|
}
|
|
if ( true && dir.exp) {
|
|
validateBrowserExpression(dir.exp, context);
|
|
}
|
|
if (dir.name === 'if') {
|
|
const branch = createIfBranch(node, dir);
|
|
const ifNode = {
|
|
type: 9 /* IF */,
|
|
loc: node.loc,
|
|
branches: [branch]
|
|
};
|
|
context.replaceNode(ifNode);
|
|
if (processCodegen) {
|
|
return processCodegen(ifNode, branch, true);
|
|
}
|
|
}
|
|
else {
|
|
// locate the adjacent v-if
|
|
const siblings = context.parent.children;
|
|
const comments = [];
|
|
let i = siblings.indexOf(node);
|
|
while (i-- >= -1) {
|
|
const sibling = siblings[i];
|
|
if (( true) && sibling && sibling.type === 3 /* COMMENT */) {
|
|
context.removeNode(sibling);
|
|
comments.unshift(sibling);
|
|
continue;
|
|
}
|
|
if (sibling &&
|
|
sibling.type === 2 /* TEXT */ &&
|
|
!sibling.content.trim().length) {
|
|
context.removeNode(sibling);
|
|
continue;
|
|
}
|
|
if (sibling && sibling.type === 9 /* IF */) {
|
|
// move the node to the if node's branches
|
|
context.removeNode();
|
|
const branch = createIfBranch(node, dir);
|
|
if (( true) &&
|
|
comments.length &&
|
|
// #3619 ignore comments if the v-if is direct child of <transition>
|
|
!(context.parent &&
|
|
context.parent.type === 1 /* ELEMENT */ &&
|
|
isBuiltInType(context.parent.tag, 'transition'))) {
|
|
branch.children = [...comments, ...branch.children];
|
|
}
|
|
// check if user is forcing same key on different branches
|
|
if (true) {
|
|
const key = branch.userKey;
|
|
if (key) {
|
|
sibling.branches.forEach(({ userKey }) => {
|
|
if (isSameKey(userKey, key)) {
|
|
context.onError(createCompilerError(28 /* X_V_IF_SAME_KEY */, branch.userKey.loc));
|
|
}
|
|
});
|
|
}
|
|
}
|
|
sibling.branches.push(branch);
|
|
const onExit = processCodegen && processCodegen(sibling, branch, false);
|
|
// since the branch was removed, it will not be traversed.
|
|
// make sure to traverse here.
|
|
traverseNode(branch, context);
|
|
// call on exit
|
|
if (onExit)
|
|
onExit();
|
|
// make sure to reset currentNode after traversal to indicate this
|
|
// node has been removed.
|
|
context.currentNode = null;
|
|
}
|
|
else {
|
|
context.onError(createCompilerError(29 /* X_V_ELSE_NO_ADJACENT_IF */, node.loc));
|
|
}
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
function createIfBranch(node, dir) {
|
|
return {
|
|
type: 10 /* IF_BRANCH */,
|
|
loc: node.loc,
|
|
condition: dir.name === 'else' ? undefined : dir.exp,
|
|
children: node.tagType === 3 /* TEMPLATE */ && !findDir(node, 'for')
|
|
? node.children
|
|
: [node],
|
|
userKey: findProp(node, `key`)
|
|
};
|
|
}
|
|
function createCodegenNodeForBranch(branch, keyIndex, context) {
|
|
if (branch.condition) {
|
|
return createConditionalExpression(branch.condition, createChildrenCodegenNode(branch, keyIndex, context),
|
|
// make sure to pass in asBlock: true so that the comment node call
|
|
// closes the current block.
|
|
createCallExpression(context.helper(CREATE_COMMENT), [
|
|
( true) ? '"v-if"' : 0,
|
|
'true'
|
|
]));
|
|
}
|
|
else {
|
|
return createChildrenCodegenNode(branch, keyIndex, context);
|
|
}
|
|
}
|
|
function createChildrenCodegenNode(branch, keyIndex, context) {
|
|
const { helper } = context;
|
|
const keyProperty = createObjectProperty(`key`, createSimpleExpression(`${keyIndex}`, false, locStub, 2 /* CAN_HOIST */));
|
|
const { children } = branch;
|
|
const firstChild = children[0];
|
|
const needFragmentWrapper = children.length !== 1 || firstChild.type !== 1 /* ELEMENT */;
|
|
if (needFragmentWrapper) {
|
|
if (children.length === 1 && firstChild.type === 11 /* FOR */) {
|
|
// optimize away nested fragments when child is a ForNode
|
|
const vnodeCall = firstChild.codegenNode;
|
|
injectProp(vnodeCall, keyProperty, context);
|
|
return vnodeCall;
|
|
}
|
|
else {
|
|
let patchFlag = 64 /* STABLE_FRAGMENT */;
|
|
let patchFlagText = _vue_shared__WEBPACK_IMPORTED_MODULE_0__.PatchFlagNames[64];
|
|
// check if the fragment actually contains a single valid child with
|
|
// the rest being comments
|
|
if (( true) &&
|
|
children.filter(c => c.type !== 3 /* COMMENT */).length === 1) {
|
|
patchFlag |= 2048 /* DEV_ROOT_FRAGMENT */;
|
|
patchFlagText += `, ${_vue_shared__WEBPACK_IMPORTED_MODULE_0__.PatchFlagNames[2048]}`;
|
|
}
|
|
return createVNodeCall(context, helper(FRAGMENT), createObjectExpression([keyProperty]), children, patchFlag + (( true) ? ` /* ${patchFlagText} */` : 0), undefined, undefined, true, false, false /* isComponent */, branch.loc);
|
|
}
|
|
}
|
|
else {
|
|
const ret = firstChild.codegenNode;
|
|
const vnodeCall = getMemoedVNodeCall(ret);
|
|
// Change createVNode to createBlock.
|
|
if (vnodeCall.type === 13 /* VNODE_CALL */) {
|
|
makeBlock(vnodeCall, context);
|
|
}
|
|
// inject branch key
|
|
injectProp(vnodeCall, keyProperty, context);
|
|
return ret;
|
|
}
|
|
}
|
|
function isSameKey(a, b) {
|
|
if (!a || a.type !== b.type) {
|
|
return false;
|
|
}
|
|
if (a.type === 6 /* ATTRIBUTE */) {
|
|
if (a.value.content !== b.value.content) {
|
|
return false;
|
|
}
|
|
}
|
|
else {
|
|
// directive
|
|
const exp = a.exp;
|
|
const branchExp = b.exp;
|
|
if (exp.type !== branchExp.type) {
|
|
return false;
|
|
}
|
|
if (exp.type !== 4 /* SIMPLE_EXPRESSION */ ||
|
|
exp.isStatic !== branchExp.isStatic ||
|
|
exp.content !== branchExp.content) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
function getParentCondition(node) {
|
|
while (true) {
|
|
if (node.type === 19 /* JS_CONDITIONAL_EXPRESSION */) {
|
|
if (node.alternate.type === 19 /* JS_CONDITIONAL_EXPRESSION */) {
|
|
node = node.alternate;
|
|
}
|
|
else {
|
|
return node;
|
|
}
|
|
}
|
|
else if (node.type === 20 /* JS_CACHE_EXPRESSION */) {
|
|
node = node.value;
|
|
}
|
|
}
|
|
}
|
|
|
|
const transformFor = createStructuralDirectiveTransform('for', (node, dir, context) => {
|
|
const { helper, removeHelper } = context;
|
|
return processFor(node, dir, context, forNode => {
|
|
// create the loop render function expression now, and add the
|
|
// iterator on exit after all children have been traversed
|
|
const renderExp = createCallExpression(helper(RENDER_LIST), [
|
|
forNode.source
|
|
]);
|
|
const memo = findDir(node, 'memo');
|
|
const keyProp = findProp(node, `key`);
|
|
const keyExp = keyProp &&
|
|
(keyProp.type === 6 /* ATTRIBUTE */
|
|
? createSimpleExpression(keyProp.value.content, true)
|
|
: keyProp.exp);
|
|
const keyProperty = keyProp ? createObjectProperty(`key`, keyExp) : null;
|
|
const isStableFragment = forNode.source.type === 4 /* SIMPLE_EXPRESSION */ &&
|
|
forNode.source.constType > 0 /* NOT_CONSTANT */;
|
|
const fragmentFlag = isStableFragment
|
|
? 64 /* STABLE_FRAGMENT */
|
|
: keyProp
|
|
? 128 /* KEYED_FRAGMENT */
|
|
: 256 /* UNKEYED_FRAGMENT */;
|
|
forNode.codegenNode = createVNodeCall(context, helper(FRAGMENT), undefined, renderExp, fragmentFlag +
|
|
(( true) ? ` /* ${_vue_shared__WEBPACK_IMPORTED_MODULE_0__.PatchFlagNames[fragmentFlag]} */` : 0), undefined, undefined, true /* isBlock */, !isStableFragment /* disableTracking */, false /* isComponent */, node.loc);
|
|
return () => {
|
|
// finish the codegen now that all children have been traversed
|
|
let childBlock;
|
|
const isTemplate = isTemplateNode(node);
|
|
const { children } = forNode;
|
|
// check <template v-for> key placement
|
|
if (( true) && isTemplate) {
|
|
node.children.some(c => {
|
|
if (c.type === 1 /* ELEMENT */) {
|
|
const key = findProp(c, 'key');
|
|
if (key) {
|
|
context.onError(createCompilerError(32 /* X_V_FOR_TEMPLATE_KEY_PLACEMENT */, key.loc));
|
|
return true;
|
|
}
|
|
}
|
|
});
|
|
}
|
|
const needFragmentWrapper = children.length !== 1 || children[0].type !== 1 /* ELEMENT */;
|
|
const slotOutlet = isSlotOutlet(node)
|
|
? node
|
|
: isTemplate &&
|
|
node.children.length === 1 &&
|
|
isSlotOutlet(node.children[0])
|
|
? node.children[0] // api-extractor somehow fails to infer this
|
|
: null;
|
|
if (slotOutlet) {
|
|
// <slot v-for="..."> or <template v-for="..."><slot/></template>
|
|
childBlock = slotOutlet.codegenNode;
|
|
if (isTemplate && keyProperty) {
|
|
// <template v-for="..." :key="..."><slot/></template>
|
|
// we need to inject the key to the renderSlot() call.
|
|
// the props for renderSlot is passed as the 3rd argument.
|
|
injectProp(childBlock, keyProperty, context);
|
|
}
|
|
}
|
|
else if (needFragmentWrapper) {
|
|
// <template v-for="..."> with text or multi-elements
|
|
// should generate a fragment block for each loop
|
|
childBlock = createVNodeCall(context, helper(FRAGMENT), keyProperty ? createObjectExpression([keyProperty]) : undefined, node.children, 64 /* STABLE_FRAGMENT */ +
|
|
(( true)
|
|
? ` /* ${_vue_shared__WEBPACK_IMPORTED_MODULE_0__.PatchFlagNames[64]} */`
|
|
: 0), undefined, undefined, true, undefined, false /* isComponent */);
|
|
}
|
|
else {
|
|
// Normal element v-for. Directly use the child's codegenNode
|
|
// but mark it as a block.
|
|
childBlock = children[0]
|
|
.codegenNode;
|
|
if (isTemplate && keyProperty) {
|
|
injectProp(childBlock, keyProperty, context);
|
|
}
|
|
if (childBlock.isBlock !== !isStableFragment) {
|
|
if (childBlock.isBlock) {
|
|
// switch from block to vnode
|
|
removeHelper(OPEN_BLOCK);
|
|
removeHelper(getVNodeBlockHelper(context.inSSR, childBlock.isComponent));
|
|
}
|
|
else {
|
|
// switch from vnode to block
|
|
removeHelper(getVNodeHelper(context.inSSR, childBlock.isComponent));
|
|
}
|
|
}
|
|
childBlock.isBlock = !isStableFragment;
|
|
if (childBlock.isBlock) {
|
|
helper(OPEN_BLOCK);
|
|
helper(getVNodeBlockHelper(context.inSSR, childBlock.isComponent));
|
|
}
|
|
else {
|
|
helper(getVNodeHelper(context.inSSR, childBlock.isComponent));
|
|
}
|
|
}
|
|
if (memo) {
|
|
const loop = createFunctionExpression(createForLoopParams(forNode.parseResult, [
|
|
createSimpleExpression(`_cached`)
|
|
]));
|
|
loop.body = createBlockStatement([
|
|
createCompoundExpression([`const _memo = (`, memo.exp, `)`]),
|
|
createCompoundExpression([
|
|
`if (_cached`,
|
|
...(keyExp ? [` && _cached.key === `, keyExp] : []),
|
|
` && ${context.helperString(IS_MEMO_SAME)}(_cached, _memo)) return _cached`
|
|
]),
|
|
createCompoundExpression([`const _item = `, childBlock]),
|
|
createSimpleExpression(`_item.memo = _memo`),
|
|
createSimpleExpression(`return _item`)
|
|
]);
|
|
renderExp.arguments.push(loop, createSimpleExpression(`_cache`), createSimpleExpression(String(context.cached++)));
|
|
}
|
|
else {
|
|
renderExp.arguments.push(createFunctionExpression(createForLoopParams(forNode.parseResult), childBlock, true /* force newline */));
|
|
}
|
|
};
|
|
});
|
|
});
|
|
// target-agnostic transform used for both Client and SSR
|
|
function processFor(node, dir, context, processCodegen) {
|
|
if (!dir.exp) {
|
|
context.onError(createCompilerError(30 /* X_V_FOR_NO_EXPRESSION */, dir.loc));
|
|
return;
|
|
}
|
|
const parseResult = parseForExpression(
|
|
// can only be simple expression because vFor transform is applied
|
|
// before expression transform.
|
|
dir.exp, context);
|
|
if (!parseResult) {
|
|
context.onError(createCompilerError(31 /* X_V_FOR_MALFORMED_EXPRESSION */, dir.loc));
|
|
return;
|
|
}
|
|
const { addIdentifiers, removeIdentifiers, scopes } = context;
|
|
const { source, value, key, index } = parseResult;
|
|
const forNode = {
|
|
type: 11 /* FOR */,
|
|
loc: dir.loc,
|
|
source,
|
|
valueAlias: value,
|
|
keyAlias: key,
|
|
objectIndexAlias: index,
|
|
parseResult,
|
|
children: isTemplateNode(node) ? node.children : [node]
|
|
};
|
|
context.replaceNode(forNode);
|
|
// bookkeeping
|
|
scopes.vFor++;
|
|
const onExit = processCodegen && processCodegen(forNode);
|
|
return () => {
|
|
scopes.vFor--;
|
|
if (onExit)
|
|
onExit();
|
|
};
|
|
}
|
|
const forAliasRE = /([\s\S]*?)\s+(?:in|of)\s+([\s\S]*)/;
|
|
// This regex doesn't cover the case if key or index aliases have destructuring,
|
|
// but those do not make sense in the first place, so this works in practice.
|
|
const forIteratorRE = /,([^,\}\]]*)(?:,([^,\}\]]*))?$/;
|
|
const stripParensRE = /^\(|\)$/g;
|
|
function parseForExpression(input, context) {
|
|
const loc = input.loc;
|
|
const exp = input.content;
|
|
const inMatch = exp.match(forAliasRE);
|
|
if (!inMatch)
|
|
return;
|
|
const [, LHS, RHS] = inMatch;
|
|
const result = {
|
|
source: createAliasExpression(loc, RHS.trim(), exp.indexOf(RHS, LHS.length)),
|
|
value: undefined,
|
|
key: undefined,
|
|
index: undefined
|
|
};
|
|
if (true) {
|
|
validateBrowserExpression(result.source, context);
|
|
}
|
|
let valueContent = LHS.trim().replace(stripParensRE, '').trim();
|
|
const trimmedOffset = LHS.indexOf(valueContent);
|
|
const iteratorMatch = valueContent.match(forIteratorRE);
|
|
if (iteratorMatch) {
|
|
valueContent = valueContent.replace(forIteratorRE, '').trim();
|
|
const keyContent = iteratorMatch[1].trim();
|
|
let keyOffset;
|
|
if (keyContent) {
|
|
keyOffset = exp.indexOf(keyContent, trimmedOffset + valueContent.length);
|
|
result.key = createAliasExpression(loc, keyContent, keyOffset);
|
|
if (true) {
|
|
validateBrowserExpression(result.key, context, true);
|
|
}
|
|
}
|
|
if (iteratorMatch[2]) {
|
|
const indexContent = iteratorMatch[2].trim();
|
|
if (indexContent) {
|
|
result.index = createAliasExpression(loc, indexContent, exp.indexOf(indexContent, result.key
|
|
? keyOffset + keyContent.length
|
|
: trimmedOffset + valueContent.length));
|
|
if (true) {
|
|
validateBrowserExpression(result.index, context, true);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
if (valueContent) {
|
|
result.value = createAliasExpression(loc, valueContent, trimmedOffset);
|
|
if (true) {
|
|
validateBrowserExpression(result.value, context, true);
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
function createAliasExpression(range, content, offset) {
|
|
return createSimpleExpression(content, false, getInnerRange(range, offset, content.length));
|
|
}
|
|
function createForLoopParams({ value, key, index }, memoArgs = []) {
|
|
return createParamsList([value, key, index, ...memoArgs]);
|
|
}
|
|
function createParamsList(args) {
|
|
let i = args.length;
|
|
while (i--) {
|
|
if (args[i])
|
|
break;
|
|
}
|
|
return args
|
|
.slice(0, i + 1)
|
|
.map((arg, i) => arg || createSimpleExpression(`_`.repeat(i + 1), false));
|
|
}
|
|
|
|
const defaultFallback = createSimpleExpression(`undefined`, false);
|
|
// A NodeTransform that:
|
|
// 1. Tracks scope identifiers for scoped slots so that they don't get prefixed
|
|
// by transformExpression. This is only applied in non-browser builds with
|
|
// { prefixIdentifiers: true }.
|
|
// 2. Track v-slot depths so that we know a slot is inside another slot.
|
|
// Note the exit callback is executed before buildSlots() on the same node,
|
|
// so only nested slots see positive numbers.
|
|
const trackSlotScopes = (node, context) => {
|
|
if (node.type === 1 /* ELEMENT */ &&
|
|
(node.tagType === 1 /* COMPONENT */ ||
|
|
node.tagType === 3 /* TEMPLATE */)) {
|
|
// We are only checking non-empty v-slot here
|
|
// since we only care about slots that introduce scope variables.
|
|
const vSlot = findDir(node, 'slot');
|
|
if (vSlot) {
|
|
vSlot.exp;
|
|
context.scopes.vSlot++;
|
|
return () => {
|
|
context.scopes.vSlot--;
|
|
};
|
|
}
|
|
}
|
|
};
|
|
// A NodeTransform that tracks scope identifiers for scoped slots with v-for.
|
|
// This transform is only applied in non-browser builds with { prefixIdentifiers: true }
|
|
const trackVForSlotScopes = (node, context) => {
|
|
let vFor;
|
|
if (isTemplateNode(node) &&
|
|
node.props.some(isVSlot) &&
|
|
(vFor = findDir(node, 'for'))) {
|
|
const result = (vFor.parseResult = parseForExpression(vFor.exp, context));
|
|
if (result) {
|
|
const { value, key, index } = result;
|
|
const { addIdentifiers, removeIdentifiers } = context;
|
|
value && addIdentifiers(value);
|
|
key && addIdentifiers(key);
|
|
index && addIdentifiers(index);
|
|
return () => {
|
|
value && removeIdentifiers(value);
|
|
key && removeIdentifiers(key);
|
|
index && removeIdentifiers(index);
|
|
};
|
|
}
|
|
}
|
|
};
|
|
const buildClientSlotFn = (props, children, loc) => createFunctionExpression(props, children, false /* newline */, true /* isSlot */, children.length ? children[0].loc : loc);
|
|
// Instead of being a DirectiveTransform, v-slot processing is called during
|
|
// transformElement to build the slots object for a component.
|
|
function buildSlots(node, context, buildSlotFn = buildClientSlotFn) {
|
|
context.helper(WITH_CTX);
|
|
const { children, loc } = node;
|
|
const slotsProperties = [];
|
|
const dynamicSlots = [];
|
|
// If the slot is inside a v-for or another v-slot, force it to be dynamic
|
|
// since it likely uses a scope variable.
|
|
let hasDynamicSlots = context.scopes.vSlot > 0 || context.scopes.vFor > 0;
|
|
// 1. Check for slot with slotProps on component itself.
|
|
// <Comp v-slot="{ prop }"/>
|
|
const onComponentSlot = findDir(node, 'slot', true);
|
|
if (onComponentSlot) {
|
|
const { arg, exp } = onComponentSlot;
|
|
if (arg && !isStaticExp(arg)) {
|
|
hasDynamicSlots = true;
|
|
}
|
|
slotsProperties.push(createObjectProperty(arg || createSimpleExpression('default', true), buildSlotFn(exp, children, loc)));
|
|
}
|
|
// 2. Iterate through children and check for template slots
|
|
// <template v-slot:foo="{ prop }">
|
|
let hasTemplateSlots = false;
|
|
let hasNamedDefaultSlot = false;
|
|
const implicitDefaultChildren = [];
|
|
const seenSlotNames = new Set();
|
|
for (let i = 0; i < children.length; i++) {
|
|
const slotElement = children[i];
|
|
let slotDir;
|
|
if (!isTemplateNode(slotElement) ||
|
|
!(slotDir = findDir(slotElement, 'slot', true))) {
|
|
// not a <template v-slot>, skip.
|
|
if (slotElement.type !== 3 /* COMMENT */) {
|
|
implicitDefaultChildren.push(slotElement);
|
|
}
|
|
continue;
|
|
}
|
|
if (onComponentSlot) {
|
|
// already has on-component slot - this is incorrect usage.
|
|
context.onError(createCompilerError(36 /* X_V_SLOT_MIXED_SLOT_USAGE */, slotDir.loc));
|
|
break;
|
|
}
|
|
hasTemplateSlots = true;
|
|
const { children: slotChildren, loc: slotLoc } = slotElement;
|
|
const { arg: slotName = createSimpleExpression(`default`, true), exp: slotProps, loc: dirLoc } = slotDir;
|
|
// check if name is dynamic.
|
|
let staticSlotName;
|
|
if (isStaticExp(slotName)) {
|
|
staticSlotName = slotName ? slotName.content : `default`;
|
|
}
|
|
else {
|
|
hasDynamicSlots = true;
|
|
}
|
|
const slotFunction = buildSlotFn(slotProps, slotChildren, slotLoc);
|
|
// check if this slot is conditional (v-if/v-for)
|
|
let vIf;
|
|
let vElse;
|
|
let vFor;
|
|
if ((vIf = findDir(slotElement, 'if'))) {
|
|
hasDynamicSlots = true;
|
|
dynamicSlots.push(createConditionalExpression(vIf.exp, buildDynamicSlot(slotName, slotFunction), defaultFallback));
|
|
}
|
|
else if ((vElse = findDir(slotElement, /^else(-if)?$/, true /* allowEmpty */))) {
|
|
// find adjacent v-if
|
|
let j = i;
|
|
let prev;
|
|
while (j--) {
|
|
prev = children[j];
|
|
if (prev.type !== 3 /* COMMENT */) {
|
|
break;
|
|
}
|
|
}
|
|
if (prev && isTemplateNode(prev) && findDir(prev, 'if')) {
|
|
// remove node
|
|
children.splice(i, 1);
|
|
i--;
|
|
// attach this slot to previous conditional
|
|
let conditional = dynamicSlots[dynamicSlots.length - 1];
|
|
while (conditional.alternate.type === 19 /* JS_CONDITIONAL_EXPRESSION */) {
|
|
conditional = conditional.alternate;
|
|
}
|
|
conditional.alternate = vElse.exp
|
|
? createConditionalExpression(vElse.exp, buildDynamicSlot(slotName, slotFunction), defaultFallback)
|
|
: buildDynamicSlot(slotName, slotFunction);
|
|
}
|
|
else {
|
|
context.onError(createCompilerError(29 /* X_V_ELSE_NO_ADJACENT_IF */, vElse.loc));
|
|
}
|
|
}
|
|
else if ((vFor = findDir(slotElement, 'for'))) {
|
|
hasDynamicSlots = true;
|
|
const parseResult = vFor.parseResult ||
|
|
parseForExpression(vFor.exp, context);
|
|
if (parseResult) {
|
|
// Render the dynamic slots as an array and add it to the createSlot()
|
|
// args. The runtime knows how to handle it appropriately.
|
|
dynamicSlots.push(createCallExpression(context.helper(RENDER_LIST), [
|
|
parseResult.source,
|
|
createFunctionExpression(createForLoopParams(parseResult), buildDynamicSlot(slotName, slotFunction), true /* force newline */)
|
|
]));
|
|
}
|
|
else {
|
|
context.onError(createCompilerError(31 /* X_V_FOR_MALFORMED_EXPRESSION */, vFor.loc));
|
|
}
|
|
}
|
|
else {
|
|
// check duplicate static names
|
|
if (staticSlotName) {
|
|
if (seenSlotNames.has(staticSlotName)) {
|
|
context.onError(createCompilerError(37 /* X_V_SLOT_DUPLICATE_SLOT_NAMES */, dirLoc));
|
|
continue;
|
|
}
|
|
seenSlotNames.add(staticSlotName);
|
|
if (staticSlotName === 'default') {
|
|
hasNamedDefaultSlot = true;
|
|
}
|
|
}
|
|
slotsProperties.push(createObjectProperty(slotName, slotFunction));
|
|
}
|
|
}
|
|
if (!onComponentSlot) {
|
|
const buildDefaultSlotProperty = (props, children) => {
|
|
const fn = buildSlotFn(props, children, loc);
|
|
if (context.compatConfig) {
|
|
fn.isNonScopedSlot = true;
|
|
}
|
|
return createObjectProperty(`default`, fn);
|
|
};
|
|
if (!hasTemplateSlots) {
|
|
// implicit default slot (on component)
|
|
slotsProperties.push(buildDefaultSlotProperty(undefined, children));
|
|
}
|
|
else if (implicitDefaultChildren.length &&
|
|
// #3766
|
|
// with whitespace: 'preserve', whitespaces between slots will end up in
|
|
// implicitDefaultChildren. Ignore if all implicit children are whitespaces.
|
|
implicitDefaultChildren.some(node => isNonWhitespaceContent(node))) {
|
|
// implicit default slot (mixed with named slots)
|
|
if (hasNamedDefaultSlot) {
|
|
context.onError(createCompilerError(38 /* X_V_SLOT_EXTRANEOUS_DEFAULT_SLOT_CHILDREN */, implicitDefaultChildren[0].loc));
|
|
}
|
|
else {
|
|
slotsProperties.push(buildDefaultSlotProperty(undefined, implicitDefaultChildren));
|
|
}
|
|
}
|
|
}
|
|
const slotFlag = hasDynamicSlots
|
|
? 2 /* DYNAMIC */
|
|
: hasForwardedSlots(node.children)
|
|
? 3 /* FORWARDED */
|
|
: 1 /* STABLE */;
|
|
let slots = createObjectExpression(slotsProperties.concat(createObjectProperty(`_`,
|
|
// 2 = compiled but dynamic = can skip normalization, but must run diff
|
|
// 1 = compiled and static = can skip normalization AND diff as optimized
|
|
createSimpleExpression(slotFlag + (( true) ? ` /* ${_vue_shared__WEBPACK_IMPORTED_MODULE_0__.slotFlagsText[slotFlag]} */` : 0), false))), loc);
|
|
if (dynamicSlots.length) {
|
|
slots = createCallExpression(context.helper(CREATE_SLOTS), [
|
|
slots,
|
|
createArrayExpression(dynamicSlots)
|
|
]);
|
|
}
|
|
return {
|
|
slots,
|
|
hasDynamicSlots
|
|
};
|
|
}
|
|
function buildDynamicSlot(name, fn) {
|
|
return createObjectExpression([
|
|
createObjectProperty(`name`, name),
|
|
createObjectProperty(`fn`, fn)
|
|
]);
|
|
}
|
|
function hasForwardedSlots(children) {
|
|
for (let i = 0; i < children.length; i++) {
|
|
const child = children[i];
|
|
switch (child.type) {
|
|
case 1 /* ELEMENT */:
|
|
if (child.tagType === 2 /* SLOT */ ||
|
|
hasForwardedSlots(child.children)) {
|
|
return true;
|
|
}
|
|
break;
|
|
case 9 /* IF */:
|
|
if (hasForwardedSlots(child.branches))
|
|
return true;
|
|
break;
|
|
case 10 /* IF_BRANCH */:
|
|
case 11 /* FOR */:
|
|
if (hasForwardedSlots(child.children))
|
|
return true;
|
|
break;
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
function isNonWhitespaceContent(node) {
|
|
if (node.type !== 2 /* TEXT */ && node.type !== 12 /* TEXT_CALL */)
|
|
return true;
|
|
return node.type === 2 /* TEXT */
|
|
? !!node.content.trim()
|
|
: isNonWhitespaceContent(node.content);
|
|
}
|
|
|
|
// some directive transforms (e.g. v-model) may return a symbol for runtime
|
|
// import, which should be used instead of a resolveDirective call.
|
|
const directiveImportMap = new WeakMap();
|
|
// generate a JavaScript AST for this element's codegen
|
|
const transformElement = (node, context) => {
|
|
// perform the work on exit, after all child expressions have been
|
|
// processed and merged.
|
|
return function postTransformElement() {
|
|
node = context.currentNode;
|
|
if (!(node.type === 1 /* ELEMENT */ &&
|
|
(node.tagType === 0 /* ELEMENT */ ||
|
|
node.tagType === 1 /* COMPONENT */))) {
|
|
return;
|
|
}
|
|
const { tag, props } = node;
|
|
const isComponent = node.tagType === 1 /* COMPONENT */;
|
|
// The goal of the transform is to create a codegenNode implementing the
|
|
// VNodeCall interface.
|
|
let vnodeTag = isComponent
|
|
? resolveComponentType(node, context)
|
|
: `"${tag}"`;
|
|
const isDynamicComponent = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isObject)(vnodeTag) && vnodeTag.callee === RESOLVE_DYNAMIC_COMPONENT;
|
|
let vnodeProps;
|
|
let vnodeChildren;
|
|
let vnodePatchFlag;
|
|
let patchFlag = 0;
|
|
let vnodeDynamicProps;
|
|
let dynamicPropNames;
|
|
let vnodeDirectives;
|
|
let shouldUseBlock =
|
|
// dynamic component may resolve to plain elements
|
|
isDynamicComponent ||
|
|
vnodeTag === TELEPORT ||
|
|
vnodeTag === SUSPENSE ||
|
|
(!isComponent &&
|
|
// <svg> and <foreignObject> must be forced into blocks so that block
|
|
// updates inside get proper isSVG flag at runtime. (#639, #643)
|
|
// This is technically web-specific, but splitting the logic out of core
|
|
// leads to too much unnecessary complexity.
|
|
(tag === 'svg' ||
|
|
tag === 'foreignObject' ||
|
|
// #938: elements with dynamic keys should be forced into blocks
|
|
findProp(node, 'key', true)));
|
|
// props
|
|
if (props.length > 0) {
|
|
const propsBuildResult = buildProps(node, context);
|
|
vnodeProps = propsBuildResult.props;
|
|
patchFlag = propsBuildResult.patchFlag;
|
|
dynamicPropNames = propsBuildResult.dynamicPropNames;
|
|
const directives = propsBuildResult.directives;
|
|
vnodeDirectives =
|
|
directives && directives.length
|
|
? createArrayExpression(directives.map(dir => buildDirectiveArgs(dir, context)))
|
|
: undefined;
|
|
}
|
|
// children
|
|
if (node.children.length > 0) {
|
|
if (vnodeTag === KEEP_ALIVE) {
|
|
// Although a built-in component, we compile KeepAlive with raw children
|
|
// instead of slot functions so that it can be used inside Transition
|
|
// or other Transition-wrapping HOCs.
|
|
// To ensure correct updates with block optimizations, we need to:
|
|
// 1. Force keep-alive into a block. This avoids its children being
|
|
// collected by a parent block.
|
|
shouldUseBlock = true;
|
|
// 2. Force keep-alive to always be updated, since it uses raw children.
|
|
patchFlag |= 1024 /* DYNAMIC_SLOTS */;
|
|
if (( true) && node.children.length > 1) {
|
|
context.onError(createCompilerError(44 /* X_KEEP_ALIVE_INVALID_CHILDREN */, {
|
|
start: node.children[0].loc.start,
|
|
end: node.children[node.children.length - 1].loc.end,
|
|
source: ''
|
|
}));
|
|
}
|
|
}
|
|
const shouldBuildAsSlots = isComponent &&
|
|
// Teleport is not a real component and has dedicated runtime handling
|
|
vnodeTag !== TELEPORT &&
|
|
// explained above.
|
|
vnodeTag !== KEEP_ALIVE;
|
|
if (shouldBuildAsSlots) {
|
|
const { slots, hasDynamicSlots } = buildSlots(node, context);
|
|
vnodeChildren = slots;
|
|
if (hasDynamicSlots) {
|
|
patchFlag |= 1024 /* DYNAMIC_SLOTS */;
|
|
}
|
|
}
|
|
else if (node.children.length === 1 && vnodeTag !== TELEPORT) {
|
|
const child = node.children[0];
|
|
const type = child.type;
|
|
// check for dynamic text children
|
|
const hasDynamicTextChild = type === 5 /* INTERPOLATION */ ||
|
|
type === 8 /* COMPOUND_EXPRESSION */;
|
|
if (hasDynamicTextChild &&
|
|
getConstantType(child, context) === 0 /* NOT_CONSTANT */) {
|
|
patchFlag |= 1 /* TEXT */;
|
|
}
|
|
// pass directly if the only child is a text node
|
|
// (plain / interpolation / expression)
|
|
if (hasDynamicTextChild || type === 2 /* TEXT */) {
|
|
vnodeChildren = child;
|
|
}
|
|
else {
|
|
vnodeChildren = node.children;
|
|
}
|
|
}
|
|
else {
|
|
vnodeChildren = node.children;
|
|
}
|
|
}
|
|
// patchFlag & dynamicPropNames
|
|
if (patchFlag !== 0) {
|
|
if ((true)) {
|
|
if (patchFlag < 0) {
|
|
// special flags (negative and mutually exclusive)
|
|
vnodePatchFlag = patchFlag + ` /* ${_vue_shared__WEBPACK_IMPORTED_MODULE_0__.PatchFlagNames[patchFlag]} */`;
|
|
}
|
|
else {
|
|
// bitwise flags
|
|
const flagNames = Object.keys(_vue_shared__WEBPACK_IMPORTED_MODULE_0__.PatchFlagNames)
|
|
.map(Number)
|
|
.filter(n => n > 0 && patchFlag & n)
|
|
.map(n => _vue_shared__WEBPACK_IMPORTED_MODULE_0__.PatchFlagNames[n])
|
|
.join(`, `);
|
|
vnodePatchFlag = patchFlag + ` /* ${flagNames} */`;
|
|
}
|
|
}
|
|
else {}
|
|
if (dynamicPropNames && dynamicPropNames.length) {
|
|
vnodeDynamicProps = stringifyDynamicPropNames(dynamicPropNames);
|
|
}
|
|
}
|
|
node.codegenNode = createVNodeCall(context, vnodeTag, vnodeProps, vnodeChildren, vnodePatchFlag, vnodeDynamicProps, vnodeDirectives, !!shouldUseBlock, false /* disableTracking */, isComponent, node.loc);
|
|
};
|
|
};
|
|
function resolveComponentType(node, context, ssr = false) {
|
|
let { tag } = node;
|
|
// 1. dynamic component
|
|
const isExplicitDynamic = isComponentTag(tag);
|
|
const isProp = findProp(node, 'is');
|
|
if (isProp) {
|
|
if (isExplicitDynamic ||
|
|
(isCompatEnabled("COMPILER_IS_ON_ELEMENT" /* COMPILER_IS_ON_ELEMENT */, context))) {
|
|
const exp = isProp.type === 6 /* ATTRIBUTE */
|
|
? isProp.value && createSimpleExpression(isProp.value.content, true)
|
|
: isProp.exp;
|
|
if (exp) {
|
|
return createCallExpression(context.helper(RESOLVE_DYNAMIC_COMPONENT), [
|
|
exp
|
|
]);
|
|
}
|
|
}
|
|
else if (isProp.type === 6 /* ATTRIBUTE */ &&
|
|
isProp.value.content.startsWith('vue:')) {
|
|
// <button is="vue:xxx">
|
|
// if not <component>, only is value that starts with "vue:" will be
|
|
// treated as component by the parse phase and reach here, unless it's
|
|
// compat mode where all is values are considered components
|
|
tag = isProp.value.content.slice(4);
|
|
}
|
|
}
|
|
// 1.5 v-is (TODO: Deprecate)
|
|
const isDir = !isExplicitDynamic && findDir(node, 'is');
|
|
if (isDir && isDir.exp) {
|
|
return createCallExpression(context.helper(RESOLVE_DYNAMIC_COMPONENT), [
|
|
isDir.exp
|
|
]);
|
|
}
|
|
// 2. built-in components (Teleport, Transition, KeepAlive, Suspense...)
|
|
const builtIn = isCoreComponent(tag) || context.isBuiltInComponent(tag);
|
|
if (builtIn) {
|
|
// built-ins are simply fallthroughs / have special handling during ssr
|
|
// so we don't need to import their runtime equivalents
|
|
if (!ssr)
|
|
context.helper(builtIn);
|
|
return builtIn;
|
|
}
|
|
// 5. user component (resolve)
|
|
context.helper(RESOLVE_COMPONENT);
|
|
context.components.add(tag);
|
|
return toValidAssetId(tag, `component`);
|
|
}
|
|
function buildProps(node, context, props = node.props, ssr = false) {
|
|
const { tag, loc: elementLoc } = node;
|
|
const isComponent = node.tagType === 1 /* COMPONENT */;
|
|
let properties = [];
|
|
const mergeArgs = [];
|
|
const runtimeDirectives = [];
|
|
// patchFlag analysis
|
|
let patchFlag = 0;
|
|
let hasRef = false;
|
|
let hasClassBinding = false;
|
|
let hasStyleBinding = false;
|
|
let hasHydrationEventBinding = false;
|
|
let hasDynamicKeys = false;
|
|
let hasVnodeHook = false;
|
|
const dynamicPropNames = [];
|
|
const analyzePatchFlag = ({ key, value }) => {
|
|
if (isStaticExp(key)) {
|
|
const name = key.content;
|
|
const isEventHandler = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isOn)(name);
|
|
if (!isComponent &&
|
|
isEventHandler &&
|
|
// omit the flag for click handlers because hydration gives click
|
|
// dedicated fast path.
|
|
name.toLowerCase() !== 'onclick' &&
|
|
// omit v-model handlers
|
|
name !== 'onUpdate:modelValue' &&
|
|
// omit onVnodeXXX hooks
|
|
!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isReservedProp)(name)) {
|
|
hasHydrationEventBinding = true;
|
|
}
|
|
if (isEventHandler && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isReservedProp)(name)) {
|
|
hasVnodeHook = true;
|
|
}
|
|
if (value.type === 20 /* JS_CACHE_EXPRESSION */ ||
|
|
((value.type === 4 /* SIMPLE_EXPRESSION */ ||
|
|
value.type === 8 /* COMPOUND_EXPRESSION */) &&
|
|
getConstantType(value, context) > 0)) {
|
|
// skip if the prop is a cached handler or has constant value
|
|
return;
|
|
}
|
|
if (name === 'ref') {
|
|
hasRef = true;
|
|
}
|
|
else if (name === 'class') {
|
|
hasClassBinding = true;
|
|
}
|
|
else if (name === 'style') {
|
|
hasStyleBinding = true;
|
|
}
|
|
else if (name !== 'key' && !dynamicPropNames.includes(name)) {
|
|
dynamicPropNames.push(name);
|
|
}
|
|
// treat the dynamic class and style binding of the component as dynamic props
|
|
if (isComponent &&
|
|
(name === 'class' || name === 'style') &&
|
|
!dynamicPropNames.includes(name)) {
|
|
dynamicPropNames.push(name);
|
|
}
|
|
}
|
|
else {
|
|
hasDynamicKeys = true;
|
|
}
|
|
};
|
|
for (let i = 0; i < props.length; i++) {
|
|
// static attribute
|
|
const prop = props[i];
|
|
if (prop.type === 6 /* ATTRIBUTE */) {
|
|
const { loc, name, value } = prop;
|
|
let isStatic = true;
|
|
if (name === 'ref') {
|
|
hasRef = true;
|
|
}
|
|
// skip is on <component>, or is="vue:xxx"
|
|
if (name === 'is' &&
|
|
(isComponentTag(tag) ||
|
|
(value && value.content.startsWith('vue:')) ||
|
|
(isCompatEnabled("COMPILER_IS_ON_ELEMENT" /* COMPILER_IS_ON_ELEMENT */, context)))) {
|
|
continue;
|
|
}
|
|
properties.push(createObjectProperty(createSimpleExpression(name, true, getInnerRange(loc, 0, name.length)), createSimpleExpression(value ? value.content : '', isStatic, value ? value.loc : loc)));
|
|
}
|
|
else {
|
|
// directives
|
|
const { name, arg, exp, loc } = prop;
|
|
const isVBind = name === 'bind';
|
|
const isVOn = name === 'on';
|
|
// skip v-slot - it is handled by its dedicated transform.
|
|
if (name === 'slot') {
|
|
if (!isComponent) {
|
|
context.onError(createCompilerError(39 /* X_V_SLOT_MISPLACED */, loc));
|
|
}
|
|
continue;
|
|
}
|
|
// skip v-once/v-memo - they are handled by dedicated transforms.
|
|
if (name === 'once' || name === 'memo') {
|
|
continue;
|
|
}
|
|
// skip v-is and :is on <component>
|
|
if (name === 'is' ||
|
|
(isVBind &&
|
|
isBindKey(arg, 'is') &&
|
|
(isComponentTag(tag) ||
|
|
(isCompatEnabled("COMPILER_IS_ON_ELEMENT" /* COMPILER_IS_ON_ELEMENT */, context))))) {
|
|
continue;
|
|
}
|
|
// skip v-on in SSR compilation
|
|
if (isVOn && ssr) {
|
|
continue;
|
|
}
|
|
// special case for v-bind and v-on with no argument
|
|
if (!arg && (isVBind || isVOn)) {
|
|
hasDynamicKeys = true;
|
|
if (exp) {
|
|
if (properties.length) {
|
|
mergeArgs.push(createObjectExpression(dedupeProperties(properties), elementLoc));
|
|
properties = [];
|
|
}
|
|
if (isVBind) {
|
|
{
|
|
// 2.x v-bind object order compat
|
|
if ((true)) {
|
|
const hasOverridableKeys = mergeArgs.some(arg => {
|
|
if (arg.type === 15 /* JS_OBJECT_EXPRESSION */) {
|
|
return arg.properties.some(({ key }) => {
|
|
if (key.type !== 4 /* SIMPLE_EXPRESSION */ ||
|
|
!key.isStatic) {
|
|
return true;
|
|
}
|
|
return (key.content !== 'class' &&
|
|
key.content !== 'style' &&
|
|
!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isOn)(key.content));
|
|
});
|
|
}
|
|
else {
|
|
// dynamic expression
|
|
return true;
|
|
}
|
|
});
|
|
if (hasOverridableKeys) {
|
|
checkCompatEnabled("COMPILER_V_BIND_OBJECT_ORDER" /* COMPILER_V_BIND_OBJECT_ORDER */, context, loc);
|
|
}
|
|
}
|
|
if (isCompatEnabled("COMPILER_V_BIND_OBJECT_ORDER" /* COMPILER_V_BIND_OBJECT_ORDER */, context)) {
|
|
mergeArgs.unshift(exp);
|
|
continue;
|
|
}
|
|
}
|
|
mergeArgs.push(exp);
|
|
}
|
|
else {
|
|
// v-on="obj" -> toHandlers(obj)
|
|
mergeArgs.push({
|
|
type: 14 /* JS_CALL_EXPRESSION */,
|
|
loc,
|
|
callee: context.helper(TO_HANDLERS),
|
|
arguments: [exp]
|
|
});
|
|
}
|
|
}
|
|
else {
|
|
context.onError(createCompilerError(isVBind
|
|
? 33 /* X_V_BIND_NO_EXPRESSION */
|
|
: 34 /* X_V_ON_NO_EXPRESSION */, loc));
|
|
}
|
|
continue;
|
|
}
|
|
const directiveTransform = context.directiveTransforms[name];
|
|
if (directiveTransform) {
|
|
// has built-in directive transform.
|
|
const { props, needRuntime } = directiveTransform(prop, node, context);
|
|
!ssr && props.forEach(analyzePatchFlag);
|
|
properties.push(...props);
|
|
if (needRuntime) {
|
|
runtimeDirectives.push(prop);
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isSymbol)(needRuntime)) {
|
|
directiveImportMap.set(prop, needRuntime);
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
// no built-in transform, this is a user custom directive.
|
|
runtimeDirectives.push(prop);
|
|
}
|
|
}
|
|
if (prop.type === 6 /* ATTRIBUTE */ &&
|
|
prop.name === 'ref' &&
|
|
context.scopes.vFor > 0 &&
|
|
checkCompatEnabled("COMPILER_V_FOR_REF" /* COMPILER_V_FOR_REF */, context, prop.loc)) {
|
|
properties.push(createObjectProperty(createSimpleExpression('refInFor', true), createSimpleExpression('true', false)));
|
|
}
|
|
}
|
|
let propsExpression = undefined;
|
|
// has v-bind="object" or v-on="object", wrap with mergeProps
|
|
if (mergeArgs.length) {
|
|
if (properties.length) {
|
|
mergeArgs.push(createObjectExpression(dedupeProperties(properties), elementLoc));
|
|
}
|
|
if (mergeArgs.length > 1) {
|
|
propsExpression = createCallExpression(context.helper(MERGE_PROPS), mergeArgs, elementLoc);
|
|
}
|
|
else {
|
|
// single v-bind with nothing else - no need for a mergeProps call
|
|
propsExpression = mergeArgs[0];
|
|
}
|
|
}
|
|
else if (properties.length) {
|
|
propsExpression = createObjectExpression(dedupeProperties(properties), elementLoc);
|
|
}
|
|
// patchFlag analysis
|
|
if (hasDynamicKeys) {
|
|
patchFlag |= 16 /* FULL_PROPS */;
|
|
}
|
|
else {
|
|
if (hasClassBinding && !isComponent) {
|
|
patchFlag |= 2 /* CLASS */;
|
|
}
|
|
if (hasStyleBinding && !isComponent) {
|
|
patchFlag |= 4 /* STYLE */;
|
|
}
|
|
if (dynamicPropNames.length) {
|
|
patchFlag |= 8 /* PROPS */;
|
|
}
|
|
if (hasHydrationEventBinding) {
|
|
patchFlag |= 32 /* HYDRATE_EVENTS */;
|
|
}
|
|
}
|
|
if ((patchFlag === 0 || patchFlag === 32 /* HYDRATE_EVENTS */) &&
|
|
(hasRef || hasVnodeHook || runtimeDirectives.length > 0)) {
|
|
patchFlag |= 512 /* NEED_PATCH */;
|
|
}
|
|
// pre-normalize props, SSR is skipped for now
|
|
if (!context.inSSR && propsExpression) {
|
|
switch (propsExpression.type) {
|
|
case 15 /* JS_OBJECT_EXPRESSION */:
|
|
// means that there is no v-bind,
|
|
// but still need to deal with dynamic key binding
|
|
let classKeyIndex = -1;
|
|
let styleKeyIndex = -1;
|
|
let hasDynamicKey = false;
|
|
for (let i = 0; i < propsExpression.properties.length; i++) {
|
|
const key = propsExpression.properties[i].key;
|
|
if (isStaticExp(key)) {
|
|
if (key.content === 'class') {
|
|
classKeyIndex = i;
|
|
}
|
|
else if (key.content === 'style') {
|
|
styleKeyIndex = i;
|
|
}
|
|
}
|
|
else if (!key.isHandlerKey) {
|
|
hasDynamicKey = true;
|
|
}
|
|
}
|
|
const classProp = propsExpression.properties[classKeyIndex];
|
|
const styleProp = propsExpression.properties[styleKeyIndex];
|
|
// no dynamic key
|
|
if (!hasDynamicKey) {
|
|
if (classProp && !isStaticExp(classProp.value)) {
|
|
classProp.value = createCallExpression(context.helper(NORMALIZE_CLASS), [classProp.value]);
|
|
}
|
|
if (styleProp &&
|
|
!isStaticExp(styleProp.value) &&
|
|
// the static style is compiled into an object,
|
|
// so use `hasStyleBinding` to ensure that it is a dynamic style binding
|
|
(hasStyleBinding ||
|
|
// v-bind:style and style both exist,
|
|
// v-bind:style with static literal object
|
|
styleProp.value.type === 17 /* JS_ARRAY_EXPRESSION */)) {
|
|
styleProp.value = createCallExpression(context.helper(NORMALIZE_STYLE), [styleProp.value]);
|
|
}
|
|
}
|
|
else {
|
|
// dynamic key binding, wrap with `normalizeProps`
|
|
propsExpression = createCallExpression(context.helper(NORMALIZE_PROPS), [propsExpression]);
|
|
}
|
|
break;
|
|
case 14 /* JS_CALL_EXPRESSION */:
|
|
// mergeProps call, do nothing
|
|
break;
|
|
default:
|
|
// single v-bind
|
|
propsExpression = createCallExpression(context.helper(NORMALIZE_PROPS), [
|
|
createCallExpression(context.helper(GUARD_REACTIVE_PROPS), [
|
|
propsExpression
|
|
])
|
|
]);
|
|
break;
|
|
}
|
|
}
|
|
return {
|
|
props: propsExpression,
|
|
directives: runtimeDirectives,
|
|
patchFlag,
|
|
dynamicPropNames
|
|
};
|
|
}
|
|
// Dedupe props in an object literal.
|
|
// Literal duplicated attributes would have been warned during the parse phase,
|
|
// however, it's possible to encounter duplicated `onXXX` handlers with different
|
|
// modifiers. We also need to merge static and dynamic class / style attributes.
|
|
// - onXXX handlers / style: merge into array
|
|
// - class: merge into single expression with concatenation
|
|
function dedupeProperties(properties) {
|
|
const knownProps = new Map();
|
|
const deduped = [];
|
|
for (let i = 0; i < properties.length; i++) {
|
|
const prop = properties[i];
|
|
// dynamic keys are always allowed
|
|
if (prop.key.type === 8 /* COMPOUND_EXPRESSION */ || !prop.key.isStatic) {
|
|
deduped.push(prop);
|
|
continue;
|
|
}
|
|
const name = prop.key.content;
|
|
const existing = knownProps.get(name);
|
|
if (existing) {
|
|
if (name === 'style' || name === 'class' || name.startsWith('on')) {
|
|
mergeAsArray(existing, prop);
|
|
}
|
|
// unexpected duplicate, should have emitted error during parse
|
|
}
|
|
else {
|
|
knownProps.set(name, prop);
|
|
deduped.push(prop);
|
|
}
|
|
}
|
|
return deduped;
|
|
}
|
|
function mergeAsArray(existing, incoming) {
|
|
if (existing.value.type === 17 /* JS_ARRAY_EXPRESSION */) {
|
|
existing.value.elements.push(incoming.value);
|
|
}
|
|
else {
|
|
existing.value = createArrayExpression([existing.value, incoming.value], existing.loc);
|
|
}
|
|
}
|
|
function buildDirectiveArgs(dir, context) {
|
|
const dirArgs = [];
|
|
const runtime = directiveImportMap.get(dir);
|
|
if (runtime) {
|
|
// built-in directive with runtime
|
|
dirArgs.push(context.helperString(runtime));
|
|
}
|
|
else {
|
|
{
|
|
// inject statement for resolving directive
|
|
context.helper(RESOLVE_DIRECTIVE);
|
|
context.directives.add(dir.name);
|
|
dirArgs.push(toValidAssetId(dir.name, `directive`));
|
|
}
|
|
}
|
|
const { loc } = dir;
|
|
if (dir.exp)
|
|
dirArgs.push(dir.exp);
|
|
if (dir.arg) {
|
|
if (!dir.exp) {
|
|
dirArgs.push(`void 0`);
|
|
}
|
|
dirArgs.push(dir.arg);
|
|
}
|
|
if (Object.keys(dir.modifiers).length) {
|
|
if (!dir.arg) {
|
|
if (!dir.exp) {
|
|
dirArgs.push(`void 0`);
|
|
}
|
|
dirArgs.push(`void 0`);
|
|
}
|
|
const trueExpression = createSimpleExpression(`true`, false, loc);
|
|
dirArgs.push(createObjectExpression(dir.modifiers.map(modifier => createObjectProperty(modifier, trueExpression)), loc));
|
|
}
|
|
return createArrayExpression(dirArgs, dir.loc);
|
|
}
|
|
function stringifyDynamicPropNames(props) {
|
|
let propsNamesString = `[`;
|
|
for (let i = 0, l = props.length; i < l; i++) {
|
|
propsNamesString += JSON.stringify(props[i]);
|
|
if (i < l - 1)
|
|
propsNamesString += ', ';
|
|
}
|
|
return propsNamesString + `]`;
|
|
}
|
|
function isComponentTag(tag) {
|
|
return tag[0].toLowerCase() + tag.slice(1) === 'component';
|
|
}
|
|
|
|
( true)
|
|
? Object.freeze({})
|
|
: 0;
|
|
( true) ? Object.freeze([]) : 0;
|
|
const cacheStringFunction = (fn) => {
|
|
const cache = Object.create(null);
|
|
return ((str) => {
|
|
const hit = cache[str];
|
|
return hit || (cache[str] = fn(str));
|
|
});
|
|
};
|
|
const camelizeRE = /-(\w)/g;
|
|
/**
|
|
* @private
|
|
*/
|
|
const camelize = cacheStringFunction((str) => {
|
|
return str.replace(camelizeRE, (_, c) => (c ? c.toUpperCase() : ''));
|
|
});
|
|
|
|
const transformSlotOutlet = (node, context) => {
|
|
if (isSlotOutlet(node)) {
|
|
const { children, loc } = node;
|
|
const { slotName, slotProps } = processSlotOutlet(node, context);
|
|
const slotArgs = [
|
|
context.prefixIdentifiers ? `_ctx.$slots` : `$slots`,
|
|
slotName
|
|
];
|
|
if (slotProps) {
|
|
slotArgs.push(slotProps);
|
|
}
|
|
if (children.length) {
|
|
if (!slotProps) {
|
|
slotArgs.push(`{}`);
|
|
}
|
|
slotArgs.push(createFunctionExpression([], children, false, false, loc));
|
|
}
|
|
if (context.scopeId && !context.slotted) {
|
|
if (!slotProps) {
|
|
slotArgs.push(`{}`);
|
|
}
|
|
if (!children.length) {
|
|
slotArgs.push(`undefined`);
|
|
}
|
|
slotArgs.push(`true`);
|
|
}
|
|
node.codegenNode = createCallExpression(context.helper(RENDER_SLOT), slotArgs, loc);
|
|
}
|
|
};
|
|
function processSlotOutlet(node, context) {
|
|
let slotName = `"default"`;
|
|
let slotProps = undefined;
|
|
const nonNameProps = [];
|
|
for (let i = 0; i < node.props.length; i++) {
|
|
const p = node.props[i];
|
|
if (p.type === 6 /* ATTRIBUTE */) {
|
|
if (p.value) {
|
|
if (p.name === 'name') {
|
|
slotName = JSON.stringify(p.value.content);
|
|
}
|
|
else {
|
|
p.name = camelize(p.name);
|
|
nonNameProps.push(p);
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
if (p.name === 'bind' && isBindKey(p.arg, 'name')) {
|
|
if (p.exp)
|
|
slotName = p.exp;
|
|
}
|
|
else {
|
|
if (p.name === 'bind' && p.arg && isStaticExp(p.arg)) {
|
|
p.arg.content = camelize(p.arg.content);
|
|
}
|
|
nonNameProps.push(p);
|
|
}
|
|
}
|
|
}
|
|
if (nonNameProps.length > 0) {
|
|
const { props, directives } = buildProps(node, context, nonNameProps);
|
|
slotProps = props;
|
|
if (directives.length) {
|
|
context.onError(createCompilerError(35 /* X_V_SLOT_UNEXPECTED_DIRECTIVE_ON_SLOT_OUTLET */, directives[0].loc));
|
|
}
|
|
}
|
|
return {
|
|
slotName,
|
|
slotProps
|
|
};
|
|
}
|
|
|
|
const fnExpRE = /^\s*([\w$_]+|\([^)]*?\))\s*=>|^\s*function(?:\s+[\w$]+)?\s*\(/;
|
|
const transformOn = (dir, node, context, augmentor) => {
|
|
const { loc, modifiers, arg } = dir;
|
|
if (!dir.exp && !modifiers.length) {
|
|
context.onError(createCompilerError(34 /* X_V_ON_NO_EXPRESSION */, loc));
|
|
}
|
|
let eventName;
|
|
if (arg.type === 4 /* SIMPLE_EXPRESSION */) {
|
|
if (arg.isStatic) {
|
|
const rawName = arg.content;
|
|
// for all event listeners, auto convert it to camelCase. See issue #2249
|
|
eventName = createSimpleExpression((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.toHandlerKey)((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.camelize)(rawName)), true, arg.loc);
|
|
}
|
|
else {
|
|
// #2388
|
|
eventName = createCompoundExpression([
|
|
`${context.helperString(TO_HANDLER_KEY)}(`,
|
|
arg,
|
|
`)`
|
|
]);
|
|
}
|
|
}
|
|
else {
|
|
// already a compound expression.
|
|
eventName = arg;
|
|
eventName.children.unshift(`${context.helperString(TO_HANDLER_KEY)}(`);
|
|
eventName.children.push(`)`);
|
|
}
|
|
// handler processing
|
|
let exp = dir.exp;
|
|
if (exp && !exp.content.trim()) {
|
|
exp = undefined;
|
|
}
|
|
let shouldCache = context.cacheHandlers && !exp && !context.inVOnce;
|
|
if (exp) {
|
|
const isMemberExp = isMemberExpression(exp.content);
|
|
const isInlineStatement = !(isMemberExp || fnExpRE.test(exp.content));
|
|
const hasMultipleStatements = exp.content.includes(`;`);
|
|
if (true) {
|
|
validateBrowserExpression(exp, context, false, hasMultipleStatements);
|
|
}
|
|
if (isInlineStatement || (shouldCache && isMemberExp)) {
|
|
// wrap inline statement in a function expression
|
|
exp = createCompoundExpression([
|
|
`${isInlineStatement
|
|
? `$event`
|
|
: `${``}(...args)`} => ${hasMultipleStatements ? `{` : `(`}`,
|
|
exp,
|
|
hasMultipleStatements ? `}` : `)`
|
|
]);
|
|
}
|
|
}
|
|
let ret = {
|
|
props: [
|
|
createObjectProperty(eventName, exp || createSimpleExpression(`() => {}`, false, loc))
|
|
]
|
|
};
|
|
// apply extended compiler augmentor
|
|
if (augmentor) {
|
|
ret = augmentor(ret);
|
|
}
|
|
if (shouldCache) {
|
|
// cache handlers so that it's always the same handler being passed down.
|
|
// this avoids unnecessary re-renders when users use inline handlers on
|
|
// components.
|
|
ret.props[0].value = context.cache(ret.props[0].value);
|
|
}
|
|
// mark the key as handler for props normalization check
|
|
ret.props.forEach(p => (p.key.isHandlerKey = true));
|
|
return ret;
|
|
};
|
|
|
|
// v-bind without arg is handled directly in ./transformElements.ts due to it affecting
|
|
// codegen for the entire props object. This transform here is only for v-bind
|
|
// *with* args.
|
|
const transformBind = (dir, _node, context) => {
|
|
const { exp, modifiers, loc } = dir;
|
|
const arg = dir.arg;
|
|
if (arg.type !== 4 /* SIMPLE_EXPRESSION */) {
|
|
arg.children.unshift(`(`);
|
|
arg.children.push(`) || ""`);
|
|
}
|
|
else if (!arg.isStatic) {
|
|
arg.content = `${arg.content} || ""`;
|
|
}
|
|
// .sync is replaced by v-model:arg
|
|
if (modifiers.includes('camel')) {
|
|
if (arg.type === 4 /* SIMPLE_EXPRESSION */) {
|
|
if (arg.isStatic) {
|
|
arg.content = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.camelize)(arg.content);
|
|
}
|
|
else {
|
|
arg.content = `${context.helperString(CAMELIZE)}(${arg.content})`;
|
|
}
|
|
}
|
|
else {
|
|
arg.children.unshift(`${context.helperString(CAMELIZE)}(`);
|
|
arg.children.push(`)`);
|
|
}
|
|
}
|
|
if (!context.inSSR) {
|
|
if (modifiers.includes('prop')) {
|
|
injectPrefix(arg, '.');
|
|
}
|
|
if (modifiers.includes('attr')) {
|
|
injectPrefix(arg, '^');
|
|
}
|
|
}
|
|
if (!exp ||
|
|
(exp.type === 4 /* SIMPLE_EXPRESSION */ && !exp.content.trim())) {
|
|
context.onError(createCompilerError(33 /* X_V_BIND_NO_EXPRESSION */, loc));
|
|
return {
|
|
props: [createObjectProperty(arg, createSimpleExpression('', true, loc))]
|
|
};
|
|
}
|
|
return {
|
|
props: [createObjectProperty(arg, exp)]
|
|
};
|
|
};
|
|
const injectPrefix = (arg, prefix) => {
|
|
if (arg.type === 4 /* SIMPLE_EXPRESSION */) {
|
|
if (arg.isStatic) {
|
|
arg.content = prefix + arg.content;
|
|
}
|
|
else {
|
|
arg.content = `\`${prefix}\${${arg.content}}\``;
|
|
}
|
|
}
|
|
else {
|
|
arg.children.unshift(`'${prefix}' + (`);
|
|
arg.children.push(`)`);
|
|
}
|
|
};
|
|
|
|
// Merge adjacent text nodes and expressions into a single expression
|
|
// e.g. <div>abc {{ d }} {{ e }}</div> should have a single expression node as child.
|
|
const transformText = (node, context) => {
|
|
if (node.type === 0 /* ROOT */ ||
|
|
node.type === 1 /* ELEMENT */ ||
|
|
node.type === 11 /* FOR */ ||
|
|
node.type === 10 /* IF_BRANCH */) {
|
|
// perform the transform on node exit so that all expressions have already
|
|
// been processed.
|
|
return () => {
|
|
const children = node.children;
|
|
let currentContainer = undefined;
|
|
let hasText = false;
|
|
for (let i = 0; i < children.length; i++) {
|
|
const child = children[i];
|
|
if (isText(child)) {
|
|
hasText = true;
|
|
for (let j = i + 1; j < children.length; j++) {
|
|
const next = children[j];
|
|
if (isText(next)) {
|
|
if (!currentContainer) {
|
|
currentContainer = children[i] = {
|
|
type: 8 /* COMPOUND_EXPRESSION */,
|
|
loc: child.loc,
|
|
children: [child]
|
|
};
|
|
}
|
|
// merge adjacent text node into current
|
|
currentContainer.children.push(` + `, next);
|
|
children.splice(j, 1);
|
|
j--;
|
|
}
|
|
else {
|
|
currentContainer = undefined;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
if (!hasText ||
|
|
// if this is a plain element with a single text child, leave it
|
|
// as-is since the runtime has dedicated fast path for this by directly
|
|
// setting textContent of the element.
|
|
// for component root it's always normalized anyway.
|
|
(children.length === 1 &&
|
|
(node.type === 0 /* ROOT */ ||
|
|
(node.type === 1 /* ELEMENT */ &&
|
|
node.tagType === 0 /* ELEMENT */ &&
|
|
// #3756
|
|
// custom directives can potentially add DOM elements arbitrarily,
|
|
// we need to avoid setting textContent of the element at runtime
|
|
// to avoid accidentally overwriting the DOM elements added
|
|
// by the user through custom directives.
|
|
!node.props.find(p => p.type === 7 /* DIRECTIVE */ &&
|
|
!context.directiveTransforms[p.name]) &&
|
|
// in compat mode, <template> tags with no special directives
|
|
// will be rendered as a fragment so its children must be
|
|
// converted into vnodes.
|
|
!(node.tag === 'template'))))) {
|
|
return;
|
|
}
|
|
// pre-convert text nodes into createTextVNode(text) calls to avoid
|
|
// runtime normalization.
|
|
for (let i = 0; i < children.length; i++) {
|
|
const child = children[i];
|
|
if (isText(child) || child.type === 8 /* COMPOUND_EXPRESSION */) {
|
|
const callArgs = [];
|
|
// createTextVNode defaults to single whitespace, so if it is a
|
|
// single space the code could be an empty call to save bytes.
|
|
if (child.type !== 2 /* TEXT */ || child.content !== ' ') {
|
|
callArgs.push(child);
|
|
}
|
|
// mark dynamic text with flag so it gets patched inside a block
|
|
if (!context.ssr &&
|
|
getConstantType(child, context) === 0 /* NOT_CONSTANT */) {
|
|
callArgs.push(1 /* TEXT */ +
|
|
(( true) ? ` /* ${_vue_shared__WEBPACK_IMPORTED_MODULE_0__.PatchFlagNames[1]} */` : 0));
|
|
}
|
|
children[i] = {
|
|
type: 12 /* TEXT_CALL */,
|
|
content: child,
|
|
loc: child.loc,
|
|
codegenNode: createCallExpression(context.helper(CREATE_TEXT), callArgs)
|
|
};
|
|
}
|
|
}
|
|
};
|
|
}
|
|
};
|
|
|
|
const seen = new WeakSet();
|
|
const transformOnce = (node, context) => {
|
|
if (node.type === 1 /* ELEMENT */ && findDir(node, 'once', true)) {
|
|
if (seen.has(node) || context.inVOnce) {
|
|
return;
|
|
}
|
|
seen.add(node);
|
|
context.inVOnce = true;
|
|
context.helper(SET_BLOCK_TRACKING);
|
|
return () => {
|
|
context.inVOnce = false;
|
|
const cur = context.currentNode;
|
|
if (cur.codegenNode) {
|
|
cur.codegenNode = context.cache(cur.codegenNode, true /* isVNode */);
|
|
}
|
|
};
|
|
}
|
|
};
|
|
|
|
const transformModel = (dir, node, context) => {
|
|
const { exp, arg } = dir;
|
|
if (!exp) {
|
|
context.onError(createCompilerError(40 /* X_V_MODEL_NO_EXPRESSION */, dir.loc));
|
|
return createTransformProps();
|
|
}
|
|
const rawExp = exp.loc.source;
|
|
const expString = exp.type === 4 /* SIMPLE_EXPRESSION */ ? exp.content : rawExp;
|
|
// im SFC <script setup> inline mode, the exp may have been transformed into
|
|
// _unref(exp)
|
|
context.bindingMetadata[rawExp];
|
|
const maybeRef = !true /* SETUP_CONST */;
|
|
if (!expString.trim() || (!isMemberExpression(expString) && !maybeRef)) {
|
|
context.onError(createCompilerError(41 /* X_V_MODEL_MALFORMED_EXPRESSION */, exp.loc));
|
|
return createTransformProps();
|
|
}
|
|
const propName = arg ? arg : createSimpleExpression('modelValue', true);
|
|
const eventName = arg
|
|
? isStaticExp(arg)
|
|
? `onUpdate:${arg.content}`
|
|
: createCompoundExpression(['"onUpdate:" + ', arg])
|
|
: `onUpdate:modelValue`;
|
|
let assignmentExp;
|
|
const eventArg = context.isTS ? `($event: any)` : `$event`;
|
|
{
|
|
assignmentExp = createCompoundExpression([
|
|
`${eventArg} => (`,
|
|
exp,
|
|
` = $event)`
|
|
]);
|
|
}
|
|
const props = [
|
|
// modelValue: foo
|
|
createObjectProperty(propName, dir.exp),
|
|
// "onUpdate:modelValue": $event => (foo = $event)
|
|
createObjectProperty(eventName, assignmentExp)
|
|
];
|
|
// modelModifiers: { foo: true, "bar-baz": true }
|
|
if (dir.modifiers.length && node.tagType === 1 /* COMPONENT */) {
|
|
const modifiers = dir.modifiers
|
|
.map(m => (isSimpleIdentifier(m) ? m : JSON.stringify(m)) + `: true`)
|
|
.join(`, `);
|
|
const modifiersKey = arg
|
|
? isStaticExp(arg)
|
|
? `${arg.content}Modifiers`
|
|
: createCompoundExpression([arg, ' + "Modifiers"'])
|
|
: `modelModifiers`;
|
|
props.push(createObjectProperty(modifiersKey, createSimpleExpression(`{ ${modifiers} }`, false, dir.loc, 2 /* CAN_HOIST */)));
|
|
}
|
|
return createTransformProps(props);
|
|
};
|
|
function createTransformProps(props = []) {
|
|
return { props };
|
|
}
|
|
|
|
const validDivisionCharRE = /[\w).+\-_$\]]/;
|
|
const transformFilter = (node, context) => {
|
|
if (!isCompatEnabled("COMPILER_FILTER" /* COMPILER_FILTERS */, context)) {
|
|
return;
|
|
}
|
|
if (node.type === 5 /* INTERPOLATION */) {
|
|
// filter rewrite is applied before expression transform so only
|
|
// simple expressions are possible at this stage
|
|
rewriteFilter(node.content, context);
|
|
}
|
|
if (node.type === 1 /* ELEMENT */) {
|
|
node.props.forEach((prop) => {
|
|
if (prop.type === 7 /* DIRECTIVE */ &&
|
|
prop.name !== 'for' &&
|
|
prop.exp) {
|
|
rewriteFilter(prop.exp, context);
|
|
}
|
|
});
|
|
}
|
|
};
|
|
function rewriteFilter(node, context) {
|
|
if (node.type === 4 /* SIMPLE_EXPRESSION */) {
|
|
parseFilter(node, context);
|
|
}
|
|
else {
|
|
for (let i = 0; i < node.children.length; i++) {
|
|
const child = node.children[i];
|
|
if (typeof child !== 'object')
|
|
continue;
|
|
if (child.type === 4 /* SIMPLE_EXPRESSION */) {
|
|
parseFilter(child, context);
|
|
}
|
|
else if (child.type === 8 /* COMPOUND_EXPRESSION */) {
|
|
rewriteFilter(node, context);
|
|
}
|
|
else if (child.type === 5 /* INTERPOLATION */) {
|
|
rewriteFilter(child.content, context);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
function parseFilter(node, context) {
|
|
const exp = node.content;
|
|
let inSingle = false;
|
|
let inDouble = false;
|
|
let inTemplateString = false;
|
|
let inRegex = false;
|
|
let curly = 0;
|
|
let square = 0;
|
|
let paren = 0;
|
|
let lastFilterIndex = 0;
|
|
let c, prev, i, expression, filters = [];
|
|
for (i = 0; i < exp.length; i++) {
|
|
prev = c;
|
|
c = exp.charCodeAt(i);
|
|
if (inSingle) {
|
|
if (c === 0x27 && prev !== 0x5c)
|
|
inSingle = false;
|
|
}
|
|
else if (inDouble) {
|
|
if (c === 0x22 && prev !== 0x5c)
|
|
inDouble = false;
|
|
}
|
|
else if (inTemplateString) {
|
|
if (c === 0x60 && prev !== 0x5c)
|
|
inTemplateString = false;
|
|
}
|
|
else if (inRegex) {
|
|
if (c === 0x2f && prev !== 0x5c)
|
|
inRegex = false;
|
|
}
|
|
else if (c === 0x7c && // pipe
|
|
exp.charCodeAt(i + 1) !== 0x7c &&
|
|
exp.charCodeAt(i - 1) !== 0x7c &&
|
|
!curly &&
|
|
!square &&
|
|
!paren) {
|
|
if (expression === undefined) {
|
|
// first filter, end of expression
|
|
lastFilterIndex = i + 1;
|
|
expression = exp.slice(0, i).trim();
|
|
}
|
|
else {
|
|
pushFilter();
|
|
}
|
|
}
|
|
else {
|
|
switch (c) {
|
|
case 0x22:
|
|
inDouble = true;
|
|
break; // "
|
|
case 0x27:
|
|
inSingle = true;
|
|
break; // '
|
|
case 0x60:
|
|
inTemplateString = true;
|
|
break; // `
|
|
case 0x28:
|
|
paren++;
|
|
break; // (
|
|
case 0x29:
|
|
paren--;
|
|
break; // )
|
|
case 0x5b:
|
|
square++;
|
|
break; // [
|
|
case 0x5d:
|
|
square--;
|
|
break; // ]
|
|
case 0x7b:
|
|
curly++;
|
|
break; // {
|
|
case 0x7d:
|
|
curly--;
|
|
break; // }
|
|
}
|
|
if (c === 0x2f) {
|
|
// /
|
|
let j = i - 1;
|
|
let p;
|
|
// find first non-whitespace prev char
|
|
for (; j >= 0; j--) {
|
|
p = exp.charAt(j);
|
|
if (p !== ' ')
|
|
break;
|
|
}
|
|
if (!p || !validDivisionCharRE.test(p)) {
|
|
inRegex = true;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
if (expression === undefined) {
|
|
expression = exp.slice(0, i).trim();
|
|
}
|
|
else if (lastFilterIndex !== 0) {
|
|
pushFilter();
|
|
}
|
|
function pushFilter() {
|
|
filters.push(exp.slice(lastFilterIndex, i).trim());
|
|
lastFilterIndex = i + 1;
|
|
}
|
|
if (filters.length) {
|
|
( true) &&
|
|
warnDeprecation("COMPILER_FILTER" /* COMPILER_FILTERS */, context, node.loc);
|
|
for (i = 0; i < filters.length; i++) {
|
|
expression = wrapFilter(expression, filters[i], context);
|
|
}
|
|
node.content = expression;
|
|
}
|
|
}
|
|
function wrapFilter(exp, filter, context) {
|
|
context.helper(RESOLVE_FILTER);
|
|
const i = filter.indexOf('(');
|
|
if (i < 0) {
|
|
context.filters.add(filter);
|
|
return `${toValidAssetId(filter, 'filter')}(${exp})`;
|
|
}
|
|
else {
|
|
const name = filter.slice(0, i);
|
|
const args = filter.slice(i + 1);
|
|
context.filters.add(name);
|
|
return `${toValidAssetId(name, 'filter')}(${exp}${args !== ')' ? ',' + args : args}`;
|
|
}
|
|
}
|
|
|
|
const seen$1 = new WeakSet();
|
|
const transformMemo = (node, context) => {
|
|
if (node.type === 1 /* ELEMENT */) {
|
|
const dir = findDir(node, 'memo');
|
|
if (!dir || seen$1.has(node)) {
|
|
return;
|
|
}
|
|
seen$1.add(node);
|
|
return () => {
|
|
const codegenNode = node.codegenNode ||
|
|
context.currentNode.codegenNode;
|
|
if (codegenNode && codegenNode.type === 13 /* VNODE_CALL */) {
|
|
// non-component sub tree should be turned into a block
|
|
if (node.tagType !== 1 /* COMPONENT */) {
|
|
makeBlock(codegenNode, context);
|
|
}
|
|
node.codegenNode = createCallExpression(context.helper(WITH_MEMO), [
|
|
dir.exp,
|
|
createFunctionExpression(undefined, codegenNode),
|
|
`_cache`,
|
|
String(context.cached++)
|
|
]);
|
|
}
|
|
};
|
|
}
|
|
};
|
|
|
|
function getBaseTransformPreset(prefixIdentifiers) {
|
|
return [
|
|
[
|
|
transformOnce,
|
|
transformIf,
|
|
transformMemo,
|
|
transformFor,
|
|
...([transformFilter] ),
|
|
...(( true)
|
|
? [transformExpression]
|
|
: 0),
|
|
transformSlotOutlet,
|
|
transformElement,
|
|
trackSlotScopes,
|
|
transformText
|
|
],
|
|
{
|
|
on: transformOn,
|
|
bind: transformBind,
|
|
model: transformModel
|
|
}
|
|
];
|
|
}
|
|
// we name it `baseCompile` so that higher order compilers like
|
|
// @vue/compiler-dom can export `compile` while re-exporting everything else.
|
|
function baseCompile(template, options = {}) {
|
|
const onError = options.onError || defaultOnError;
|
|
const isModuleMode = options.mode === 'module';
|
|
/* istanbul ignore if */
|
|
{
|
|
if (options.prefixIdentifiers === true) {
|
|
onError(createCompilerError(45 /* X_PREFIX_ID_NOT_SUPPORTED */));
|
|
}
|
|
else if (isModuleMode) {
|
|
onError(createCompilerError(46 /* X_MODULE_MODE_NOT_SUPPORTED */));
|
|
}
|
|
}
|
|
const prefixIdentifiers = !true ;
|
|
if (options.cacheHandlers) {
|
|
onError(createCompilerError(47 /* X_CACHE_HANDLER_NOT_SUPPORTED */));
|
|
}
|
|
if (options.scopeId && !isModuleMode) {
|
|
onError(createCompilerError(48 /* X_SCOPE_ID_NOT_SUPPORTED */));
|
|
}
|
|
const ast = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isString)(template) ? baseParse(template, options) : template;
|
|
const [nodeTransforms, directiveTransforms] = getBaseTransformPreset();
|
|
transform(ast, (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.extend)({}, options, {
|
|
prefixIdentifiers,
|
|
nodeTransforms: [
|
|
...nodeTransforms,
|
|
...(options.nodeTransforms || []) // user transforms
|
|
],
|
|
directiveTransforms: (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.extend)({}, directiveTransforms, options.directiveTransforms || {} // user transforms
|
|
)
|
|
}));
|
|
return generate(ast, (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.extend)({}, options, {
|
|
prefixIdentifiers
|
|
}));
|
|
}
|
|
|
|
const noopDirectiveTransform = () => ({ props: [] });
|
|
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/compiler-dom/dist/compiler-dom.esm-bundler.js":
|
|
/*!*************************************************************************!*\
|
|
!*** ./node_modules/@vue/compiler-dom/dist/compiler-dom.esm-bundler.js ***!
|
|
\*************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "BASE_TRANSITION": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.BASE_TRANSITION),
|
|
/* harmony export */ "CAMELIZE": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.CAMELIZE),
|
|
/* harmony export */ "CAPITALIZE": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.CAPITALIZE),
|
|
/* harmony export */ "CREATE_BLOCK": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.CREATE_BLOCK),
|
|
/* harmony export */ "CREATE_COMMENT": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.CREATE_COMMENT),
|
|
/* harmony export */ "CREATE_ELEMENT_BLOCK": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.CREATE_ELEMENT_BLOCK),
|
|
/* harmony export */ "CREATE_ELEMENT_VNODE": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.CREATE_ELEMENT_VNODE),
|
|
/* harmony export */ "CREATE_SLOTS": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.CREATE_SLOTS),
|
|
/* harmony export */ "CREATE_STATIC": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.CREATE_STATIC),
|
|
/* harmony export */ "CREATE_TEXT": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.CREATE_TEXT),
|
|
/* harmony export */ "CREATE_VNODE": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.CREATE_VNODE),
|
|
/* harmony export */ "FRAGMENT": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.FRAGMENT),
|
|
/* harmony export */ "GUARD_REACTIVE_PROPS": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.GUARD_REACTIVE_PROPS),
|
|
/* harmony export */ "IS_MEMO_SAME": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.IS_MEMO_SAME),
|
|
/* harmony export */ "IS_REF": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.IS_REF),
|
|
/* harmony export */ "KEEP_ALIVE": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.KEEP_ALIVE),
|
|
/* harmony export */ "MERGE_PROPS": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.MERGE_PROPS),
|
|
/* harmony export */ "NORMALIZE_CLASS": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.NORMALIZE_CLASS),
|
|
/* harmony export */ "NORMALIZE_PROPS": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.NORMALIZE_PROPS),
|
|
/* harmony export */ "NORMALIZE_STYLE": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.NORMALIZE_STYLE),
|
|
/* harmony export */ "OPEN_BLOCK": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.OPEN_BLOCK),
|
|
/* harmony export */ "POP_SCOPE_ID": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.POP_SCOPE_ID),
|
|
/* harmony export */ "PUSH_SCOPE_ID": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.PUSH_SCOPE_ID),
|
|
/* harmony export */ "RENDER_LIST": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.RENDER_LIST),
|
|
/* harmony export */ "RENDER_SLOT": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.RENDER_SLOT),
|
|
/* harmony export */ "RESOLVE_COMPONENT": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.RESOLVE_COMPONENT),
|
|
/* harmony export */ "RESOLVE_DIRECTIVE": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.RESOLVE_DIRECTIVE),
|
|
/* harmony export */ "RESOLVE_DYNAMIC_COMPONENT": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.RESOLVE_DYNAMIC_COMPONENT),
|
|
/* harmony export */ "RESOLVE_FILTER": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.RESOLVE_FILTER),
|
|
/* harmony export */ "SET_BLOCK_TRACKING": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.SET_BLOCK_TRACKING),
|
|
/* harmony export */ "SUSPENSE": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.SUSPENSE),
|
|
/* harmony export */ "TELEPORT": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.TELEPORT),
|
|
/* harmony export */ "TO_DISPLAY_STRING": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.TO_DISPLAY_STRING),
|
|
/* harmony export */ "TO_HANDLERS": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.TO_HANDLERS),
|
|
/* harmony export */ "TO_HANDLER_KEY": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.TO_HANDLER_KEY),
|
|
/* harmony export */ "UNREF": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.UNREF),
|
|
/* harmony export */ "WITH_CTX": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.WITH_CTX),
|
|
/* harmony export */ "WITH_DIRECTIVES": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.WITH_DIRECTIVES),
|
|
/* harmony export */ "WITH_MEMO": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.WITH_MEMO),
|
|
/* harmony export */ "WITH_SCOPE_ID": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.WITH_SCOPE_ID),
|
|
/* harmony export */ "advancePositionWithClone": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.advancePositionWithClone),
|
|
/* harmony export */ "advancePositionWithMutation": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.advancePositionWithMutation),
|
|
/* harmony export */ "assert": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.assert),
|
|
/* harmony export */ "baseCompile": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.baseCompile),
|
|
/* harmony export */ "baseParse": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.baseParse),
|
|
/* harmony export */ "buildProps": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.buildProps),
|
|
/* harmony export */ "buildSlots": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.buildSlots),
|
|
/* harmony export */ "checkCompatEnabled": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.checkCompatEnabled),
|
|
/* harmony export */ "createArrayExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createArrayExpression),
|
|
/* harmony export */ "createAssignmentExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createAssignmentExpression),
|
|
/* harmony export */ "createBlockStatement": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createBlockStatement),
|
|
/* harmony export */ "createCacheExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createCacheExpression),
|
|
/* harmony export */ "createCallExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createCallExpression),
|
|
/* harmony export */ "createCompilerError": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createCompilerError),
|
|
/* harmony export */ "createCompoundExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createCompoundExpression),
|
|
/* harmony export */ "createConditionalExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createConditionalExpression),
|
|
/* harmony export */ "createForLoopParams": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createForLoopParams),
|
|
/* harmony export */ "createFunctionExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createFunctionExpression),
|
|
/* harmony export */ "createIfStatement": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createIfStatement),
|
|
/* harmony export */ "createInterpolation": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createInterpolation),
|
|
/* harmony export */ "createObjectExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createObjectExpression),
|
|
/* harmony export */ "createObjectProperty": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createObjectProperty),
|
|
/* harmony export */ "createReturnStatement": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createReturnStatement),
|
|
/* harmony export */ "createRoot": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createRoot),
|
|
/* harmony export */ "createSequenceExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createSequenceExpression),
|
|
/* harmony export */ "createSimpleExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createSimpleExpression),
|
|
/* harmony export */ "createStructuralDirectiveTransform": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createStructuralDirectiveTransform),
|
|
/* harmony export */ "createTemplateLiteral": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createTemplateLiteral),
|
|
/* harmony export */ "createTransformContext": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createTransformContext),
|
|
/* harmony export */ "createVNodeCall": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createVNodeCall),
|
|
/* harmony export */ "extractIdentifiers": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.extractIdentifiers),
|
|
/* harmony export */ "findDir": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.findDir),
|
|
/* harmony export */ "findProp": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.findProp),
|
|
/* harmony export */ "generate": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.generate),
|
|
/* harmony export */ "generateCodeFrame": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.generateCodeFrame),
|
|
/* harmony export */ "getBaseTransformPreset": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.getBaseTransformPreset),
|
|
/* harmony export */ "getInnerRange": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.getInnerRange),
|
|
/* harmony export */ "getMemoedVNodeCall": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.getMemoedVNodeCall),
|
|
/* harmony export */ "getVNodeBlockHelper": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.getVNodeBlockHelper),
|
|
/* harmony export */ "getVNodeHelper": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.getVNodeHelper),
|
|
/* harmony export */ "hasDynamicKeyVBind": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.hasDynamicKeyVBind),
|
|
/* harmony export */ "hasScopeRef": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.hasScopeRef),
|
|
/* harmony export */ "helperNameMap": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.helperNameMap),
|
|
/* harmony export */ "injectProp": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.injectProp),
|
|
/* harmony export */ "isBindKey": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isBindKey),
|
|
/* harmony export */ "isBuiltInType": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isBuiltInType),
|
|
/* harmony export */ "isCoreComponent": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isCoreComponent),
|
|
/* harmony export */ "isFunctionType": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isFunctionType),
|
|
/* harmony export */ "isInDestructureAssignment": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isInDestructureAssignment),
|
|
/* harmony export */ "isMemberExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isMemberExpression),
|
|
/* harmony export */ "isReferencedIdentifier": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isReferencedIdentifier),
|
|
/* harmony export */ "isSimpleIdentifier": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isSimpleIdentifier),
|
|
/* harmony export */ "isSlotOutlet": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isSlotOutlet),
|
|
/* harmony export */ "isStaticExp": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isStaticExp),
|
|
/* harmony export */ "isStaticProperty": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isStaticProperty),
|
|
/* harmony export */ "isStaticPropertyKey": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isStaticPropertyKey),
|
|
/* harmony export */ "isTemplateNode": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isTemplateNode),
|
|
/* harmony export */ "isText": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isText),
|
|
/* harmony export */ "isVSlot": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isVSlot),
|
|
/* harmony export */ "locStub": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.locStub),
|
|
/* harmony export */ "makeBlock": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.makeBlock),
|
|
/* harmony export */ "noopDirectiveTransform": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.noopDirectiveTransform),
|
|
/* harmony export */ "processExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.processExpression),
|
|
/* harmony export */ "processFor": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.processFor),
|
|
/* harmony export */ "processIf": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.processIf),
|
|
/* harmony export */ "processSlotOutlet": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.processSlotOutlet),
|
|
/* harmony export */ "registerRuntimeHelpers": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.registerRuntimeHelpers),
|
|
/* harmony export */ "resolveComponentType": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.resolveComponentType),
|
|
/* harmony export */ "toValidAssetId": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.toValidAssetId),
|
|
/* harmony export */ "trackSlotScopes": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.trackSlotScopes),
|
|
/* harmony export */ "trackVForSlotScopes": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.trackVForSlotScopes),
|
|
/* harmony export */ "transform": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.transform),
|
|
/* harmony export */ "transformBind": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.transformBind),
|
|
/* harmony export */ "transformElement": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.transformElement),
|
|
/* harmony export */ "transformExpression": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.transformExpression),
|
|
/* harmony export */ "transformModel": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.transformModel),
|
|
/* harmony export */ "transformOn": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.transformOn),
|
|
/* harmony export */ "traverseNode": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.traverseNode),
|
|
/* harmony export */ "walkBlockDeclarations": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.walkBlockDeclarations),
|
|
/* harmony export */ "walkFunctionParams": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.walkFunctionParams),
|
|
/* harmony export */ "walkIdentifiers": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.walkIdentifiers),
|
|
/* harmony export */ "warnDeprecation": () => (/* reexport safe */ _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.warnDeprecation),
|
|
/* harmony export */ "DOMDirectiveTransforms": () => (/* binding */ DOMDirectiveTransforms),
|
|
/* harmony export */ "DOMNodeTransforms": () => (/* binding */ DOMNodeTransforms),
|
|
/* harmony export */ "TRANSITION": () => (/* binding */ TRANSITION),
|
|
/* harmony export */ "TRANSITION_GROUP": () => (/* binding */ TRANSITION_GROUP),
|
|
/* harmony export */ "V_MODEL_CHECKBOX": () => (/* binding */ V_MODEL_CHECKBOX),
|
|
/* harmony export */ "V_MODEL_DYNAMIC": () => (/* binding */ V_MODEL_DYNAMIC),
|
|
/* harmony export */ "V_MODEL_RADIO": () => (/* binding */ V_MODEL_RADIO),
|
|
/* harmony export */ "V_MODEL_SELECT": () => (/* binding */ V_MODEL_SELECT),
|
|
/* harmony export */ "V_MODEL_TEXT": () => (/* binding */ V_MODEL_TEXT),
|
|
/* harmony export */ "V_ON_WITH_KEYS": () => (/* binding */ V_ON_WITH_KEYS),
|
|
/* harmony export */ "V_ON_WITH_MODIFIERS": () => (/* binding */ V_ON_WITH_MODIFIERS),
|
|
/* harmony export */ "V_SHOW": () => (/* binding */ V_SHOW),
|
|
/* harmony export */ "compile": () => (/* binding */ compile),
|
|
/* harmony export */ "createDOMCompilerError": () => (/* binding */ createDOMCompilerError),
|
|
/* harmony export */ "parse": () => (/* binding */ parse),
|
|
/* harmony export */ "parserOptions": () => (/* binding */ parserOptions),
|
|
/* harmony export */ "transformStyle": () => (/* binding */ transformStyle)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @vue/compiler-core */ "./node_modules/@vue/compiler-core/dist/compiler-core.esm-bundler.js");
|
|
/* harmony import */ var _vue_shared__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @vue/shared */ "./node_modules/@vue/shared/dist/shared.esm-bundler.js");
|
|
|
|
|
|
|
|
|
|
const V_MODEL_RADIO = Symbol(( true) ? `vModelRadio` : 0);
|
|
const V_MODEL_CHECKBOX = Symbol(( true) ? `vModelCheckbox` : 0);
|
|
const V_MODEL_TEXT = Symbol(( true) ? `vModelText` : 0);
|
|
const V_MODEL_SELECT = Symbol(( true) ? `vModelSelect` : 0);
|
|
const V_MODEL_DYNAMIC = Symbol(( true) ? `vModelDynamic` : 0);
|
|
const V_ON_WITH_MODIFIERS = Symbol(( true) ? `vOnModifiersGuard` : 0);
|
|
const V_ON_WITH_KEYS = Symbol(( true) ? `vOnKeysGuard` : 0);
|
|
const V_SHOW = Symbol(( true) ? `vShow` : 0);
|
|
const TRANSITION = Symbol(( true) ? `Transition` : 0);
|
|
const TRANSITION_GROUP = Symbol(( true) ? `TransitionGroup` : 0);
|
|
(0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.registerRuntimeHelpers)({
|
|
[V_MODEL_RADIO]: `vModelRadio`,
|
|
[V_MODEL_CHECKBOX]: `vModelCheckbox`,
|
|
[V_MODEL_TEXT]: `vModelText`,
|
|
[V_MODEL_SELECT]: `vModelSelect`,
|
|
[V_MODEL_DYNAMIC]: `vModelDynamic`,
|
|
[V_ON_WITH_MODIFIERS]: `withModifiers`,
|
|
[V_ON_WITH_KEYS]: `withKeys`,
|
|
[V_SHOW]: `vShow`,
|
|
[TRANSITION]: `Transition`,
|
|
[TRANSITION_GROUP]: `TransitionGroup`
|
|
});
|
|
|
|
/* eslint-disable no-restricted-globals */
|
|
let decoder;
|
|
function decodeHtmlBrowser(raw, asAttr = false) {
|
|
if (!decoder) {
|
|
decoder = document.createElement('div');
|
|
}
|
|
if (asAttr) {
|
|
decoder.innerHTML = `<div foo="${raw.replace(/"/g, '"')}">`;
|
|
return decoder.children[0].getAttribute('foo');
|
|
}
|
|
else {
|
|
decoder.innerHTML = raw;
|
|
return decoder.textContent;
|
|
}
|
|
}
|
|
|
|
const isRawTextContainer = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.makeMap)('style,iframe,script,noscript', true);
|
|
const parserOptions = {
|
|
isVoidTag: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.isVoidTag,
|
|
isNativeTag: tag => (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isHTMLTag)(tag) || (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isSVGTag)(tag),
|
|
isPreTag: tag => tag === 'pre',
|
|
decodeEntities: decodeHtmlBrowser ,
|
|
isBuiltInComponent: (tag) => {
|
|
if ((0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isBuiltInType)(tag, `Transition`)) {
|
|
return TRANSITION;
|
|
}
|
|
else if ((0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isBuiltInType)(tag, `TransitionGroup`)) {
|
|
return TRANSITION_GROUP;
|
|
}
|
|
},
|
|
// https://html.spec.whatwg.org/multipage/parsing.html#tree-construction-dispatcher
|
|
getNamespace(tag, parent) {
|
|
let ns = parent ? parent.ns : 0 /* HTML */;
|
|
if (parent && ns === 2 /* MATH_ML */) {
|
|
if (parent.tag === 'annotation-xml') {
|
|
if (tag === 'svg') {
|
|
return 1 /* SVG */;
|
|
}
|
|
if (parent.props.some(a => a.type === 6 /* ATTRIBUTE */ &&
|
|
a.name === 'encoding' &&
|
|
a.value != null &&
|
|
(a.value.content === 'text/html' ||
|
|
a.value.content === 'application/xhtml+xml'))) {
|
|
ns = 0 /* HTML */;
|
|
}
|
|
}
|
|
else if (/^m(?:[ions]|text)$/.test(parent.tag) &&
|
|
tag !== 'mglyph' &&
|
|
tag !== 'malignmark') {
|
|
ns = 0 /* HTML */;
|
|
}
|
|
}
|
|
else if (parent && ns === 1 /* SVG */) {
|
|
if (parent.tag === 'foreignObject' ||
|
|
parent.tag === 'desc' ||
|
|
parent.tag === 'title') {
|
|
ns = 0 /* HTML */;
|
|
}
|
|
}
|
|
if (ns === 0 /* HTML */) {
|
|
if (tag === 'svg') {
|
|
return 1 /* SVG */;
|
|
}
|
|
if (tag === 'math') {
|
|
return 2 /* MATH_ML */;
|
|
}
|
|
}
|
|
return ns;
|
|
},
|
|
// https://html.spec.whatwg.org/multipage/parsing.html#parsing-html-fragments
|
|
getTextMode({ tag, ns }) {
|
|
if (ns === 0 /* HTML */) {
|
|
if (tag === 'textarea' || tag === 'title') {
|
|
return 1 /* RCDATA */;
|
|
}
|
|
if (isRawTextContainer(tag)) {
|
|
return 2 /* RAWTEXT */;
|
|
}
|
|
}
|
|
return 0 /* DATA */;
|
|
}
|
|
};
|
|
|
|
// Parse inline CSS strings for static style attributes into an object.
|
|
// This is a NodeTransform since it works on the static `style` attribute and
|
|
// converts it into a dynamic equivalent:
|
|
// style="color: red" -> :style='{ "color": "red" }'
|
|
// It is then processed by `transformElement` and included in the generated
|
|
// props.
|
|
const transformStyle = node => {
|
|
if (node.type === 1 /* ELEMENT */) {
|
|
node.props.forEach((p, i) => {
|
|
if (p.type === 6 /* ATTRIBUTE */ && p.name === 'style' && p.value) {
|
|
// replace p with an expression node
|
|
node.props[i] = {
|
|
type: 7 /* DIRECTIVE */,
|
|
name: `bind`,
|
|
arg: (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createSimpleExpression)(`style`, true, p.loc),
|
|
exp: parseInlineCSS(p.value.content, p.loc),
|
|
modifiers: [],
|
|
loc: p.loc
|
|
};
|
|
}
|
|
});
|
|
}
|
|
};
|
|
const parseInlineCSS = (cssText, loc) => {
|
|
const normalized = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.parseStringStyle)(cssText);
|
|
return (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createSimpleExpression)(JSON.stringify(normalized), false, loc, 3 /* CAN_STRINGIFY */);
|
|
};
|
|
|
|
function createDOMCompilerError(code, loc) {
|
|
return (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createCompilerError)(code, loc, true ? DOMErrorMessages : 0);
|
|
}
|
|
const DOMErrorMessages = {
|
|
[49 /* X_V_HTML_NO_EXPRESSION */]: `v-html is missing expression.`,
|
|
[50 /* X_V_HTML_WITH_CHILDREN */]: `v-html will override element children.`,
|
|
[51 /* X_V_TEXT_NO_EXPRESSION */]: `v-text is missing expression.`,
|
|
[52 /* X_V_TEXT_WITH_CHILDREN */]: `v-text will override element children.`,
|
|
[53 /* X_V_MODEL_ON_INVALID_ELEMENT */]: `v-model can only be used on <input>, <textarea> and <select> elements.`,
|
|
[54 /* X_V_MODEL_ARG_ON_ELEMENT */]: `v-model argument is not supported on plain elements.`,
|
|
[55 /* X_V_MODEL_ON_FILE_INPUT_ELEMENT */]: `v-model cannot be used on file inputs since they are read-only. Use a v-on:change listener instead.`,
|
|
[56 /* X_V_MODEL_UNNECESSARY_VALUE */]: `Unnecessary value binding used alongside v-model. It will interfere with v-model's behavior.`,
|
|
[57 /* X_V_SHOW_NO_EXPRESSION */]: `v-show is missing expression.`,
|
|
[58 /* X_TRANSITION_INVALID_CHILDREN */]: `<Transition> expects exactly one child element or component.`,
|
|
[59 /* X_IGNORED_SIDE_EFFECT_TAG */]: `Tags with side effect (<script> and <style>) are ignored in client component templates.`
|
|
};
|
|
|
|
const transformVHtml = (dir, node, context) => {
|
|
const { exp, loc } = dir;
|
|
if (!exp) {
|
|
context.onError(createDOMCompilerError(49 /* X_V_HTML_NO_EXPRESSION */, loc));
|
|
}
|
|
if (node.children.length) {
|
|
context.onError(createDOMCompilerError(50 /* X_V_HTML_WITH_CHILDREN */, loc));
|
|
node.children.length = 0;
|
|
}
|
|
return {
|
|
props: [
|
|
(0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createObjectProperty)((0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createSimpleExpression)(`innerHTML`, true, loc), exp || (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createSimpleExpression)('', true))
|
|
]
|
|
};
|
|
};
|
|
|
|
const transformVText = (dir, node, context) => {
|
|
const { exp, loc } = dir;
|
|
if (!exp) {
|
|
context.onError(createDOMCompilerError(51 /* X_V_TEXT_NO_EXPRESSION */, loc));
|
|
}
|
|
if (node.children.length) {
|
|
context.onError(createDOMCompilerError(52 /* X_V_TEXT_WITH_CHILDREN */, loc));
|
|
node.children.length = 0;
|
|
}
|
|
return {
|
|
props: [
|
|
(0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createObjectProperty)((0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createSimpleExpression)(`textContent`, true), exp
|
|
? (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createCallExpression)(context.helperString(_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.TO_DISPLAY_STRING), [exp], loc)
|
|
: (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createSimpleExpression)('', true))
|
|
]
|
|
};
|
|
};
|
|
|
|
const transformModel = (dir, node, context) => {
|
|
const baseResult = (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.transformModel)(dir, node, context);
|
|
// base transform has errors OR component v-model (only need props)
|
|
if (!baseResult.props.length || node.tagType === 1 /* COMPONENT */) {
|
|
return baseResult;
|
|
}
|
|
if (dir.arg) {
|
|
context.onError(createDOMCompilerError(54 /* X_V_MODEL_ARG_ON_ELEMENT */, dir.arg.loc));
|
|
}
|
|
function checkDuplicatedValue() {
|
|
const value = (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.findProp)(node, 'value');
|
|
if (value) {
|
|
context.onError(createDOMCompilerError(56 /* X_V_MODEL_UNNECESSARY_VALUE */, value.loc));
|
|
}
|
|
}
|
|
const { tag } = node;
|
|
const isCustomElement = context.isCustomElement(tag);
|
|
if (tag === 'input' ||
|
|
tag === 'textarea' ||
|
|
tag === 'select' ||
|
|
isCustomElement) {
|
|
let directiveToUse = V_MODEL_TEXT;
|
|
let isInvalidType = false;
|
|
if (tag === 'input' || isCustomElement) {
|
|
const type = (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.findProp)(node, `type`);
|
|
if (type) {
|
|
if (type.type === 7 /* DIRECTIVE */) {
|
|
// :type="foo"
|
|
directiveToUse = V_MODEL_DYNAMIC;
|
|
}
|
|
else if (type.value) {
|
|
switch (type.value.content) {
|
|
case 'radio':
|
|
directiveToUse = V_MODEL_RADIO;
|
|
break;
|
|
case 'checkbox':
|
|
directiveToUse = V_MODEL_CHECKBOX;
|
|
break;
|
|
case 'file':
|
|
isInvalidType = true;
|
|
context.onError(createDOMCompilerError(55 /* X_V_MODEL_ON_FILE_INPUT_ELEMENT */, dir.loc));
|
|
break;
|
|
default:
|
|
// text type
|
|
( true) && checkDuplicatedValue();
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
else if ((0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.hasDynamicKeyVBind)(node)) {
|
|
// element has bindings with dynamic keys, which can possibly contain
|
|
// "type".
|
|
directiveToUse = V_MODEL_DYNAMIC;
|
|
}
|
|
else {
|
|
// text type
|
|
( true) && checkDuplicatedValue();
|
|
}
|
|
}
|
|
else if (tag === 'select') {
|
|
directiveToUse = V_MODEL_SELECT;
|
|
}
|
|
else {
|
|
// textarea
|
|
( true) && checkDuplicatedValue();
|
|
}
|
|
// inject runtime directive
|
|
// by returning the helper symbol via needRuntime
|
|
// the import will replaced a resolveDirective call.
|
|
if (!isInvalidType) {
|
|
baseResult.needRuntime = context.helper(directiveToUse);
|
|
}
|
|
}
|
|
else {
|
|
context.onError(createDOMCompilerError(53 /* X_V_MODEL_ON_INVALID_ELEMENT */, dir.loc));
|
|
}
|
|
// native vmodel doesn't need the `modelValue` props since they are also
|
|
// passed to the runtime as `binding.value`. removing it reduces code size.
|
|
baseResult.props = baseResult.props.filter(p => !(p.key.type === 4 /* SIMPLE_EXPRESSION */ &&
|
|
p.key.content === 'modelValue'));
|
|
return baseResult;
|
|
};
|
|
|
|
const isEventOptionModifier = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.makeMap)(`passive,once,capture`);
|
|
const isNonKeyModifier = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.makeMap)(
|
|
// event propagation management
|
|
`stop,prevent,self,` +
|
|
// system modifiers + exact
|
|
`ctrl,shift,alt,meta,exact,` +
|
|
// mouse
|
|
`middle`);
|
|
// left & right could be mouse or key modifiers based on event type
|
|
const maybeKeyModifier = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.makeMap)('left,right');
|
|
const isKeyboardEvent = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.makeMap)(`onkeyup,onkeydown,onkeypress`, true);
|
|
const resolveModifiers = (key, modifiers, context, loc) => {
|
|
const keyModifiers = [];
|
|
const nonKeyModifiers = [];
|
|
const eventOptionModifiers = [];
|
|
for (let i = 0; i < modifiers.length; i++) {
|
|
const modifier = modifiers[i];
|
|
if (modifier === 'native' &&
|
|
(0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.checkCompatEnabled)("COMPILER_V_ON_NATIVE" /* COMPILER_V_ON_NATIVE */, context, loc)) {
|
|
eventOptionModifiers.push(modifier);
|
|
}
|
|
else if (isEventOptionModifier(modifier)) {
|
|
// eventOptionModifiers: modifiers for addEventListener() options,
|
|
// e.g. .passive & .capture
|
|
eventOptionModifiers.push(modifier);
|
|
}
|
|
else {
|
|
// runtimeModifiers: modifiers that needs runtime guards
|
|
if (maybeKeyModifier(modifier)) {
|
|
if ((0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isStaticExp)(key)) {
|
|
if (isKeyboardEvent(key.content)) {
|
|
keyModifiers.push(modifier);
|
|
}
|
|
else {
|
|
nonKeyModifiers.push(modifier);
|
|
}
|
|
}
|
|
else {
|
|
keyModifiers.push(modifier);
|
|
nonKeyModifiers.push(modifier);
|
|
}
|
|
}
|
|
else {
|
|
if (isNonKeyModifier(modifier)) {
|
|
nonKeyModifiers.push(modifier);
|
|
}
|
|
else {
|
|
keyModifiers.push(modifier);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return {
|
|
keyModifiers,
|
|
nonKeyModifiers,
|
|
eventOptionModifiers
|
|
};
|
|
};
|
|
const transformClick = (key, event) => {
|
|
const isStaticClick = (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isStaticExp)(key) && key.content.toLowerCase() === 'onclick';
|
|
return isStaticClick
|
|
? (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createSimpleExpression)(event, true)
|
|
: key.type !== 4 /* SIMPLE_EXPRESSION */
|
|
? (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createCompoundExpression)([
|
|
`(`,
|
|
key,
|
|
`) === "onClick" ? "${event}" : (`,
|
|
key,
|
|
`)`
|
|
])
|
|
: key;
|
|
};
|
|
const transformOn = (dir, node, context) => {
|
|
return (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.transformOn)(dir, node, context, baseResult => {
|
|
const { modifiers } = dir;
|
|
if (!modifiers.length)
|
|
return baseResult;
|
|
let { key, value: handlerExp } = baseResult.props[0];
|
|
const { keyModifiers, nonKeyModifiers, eventOptionModifiers } = resolveModifiers(key, modifiers, context, dir.loc);
|
|
// normalize click.right and click.middle since they don't actually fire
|
|
if (nonKeyModifiers.includes('right')) {
|
|
key = transformClick(key, `onContextmenu`);
|
|
}
|
|
if (nonKeyModifiers.includes('middle')) {
|
|
key = transformClick(key, `onMouseup`);
|
|
}
|
|
if (nonKeyModifiers.length) {
|
|
handlerExp = (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createCallExpression)(context.helper(V_ON_WITH_MODIFIERS), [
|
|
handlerExp,
|
|
JSON.stringify(nonKeyModifiers)
|
|
]);
|
|
}
|
|
if (keyModifiers.length &&
|
|
// if event name is dynamic, always wrap with keys guard
|
|
(!(0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isStaticExp)(key) || isKeyboardEvent(key.content))) {
|
|
handlerExp = (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createCallExpression)(context.helper(V_ON_WITH_KEYS), [
|
|
handlerExp,
|
|
JSON.stringify(keyModifiers)
|
|
]);
|
|
}
|
|
if (eventOptionModifiers.length) {
|
|
const modifierPostfix = eventOptionModifiers.map(_vue_shared__WEBPACK_IMPORTED_MODULE_1__.capitalize).join('');
|
|
key = (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.isStaticExp)(key)
|
|
? (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createSimpleExpression)(`${key.content}${modifierPostfix}`, true)
|
|
: (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createCompoundExpression)([`(`, key, `) + "${modifierPostfix}"`]);
|
|
}
|
|
return {
|
|
props: [(0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.createObjectProperty)(key, handlerExp)]
|
|
};
|
|
});
|
|
};
|
|
|
|
const transformShow = (dir, node, context) => {
|
|
const { exp, loc } = dir;
|
|
if (!exp) {
|
|
context.onError(createDOMCompilerError(57 /* X_V_SHOW_NO_EXPRESSION */, loc));
|
|
}
|
|
return {
|
|
props: [],
|
|
needRuntime: context.helper(V_SHOW)
|
|
};
|
|
};
|
|
|
|
const warnTransitionChildren = (node, context) => {
|
|
if (node.type === 1 /* ELEMENT */ &&
|
|
node.tagType === 1 /* COMPONENT */) {
|
|
const component = context.isBuiltInComponent(node.tag);
|
|
if (component === TRANSITION) {
|
|
return () => {
|
|
if (node.children.length && hasMultipleChildren(node)) {
|
|
context.onError(createDOMCompilerError(58 /* X_TRANSITION_INVALID_CHILDREN */, {
|
|
start: node.children[0].loc.start,
|
|
end: node.children[node.children.length - 1].loc.end,
|
|
source: ''
|
|
}));
|
|
}
|
|
};
|
|
}
|
|
}
|
|
};
|
|
function hasMultipleChildren(node) {
|
|
// #1352 filter out potential comment nodes.
|
|
const children = (node.children = node.children.filter(c => c.type !== 3 /* COMMENT */));
|
|
const child = children[0];
|
|
return (children.length !== 1 ||
|
|
child.type === 11 /* FOR */ ||
|
|
(child.type === 9 /* IF */ && child.branches.some(hasMultipleChildren)));
|
|
}
|
|
|
|
const ignoreSideEffectTags = (node, context) => {
|
|
if (node.type === 1 /* ELEMENT */ &&
|
|
node.tagType === 0 /* ELEMENT */ &&
|
|
(node.tag === 'script' || node.tag === 'style')) {
|
|
context.onError(createDOMCompilerError(59 /* X_IGNORED_SIDE_EFFECT_TAG */, node.loc));
|
|
context.removeNode();
|
|
}
|
|
};
|
|
|
|
const DOMNodeTransforms = [
|
|
transformStyle,
|
|
...(( true) ? [warnTransitionChildren] : 0)
|
|
];
|
|
const DOMDirectiveTransforms = {
|
|
cloak: _vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.noopDirectiveTransform,
|
|
html: transformVHtml,
|
|
text: transformVText,
|
|
model: transformModel,
|
|
on: transformOn,
|
|
show: transformShow
|
|
};
|
|
function compile(template, options = {}) {
|
|
return (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.baseCompile)(template, (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({}, parserOptions, options, {
|
|
nodeTransforms: [
|
|
// ignore <script> and <tag>
|
|
// this is not put inside DOMNodeTransforms because that list is used
|
|
// by compiler-ssr to generate vnode fallback branches
|
|
ignoreSideEffectTags,
|
|
...DOMNodeTransforms,
|
|
...(options.nodeTransforms || [])
|
|
],
|
|
directiveTransforms: (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({}, DOMDirectiveTransforms, options.directiveTransforms || {}),
|
|
transformHoist: null
|
|
}));
|
|
}
|
|
function parse(template, options = {}) {
|
|
return (0,_vue_compiler_core__WEBPACK_IMPORTED_MODULE_0__.baseParse)(template, (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({}, parserOptions, options));
|
|
}
|
|
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/devtools-api/lib/esm/api/api.js":
|
|
/*!***********************************************************!*\
|
|
!*** ./node_modules/@vue/devtools-api/lib/esm/api/api.js ***!
|
|
\***********************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/devtools-api/lib/esm/api/app.js":
|
|
/*!***********************************************************!*\
|
|
!*** ./node_modules/@vue/devtools-api/lib/esm/api/app.js ***!
|
|
\***********************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/devtools-api/lib/esm/api/component.js":
|
|
/*!*****************************************************************!*\
|
|
!*** ./node_modules/@vue/devtools-api/lib/esm/api/component.js ***!
|
|
\*****************************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/devtools-api/lib/esm/api/context.js":
|
|
/*!***************************************************************!*\
|
|
!*** ./node_modules/@vue/devtools-api/lib/esm/api/context.js ***!
|
|
\***************************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/devtools-api/lib/esm/api/hooks.js":
|
|
/*!*************************************************************!*\
|
|
!*** ./node_modules/@vue/devtools-api/lib/esm/api/hooks.js ***!
|
|
\*************************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/devtools-api/lib/esm/api/index.js":
|
|
/*!*************************************************************!*\
|
|
!*** ./node_modules/@vue/devtools-api/lib/esm/api/index.js ***!
|
|
\*************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony import */ var _api__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./api */ "./node_modules/@vue/devtools-api/lib/esm/api/api.js");
|
|
/* harmony import */ var _api__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_api__WEBPACK_IMPORTED_MODULE_0__);
|
|
/* harmony reexport (unknown) */ var __WEBPACK_REEXPORT_OBJECT__ = {};
|
|
/* harmony reexport (unknown) */ for(const __WEBPACK_IMPORT_KEY__ in _api__WEBPACK_IMPORTED_MODULE_0__) if(__WEBPACK_IMPORT_KEY__ !== "default") __WEBPACK_REEXPORT_OBJECT__[__WEBPACK_IMPORT_KEY__] = () => _api__WEBPACK_IMPORTED_MODULE_0__[__WEBPACK_IMPORT_KEY__]
|
|
/* harmony reexport (unknown) */ __webpack_require__.d(__webpack_exports__, __WEBPACK_REEXPORT_OBJECT__);
|
|
/* harmony import */ var _app__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! ./app */ "./node_modules/@vue/devtools-api/lib/esm/api/app.js");
|
|
/* harmony import */ var _app__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_app__WEBPACK_IMPORTED_MODULE_1__);
|
|
/* harmony reexport (unknown) */ var __WEBPACK_REEXPORT_OBJECT__ = {};
|
|
/* harmony reexport (unknown) */ for(const __WEBPACK_IMPORT_KEY__ in _app__WEBPACK_IMPORTED_MODULE_1__) if(__WEBPACK_IMPORT_KEY__ !== "default") __WEBPACK_REEXPORT_OBJECT__[__WEBPACK_IMPORT_KEY__] = () => _app__WEBPACK_IMPORTED_MODULE_1__[__WEBPACK_IMPORT_KEY__]
|
|
/* harmony reexport (unknown) */ __webpack_require__.d(__webpack_exports__, __WEBPACK_REEXPORT_OBJECT__);
|
|
/* harmony import */ var _component__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! ./component */ "./node_modules/@vue/devtools-api/lib/esm/api/component.js");
|
|
/* harmony import */ var _component__WEBPACK_IMPORTED_MODULE_2___default = /*#__PURE__*/__webpack_require__.n(_component__WEBPACK_IMPORTED_MODULE_2__);
|
|
/* harmony reexport (unknown) */ var __WEBPACK_REEXPORT_OBJECT__ = {};
|
|
/* harmony reexport (unknown) */ for(const __WEBPACK_IMPORT_KEY__ in _component__WEBPACK_IMPORTED_MODULE_2__) if(__WEBPACK_IMPORT_KEY__ !== "default") __WEBPACK_REEXPORT_OBJECT__[__WEBPACK_IMPORT_KEY__] = () => _component__WEBPACK_IMPORTED_MODULE_2__[__WEBPACK_IMPORT_KEY__]
|
|
/* harmony reexport (unknown) */ __webpack_require__.d(__webpack_exports__, __WEBPACK_REEXPORT_OBJECT__);
|
|
/* harmony import */ var _context__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! ./context */ "./node_modules/@vue/devtools-api/lib/esm/api/context.js");
|
|
/* harmony import */ var _context__WEBPACK_IMPORTED_MODULE_3___default = /*#__PURE__*/__webpack_require__.n(_context__WEBPACK_IMPORTED_MODULE_3__);
|
|
/* harmony reexport (unknown) */ var __WEBPACK_REEXPORT_OBJECT__ = {};
|
|
/* harmony reexport (unknown) */ for(const __WEBPACK_IMPORT_KEY__ in _context__WEBPACK_IMPORTED_MODULE_3__) if(__WEBPACK_IMPORT_KEY__ !== "default") __WEBPACK_REEXPORT_OBJECT__[__WEBPACK_IMPORT_KEY__] = () => _context__WEBPACK_IMPORTED_MODULE_3__[__WEBPACK_IMPORT_KEY__]
|
|
/* harmony reexport (unknown) */ __webpack_require__.d(__webpack_exports__, __WEBPACK_REEXPORT_OBJECT__);
|
|
/* harmony import */ var _hooks__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! ./hooks */ "./node_modules/@vue/devtools-api/lib/esm/api/hooks.js");
|
|
/* harmony import */ var _hooks__WEBPACK_IMPORTED_MODULE_4___default = /*#__PURE__*/__webpack_require__.n(_hooks__WEBPACK_IMPORTED_MODULE_4__);
|
|
/* harmony reexport (unknown) */ var __WEBPACK_REEXPORT_OBJECT__ = {};
|
|
/* harmony reexport (unknown) */ for(const __WEBPACK_IMPORT_KEY__ in _hooks__WEBPACK_IMPORTED_MODULE_4__) if(__WEBPACK_IMPORT_KEY__ !== "default") __WEBPACK_REEXPORT_OBJECT__[__WEBPACK_IMPORT_KEY__] = () => _hooks__WEBPACK_IMPORTED_MODULE_4__[__WEBPACK_IMPORT_KEY__]
|
|
/* harmony reexport (unknown) */ __webpack_require__.d(__webpack_exports__, __WEBPACK_REEXPORT_OBJECT__);
|
|
/* harmony import */ var _util__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! ./util */ "./node_modules/@vue/devtools-api/lib/esm/api/util.js");
|
|
/* harmony import */ var _util__WEBPACK_IMPORTED_MODULE_5___default = /*#__PURE__*/__webpack_require__.n(_util__WEBPACK_IMPORTED_MODULE_5__);
|
|
/* harmony reexport (unknown) */ var __WEBPACK_REEXPORT_OBJECT__ = {};
|
|
/* harmony reexport (unknown) */ for(const __WEBPACK_IMPORT_KEY__ in _util__WEBPACK_IMPORTED_MODULE_5__) if(__WEBPACK_IMPORT_KEY__ !== "default") __WEBPACK_REEXPORT_OBJECT__[__WEBPACK_IMPORT_KEY__] = () => _util__WEBPACK_IMPORTED_MODULE_5__[__WEBPACK_IMPORT_KEY__]
|
|
/* harmony reexport (unknown) */ __webpack_require__.d(__webpack_exports__, __WEBPACK_REEXPORT_OBJECT__);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/devtools-api/lib/esm/api/util.js":
|
|
/*!************************************************************!*\
|
|
!*** ./node_modules/@vue/devtools-api/lib/esm/api/util.js ***!
|
|
\************************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/devtools-api/lib/esm/const.js":
|
|
/*!*********************************************************!*\
|
|
!*** ./node_modules/@vue/devtools-api/lib/esm/const.js ***!
|
|
\*********************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "HOOK_SETUP": () => (/* binding */ HOOK_SETUP)
|
|
/* harmony export */ });
|
|
const HOOK_SETUP = 'devtools-plugin:setup';
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/devtools-api/lib/esm/env.js":
|
|
/*!*******************************************************!*\
|
|
!*** ./node_modules/@vue/devtools-api/lib/esm/env.js ***!
|
|
\*******************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "getDevtoolsGlobalHook": () => (/* binding */ getDevtoolsGlobalHook),
|
|
/* harmony export */ "getTarget": () => (/* binding */ getTarget)
|
|
/* harmony export */ });
|
|
function getDevtoolsGlobalHook() {
|
|
return getTarget().__VUE_DEVTOOLS_GLOBAL_HOOK__;
|
|
}
|
|
function getTarget() {
|
|
// @ts-ignore
|
|
return typeof navigator !== 'undefined'
|
|
? window
|
|
: typeof __webpack_require__.g !== 'undefined'
|
|
? __webpack_require__.g
|
|
: {};
|
|
}
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/devtools-api/lib/esm/index.js":
|
|
/*!*********************************************************!*\
|
|
!*** ./node_modules/@vue/devtools-api/lib/esm/index.js ***!
|
|
\*********************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "setupDevtoolsPlugin": () => (/* binding */ setupDevtoolsPlugin)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _env__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! ./env */ "./node_modules/@vue/devtools-api/lib/esm/env.js");
|
|
/* harmony import */ var _const__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! ./const */ "./node_modules/@vue/devtools-api/lib/esm/const.js");
|
|
/* harmony import */ var _api__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./api */ "./node_modules/@vue/devtools-api/lib/esm/api/index.js");
|
|
/* harmony reexport (unknown) */ var __WEBPACK_REEXPORT_OBJECT__ = {};
|
|
/* harmony reexport (unknown) */ for(const __WEBPACK_IMPORT_KEY__ in _api__WEBPACK_IMPORTED_MODULE_0__) if(["default","setupDevtoolsPlugin"].indexOf(__WEBPACK_IMPORT_KEY__) < 0) __WEBPACK_REEXPORT_OBJECT__[__WEBPACK_IMPORT_KEY__] = () => _api__WEBPACK_IMPORTED_MODULE_0__[__WEBPACK_IMPORT_KEY__]
|
|
/* harmony reexport (unknown) */ __webpack_require__.d(__webpack_exports__, __WEBPACK_REEXPORT_OBJECT__);
|
|
|
|
|
|
|
|
function setupDevtoolsPlugin(pluginDescriptor, setupFn) {
|
|
const hook = (0,_env__WEBPACK_IMPORTED_MODULE_1__.getDevtoolsGlobalHook)();
|
|
if (hook) {
|
|
hook.emit(_const__WEBPACK_IMPORTED_MODULE_2__.HOOK_SETUP, pluginDescriptor, setupFn);
|
|
}
|
|
else {
|
|
const target = (0,_env__WEBPACK_IMPORTED_MODULE_1__.getTarget)();
|
|
const list = target.__VUE_DEVTOOLS_PLUGINS__ = target.__VUE_DEVTOOLS_PLUGINS__ || [];
|
|
list.push({
|
|
pluginDescriptor,
|
|
setupFn
|
|
});
|
|
}
|
|
}
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/reactivity/dist/reactivity.esm-bundler.js":
|
|
/*!*********************************************************************!*\
|
|
!*** ./node_modules/@vue/reactivity/dist/reactivity.esm-bundler.js ***!
|
|
\*********************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "EffectScope": () => (/* binding */ EffectScope),
|
|
/* harmony export */ "ITERATE_KEY": () => (/* binding */ ITERATE_KEY),
|
|
/* harmony export */ "ReactiveEffect": () => (/* binding */ ReactiveEffect),
|
|
/* harmony export */ "computed": () => (/* binding */ computed),
|
|
/* harmony export */ "customRef": () => (/* binding */ customRef),
|
|
/* harmony export */ "deferredComputed": () => (/* binding */ deferredComputed),
|
|
/* harmony export */ "effect": () => (/* binding */ effect),
|
|
/* harmony export */ "effectScope": () => (/* binding */ effectScope),
|
|
/* harmony export */ "enableTracking": () => (/* binding */ enableTracking),
|
|
/* harmony export */ "getCurrentScope": () => (/* binding */ getCurrentScope),
|
|
/* harmony export */ "isProxy": () => (/* binding */ isProxy),
|
|
/* harmony export */ "isReactive": () => (/* binding */ isReactive),
|
|
/* harmony export */ "isReadonly": () => (/* binding */ isReadonly),
|
|
/* harmony export */ "isRef": () => (/* binding */ isRef),
|
|
/* harmony export */ "markRaw": () => (/* binding */ markRaw),
|
|
/* harmony export */ "onScopeDispose": () => (/* binding */ onScopeDispose),
|
|
/* harmony export */ "pauseTracking": () => (/* binding */ pauseTracking),
|
|
/* harmony export */ "proxyRefs": () => (/* binding */ proxyRefs),
|
|
/* harmony export */ "reactive": () => (/* binding */ reactive),
|
|
/* harmony export */ "readonly": () => (/* binding */ readonly),
|
|
/* harmony export */ "ref": () => (/* binding */ ref),
|
|
/* harmony export */ "resetTracking": () => (/* binding */ resetTracking),
|
|
/* harmony export */ "shallowReactive": () => (/* binding */ shallowReactive),
|
|
/* harmony export */ "shallowReadonly": () => (/* binding */ shallowReadonly),
|
|
/* harmony export */ "shallowRef": () => (/* binding */ shallowRef),
|
|
/* harmony export */ "stop": () => (/* binding */ stop),
|
|
/* harmony export */ "toRaw": () => (/* binding */ toRaw),
|
|
/* harmony export */ "toRef": () => (/* binding */ toRef),
|
|
/* harmony export */ "toRefs": () => (/* binding */ toRefs),
|
|
/* harmony export */ "track": () => (/* binding */ track),
|
|
/* harmony export */ "trigger": () => (/* binding */ trigger),
|
|
/* harmony export */ "triggerRef": () => (/* binding */ triggerRef),
|
|
/* harmony export */ "unref": () => (/* binding */ unref)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _vue_shared__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @vue/shared */ "./node_modules/@vue/shared/dist/shared.esm-bundler.js");
|
|
|
|
|
|
function warn(msg, ...args) {
|
|
console.warn(`[Vue warn] ${msg}`, ...args);
|
|
}
|
|
|
|
let activeEffectScope;
|
|
const effectScopeStack = [];
|
|
class EffectScope {
|
|
constructor(detached = false) {
|
|
this.active = true;
|
|
this.effects = [];
|
|
this.cleanups = [];
|
|
if (!detached && activeEffectScope) {
|
|
this.parent = activeEffectScope;
|
|
this.index =
|
|
(activeEffectScope.scopes || (activeEffectScope.scopes = [])).push(this) - 1;
|
|
}
|
|
}
|
|
run(fn) {
|
|
if (this.active) {
|
|
try {
|
|
this.on();
|
|
return fn();
|
|
}
|
|
finally {
|
|
this.off();
|
|
}
|
|
}
|
|
else if ((true)) {
|
|
warn(`cannot run an inactive effect scope.`);
|
|
}
|
|
}
|
|
on() {
|
|
if (this.active) {
|
|
effectScopeStack.push(this);
|
|
activeEffectScope = this;
|
|
}
|
|
}
|
|
off() {
|
|
if (this.active) {
|
|
effectScopeStack.pop();
|
|
activeEffectScope = effectScopeStack[effectScopeStack.length - 1];
|
|
}
|
|
}
|
|
stop(fromParent) {
|
|
if (this.active) {
|
|
this.effects.forEach(e => e.stop());
|
|
this.cleanups.forEach(cleanup => cleanup());
|
|
if (this.scopes) {
|
|
this.scopes.forEach(e => e.stop(true));
|
|
}
|
|
// nested scope, dereference from parent to avoid memory leaks
|
|
if (this.parent && !fromParent) {
|
|
// optimized O(1) removal
|
|
const last = this.parent.scopes.pop();
|
|
if (last && last !== this) {
|
|
this.parent.scopes[this.index] = last;
|
|
last.index = this.index;
|
|
}
|
|
}
|
|
this.active = false;
|
|
}
|
|
}
|
|
}
|
|
function effectScope(detached) {
|
|
return new EffectScope(detached);
|
|
}
|
|
function recordEffectScope(effect, scope) {
|
|
scope = scope || activeEffectScope;
|
|
if (scope && scope.active) {
|
|
scope.effects.push(effect);
|
|
}
|
|
}
|
|
function getCurrentScope() {
|
|
return activeEffectScope;
|
|
}
|
|
function onScopeDispose(fn) {
|
|
if (activeEffectScope) {
|
|
activeEffectScope.cleanups.push(fn);
|
|
}
|
|
else if ((true)) {
|
|
warn(`onScopeDispose() is called when there is no active effect scope` +
|
|
` to be associated with.`);
|
|
}
|
|
}
|
|
|
|
const createDep = (effects) => {
|
|
const dep = new Set(effects);
|
|
dep.w = 0;
|
|
dep.n = 0;
|
|
return dep;
|
|
};
|
|
const wasTracked = (dep) => (dep.w & trackOpBit) > 0;
|
|
const newTracked = (dep) => (dep.n & trackOpBit) > 0;
|
|
const initDepMarkers = ({ deps }) => {
|
|
if (deps.length) {
|
|
for (let i = 0; i < deps.length; i++) {
|
|
deps[i].w |= trackOpBit; // set was tracked
|
|
}
|
|
}
|
|
};
|
|
const finalizeDepMarkers = (effect) => {
|
|
const { deps } = effect;
|
|
if (deps.length) {
|
|
let ptr = 0;
|
|
for (let i = 0; i < deps.length; i++) {
|
|
const dep = deps[i];
|
|
if (wasTracked(dep) && !newTracked(dep)) {
|
|
dep.delete(effect);
|
|
}
|
|
else {
|
|
deps[ptr++] = dep;
|
|
}
|
|
// clear bits
|
|
dep.w &= ~trackOpBit;
|
|
dep.n &= ~trackOpBit;
|
|
}
|
|
deps.length = ptr;
|
|
}
|
|
};
|
|
|
|
const targetMap = new WeakMap();
|
|
// The number of effects currently being tracked recursively.
|
|
let effectTrackDepth = 0;
|
|
let trackOpBit = 1;
|
|
/**
|
|
* The bitwise track markers support at most 30 levels op recursion.
|
|
* This value is chosen to enable modern JS engines to use a SMI on all platforms.
|
|
* When recursion depth is greater, fall back to using a full cleanup.
|
|
*/
|
|
const maxMarkerBits = 30;
|
|
const effectStack = [];
|
|
let activeEffect;
|
|
const ITERATE_KEY = Symbol(( true) ? 'iterate' : 0);
|
|
const MAP_KEY_ITERATE_KEY = Symbol(( true) ? 'Map key iterate' : 0);
|
|
class ReactiveEffect {
|
|
constructor(fn, scheduler = null, scope) {
|
|
this.fn = fn;
|
|
this.scheduler = scheduler;
|
|
this.active = true;
|
|
this.deps = [];
|
|
recordEffectScope(this, scope);
|
|
}
|
|
run() {
|
|
if (!this.active) {
|
|
return this.fn();
|
|
}
|
|
if (!effectStack.includes(this)) {
|
|
try {
|
|
effectStack.push((activeEffect = this));
|
|
enableTracking();
|
|
trackOpBit = 1 << ++effectTrackDepth;
|
|
if (effectTrackDepth <= maxMarkerBits) {
|
|
initDepMarkers(this);
|
|
}
|
|
else {
|
|
cleanupEffect(this);
|
|
}
|
|
return this.fn();
|
|
}
|
|
finally {
|
|
if (effectTrackDepth <= maxMarkerBits) {
|
|
finalizeDepMarkers(this);
|
|
}
|
|
trackOpBit = 1 << --effectTrackDepth;
|
|
resetTracking();
|
|
effectStack.pop();
|
|
const n = effectStack.length;
|
|
activeEffect = n > 0 ? effectStack[n - 1] : undefined;
|
|
}
|
|
}
|
|
}
|
|
stop() {
|
|
if (this.active) {
|
|
cleanupEffect(this);
|
|
if (this.onStop) {
|
|
this.onStop();
|
|
}
|
|
this.active = false;
|
|
}
|
|
}
|
|
}
|
|
function cleanupEffect(effect) {
|
|
const { deps } = effect;
|
|
if (deps.length) {
|
|
for (let i = 0; i < deps.length; i++) {
|
|
deps[i].delete(effect);
|
|
}
|
|
deps.length = 0;
|
|
}
|
|
}
|
|
function effect(fn, options) {
|
|
if (fn.effect) {
|
|
fn = fn.effect.fn;
|
|
}
|
|
const _effect = new ReactiveEffect(fn);
|
|
if (options) {
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.extend)(_effect, options);
|
|
if (options.scope)
|
|
recordEffectScope(_effect, options.scope);
|
|
}
|
|
if (!options || !options.lazy) {
|
|
_effect.run();
|
|
}
|
|
const runner = _effect.run.bind(_effect);
|
|
runner.effect = _effect;
|
|
return runner;
|
|
}
|
|
function stop(runner) {
|
|
runner.effect.stop();
|
|
}
|
|
let shouldTrack = true;
|
|
const trackStack = [];
|
|
function pauseTracking() {
|
|
trackStack.push(shouldTrack);
|
|
shouldTrack = false;
|
|
}
|
|
function enableTracking() {
|
|
trackStack.push(shouldTrack);
|
|
shouldTrack = true;
|
|
}
|
|
function resetTracking() {
|
|
const last = trackStack.pop();
|
|
shouldTrack = last === undefined ? true : last;
|
|
}
|
|
function track(target, type, key) {
|
|
if (!isTracking()) {
|
|
return;
|
|
}
|
|
let depsMap = targetMap.get(target);
|
|
if (!depsMap) {
|
|
targetMap.set(target, (depsMap = new Map()));
|
|
}
|
|
let dep = depsMap.get(key);
|
|
if (!dep) {
|
|
depsMap.set(key, (dep = createDep()));
|
|
}
|
|
const eventInfo = ( true)
|
|
? { effect: activeEffect, target, type, key }
|
|
: 0;
|
|
trackEffects(dep, eventInfo);
|
|
}
|
|
function isTracking() {
|
|
return shouldTrack && activeEffect !== undefined;
|
|
}
|
|
function trackEffects(dep, debuggerEventExtraInfo) {
|
|
let shouldTrack = false;
|
|
if (effectTrackDepth <= maxMarkerBits) {
|
|
if (!newTracked(dep)) {
|
|
dep.n |= trackOpBit; // set newly tracked
|
|
shouldTrack = !wasTracked(dep);
|
|
}
|
|
}
|
|
else {
|
|
// Full cleanup mode.
|
|
shouldTrack = !dep.has(activeEffect);
|
|
}
|
|
if (shouldTrack) {
|
|
dep.add(activeEffect);
|
|
activeEffect.deps.push(dep);
|
|
if (( true) && activeEffect.onTrack) {
|
|
activeEffect.onTrack(Object.assign({
|
|
effect: activeEffect
|
|
}, debuggerEventExtraInfo));
|
|
}
|
|
}
|
|
}
|
|
function trigger(target, type, key, newValue, oldValue, oldTarget) {
|
|
const depsMap = targetMap.get(target);
|
|
if (!depsMap) {
|
|
// never been tracked
|
|
return;
|
|
}
|
|
let deps = [];
|
|
if (type === "clear" /* CLEAR */) {
|
|
// collection being cleared
|
|
// trigger all effects for target
|
|
deps = [...depsMap.values()];
|
|
}
|
|
else if (key === 'length' && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(target)) {
|
|
depsMap.forEach((dep, key) => {
|
|
if (key === 'length' || key >= newValue) {
|
|
deps.push(dep);
|
|
}
|
|
});
|
|
}
|
|
else {
|
|
// schedule runs for SET | ADD | DELETE
|
|
if (key !== void 0) {
|
|
deps.push(depsMap.get(key));
|
|
}
|
|
// also run for iteration key on ADD | DELETE | Map.SET
|
|
switch (type) {
|
|
case "add" /* ADD */:
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(target)) {
|
|
deps.push(depsMap.get(ITERATE_KEY));
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isMap)(target)) {
|
|
deps.push(depsMap.get(MAP_KEY_ITERATE_KEY));
|
|
}
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isIntegerKey)(key)) {
|
|
// new index added to array -> length changes
|
|
deps.push(depsMap.get('length'));
|
|
}
|
|
break;
|
|
case "delete" /* DELETE */:
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(target)) {
|
|
deps.push(depsMap.get(ITERATE_KEY));
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isMap)(target)) {
|
|
deps.push(depsMap.get(MAP_KEY_ITERATE_KEY));
|
|
}
|
|
}
|
|
break;
|
|
case "set" /* SET */:
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isMap)(target)) {
|
|
deps.push(depsMap.get(ITERATE_KEY));
|
|
}
|
|
break;
|
|
}
|
|
}
|
|
const eventInfo = ( true)
|
|
? { target, type, key, newValue, oldValue, oldTarget }
|
|
: 0;
|
|
if (deps.length === 1) {
|
|
if (deps[0]) {
|
|
if ((true)) {
|
|
triggerEffects(deps[0], eventInfo);
|
|
}
|
|
else {}
|
|
}
|
|
}
|
|
else {
|
|
const effects = [];
|
|
for (const dep of deps) {
|
|
if (dep) {
|
|
effects.push(...dep);
|
|
}
|
|
}
|
|
if ((true)) {
|
|
triggerEffects(createDep(effects), eventInfo);
|
|
}
|
|
else {}
|
|
}
|
|
}
|
|
function triggerEffects(dep, debuggerEventExtraInfo) {
|
|
// spread into array for stabilization
|
|
for (const effect of (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(dep) ? dep : [...dep]) {
|
|
if (effect !== activeEffect || effect.allowRecurse) {
|
|
if (( true) && effect.onTrigger) {
|
|
effect.onTrigger((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.extend)({ effect }, debuggerEventExtraInfo));
|
|
}
|
|
if (effect.scheduler) {
|
|
effect.scheduler();
|
|
}
|
|
else {
|
|
effect.run();
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
const isNonTrackableKeys = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.makeMap)(`__proto__,__v_isRef,__isVue`);
|
|
const builtInSymbols = new Set(Object.getOwnPropertyNames(Symbol)
|
|
.map(key => Symbol[key])
|
|
.filter(_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isSymbol));
|
|
const get = /*#__PURE__*/ createGetter();
|
|
const shallowGet = /*#__PURE__*/ createGetter(false, true);
|
|
const readonlyGet = /*#__PURE__*/ createGetter(true);
|
|
const shallowReadonlyGet = /*#__PURE__*/ createGetter(true, true);
|
|
const arrayInstrumentations = /*#__PURE__*/ createArrayInstrumentations();
|
|
function createArrayInstrumentations() {
|
|
const instrumentations = {};
|
|
['includes', 'indexOf', 'lastIndexOf'].forEach(key => {
|
|
instrumentations[key] = function (...args) {
|
|
const arr = toRaw(this);
|
|
for (let i = 0, l = this.length; i < l; i++) {
|
|
track(arr, "get" /* GET */, i + '');
|
|
}
|
|
// we run the method using the original args first (which may be reactive)
|
|
const res = arr[key](...args);
|
|
if (res === -1 || res === false) {
|
|
// if that didn't work, run it again using raw values.
|
|
return arr[key](...args.map(toRaw));
|
|
}
|
|
else {
|
|
return res;
|
|
}
|
|
};
|
|
});
|
|
['push', 'pop', 'shift', 'unshift', 'splice'].forEach(key => {
|
|
instrumentations[key] = function (...args) {
|
|
pauseTracking();
|
|
const res = toRaw(this)[key].apply(this, args);
|
|
resetTracking();
|
|
return res;
|
|
};
|
|
});
|
|
return instrumentations;
|
|
}
|
|
function createGetter(isReadonly = false, shallow = false) {
|
|
return function get(target, key, receiver) {
|
|
if (key === "__v_isReactive" /* IS_REACTIVE */) {
|
|
return !isReadonly;
|
|
}
|
|
else if (key === "__v_isReadonly" /* IS_READONLY */) {
|
|
return isReadonly;
|
|
}
|
|
else if (key === "__v_raw" /* RAW */ &&
|
|
receiver ===
|
|
(isReadonly
|
|
? shallow
|
|
? shallowReadonlyMap
|
|
: readonlyMap
|
|
: shallow
|
|
? shallowReactiveMap
|
|
: reactiveMap).get(target)) {
|
|
return target;
|
|
}
|
|
const targetIsArray = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(target);
|
|
if (!isReadonly && targetIsArray && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.hasOwn)(arrayInstrumentations, key)) {
|
|
return Reflect.get(arrayInstrumentations, key, receiver);
|
|
}
|
|
const res = Reflect.get(target, key, receiver);
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isSymbol)(key) ? builtInSymbols.has(key) : isNonTrackableKeys(key)) {
|
|
return res;
|
|
}
|
|
if (!isReadonly) {
|
|
track(target, "get" /* GET */, key);
|
|
}
|
|
if (shallow) {
|
|
return res;
|
|
}
|
|
if (isRef(res)) {
|
|
// ref unwrapping - does not apply for Array + integer key.
|
|
const shouldUnwrap = !targetIsArray || !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isIntegerKey)(key);
|
|
return shouldUnwrap ? res.value : res;
|
|
}
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isObject)(res)) {
|
|
// Convert returned value into a proxy as well. we do the isObject check
|
|
// here to avoid invalid value warning. Also need to lazy access readonly
|
|
// and reactive here to avoid circular dependency.
|
|
return isReadonly ? readonly(res) : reactive(res);
|
|
}
|
|
return res;
|
|
};
|
|
}
|
|
const set = /*#__PURE__*/ createSetter();
|
|
const shallowSet = /*#__PURE__*/ createSetter(true);
|
|
function createSetter(shallow = false) {
|
|
return function set(target, key, value, receiver) {
|
|
let oldValue = target[key];
|
|
if (!shallow) {
|
|
value = toRaw(value);
|
|
oldValue = toRaw(oldValue);
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(target) && isRef(oldValue) && !isRef(value)) {
|
|
oldValue.value = value;
|
|
return true;
|
|
}
|
|
}
|
|
const hadKey = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(target) && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isIntegerKey)(key)
|
|
? Number(key) < target.length
|
|
: (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.hasOwn)(target, key);
|
|
const result = Reflect.set(target, key, value, receiver);
|
|
// don't trigger if target is something up in the prototype chain of original
|
|
if (target === toRaw(receiver)) {
|
|
if (!hadKey) {
|
|
trigger(target, "add" /* ADD */, key, value);
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.hasChanged)(value, oldValue)) {
|
|
trigger(target, "set" /* SET */, key, value, oldValue);
|
|
}
|
|
}
|
|
return result;
|
|
};
|
|
}
|
|
function deleteProperty(target, key) {
|
|
const hadKey = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.hasOwn)(target, key);
|
|
const oldValue = target[key];
|
|
const result = Reflect.deleteProperty(target, key);
|
|
if (result && hadKey) {
|
|
trigger(target, "delete" /* DELETE */, key, undefined, oldValue);
|
|
}
|
|
return result;
|
|
}
|
|
function has(target, key) {
|
|
const result = Reflect.has(target, key);
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isSymbol)(key) || !builtInSymbols.has(key)) {
|
|
track(target, "has" /* HAS */, key);
|
|
}
|
|
return result;
|
|
}
|
|
function ownKeys(target) {
|
|
track(target, "iterate" /* ITERATE */, (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(target) ? 'length' : ITERATE_KEY);
|
|
return Reflect.ownKeys(target);
|
|
}
|
|
const mutableHandlers = {
|
|
get,
|
|
set,
|
|
deleteProperty,
|
|
has,
|
|
ownKeys
|
|
};
|
|
const readonlyHandlers = {
|
|
get: readonlyGet,
|
|
set(target, key) {
|
|
if ((true)) {
|
|
console.warn(`Set operation on key "${String(key)}" failed: target is readonly.`, target);
|
|
}
|
|
return true;
|
|
},
|
|
deleteProperty(target, key) {
|
|
if ((true)) {
|
|
console.warn(`Delete operation on key "${String(key)}" failed: target is readonly.`, target);
|
|
}
|
|
return true;
|
|
}
|
|
};
|
|
const shallowReactiveHandlers = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.extend)({}, mutableHandlers, {
|
|
get: shallowGet,
|
|
set: shallowSet
|
|
});
|
|
// Props handlers are special in the sense that it should not unwrap top-level
|
|
// refs (in order to allow refs to be explicitly passed down), but should
|
|
// retain the reactivity of the normal readonly object.
|
|
const shallowReadonlyHandlers = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.extend)({}, readonlyHandlers, {
|
|
get: shallowReadonlyGet
|
|
});
|
|
|
|
const toReactive = (value) => (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isObject)(value) ? reactive(value) : value;
|
|
const toReadonly = (value) => (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isObject)(value) ? readonly(value) : value;
|
|
const toShallow = (value) => value;
|
|
const getProto = (v) => Reflect.getPrototypeOf(v);
|
|
function get$1(target, key, isReadonly = false, isShallow = false) {
|
|
// #1772: readonly(reactive(Map)) should return readonly + reactive version
|
|
// of the value
|
|
target = target["__v_raw" /* RAW */];
|
|
const rawTarget = toRaw(target);
|
|
const rawKey = toRaw(key);
|
|
if (key !== rawKey) {
|
|
!isReadonly && track(rawTarget, "get" /* GET */, key);
|
|
}
|
|
!isReadonly && track(rawTarget, "get" /* GET */, rawKey);
|
|
const { has } = getProto(rawTarget);
|
|
const wrap = isShallow ? toShallow : isReadonly ? toReadonly : toReactive;
|
|
if (has.call(rawTarget, key)) {
|
|
return wrap(target.get(key));
|
|
}
|
|
else if (has.call(rawTarget, rawKey)) {
|
|
return wrap(target.get(rawKey));
|
|
}
|
|
else if (target !== rawTarget) {
|
|
// #3602 readonly(reactive(Map))
|
|
// ensure that the nested reactive `Map` can do tracking for itself
|
|
target.get(key);
|
|
}
|
|
}
|
|
function has$1(key, isReadonly = false) {
|
|
const target = this["__v_raw" /* RAW */];
|
|
const rawTarget = toRaw(target);
|
|
const rawKey = toRaw(key);
|
|
if (key !== rawKey) {
|
|
!isReadonly && track(rawTarget, "has" /* HAS */, key);
|
|
}
|
|
!isReadonly && track(rawTarget, "has" /* HAS */, rawKey);
|
|
return key === rawKey
|
|
? target.has(key)
|
|
: target.has(key) || target.has(rawKey);
|
|
}
|
|
function size(target, isReadonly = false) {
|
|
target = target["__v_raw" /* RAW */];
|
|
!isReadonly && track(toRaw(target), "iterate" /* ITERATE */, ITERATE_KEY);
|
|
return Reflect.get(target, 'size', target);
|
|
}
|
|
function add(value) {
|
|
value = toRaw(value);
|
|
const target = toRaw(this);
|
|
const proto = getProto(target);
|
|
const hadKey = proto.has.call(target, value);
|
|
if (!hadKey) {
|
|
target.add(value);
|
|
trigger(target, "add" /* ADD */, value, value);
|
|
}
|
|
return this;
|
|
}
|
|
function set$1(key, value) {
|
|
value = toRaw(value);
|
|
const target = toRaw(this);
|
|
const { has, get } = getProto(target);
|
|
let hadKey = has.call(target, key);
|
|
if (!hadKey) {
|
|
key = toRaw(key);
|
|
hadKey = has.call(target, key);
|
|
}
|
|
else if ((true)) {
|
|
checkIdentityKeys(target, has, key);
|
|
}
|
|
const oldValue = get.call(target, key);
|
|
target.set(key, value);
|
|
if (!hadKey) {
|
|
trigger(target, "add" /* ADD */, key, value);
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.hasChanged)(value, oldValue)) {
|
|
trigger(target, "set" /* SET */, key, value, oldValue);
|
|
}
|
|
return this;
|
|
}
|
|
function deleteEntry(key) {
|
|
const target = toRaw(this);
|
|
const { has, get } = getProto(target);
|
|
let hadKey = has.call(target, key);
|
|
if (!hadKey) {
|
|
key = toRaw(key);
|
|
hadKey = has.call(target, key);
|
|
}
|
|
else if ((true)) {
|
|
checkIdentityKeys(target, has, key);
|
|
}
|
|
const oldValue = get ? get.call(target, key) : undefined;
|
|
// forward the operation before queueing reactions
|
|
const result = target.delete(key);
|
|
if (hadKey) {
|
|
trigger(target, "delete" /* DELETE */, key, undefined, oldValue);
|
|
}
|
|
return result;
|
|
}
|
|
function clear() {
|
|
const target = toRaw(this);
|
|
const hadItems = target.size !== 0;
|
|
const oldTarget = ( true)
|
|
? (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isMap)(target)
|
|
? new Map(target)
|
|
: new Set(target)
|
|
: 0;
|
|
// forward the operation before queueing reactions
|
|
const result = target.clear();
|
|
if (hadItems) {
|
|
trigger(target, "clear" /* CLEAR */, undefined, undefined, oldTarget);
|
|
}
|
|
return result;
|
|
}
|
|
function createForEach(isReadonly, isShallow) {
|
|
return function forEach(callback, thisArg) {
|
|
const observed = this;
|
|
const target = observed["__v_raw" /* RAW */];
|
|
const rawTarget = toRaw(target);
|
|
const wrap = isShallow ? toShallow : isReadonly ? toReadonly : toReactive;
|
|
!isReadonly && track(rawTarget, "iterate" /* ITERATE */, ITERATE_KEY);
|
|
return target.forEach((value, key) => {
|
|
// important: make sure the callback is
|
|
// 1. invoked with the reactive map as `this` and 3rd arg
|
|
// 2. the value received should be a corresponding reactive/readonly.
|
|
return callback.call(thisArg, wrap(value), wrap(key), observed);
|
|
});
|
|
};
|
|
}
|
|
function createIterableMethod(method, isReadonly, isShallow) {
|
|
return function (...args) {
|
|
const target = this["__v_raw" /* RAW */];
|
|
const rawTarget = toRaw(target);
|
|
const targetIsMap = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isMap)(rawTarget);
|
|
const isPair = method === 'entries' || (method === Symbol.iterator && targetIsMap);
|
|
const isKeyOnly = method === 'keys' && targetIsMap;
|
|
const innerIterator = target[method](...args);
|
|
const wrap = isShallow ? toShallow : isReadonly ? toReadonly : toReactive;
|
|
!isReadonly &&
|
|
track(rawTarget, "iterate" /* ITERATE */, isKeyOnly ? MAP_KEY_ITERATE_KEY : ITERATE_KEY);
|
|
// return a wrapped iterator which returns observed versions of the
|
|
// values emitted from the real iterator
|
|
return {
|
|
// iterator protocol
|
|
next() {
|
|
const { value, done } = innerIterator.next();
|
|
return done
|
|
? { value, done }
|
|
: {
|
|
value: isPair ? [wrap(value[0]), wrap(value[1])] : wrap(value),
|
|
done
|
|
};
|
|
},
|
|
// iterable protocol
|
|
[Symbol.iterator]() {
|
|
return this;
|
|
}
|
|
};
|
|
};
|
|
}
|
|
function createReadonlyMethod(type) {
|
|
return function (...args) {
|
|
if ((true)) {
|
|
const key = args[0] ? `on key "${args[0]}" ` : ``;
|
|
console.warn(`${(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.capitalize)(type)} operation ${key}failed: target is readonly.`, toRaw(this));
|
|
}
|
|
return type === "delete" /* DELETE */ ? false : this;
|
|
};
|
|
}
|
|
function createInstrumentations() {
|
|
const mutableInstrumentations = {
|
|
get(key) {
|
|
return get$1(this, key);
|
|
},
|
|
get size() {
|
|
return size(this);
|
|
},
|
|
has: has$1,
|
|
add,
|
|
set: set$1,
|
|
delete: deleteEntry,
|
|
clear,
|
|
forEach: createForEach(false, false)
|
|
};
|
|
const shallowInstrumentations = {
|
|
get(key) {
|
|
return get$1(this, key, false, true);
|
|
},
|
|
get size() {
|
|
return size(this);
|
|
},
|
|
has: has$1,
|
|
add,
|
|
set: set$1,
|
|
delete: deleteEntry,
|
|
clear,
|
|
forEach: createForEach(false, true)
|
|
};
|
|
const readonlyInstrumentations = {
|
|
get(key) {
|
|
return get$1(this, key, true);
|
|
},
|
|
get size() {
|
|
return size(this, true);
|
|
},
|
|
has(key) {
|
|
return has$1.call(this, key, true);
|
|
},
|
|
add: createReadonlyMethod("add" /* ADD */),
|
|
set: createReadonlyMethod("set" /* SET */),
|
|
delete: createReadonlyMethod("delete" /* DELETE */),
|
|
clear: createReadonlyMethod("clear" /* CLEAR */),
|
|
forEach: createForEach(true, false)
|
|
};
|
|
const shallowReadonlyInstrumentations = {
|
|
get(key) {
|
|
return get$1(this, key, true, true);
|
|
},
|
|
get size() {
|
|
return size(this, true);
|
|
},
|
|
has(key) {
|
|
return has$1.call(this, key, true);
|
|
},
|
|
add: createReadonlyMethod("add" /* ADD */),
|
|
set: createReadonlyMethod("set" /* SET */),
|
|
delete: createReadonlyMethod("delete" /* DELETE */),
|
|
clear: createReadonlyMethod("clear" /* CLEAR */),
|
|
forEach: createForEach(true, true)
|
|
};
|
|
const iteratorMethods = ['keys', 'values', 'entries', Symbol.iterator];
|
|
iteratorMethods.forEach(method => {
|
|
mutableInstrumentations[method] = createIterableMethod(method, false, false);
|
|
readonlyInstrumentations[method] = createIterableMethod(method, true, false);
|
|
shallowInstrumentations[method] = createIterableMethod(method, false, true);
|
|
shallowReadonlyInstrumentations[method] = createIterableMethod(method, true, true);
|
|
});
|
|
return [
|
|
mutableInstrumentations,
|
|
readonlyInstrumentations,
|
|
shallowInstrumentations,
|
|
shallowReadonlyInstrumentations
|
|
];
|
|
}
|
|
const [mutableInstrumentations, readonlyInstrumentations, shallowInstrumentations, shallowReadonlyInstrumentations] = /* #__PURE__*/ createInstrumentations();
|
|
function createInstrumentationGetter(isReadonly, shallow) {
|
|
const instrumentations = shallow
|
|
? isReadonly
|
|
? shallowReadonlyInstrumentations
|
|
: shallowInstrumentations
|
|
: isReadonly
|
|
? readonlyInstrumentations
|
|
: mutableInstrumentations;
|
|
return (target, key, receiver) => {
|
|
if (key === "__v_isReactive" /* IS_REACTIVE */) {
|
|
return !isReadonly;
|
|
}
|
|
else if (key === "__v_isReadonly" /* IS_READONLY */) {
|
|
return isReadonly;
|
|
}
|
|
else if (key === "__v_raw" /* RAW */) {
|
|
return target;
|
|
}
|
|
return Reflect.get((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.hasOwn)(instrumentations, key) && key in target
|
|
? instrumentations
|
|
: target, key, receiver);
|
|
};
|
|
}
|
|
const mutableCollectionHandlers = {
|
|
get: /*#__PURE__*/ createInstrumentationGetter(false, false)
|
|
};
|
|
const shallowCollectionHandlers = {
|
|
get: /*#__PURE__*/ createInstrumentationGetter(false, true)
|
|
};
|
|
const readonlyCollectionHandlers = {
|
|
get: /*#__PURE__*/ createInstrumentationGetter(true, false)
|
|
};
|
|
const shallowReadonlyCollectionHandlers = {
|
|
get: /*#__PURE__*/ createInstrumentationGetter(true, true)
|
|
};
|
|
function checkIdentityKeys(target, has, key) {
|
|
const rawKey = toRaw(key);
|
|
if (rawKey !== key && has.call(target, rawKey)) {
|
|
const type = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.toRawType)(target);
|
|
console.warn(`Reactive ${type} contains both the raw and reactive ` +
|
|
`versions of the same object${type === `Map` ? ` as keys` : ``}, ` +
|
|
`which can lead to inconsistencies. ` +
|
|
`Avoid differentiating between the raw and reactive versions ` +
|
|
`of an object and only use the reactive version if possible.`);
|
|
}
|
|
}
|
|
|
|
const reactiveMap = new WeakMap();
|
|
const shallowReactiveMap = new WeakMap();
|
|
const readonlyMap = new WeakMap();
|
|
const shallowReadonlyMap = new WeakMap();
|
|
function targetTypeMap(rawType) {
|
|
switch (rawType) {
|
|
case 'Object':
|
|
case 'Array':
|
|
return 1 /* COMMON */;
|
|
case 'Map':
|
|
case 'Set':
|
|
case 'WeakMap':
|
|
case 'WeakSet':
|
|
return 2 /* COLLECTION */;
|
|
default:
|
|
return 0 /* INVALID */;
|
|
}
|
|
}
|
|
function getTargetType(value) {
|
|
return value["__v_skip" /* SKIP */] || !Object.isExtensible(value)
|
|
? 0 /* INVALID */
|
|
: targetTypeMap((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.toRawType)(value));
|
|
}
|
|
function reactive(target) {
|
|
// if trying to observe a readonly proxy, return the readonly version.
|
|
if (target && target["__v_isReadonly" /* IS_READONLY */]) {
|
|
return target;
|
|
}
|
|
return createReactiveObject(target, false, mutableHandlers, mutableCollectionHandlers, reactiveMap);
|
|
}
|
|
/**
|
|
* Return a shallowly-reactive copy of the original object, where only the root
|
|
* level properties are reactive. It also does not auto-unwrap refs (even at the
|
|
* root level).
|
|
*/
|
|
function shallowReactive(target) {
|
|
return createReactiveObject(target, false, shallowReactiveHandlers, shallowCollectionHandlers, shallowReactiveMap);
|
|
}
|
|
/**
|
|
* Creates a readonly copy of the original object. Note the returned copy is not
|
|
* made reactive, but `readonly` can be called on an already reactive object.
|
|
*/
|
|
function readonly(target) {
|
|
return createReactiveObject(target, true, readonlyHandlers, readonlyCollectionHandlers, readonlyMap);
|
|
}
|
|
/**
|
|
* Returns a reactive-copy of the original object, where only the root level
|
|
* properties are readonly, and does NOT unwrap refs nor recursively convert
|
|
* returned properties.
|
|
* This is used for creating the props proxy object for stateful components.
|
|
*/
|
|
function shallowReadonly(target) {
|
|
return createReactiveObject(target, true, shallowReadonlyHandlers, shallowReadonlyCollectionHandlers, shallowReadonlyMap);
|
|
}
|
|
function createReactiveObject(target, isReadonly, baseHandlers, collectionHandlers, proxyMap) {
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isObject)(target)) {
|
|
if ((true)) {
|
|
console.warn(`value cannot be made reactive: ${String(target)}`);
|
|
}
|
|
return target;
|
|
}
|
|
// target is already a Proxy, return it.
|
|
// exception: calling readonly() on a reactive object
|
|
if (target["__v_raw" /* RAW */] &&
|
|
!(isReadonly && target["__v_isReactive" /* IS_REACTIVE */])) {
|
|
return target;
|
|
}
|
|
// target already has corresponding Proxy
|
|
const existingProxy = proxyMap.get(target);
|
|
if (existingProxy) {
|
|
return existingProxy;
|
|
}
|
|
// only a whitelist of value types can be observed.
|
|
const targetType = getTargetType(target);
|
|
if (targetType === 0 /* INVALID */) {
|
|
return target;
|
|
}
|
|
const proxy = new Proxy(target, targetType === 2 /* COLLECTION */ ? collectionHandlers : baseHandlers);
|
|
proxyMap.set(target, proxy);
|
|
return proxy;
|
|
}
|
|
function isReactive(value) {
|
|
if (isReadonly(value)) {
|
|
return isReactive(value["__v_raw" /* RAW */]);
|
|
}
|
|
return !!(value && value["__v_isReactive" /* IS_REACTIVE */]);
|
|
}
|
|
function isReadonly(value) {
|
|
return !!(value && value["__v_isReadonly" /* IS_READONLY */]);
|
|
}
|
|
function isProxy(value) {
|
|
return isReactive(value) || isReadonly(value);
|
|
}
|
|
function toRaw(observed) {
|
|
const raw = observed && observed["__v_raw" /* RAW */];
|
|
return raw ? toRaw(raw) : observed;
|
|
}
|
|
function markRaw(value) {
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.def)(value, "__v_skip" /* SKIP */, true);
|
|
return value;
|
|
}
|
|
|
|
function trackRefValue(ref) {
|
|
if (isTracking()) {
|
|
ref = toRaw(ref);
|
|
if (!ref.dep) {
|
|
ref.dep = createDep();
|
|
}
|
|
if ((true)) {
|
|
trackEffects(ref.dep, {
|
|
target: ref,
|
|
type: "get" /* GET */,
|
|
key: 'value'
|
|
});
|
|
}
|
|
else {}
|
|
}
|
|
}
|
|
function triggerRefValue(ref, newVal) {
|
|
ref = toRaw(ref);
|
|
if (ref.dep) {
|
|
if ((true)) {
|
|
triggerEffects(ref.dep, {
|
|
target: ref,
|
|
type: "set" /* SET */,
|
|
key: 'value',
|
|
newValue: newVal
|
|
});
|
|
}
|
|
else {}
|
|
}
|
|
}
|
|
const convert = (val) => (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isObject)(val) ? reactive(val) : val;
|
|
function isRef(r) {
|
|
return Boolean(r && r.__v_isRef === true);
|
|
}
|
|
function ref(value) {
|
|
return createRef(value, false);
|
|
}
|
|
function shallowRef(value) {
|
|
return createRef(value, true);
|
|
}
|
|
class RefImpl {
|
|
constructor(value, _shallow) {
|
|
this._shallow = _shallow;
|
|
this.dep = undefined;
|
|
this.__v_isRef = true;
|
|
this._rawValue = _shallow ? value : toRaw(value);
|
|
this._value = _shallow ? value : convert(value);
|
|
}
|
|
get value() {
|
|
trackRefValue(this);
|
|
return this._value;
|
|
}
|
|
set value(newVal) {
|
|
newVal = this._shallow ? newVal : toRaw(newVal);
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.hasChanged)(newVal, this._rawValue)) {
|
|
this._rawValue = newVal;
|
|
this._value = this._shallow ? newVal : convert(newVal);
|
|
triggerRefValue(this, newVal);
|
|
}
|
|
}
|
|
}
|
|
function createRef(rawValue, shallow) {
|
|
if (isRef(rawValue)) {
|
|
return rawValue;
|
|
}
|
|
return new RefImpl(rawValue, shallow);
|
|
}
|
|
function triggerRef(ref) {
|
|
triggerRefValue(ref, ( true) ? ref.value : 0);
|
|
}
|
|
function unref(ref) {
|
|
return isRef(ref) ? ref.value : ref;
|
|
}
|
|
const shallowUnwrapHandlers = {
|
|
get: (target, key, receiver) => unref(Reflect.get(target, key, receiver)),
|
|
set: (target, key, value, receiver) => {
|
|
const oldValue = target[key];
|
|
if (isRef(oldValue) && !isRef(value)) {
|
|
oldValue.value = value;
|
|
return true;
|
|
}
|
|
else {
|
|
return Reflect.set(target, key, value, receiver);
|
|
}
|
|
}
|
|
};
|
|
function proxyRefs(objectWithRefs) {
|
|
return isReactive(objectWithRefs)
|
|
? objectWithRefs
|
|
: new Proxy(objectWithRefs, shallowUnwrapHandlers);
|
|
}
|
|
class CustomRefImpl {
|
|
constructor(factory) {
|
|
this.dep = undefined;
|
|
this.__v_isRef = true;
|
|
const { get, set } = factory(() => trackRefValue(this), () => triggerRefValue(this));
|
|
this._get = get;
|
|
this._set = set;
|
|
}
|
|
get value() {
|
|
return this._get();
|
|
}
|
|
set value(newVal) {
|
|
this._set(newVal);
|
|
}
|
|
}
|
|
function customRef(factory) {
|
|
return new CustomRefImpl(factory);
|
|
}
|
|
function toRefs(object) {
|
|
if (( true) && !isProxy(object)) {
|
|
console.warn(`toRefs() expects a reactive object but received a plain one.`);
|
|
}
|
|
const ret = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isArray)(object) ? new Array(object.length) : {};
|
|
for (const key in object) {
|
|
ret[key] = toRef(object, key);
|
|
}
|
|
return ret;
|
|
}
|
|
class ObjectRefImpl {
|
|
constructor(_object, _key) {
|
|
this._object = _object;
|
|
this._key = _key;
|
|
this.__v_isRef = true;
|
|
}
|
|
get value() {
|
|
return this._object[this._key];
|
|
}
|
|
set value(newVal) {
|
|
this._object[this._key] = newVal;
|
|
}
|
|
}
|
|
function toRef(object, key) {
|
|
const val = object[key];
|
|
return isRef(val) ? val : new ObjectRefImpl(object, key);
|
|
}
|
|
|
|
class ComputedRefImpl {
|
|
constructor(getter, _setter, isReadonly) {
|
|
this._setter = _setter;
|
|
this.dep = undefined;
|
|
this._dirty = true;
|
|
this.__v_isRef = true;
|
|
this.effect = new ReactiveEffect(getter, () => {
|
|
if (!this._dirty) {
|
|
this._dirty = true;
|
|
triggerRefValue(this);
|
|
}
|
|
});
|
|
this["__v_isReadonly" /* IS_READONLY */] = isReadonly;
|
|
}
|
|
get value() {
|
|
// the computed ref may get wrapped by other proxies e.g. readonly() #3376
|
|
const self = toRaw(this);
|
|
trackRefValue(self);
|
|
if (self._dirty) {
|
|
self._dirty = false;
|
|
self._value = self.effect.run();
|
|
}
|
|
return self._value;
|
|
}
|
|
set value(newValue) {
|
|
this._setter(newValue);
|
|
}
|
|
}
|
|
function computed(getterOrOptions, debugOptions) {
|
|
let getter;
|
|
let setter;
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isFunction)(getterOrOptions)) {
|
|
getter = getterOrOptions;
|
|
setter = ( true)
|
|
? () => {
|
|
console.warn('Write operation failed: computed value is readonly');
|
|
}
|
|
: 0;
|
|
}
|
|
else {
|
|
getter = getterOrOptions.get;
|
|
setter = getterOrOptions.set;
|
|
}
|
|
const cRef = new ComputedRefImpl(getter, setter, (0,_vue_shared__WEBPACK_IMPORTED_MODULE_0__.isFunction)(getterOrOptions) || !getterOrOptions.set);
|
|
if (( true) && debugOptions) {
|
|
cRef.effect.onTrack = debugOptions.onTrack;
|
|
cRef.effect.onTrigger = debugOptions.onTrigger;
|
|
}
|
|
return cRef;
|
|
}
|
|
|
|
var _a;
|
|
const tick = Promise.resolve();
|
|
const queue = [];
|
|
let queued = false;
|
|
const scheduler = (fn) => {
|
|
queue.push(fn);
|
|
if (!queued) {
|
|
queued = true;
|
|
tick.then(flush);
|
|
}
|
|
};
|
|
const flush = () => {
|
|
for (let i = 0; i < queue.length; i++) {
|
|
queue[i]();
|
|
}
|
|
queue.length = 0;
|
|
queued = false;
|
|
};
|
|
class DeferredComputedRefImpl {
|
|
constructor(getter) {
|
|
this.dep = undefined;
|
|
this._dirty = true;
|
|
this.__v_isRef = true;
|
|
this[_a] = true;
|
|
let compareTarget;
|
|
let hasCompareTarget = false;
|
|
let scheduled = false;
|
|
this.effect = new ReactiveEffect(getter, (computedTrigger) => {
|
|
if (this.dep) {
|
|
if (computedTrigger) {
|
|
compareTarget = this._value;
|
|
hasCompareTarget = true;
|
|
}
|
|
else if (!scheduled) {
|
|
const valueToCompare = hasCompareTarget ? compareTarget : this._value;
|
|
scheduled = true;
|
|
hasCompareTarget = false;
|
|
scheduler(() => {
|
|
if (this.effect.active && this._get() !== valueToCompare) {
|
|
triggerRefValue(this);
|
|
}
|
|
scheduled = false;
|
|
});
|
|
}
|
|
// chained upstream computeds are notified synchronously to ensure
|
|
// value invalidation in case of sync access; normal effects are
|
|
// deferred to be triggered in scheduler.
|
|
for (const e of this.dep) {
|
|
if (e.computed) {
|
|
e.scheduler(true /* computedTrigger */);
|
|
}
|
|
}
|
|
}
|
|
this._dirty = true;
|
|
});
|
|
this.effect.computed = true;
|
|
}
|
|
_get() {
|
|
if (this._dirty) {
|
|
this._dirty = false;
|
|
return (this._value = this.effect.run());
|
|
}
|
|
return this._value;
|
|
}
|
|
get value() {
|
|
trackRefValue(this);
|
|
// the computed ref may get wrapped by other proxies e.g. readonly() #3376
|
|
return toRaw(this)._get();
|
|
}
|
|
}
|
|
_a = "__v_isReadonly" /* IS_READONLY */;
|
|
function deferredComputed(getter) {
|
|
return new DeferredComputedRefImpl(getter);
|
|
}
|
|
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/runtime-core/dist/runtime-core.esm-bundler.js":
|
|
/*!*************************************************************************!*\
|
|
!*** ./node_modules/@vue/runtime-core/dist/runtime-core.esm-bundler.js ***!
|
|
\*************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "EffectScope": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.EffectScope),
|
|
/* harmony export */ "ReactiveEffect": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.ReactiveEffect),
|
|
/* harmony export */ "computed": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.computed),
|
|
/* harmony export */ "customRef": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.customRef),
|
|
/* harmony export */ "effect": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.effect),
|
|
/* harmony export */ "effectScope": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.effectScope),
|
|
/* harmony export */ "getCurrentScope": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.getCurrentScope),
|
|
/* harmony export */ "isProxy": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isProxy),
|
|
/* harmony export */ "isReactive": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isReactive),
|
|
/* harmony export */ "isReadonly": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isReadonly),
|
|
/* harmony export */ "isRef": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isRef),
|
|
/* harmony export */ "markRaw": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.markRaw),
|
|
/* harmony export */ "onScopeDispose": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.onScopeDispose),
|
|
/* harmony export */ "proxyRefs": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.proxyRefs),
|
|
/* harmony export */ "reactive": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.reactive),
|
|
/* harmony export */ "readonly": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.readonly),
|
|
/* harmony export */ "ref": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.ref),
|
|
/* harmony export */ "shallowReactive": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.shallowReactive),
|
|
/* harmony export */ "shallowReadonly": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.shallowReadonly),
|
|
/* harmony export */ "shallowRef": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.shallowRef),
|
|
/* harmony export */ "stop": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.stop),
|
|
/* harmony export */ "toRaw": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw),
|
|
/* harmony export */ "toRef": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRef),
|
|
/* harmony export */ "toRefs": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRefs),
|
|
/* harmony export */ "triggerRef": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.triggerRef),
|
|
/* harmony export */ "unref": () => (/* reexport safe */ _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.unref),
|
|
/* harmony export */ "camelize": () => (/* reexport safe */ _vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize),
|
|
/* harmony export */ "capitalize": () => (/* reexport safe */ _vue_shared__WEBPACK_IMPORTED_MODULE_1__.capitalize),
|
|
/* harmony export */ "normalizeClass": () => (/* reexport safe */ _vue_shared__WEBPACK_IMPORTED_MODULE_1__.normalizeClass),
|
|
/* harmony export */ "normalizeProps": () => (/* reexport safe */ _vue_shared__WEBPACK_IMPORTED_MODULE_1__.normalizeProps),
|
|
/* harmony export */ "normalizeStyle": () => (/* reexport safe */ _vue_shared__WEBPACK_IMPORTED_MODULE_1__.normalizeStyle),
|
|
/* harmony export */ "toDisplayString": () => (/* reexport safe */ _vue_shared__WEBPACK_IMPORTED_MODULE_1__.toDisplayString),
|
|
/* harmony export */ "toHandlerKey": () => (/* reexport safe */ _vue_shared__WEBPACK_IMPORTED_MODULE_1__.toHandlerKey),
|
|
/* harmony export */ "BaseTransition": () => (/* binding */ BaseTransition),
|
|
/* harmony export */ "Comment": () => (/* binding */ Comment$1),
|
|
/* harmony export */ "Fragment": () => (/* binding */ Fragment),
|
|
/* harmony export */ "KeepAlive": () => (/* binding */ KeepAlive),
|
|
/* harmony export */ "Static": () => (/* binding */ Static),
|
|
/* harmony export */ "Suspense": () => (/* binding */ Suspense),
|
|
/* harmony export */ "Teleport": () => (/* binding */ Teleport),
|
|
/* harmony export */ "Text": () => (/* binding */ Text),
|
|
/* harmony export */ "callWithAsyncErrorHandling": () => (/* binding */ callWithAsyncErrorHandling),
|
|
/* harmony export */ "callWithErrorHandling": () => (/* binding */ callWithErrorHandling),
|
|
/* harmony export */ "cloneVNode": () => (/* binding */ cloneVNode),
|
|
/* harmony export */ "compatUtils": () => (/* binding */ compatUtils),
|
|
/* harmony export */ "createBlock": () => (/* binding */ createBlock),
|
|
/* harmony export */ "createCommentVNode": () => (/* binding */ createCommentVNode),
|
|
/* harmony export */ "createElementBlock": () => (/* binding */ createElementBlock),
|
|
/* harmony export */ "createElementVNode": () => (/* binding */ createBaseVNode),
|
|
/* harmony export */ "createHydrationRenderer": () => (/* binding */ createHydrationRenderer),
|
|
/* harmony export */ "createRenderer": () => (/* binding */ createRenderer),
|
|
/* harmony export */ "createSlots": () => (/* binding */ createSlots),
|
|
/* harmony export */ "createStaticVNode": () => (/* binding */ createStaticVNode),
|
|
/* harmony export */ "createTextVNode": () => (/* binding */ createTextVNode),
|
|
/* harmony export */ "createVNode": () => (/* binding */ createVNode),
|
|
/* harmony export */ "defineAsyncComponent": () => (/* binding */ defineAsyncComponent),
|
|
/* harmony export */ "defineComponent": () => (/* binding */ defineComponent),
|
|
/* harmony export */ "defineEmits": () => (/* binding */ defineEmits),
|
|
/* harmony export */ "defineExpose": () => (/* binding */ defineExpose),
|
|
/* harmony export */ "defineProps": () => (/* binding */ defineProps),
|
|
/* harmony export */ "devtools": () => (/* binding */ devtools),
|
|
/* harmony export */ "getCurrentInstance": () => (/* binding */ getCurrentInstance),
|
|
/* harmony export */ "getTransitionRawChildren": () => (/* binding */ getTransitionRawChildren),
|
|
/* harmony export */ "guardReactiveProps": () => (/* binding */ guardReactiveProps),
|
|
/* harmony export */ "h": () => (/* binding */ h),
|
|
/* harmony export */ "handleError": () => (/* binding */ handleError),
|
|
/* harmony export */ "initCustomFormatter": () => (/* binding */ initCustomFormatter),
|
|
/* harmony export */ "inject": () => (/* binding */ inject),
|
|
/* harmony export */ "isMemoSame": () => (/* binding */ isMemoSame),
|
|
/* harmony export */ "isRuntimeOnly": () => (/* binding */ isRuntimeOnly),
|
|
/* harmony export */ "isVNode": () => (/* binding */ isVNode),
|
|
/* harmony export */ "mergeDefaults": () => (/* binding */ mergeDefaults),
|
|
/* harmony export */ "mergeProps": () => (/* binding */ mergeProps),
|
|
/* harmony export */ "nextTick": () => (/* binding */ nextTick),
|
|
/* harmony export */ "onActivated": () => (/* binding */ onActivated),
|
|
/* harmony export */ "onBeforeMount": () => (/* binding */ onBeforeMount),
|
|
/* harmony export */ "onBeforeUnmount": () => (/* binding */ onBeforeUnmount),
|
|
/* harmony export */ "onBeforeUpdate": () => (/* binding */ onBeforeUpdate),
|
|
/* harmony export */ "onDeactivated": () => (/* binding */ onDeactivated),
|
|
/* harmony export */ "onErrorCaptured": () => (/* binding */ onErrorCaptured),
|
|
/* harmony export */ "onMounted": () => (/* binding */ onMounted),
|
|
/* harmony export */ "onRenderTracked": () => (/* binding */ onRenderTracked),
|
|
/* harmony export */ "onRenderTriggered": () => (/* binding */ onRenderTriggered),
|
|
/* harmony export */ "onServerPrefetch": () => (/* binding */ onServerPrefetch),
|
|
/* harmony export */ "onUnmounted": () => (/* binding */ onUnmounted),
|
|
/* harmony export */ "onUpdated": () => (/* binding */ onUpdated),
|
|
/* harmony export */ "openBlock": () => (/* binding */ openBlock),
|
|
/* harmony export */ "popScopeId": () => (/* binding */ popScopeId),
|
|
/* harmony export */ "provide": () => (/* binding */ provide),
|
|
/* harmony export */ "pushScopeId": () => (/* binding */ pushScopeId),
|
|
/* harmony export */ "queuePostFlushCb": () => (/* binding */ queuePostFlushCb),
|
|
/* harmony export */ "registerRuntimeCompiler": () => (/* binding */ registerRuntimeCompiler),
|
|
/* harmony export */ "renderList": () => (/* binding */ renderList),
|
|
/* harmony export */ "renderSlot": () => (/* binding */ renderSlot),
|
|
/* harmony export */ "resolveComponent": () => (/* binding */ resolveComponent),
|
|
/* harmony export */ "resolveDirective": () => (/* binding */ resolveDirective),
|
|
/* harmony export */ "resolveDynamicComponent": () => (/* binding */ resolveDynamicComponent),
|
|
/* harmony export */ "resolveFilter": () => (/* binding */ resolveFilter),
|
|
/* harmony export */ "resolveTransitionHooks": () => (/* binding */ resolveTransitionHooks),
|
|
/* harmony export */ "setBlockTracking": () => (/* binding */ setBlockTracking),
|
|
/* harmony export */ "setDevtoolsHook": () => (/* binding */ setDevtoolsHook),
|
|
/* harmony export */ "setTransitionHooks": () => (/* binding */ setTransitionHooks),
|
|
/* harmony export */ "ssrContextKey": () => (/* binding */ ssrContextKey),
|
|
/* harmony export */ "ssrUtils": () => (/* binding */ ssrUtils),
|
|
/* harmony export */ "toHandlers": () => (/* binding */ toHandlers),
|
|
/* harmony export */ "transformVNodeArgs": () => (/* binding */ transformVNodeArgs),
|
|
/* harmony export */ "useAttrs": () => (/* binding */ useAttrs),
|
|
/* harmony export */ "useSSRContext": () => (/* binding */ useSSRContext),
|
|
/* harmony export */ "useSlots": () => (/* binding */ useSlots),
|
|
/* harmony export */ "useTransitionState": () => (/* binding */ useTransitionState),
|
|
/* harmony export */ "version": () => (/* binding */ version),
|
|
/* harmony export */ "warn": () => (/* binding */ warn),
|
|
/* harmony export */ "watch": () => (/* binding */ watch),
|
|
/* harmony export */ "watchEffect": () => (/* binding */ watchEffect),
|
|
/* harmony export */ "watchPostEffect": () => (/* binding */ watchPostEffect),
|
|
/* harmony export */ "watchSyncEffect": () => (/* binding */ watchSyncEffect),
|
|
/* harmony export */ "withAsyncContext": () => (/* binding */ withAsyncContext),
|
|
/* harmony export */ "withCtx": () => (/* binding */ withCtx),
|
|
/* harmony export */ "withDefaults": () => (/* binding */ withDefaults),
|
|
/* harmony export */ "withDirectives": () => (/* binding */ withDirectives),
|
|
/* harmony export */ "withMemo": () => (/* binding */ withMemo),
|
|
/* harmony export */ "withScopeId": () => (/* binding */ withScopeId)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @vue/reactivity */ "./node_modules/@vue/reactivity/dist/reactivity.esm-bundler.js");
|
|
/* harmony import */ var _vue_shared__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @vue/shared */ "./node_modules/@vue/shared/dist/shared.esm-bundler.js");
|
|
|
|
|
|
|
|
|
|
|
|
/* eslint-disable no-restricted-globals */
|
|
let isHmrUpdating = false;
|
|
const hmrDirtyComponents = new Set();
|
|
// Expose the HMR runtime on the global object
|
|
// This makes it entirely tree-shakable without polluting the exports and makes
|
|
// it easier to be used in toolings like vue-loader
|
|
// Note: for a component to be eligible for HMR it also needs the __hmrId option
|
|
// to be set so that its instances can be registered / removed.
|
|
if ((true)) {
|
|
const globalObject = typeof __webpack_require__.g !== 'undefined'
|
|
? __webpack_require__.g
|
|
: typeof self !== 'undefined'
|
|
? self
|
|
: typeof window !== 'undefined'
|
|
? window
|
|
: {};
|
|
globalObject.__VUE_HMR_RUNTIME__ = {
|
|
createRecord: tryWrap(createRecord),
|
|
rerender: tryWrap(rerender),
|
|
reload: tryWrap(reload)
|
|
};
|
|
}
|
|
const map = new Map();
|
|
function registerHMR(instance) {
|
|
const id = instance.type.__hmrId;
|
|
let record = map.get(id);
|
|
if (!record) {
|
|
createRecord(id, instance.type);
|
|
record = map.get(id);
|
|
}
|
|
record.instances.add(instance);
|
|
}
|
|
function unregisterHMR(instance) {
|
|
map.get(instance.type.__hmrId).instances.delete(instance);
|
|
}
|
|
function createRecord(id, component) {
|
|
if (!component) {
|
|
warn(`HMR API usage is out of date.\n` +
|
|
`Please upgrade vue-loader/vite/rollup-plugin-vue or other relevant ` +
|
|
`dependency that handles Vue SFC compilation.`);
|
|
component = {};
|
|
}
|
|
if (map.has(id)) {
|
|
return false;
|
|
}
|
|
map.set(id, {
|
|
component: isClassComponent(component) ? component.__vccOpts : component,
|
|
instances: new Set()
|
|
});
|
|
return true;
|
|
}
|
|
function rerender(id, newRender) {
|
|
const record = map.get(id);
|
|
if (!record)
|
|
return;
|
|
if (newRender)
|
|
record.component.render = newRender;
|
|
// Array.from creates a snapshot which avoids the set being mutated during
|
|
// updates
|
|
Array.from(record.instances).forEach(instance => {
|
|
if (newRender) {
|
|
instance.render = newRender;
|
|
}
|
|
instance.renderCache = [];
|
|
// this flag forces child components with slot content to update
|
|
isHmrUpdating = true;
|
|
instance.update();
|
|
isHmrUpdating = false;
|
|
});
|
|
}
|
|
function reload(id, newComp) {
|
|
const record = map.get(id);
|
|
if (!record)
|
|
return;
|
|
// Array.from creates a snapshot which avoids the set being mutated during
|
|
// updates
|
|
const { component, instances } = record;
|
|
if (!hmrDirtyComponents.has(component)) {
|
|
// 1. Update existing comp definition to match new one
|
|
newComp = isClassComponent(newComp) ? newComp.__vccOpts : newComp;
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)(component, newComp);
|
|
for (const key in component) {
|
|
if (key !== '__file' && !(key in newComp)) {
|
|
delete component[key];
|
|
}
|
|
}
|
|
// 2. Mark component dirty. This forces the renderer to replace the component
|
|
// on patch.
|
|
hmrDirtyComponents.add(component);
|
|
// 3. Make sure to unmark the component after the reload.
|
|
queuePostFlushCb(() => {
|
|
hmrDirtyComponents.delete(component);
|
|
});
|
|
}
|
|
Array.from(instances).forEach(instance => {
|
|
// invalidate options resolution cache
|
|
instance.appContext.optionsCache.delete(instance.type);
|
|
if (instance.ceReload) {
|
|
// custom element
|
|
hmrDirtyComponents.add(component);
|
|
instance.ceReload(newComp.styles);
|
|
hmrDirtyComponents.delete(component);
|
|
}
|
|
else if (instance.parent) {
|
|
// 4. Force the parent instance to re-render. This will cause all updated
|
|
// components to be unmounted and re-mounted. Queue the update so that we
|
|
// don't end up forcing the same parent to re-render multiple times.
|
|
queueJob(instance.parent.update);
|
|
// instance is the inner component of an async custom element
|
|
// invoke to reset styles
|
|
if (instance.parent.type.__asyncLoader &&
|
|
instance.parent.ceReload) {
|
|
instance.parent.ceReload(newComp.styles);
|
|
}
|
|
}
|
|
else if (instance.appContext.reload) {
|
|
// root instance mounted via createApp() has a reload method
|
|
instance.appContext.reload();
|
|
}
|
|
else if (typeof window !== 'undefined') {
|
|
// root instance inside tree created via raw render(). Force reload.
|
|
window.location.reload();
|
|
}
|
|
else {
|
|
console.warn('[HMR] Root or manually mounted instance modified. Full reload required.');
|
|
}
|
|
});
|
|
}
|
|
function tryWrap(fn) {
|
|
return (id, arg) => {
|
|
try {
|
|
return fn(id, arg);
|
|
}
|
|
catch (e) {
|
|
console.error(e);
|
|
console.warn(`[HMR] Something went wrong during Vue component hot-reload. ` +
|
|
`Full reload required.`);
|
|
}
|
|
};
|
|
}
|
|
|
|
let devtools;
|
|
function setDevtoolsHook(hook) {
|
|
devtools = hook;
|
|
}
|
|
function devtoolsInitApp(app, version) {
|
|
// TODO queue if devtools is undefined
|
|
if (!devtools)
|
|
return;
|
|
devtools.emit("app:init" /* APP_INIT */, app, version, {
|
|
Fragment,
|
|
Text,
|
|
Comment: Comment$1,
|
|
Static
|
|
});
|
|
}
|
|
function devtoolsUnmountApp(app) {
|
|
if (!devtools)
|
|
return;
|
|
devtools.emit("app:unmount" /* APP_UNMOUNT */, app);
|
|
}
|
|
const devtoolsComponentAdded = /*#__PURE__*/ createDevtoolsComponentHook("component:added" /* COMPONENT_ADDED */);
|
|
const devtoolsComponentUpdated =
|
|
/*#__PURE__*/ createDevtoolsComponentHook("component:updated" /* COMPONENT_UPDATED */);
|
|
const devtoolsComponentRemoved =
|
|
/*#__PURE__*/ createDevtoolsComponentHook("component:removed" /* COMPONENT_REMOVED */);
|
|
function createDevtoolsComponentHook(hook) {
|
|
return (component) => {
|
|
if (!devtools)
|
|
return;
|
|
devtools.emit(hook, component.appContext.app, component.uid, component.parent ? component.parent.uid : undefined, component);
|
|
};
|
|
}
|
|
const devtoolsPerfStart = /*#__PURE__*/ createDevtoolsPerformanceHook("perf:start" /* PERFORMANCE_START */);
|
|
const devtoolsPerfEnd = /*#__PURE__*/ createDevtoolsPerformanceHook("perf:end" /* PERFORMANCE_END */);
|
|
function createDevtoolsPerformanceHook(hook) {
|
|
return (component, type, time) => {
|
|
if (!devtools)
|
|
return;
|
|
devtools.emit(hook, component.appContext.app, component.uid, component, type, time);
|
|
};
|
|
}
|
|
function devtoolsComponentEmit(component, event, params) {
|
|
if (!devtools)
|
|
return;
|
|
devtools.emit("component:emit" /* COMPONENT_EMIT */, component.appContext.app, component, event, params);
|
|
}
|
|
|
|
const deprecationData = {
|
|
["GLOBAL_MOUNT" /* GLOBAL_MOUNT */]: {
|
|
message: `The global app bootstrapping API has changed: vm.$mount() and the "el" ` +
|
|
`option have been removed. Use createApp(RootComponent).mount() instead.`,
|
|
link: `https://v3.vuejs.org/guide/migration/global-api.html#mounting-app-instance`
|
|
},
|
|
["GLOBAL_MOUNT_CONTAINER" /* GLOBAL_MOUNT_CONTAINER */]: {
|
|
message: `Vue detected directives on the mount container. ` +
|
|
`In Vue 3, the container is no longer considered part of the template ` +
|
|
`and will not be processed/replaced.`,
|
|
link: `https://v3.vuejs.org/guide/migration/mount-changes.html`
|
|
},
|
|
["GLOBAL_EXTEND" /* GLOBAL_EXTEND */]: {
|
|
message: `Vue.extend() has been removed in Vue 3. ` +
|
|
`Use defineComponent() instead.`,
|
|
link: `https://v3.vuejs.org/api/global-api.html#definecomponent`
|
|
},
|
|
["GLOBAL_PROTOTYPE" /* GLOBAL_PROTOTYPE */]: {
|
|
message: `Vue.prototype is no longer available in Vue 3. ` +
|
|
`Use app.config.globalProperties instead.`,
|
|
link: `https://v3.vuejs.org/guide/migration/global-api.html#vue-prototype-replaced-by-config-globalproperties`
|
|
},
|
|
["GLOBAL_SET" /* GLOBAL_SET */]: {
|
|
message: `Vue.set() has been removed as it is no longer needed in Vue 3. ` +
|
|
`Simply use native JavaScript mutations.`
|
|
},
|
|
["GLOBAL_DELETE" /* GLOBAL_DELETE */]: {
|
|
message: `Vue.delete() has been removed as it is no longer needed in Vue 3. ` +
|
|
`Simply use native JavaScript mutations.`
|
|
},
|
|
["GLOBAL_OBSERVABLE" /* GLOBAL_OBSERVABLE */]: {
|
|
message: `Vue.observable() has been removed. ` +
|
|
`Use \`import { reactive } from "vue"\` from Composition API instead.`,
|
|
link: `https://v3.vuejs.org/api/basic-reactivity.html`
|
|
},
|
|
["GLOBAL_PRIVATE_UTIL" /* GLOBAL_PRIVATE_UTIL */]: {
|
|
message: `Vue.util has been removed. Please refactor to avoid its usage ` +
|
|
`since it was an internal API even in Vue 2.`
|
|
},
|
|
["CONFIG_SILENT" /* CONFIG_SILENT */]: {
|
|
message: `config.silent has been removed because it is not good practice to ` +
|
|
`intentionally suppress warnings. You can use your browser console's ` +
|
|
`filter features to focus on relevant messages.`
|
|
},
|
|
["CONFIG_DEVTOOLS" /* CONFIG_DEVTOOLS */]: {
|
|
message: `config.devtools has been removed. To enable devtools for ` +
|
|
`production, configure the __VUE_PROD_DEVTOOLS__ compile-time flag.`,
|
|
link: `https://github.com/vuejs/vue-next/tree/master/packages/vue#bundler-build-feature-flags`
|
|
},
|
|
["CONFIG_KEY_CODES" /* CONFIG_KEY_CODES */]: {
|
|
message: `config.keyCodes has been removed. ` +
|
|
`In Vue 3, you can directly use the kebab-case key names as v-on modifiers.`,
|
|
link: `https://v3.vuejs.org/guide/migration/keycode-modifiers.html`
|
|
},
|
|
["CONFIG_PRODUCTION_TIP" /* CONFIG_PRODUCTION_TIP */]: {
|
|
message: `config.productionTip has been removed.`,
|
|
link: `https://v3.vuejs.org/guide/migration/global-api.html#config-productiontip-removed`
|
|
},
|
|
["CONFIG_IGNORED_ELEMENTS" /* CONFIG_IGNORED_ELEMENTS */]: {
|
|
message: () => {
|
|
let msg = `config.ignoredElements has been removed.`;
|
|
if (isRuntimeOnly()) {
|
|
msg += ` Pass the "isCustomElement" option to @vue/compiler-dom instead.`;
|
|
}
|
|
else {
|
|
msg += ` Use config.isCustomElement instead.`;
|
|
}
|
|
return msg;
|
|
},
|
|
link: `https://v3.vuejs.org/guide/migration/global-api.html#config-ignoredelements-is-now-config-iscustomelement`
|
|
},
|
|
["CONFIG_WHITESPACE" /* CONFIG_WHITESPACE */]: {
|
|
// this warning is only relevant in the full build when using runtime
|
|
// compilation, so it's put in the runtime compatConfig list.
|
|
message: `Vue 3 compiler's whitespace option will default to "condense" instead of ` +
|
|
`"preserve". To suppress this warning, provide an explicit value for ` +
|
|
`\`config.compilerOptions.whitespace\`.`
|
|
},
|
|
["CONFIG_OPTION_MERGE_STRATS" /* CONFIG_OPTION_MERGE_STRATS */]: {
|
|
message: `config.optionMergeStrategies no longer exposes internal strategies. ` +
|
|
`Use custom merge functions instead.`
|
|
},
|
|
["INSTANCE_SET" /* INSTANCE_SET */]: {
|
|
message: `vm.$set() has been removed as it is no longer needed in Vue 3. ` +
|
|
`Simply use native JavaScript mutations.`
|
|
},
|
|
["INSTANCE_DELETE" /* INSTANCE_DELETE */]: {
|
|
message: `vm.$delete() has been removed as it is no longer needed in Vue 3. ` +
|
|
`Simply use native JavaScript mutations.`
|
|
},
|
|
["INSTANCE_DESTROY" /* INSTANCE_DESTROY */]: {
|
|
message: `vm.$destroy() has been removed. Use app.unmount() instead.`,
|
|
link: `https://v3.vuejs.org/api/application-api.html#unmount`
|
|
},
|
|
["INSTANCE_EVENT_EMITTER" /* INSTANCE_EVENT_EMITTER */]: {
|
|
message: `vm.$on/$once/$off() have been removed. ` +
|
|
`Use an external event emitter library instead.`,
|
|
link: `https://v3.vuejs.org/guide/migration/events-api.html`
|
|
},
|
|
["INSTANCE_EVENT_HOOKS" /* INSTANCE_EVENT_HOOKS */]: {
|
|
message: event => `"${event}" lifecycle events are no longer supported. From templates, ` +
|
|
`use the "vnode" prefix instead of "hook:". For example, @${event} ` +
|
|
`should be changed to @vnode-${event.slice(5)}. ` +
|
|
`From JavaScript, use Composition API to dynamically register lifecycle ` +
|
|
`hooks.`,
|
|
link: `https://v3.vuejs.org/guide/migration/vnode-lifecycle-events.html`
|
|
},
|
|
["INSTANCE_CHILDREN" /* INSTANCE_CHILDREN */]: {
|
|
message: `vm.$children has been removed. Consider refactoring your logic ` +
|
|
`to avoid relying on direct access to child components.`,
|
|
link: `https://v3.vuejs.org/guide/migration/children.html`
|
|
},
|
|
["INSTANCE_LISTENERS" /* INSTANCE_LISTENERS */]: {
|
|
message: `vm.$listeners has been removed. In Vue 3, parent v-on listeners are ` +
|
|
`included in vm.$attrs and it is no longer necessary to separately use ` +
|
|
`v-on="$listeners" if you are already using v-bind="$attrs". ` +
|
|
`(Note: the Vue 3 behavior only applies if this compat config is disabled)`,
|
|
link: `https://v3.vuejs.org/guide/migration/listeners-removed.html`
|
|
},
|
|
["INSTANCE_SCOPED_SLOTS" /* INSTANCE_SCOPED_SLOTS */]: {
|
|
message: `vm.$scopedSlots has been removed. Use vm.$slots instead.`,
|
|
link: `https://v3.vuejs.org/guide/migration/slots-unification.html`
|
|
},
|
|
["INSTANCE_ATTRS_CLASS_STYLE" /* INSTANCE_ATTRS_CLASS_STYLE */]: {
|
|
message: componentName => `Component <${componentName || 'Anonymous'}> has \`inheritAttrs: false\` but is ` +
|
|
`relying on class/style fallthrough from parent. In Vue 3, class/style ` +
|
|
`are now included in $attrs and will no longer fallthrough when ` +
|
|
`inheritAttrs is false. If you are already using v-bind="$attrs" on ` +
|
|
`component root it should render the same end result. ` +
|
|
`If you are binding $attrs to a non-root element and expecting ` +
|
|
`class/style to fallthrough on root, you will need to now manually bind ` +
|
|
`them on root via :class="$attrs.class".`,
|
|
link: `https://v3.vuejs.org/guide/migration/attrs-includes-class-style.html`
|
|
},
|
|
["OPTIONS_DATA_FN" /* OPTIONS_DATA_FN */]: {
|
|
message: `The "data" option can no longer be a plain object. ` +
|
|
`Always use a function.`,
|
|
link: `https://v3.vuejs.org/guide/migration/data-option.html`
|
|
},
|
|
["OPTIONS_DATA_MERGE" /* OPTIONS_DATA_MERGE */]: {
|
|
message: (key) => `Detected conflicting key "${key}" when merging data option values. ` +
|
|
`In Vue 3, data keys are merged shallowly and will override one another.`,
|
|
link: `https://v3.vuejs.org/guide/migration/data-option.html#mixin-merge-behavior-change`
|
|
},
|
|
["OPTIONS_BEFORE_DESTROY" /* OPTIONS_BEFORE_DESTROY */]: {
|
|
message: `\`beforeDestroy\` has been renamed to \`beforeUnmount\`.`
|
|
},
|
|
["OPTIONS_DESTROYED" /* OPTIONS_DESTROYED */]: {
|
|
message: `\`destroyed\` has been renamed to \`unmounted\`.`
|
|
},
|
|
["WATCH_ARRAY" /* WATCH_ARRAY */]: {
|
|
message: `"watch" option or vm.$watch on an array value will no longer ` +
|
|
`trigger on array mutation unless the "deep" option is specified. ` +
|
|
`If current usage is intended, you can disable the compat behavior and ` +
|
|
`suppress this warning with:` +
|
|
`\n\n configureCompat({ ${"WATCH_ARRAY" /* WATCH_ARRAY */}: false })\n`,
|
|
link: `https://v3.vuejs.org/guide/migration/watch.html`
|
|
},
|
|
["PROPS_DEFAULT_THIS" /* PROPS_DEFAULT_THIS */]: {
|
|
message: (key) => `props default value function no longer has access to "this". The compat ` +
|
|
`build only offers access to this.$options.` +
|
|
`(found in prop "${key}")`,
|
|
link: `https://v3.vuejs.org/guide/migration/props-default-this.html`
|
|
},
|
|
["CUSTOM_DIR" /* CUSTOM_DIR */]: {
|
|
message: (legacyHook, newHook) => `Custom directive hook "${legacyHook}" has been removed. ` +
|
|
`Use "${newHook}" instead.`,
|
|
link: `https://v3.vuejs.org/guide/migration/custom-directives.html`
|
|
},
|
|
["V_FOR_REF" /* V_FOR_REF */]: {
|
|
message: `Ref usage on v-for no longer creates array ref values in Vue 3. ` +
|
|
`Consider using function refs or refactor to avoid ref usage altogether.`,
|
|
link: `https://v3.vuejs.org/guide/migration/array-refs.html`
|
|
},
|
|
["V_ON_KEYCODE_MODIFIER" /* V_ON_KEYCODE_MODIFIER */]: {
|
|
message: `Using keyCode as v-on modifier is no longer supported. ` +
|
|
`Use kebab-case key name modifiers instead.`,
|
|
link: `https://v3.vuejs.org/guide/migration/keycode-modifiers.html`
|
|
},
|
|
["ATTR_FALSE_VALUE" /* ATTR_FALSE_VALUE */]: {
|
|
message: (name) => `Attribute "${name}" with v-bind value \`false\` will render ` +
|
|
`${name}="false" instead of removing it in Vue 3. To remove the attribute, ` +
|
|
`use \`null\` or \`undefined\` instead. If the usage is intended, ` +
|
|
`you can disable the compat behavior and suppress this warning with:` +
|
|
`\n\n configureCompat({ ${"ATTR_FALSE_VALUE" /* ATTR_FALSE_VALUE */}: false })\n`,
|
|
link: `https://v3.vuejs.org/guide/migration/attribute-coercion.html`
|
|
},
|
|
["ATTR_ENUMERATED_COERCION" /* ATTR_ENUMERATED_COERCION */]: {
|
|
message: (name, value, coerced) => `Enumerated attribute "${name}" with v-bind value \`${value}\` will ` +
|
|
`${value === null ? `be removed` : `render the value as-is`} instead of coercing the value to "${coerced}" in Vue 3. ` +
|
|
`Always use explicit "true" or "false" values for enumerated attributes. ` +
|
|
`If the usage is intended, ` +
|
|
`you can disable the compat behavior and suppress this warning with:` +
|
|
`\n\n configureCompat({ ${"ATTR_ENUMERATED_COERCION" /* ATTR_ENUMERATED_COERCION */}: false })\n`,
|
|
link: `https://v3.vuejs.org/guide/migration/attribute-coercion.html`
|
|
},
|
|
["TRANSITION_CLASSES" /* TRANSITION_CLASSES */]: {
|
|
message: `` // this feature cannot be runtime-detected
|
|
},
|
|
["TRANSITION_GROUP_ROOT" /* TRANSITION_GROUP_ROOT */]: {
|
|
message: `<TransitionGroup> no longer renders a root <span> element by ` +
|
|
`default if no "tag" prop is specified. If you do not rely on the span ` +
|
|
`for styling, you can disable the compat behavior and suppress this ` +
|
|
`warning with:` +
|
|
`\n\n configureCompat({ ${"TRANSITION_GROUP_ROOT" /* TRANSITION_GROUP_ROOT */}: false })\n`,
|
|
link: `https://v3.vuejs.org/guide/migration/transition-group.html`
|
|
},
|
|
["COMPONENT_ASYNC" /* COMPONENT_ASYNC */]: {
|
|
message: (comp) => {
|
|
const name = getComponentName(comp);
|
|
return (`Async component${name ? ` <${name}>` : `s`} should be explicitly created via \`defineAsyncComponent()\` ` +
|
|
`in Vue 3. Plain functions will be treated as functional components in ` +
|
|
`non-compat build. If you have already migrated all async component ` +
|
|
`usage and intend to use plain functions for functional components, ` +
|
|
`you can disable the compat behavior and suppress this ` +
|
|
`warning with:` +
|
|
`\n\n configureCompat({ ${"COMPONENT_ASYNC" /* COMPONENT_ASYNC */}: false })\n`);
|
|
},
|
|
link: `https://v3.vuejs.org/guide/migration/async-components.html`
|
|
},
|
|
["COMPONENT_FUNCTIONAL" /* COMPONENT_FUNCTIONAL */]: {
|
|
message: (comp) => {
|
|
const name = getComponentName(comp);
|
|
return (`Functional component${name ? ` <${name}>` : `s`} should be defined as a plain function in Vue 3. The "functional" ` +
|
|
`option has been removed. NOTE: Before migrating to use plain ` +
|
|
`functions for functional components, first make sure that all async ` +
|
|
`components usage have been migrated and its compat behavior has ` +
|
|
`been disabled.`);
|
|
},
|
|
link: `https://v3.vuejs.org/guide/migration/functional-components.html`
|
|
},
|
|
["COMPONENT_V_MODEL" /* COMPONENT_V_MODEL */]: {
|
|
message: (comp) => {
|
|
const configMsg = `opt-in to ` +
|
|
`Vue 3 behavior on a per-component basis with \`compatConfig: { ${"COMPONENT_V_MODEL" /* COMPONENT_V_MODEL */}: false }\`.`;
|
|
if (comp.props &&
|
|
((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(comp.props)
|
|
? comp.props.includes('modelValue')
|
|
: (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(comp.props, 'modelValue'))) {
|
|
return (`Component delcares "modelValue" prop, which is Vue 3 usage, but ` +
|
|
`is running under Vue 2 compat v-model behavior. You can ${configMsg}`);
|
|
}
|
|
return (`v-model usage on component has changed in Vue 3. Component that expects ` +
|
|
`to work with v-model should now use the "modelValue" prop and emit the ` +
|
|
`"update:modelValue" event. You can update the usage and then ${configMsg}`);
|
|
},
|
|
link: `https://v3.vuejs.org/guide/migration/v-model.html`
|
|
},
|
|
["RENDER_FUNCTION" /* RENDER_FUNCTION */]: {
|
|
message: `Vue 3's render function API has changed. ` +
|
|
`You can opt-in to the new API with:` +
|
|
`\n\n configureCompat({ ${"RENDER_FUNCTION" /* RENDER_FUNCTION */}: false })\n` +
|
|
`\n (This can also be done per-component via the "compatConfig" option.)`,
|
|
link: `https://v3.vuejs.org/guide/migration/render-function-api.html`
|
|
},
|
|
["FILTERS" /* FILTERS */]: {
|
|
message: `filters have been removed in Vue 3. ` +
|
|
`The "|" symbol will be treated as native JavaScript bitwise OR operator. ` +
|
|
`Use method calls or computed properties instead.`,
|
|
link: `https://v3.vuejs.org/guide/migration/filters.html`
|
|
},
|
|
["PRIVATE_APIS" /* PRIVATE_APIS */]: {
|
|
message: name => `"${name}" is a Vue 2 private API that no longer exists in Vue 3. ` +
|
|
`If you are seeing this warning only due to a dependency, you can ` +
|
|
`suppress this warning via { PRIVATE_APIS: 'supress-warning' }.`
|
|
}
|
|
};
|
|
const instanceWarned = Object.create(null);
|
|
const warnCount = Object.create(null);
|
|
function warnDeprecation(key, instance, ...args) {
|
|
if (false) {}
|
|
instance = instance || getCurrentInstance();
|
|
// check user config
|
|
const config = getCompatConfigForKey(key, instance);
|
|
if (config === 'suppress-warning') {
|
|
return;
|
|
}
|
|
const dupKey = key + args.join('');
|
|
let compId = instance && formatComponentName(instance, instance.type);
|
|
if (compId === 'Anonymous' && instance) {
|
|
compId = instance.uid;
|
|
}
|
|
// skip if the same warning is emitted for the same component type
|
|
const componentDupKey = dupKey + compId;
|
|
if (componentDupKey in instanceWarned) {
|
|
return;
|
|
}
|
|
instanceWarned[componentDupKey] = true;
|
|
// same warning, but different component. skip the long message and just
|
|
// log the key and count.
|
|
if (dupKey in warnCount) {
|
|
warn(`(deprecation ${key}) (${++warnCount[dupKey] + 1})`);
|
|
return;
|
|
}
|
|
warnCount[dupKey] = 0;
|
|
const { message, link } = deprecationData[key];
|
|
warn(`(deprecation ${key}) ${typeof message === 'function' ? message(...args) : message}${link ? `\n Details: ${link}` : ``}`);
|
|
if (!isCompatEnabled(key, instance, true)) {
|
|
console.error(`^ The above deprecation's compat behavior is disabled and will likely ` +
|
|
`lead to runtime errors.`);
|
|
}
|
|
}
|
|
const globalCompatConfig = {
|
|
MODE: 2
|
|
};
|
|
function getCompatConfigForKey(key, instance) {
|
|
const instanceConfig = instance && instance.type.compatConfig;
|
|
if (instanceConfig && key in instanceConfig) {
|
|
return instanceConfig[key];
|
|
}
|
|
return globalCompatConfig[key];
|
|
}
|
|
function isCompatEnabled(key, instance, enableForBuiltIn = false) {
|
|
// skip compat for built-in components
|
|
if (!enableForBuiltIn && instance && instance.type.__isBuiltIn) {
|
|
return false;
|
|
}
|
|
const rawMode = getCompatConfigForKey('MODE', instance) || 2;
|
|
const val = getCompatConfigForKey(key, instance);
|
|
const mode = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(rawMode)
|
|
? rawMode(instance && instance.type)
|
|
: rawMode;
|
|
if (mode === 2) {
|
|
return val !== false;
|
|
}
|
|
else {
|
|
return val === true || val === 'suppress-warning';
|
|
}
|
|
}
|
|
|
|
function emit(instance, event, ...rawArgs) {
|
|
const props = instance.vnode.props || _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ;
|
|
if ((true)) {
|
|
const { emitsOptions, propsOptions: [propsOptions] } = instance;
|
|
if (emitsOptions) {
|
|
if (!(event in emitsOptions) &&
|
|
!(false )) {
|
|
if (!propsOptions || !((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toHandlerKey)(event) in propsOptions)) {
|
|
warn(`Component emitted event "${event}" but it is neither declared in ` +
|
|
`the emits option nor as an "${(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toHandlerKey)(event)}" prop.`);
|
|
}
|
|
}
|
|
else {
|
|
const validator = emitsOptions[event];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(validator)) {
|
|
const isValid = validator(...rawArgs);
|
|
if (!isValid) {
|
|
warn(`Invalid event arguments: event validation failed for event "${event}".`);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
let args = rawArgs;
|
|
const isModelListener = event.startsWith('update:');
|
|
// for v-model update:xxx events, apply modifiers on args
|
|
const modelArg = isModelListener && event.slice(7);
|
|
if (modelArg && modelArg in props) {
|
|
const modifiersKey = `${modelArg === 'modelValue' ? 'model' : modelArg}Modifiers`;
|
|
const { number, trim } = props[modifiersKey] || _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ;
|
|
if (trim) {
|
|
args = rawArgs.map(a => a.trim());
|
|
}
|
|
else if (number) {
|
|
args = rawArgs.map(_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toNumber);
|
|
}
|
|
}
|
|
if (true) {
|
|
devtoolsComponentEmit(instance, event, args);
|
|
}
|
|
if ((true)) {
|
|
const lowerCaseEvent = event.toLowerCase();
|
|
if (lowerCaseEvent !== event && props[(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toHandlerKey)(lowerCaseEvent)]) {
|
|
warn(`Event "${lowerCaseEvent}" is emitted in component ` +
|
|
`${formatComponentName(instance, instance.type)} but the handler is registered for "${event}". ` +
|
|
`Note that HTML attributes are case-insensitive and you cannot use ` +
|
|
`v-on to listen to camelCase events when using in-DOM templates. ` +
|
|
`You should probably use "${(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hyphenate)(event)}" instead of "${event}".`);
|
|
}
|
|
}
|
|
let handlerName;
|
|
let handler = props[(handlerName = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toHandlerKey)(event))] ||
|
|
// also try camelCase event handler (#2249)
|
|
props[(handlerName = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toHandlerKey)((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize)(event)))];
|
|
// for v-model update:xxx events, also trigger kebab-case equivalent
|
|
// for props passed via kebab-case
|
|
if (!handler && isModelListener) {
|
|
handler = props[(handlerName = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toHandlerKey)((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hyphenate)(event)))];
|
|
}
|
|
if (handler) {
|
|
callWithAsyncErrorHandling(handler, instance, 6 /* COMPONENT_EVENT_HANDLER */, args);
|
|
}
|
|
const onceHandler = props[handlerName + `Once`];
|
|
if (onceHandler) {
|
|
if (!instance.emitted) {
|
|
instance.emitted = {};
|
|
}
|
|
else if (instance.emitted[handlerName]) {
|
|
return;
|
|
}
|
|
instance.emitted[handlerName] = true;
|
|
callWithAsyncErrorHandling(onceHandler, instance, 6 /* COMPONENT_EVENT_HANDLER */, args);
|
|
}
|
|
}
|
|
function normalizeEmitsOptions(comp, appContext, asMixin = false) {
|
|
const cache = appContext.emitsCache;
|
|
const cached = cache.get(comp);
|
|
if (cached !== undefined) {
|
|
return cached;
|
|
}
|
|
const raw = comp.emits;
|
|
let normalized = {};
|
|
// apply mixin/extends props
|
|
let hasExtends = false;
|
|
if (__VUE_OPTIONS_API__ && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(comp)) {
|
|
const extendEmits = (raw) => {
|
|
const normalizedFromExtend = normalizeEmitsOptions(raw, appContext, true);
|
|
if (normalizedFromExtend) {
|
|
hasExtends = true;
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)(normalized, normalizedFromExtend);
|
|
}
|
|
};
|
|
if (!asMixin && appContext.mixins.length) {
|
|
appContext.mixins.forEach(extendEmits);
|
|
}
|
|
if (comp.extends) {
|
|
extendEmits(comp.extends);
|
|
}
|
|
if (comp.mixins) {
|
|
comp.mixins.forEach(extendEmits);
|
|
}
|
|
}
|
|
if (!raw && !hasExtends) {
|
|
cache.set(comp, null);
|
|
return null;
|
|
}
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(raw)) {
|
|
raw.forEach(key => (normalized[key] = null));
|
|
}
|
|
else {
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)(normalized, raw);
|
|
}
|
|
cache.set(comp, normalized);
|
|
return normalized;
|
|
}
|
|
// Check if an incoming prop key is a declared emit event listener.
|
|
// e.g. With `emits: { click: null }`, props named `onClick` and `onclick` are
|
|
// both considered matched listeners.
|
|
function isEmitListener(options, key) {
|
|
if (!options || !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isOn)(key)) {
|
|
return false;
|
|
}
|
|
key = key.slice(2).replace(/Once$/, '');
|
|
return ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(options, key[0].toLowerCase() + key.slice(1)) ||
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(options, (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hyphenate)(key)) ||
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(options, key));
|
|
}
|
|
|
|
/**
|
|
* mark the current rendering instance for asset resolution (e.g.
|
|
* resolveComponent, resolveDirective) during render
|
|
*/
|
|
let currentRenderingInstance = null;
|
|
let currentScopeId = null;
|
|
/**
|
|
* Note: rendering calls maybe nested. The function returns the parent rendering
|
|
* instance if present, which should be restored after the render is done:
|
|
*
|
|
* ```js
|
|
* const prev = setCurrentRenderingInstance(i)
|
|
* // ...render
|
|
* setCurrentRenderingInstance(prev)
|
|
* ```
|
|
*/
|
|
function setCurrentRenderingInstance(instance) {
|
|
const prev = currentRenderingInstance;
|
|
currentRenderingInstance = instance;
|
|
currentScopeId = (instance && instance.type.__scopeId) || null;
|
|
return prev;
|
|
}
|
|
/**
|
|
* Set scope id when creating hoisted vnodes.
|
|
* @private compiler helper
|
|
*/
|
|
function pushScopeId(id) {
|
|
currentScopeId = id;
|
|
}
|
|
/**
|
|
* Technically we no longer need this after 3.0.8 but we need to keep the same
|
|
* API for backwards compat w/ code generated by compilers.
|
|
* @private
|
|
*/
|
|
function popScopeId() {
|
|
currentScopeId = null;
|
|
}
|
|
/**
|
|
* Only for backwards compat
|
|
* @private
|
|
*/
|
|
const withScopeId = (_id) => withCtx;
|
|
/**
|
|
* Wrap a slot function to memoize current rendering instance
|
|
* @private compiler helper
|
|
*/
|
|
function withCtx(fn, ctx = currentRenderingInstance, isNonScopedSlot // false only
|
|
) {
|
|
if (!ctx)
|
|
return fn;
|
|
// already normalized
|
|
if (fn._n) {
|
|
return fn;
|
|
}
|
|
const renderFnWithContext = (...args) => {
|
|
// If a user calls a compiled slot inside a template expression (#1745), it
|
|
// can mess up block tracking, so by default we disable block tracking and
|
|
// force bail out when invoking a compiled slot (indicated by the ._d flag).
|
|
// This isn't necessary if rendering a compiled `<slot>`, so we flip the
|
|
// ._d flag off when invoking the wrapped fn inside `renderSlot`.
|
|
if (renderFnWithContext._d) {
|
|
setBlockTracking(-1);
|
|
}
|
|
const prevInstance = setCurrentRenderingInstance(ctx);
|
|
const res = fn(...args);
|
|
setCurrentRenderingInstance(prevInstance);
|
|
if (renderFnWithContext._d) {
|
|
setBlockTracking(1);
|
|
}
|
|
if (true) {
|
|
devtoolsComponentUpdated(ctx);
|
|
}
|
|
return res;
|
|
};
|
|
// mark normalized to avoid duplicated wrapping
|
|
renderFnWithContext._n = true;
|
|
// mark this as compiled by default
|
|
// this is used in vnode.ts -> normalizeChildren() to set the slot
|
|
// rendering flag.
|
|
renderFnWithContext._c = true;
|
|
// disable block tracking by default
|
|
renderFnWithContext._d = true;
|
|
return renderFnWithContext;
|
|
}
|
|
|
|
/**
|
|
* dev only flag to track whether $attrs was used during render.
|
|
* If $attrs was used during render then the warning for failed attrs
|
|
* fallthrough can be suppressed.
|
|
*/
|
|
let accessedAttrs = false;
|
|
function markAttrsAccessed() {
|
|
accessedAttrs = true;
|
|
}
|
|
function renderComponentRoot(instance) {
|
|
const { type: Component, vnode, proxy, withProxy, props, propsOptions: [propsOptions], slots, attrs, emit, render, renderCache, data, setupState, ctx, inheritAttrs } = instance;
|
|
let result;
|
|
const prev = setCurrentRenderingInstance(instance);
|
|
if ((true)) {
|
|
accessedAttrs = false;
|
|
}
|
|
try {
|
|
let fallthroughAttrs;
|
|
if (vnode.shapeFlag & 4 /* STATEFUL_COMPONENT */) {
|
|
// withProxy is a proxy with a different `has` trap only for
|
|
// runtime-compiled render functions using `with` block.
|
|
const proxyToUse = withProxy || proxy;
|
|
result = normalizeVNode(render.call(proxyToUse, proxyToUse, renderCache, props, setupState, data, ctx));
|
|
fallthroughAttrs = attrs;
|
|
}
|
|
else {
|
|
// functional
|
|
const render = Component;
|
|
// in dev, mark attrs accessed if optional props (attrs === props)
|
|
if (( true) && attrs === props) {
|
|
markAttrsAccessed();
|
|
}
|
|
result = normalizeVNode(render.length > 1
|
|
? render(props, ( true)
|
|
? {
|
|
get attrs() {
|
|
markAttrsAccessed();
|
|
return attrs;
|
|
},
|
|
slots,
|
|
emit
|
|
}
|
|
: 0)
|
|
: render(props, null /* we know it doesn't need it */));
|
|
fallthroughAttrs = Component.props
|
|
? attrs
|
|
: getFunctionalFallthrough(attrs);
|
|
}
|
|
// attr merging
|
|
// in dev mode, comments are preserved, and it's possible for a template
|
|
// to have comments along side the root element which makes it a fragment
|
|
let root = result;
|
|
let setRoot = undefined;
|
|
if (( true) &&
|
|
result.patchFlag > 0 &&
|
|
result.patchFlag & 2048 /* DEV_ROOT_FRAGMENT */) {
|
|
;
|
|
[root, setRoot] = getChildRoot(result);
|
|
}
|
|
if (fallthroughAttrs && inheritAttrs !== false) {
|
|
const keys = Object.keys(fallthroughAttrs);
|
|
const { shapeFlag } = root;
|
|
if (keys.length) {
|
|
if (shapeFlag & (1 /* ELEMENT */ | 6 /* COMPONENT */)) {
|
|
if (propsOptions && keys.some(_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isModelListener)) {
|
|
// If a v-model listener (onUpdate:xxx) has a corresponding declared
|
|
// prop, it indicates this component expects to handle v-model and
|
|
// it should not fallthrough.
|
|
// related: #1543, #1643, #1989
|
|
fallthroughAttrs = filterModelListeners(fallthroughAttrs, propsOptions);
|
|
}
|
|
root = cloneVNode(root, fallthroughAttrs);
|
|
}
|
|
else if (( true) && !accessedAttrs && root.type !== Comment$1) {
|
|
const allAttrs = Object.keys(attrs);
|
|
const eventAttrs = [];
|
|
const extraAttrs = [];
|
|
for (let i = 0, l = allAttrs.length; i < l; i++) {
|
|
const key = allAttrs[i];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isOn)(key)) {
|
|
// ignore v-model handlers when they fail to fallthrough
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isModelListener)(key)) {
|
|
// remove `on`, lowercase first letter to reflect event casing
|
|
// accurately
|
|
eventAttrs.push(key[2].toLowerCase() + key.slice(3));
|
|
}
|
|
}
|
|
else {
|
|
extraAttrs.push(key);
|
|
}
|
|
}
|
|
if (extraAttrs.length) {
|
|
warn(`Extraneous non-props attributes (` +
|
|
`${extraAttrs.join(', ')}) ` +
|
|
`were passed to component but could not be automatically inherited ` +
|
|
`because component renders fragment or text root nodes.`);
|
|
}
|
|
if (eventAttrs.length) {
|
|
warn(`Extraneous non-emits event listeners (` +
|
|
`${eventAttrs.join(', ')}) ` +
|
|
`were passed to component but could not be automatically inherited ` +
|
|
`because component renders fragment or text root nodes. ` +
|
|
`If the listener is intended to be a component custom event listener only, ` +
|
|
`declare it using the "emits" option.`);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
if (false) {}
|
|
// inherit directives
|
|
if (vnode.dirs) {
|
|
if (( true) && !isElementRoot(root)) {
|
|
warn(`Runtime directive used on component with non-element root node. ` +
|
|
`The directives will not function as intended.`);
|
|
}
|
|
root.dirs = root.dirs ? root.dirs.concat(vnode.dirs) : vnode.dirs;
|
|
}
|
|
// inherit transition data
|
|
if (vnode.transition) {
|
|
if (( true) && !isElementRoot(root)) {
|
|
warn(`Component inside <Transition> renders non-element root node ` +
|
|
`that cannot be animated.`);
|
|
}
|
|
root.transition = vnode.transition;
|
|
}
|
|
if (( true) && setRoot) {
|
|
setRoot(root);
|
|
}
|
|
else {
|
|
result = root;
|
|
}
|
|
}
|
|
catch (err) {
|
|
blockStack.length = 0;
|
|
handleError(err, instance, 1 /* RENDER_FUNCTION */);
|
|
result = createVNode(Comment$1);
|
|
}
|
|
setCurrentRenderingInstance(prev);
|
|
return result;
|
|
}
|
|
/**
|
|
* dev only
|
|
* In dev mode, template root level comments are rendered, which turns the
|
|
* template into a fragment root, but we need to locate the single element
|
|
* root for attrs and scope id processing.
|
|
*/
|
|
const getChildRoot = (vnode) => {
|
|
const rawChildren = vnode.children;
|
|
const dynamicChildren = vnode.dynamicChildren;
|
|
const childRoot = filterSingleRoot(rawChildren);
|
|
if (!childRoot) {
|
|
return [vnode, undefined];
|
|
}
|
|
const index = rawChildren.indexOf(childRoot);
|
|
const dynamicIndex = dynamicChildren ? dynamicChildren.indexOf(childRoot) : -1;
|
|
const setRoot = (updatedRoot) => {
|
|
rawChildren[index] = updatedRoot;
|
|
if (dynamicChildren) {
|
|
if (dynamicIndex > -1) {
|
|
dynamicChildren[dynamicIndex] = updatedRoot;
|
|
}
|
|
else if (updatedRoot.patchFlag > 0) {
|
|
vnode.dynamicChildren = [...dynamicChildren, updatedRoot];
|
|
}
|
|
}
|
|
};
|
|
return [normalizeVNode(childRoot), setRoot];
|
|
};
|
|
function filterSingleRoot(children) {
|
|
let singleRoot;
|
|
for (let i = 0; i < children.length; i++) {
|
|
const child = children[i];
|
|
if (isVNode(child)) {
|
|
// ignore user comment
|
|
if (child.type !== Comment$1 || child.children === 'v-if') {
|
|
if (singleRoot) {
|
|
// has more than 1 non-comment child, return now
|
|
return;
|
|
}
|
|
else {
|
|
singleRoot = child;
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
return;
|
|
}
|
|
}
|
|
return singleRoot;
|
|
}
|
|
const getFunctionalFallthrough = (attrs) => {
|
|
let res;
|
|
for (const key in attrs) {
|
|
if (key === 'class' || key === 'style' || (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isOn)(key)) {
|
|
(res || (res = {}))[key] = attrs[key];
|
|
}
|
|
}
|
|
return res;
|
|
};
|
|
const filterModelListeners = (attrs, props) => {
|
|
const res = {};
|
|
for (const key in attrs) {
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isModelListener)(key) || !(key.slice(9) in props)) {
|
|
res[key] = attrs[key];
|
|
}
|
|
}
|
|
return res;
|
|
};
|
|
const isElementRoot = (vnode) => {
|
|
return (vnode.shapeFlag & (6 /* COMPONENT */ | 1 /* ELEMENT */) ||
|
|
vnode.type === Comment$1 // potential v-if branch switch
|
|
);
|
|
};
|
|
function shouldUpdateComponent(prevVNode, nextVNode, optimized) {
|
|
const { props: prevProps, children: prevChildren, component } = prevVNode;
|
|
const { props: nextProps, children: nextChildren, patchFlag } = nextVNode;
|
|
const emits = component.emitsOptions;
|
|
// Parent component's render function was hot-updated. Since this may have
|
|
// caused the child component's slots content to have changed, we need to
|
|
// force the child to update as well.
|
|
if (( true) && (prevChildren || nextChildren) && isHmrUpdating) {
|
|
return true;
|
|
}
|
|
// force child update for runtime directive or transition on component vnode.
|
|
if (nextVNode.dirs || nextVNode.transition) {
|
|
return true;
|
|
}
|
|
if (optimized && patchFlag >= 0) {
|
|
if (patchFlag & 1024 /* DYNAMIC_SLOTS */) {
|
|
// slot content that references values that might have changed,
|
|
// e.g. in a v-for
|
|
return true;
|
|
}
|
|
if (patchFlag & 16 /* FULL_PROPS */) {
|
|
if (!prevProps) {
|
|
return !!nextProps;
|
|
}
|
|
// presence of this flag indicates props are always non-null
|
|
return hasPropsChanged(prevProps, nextProps, emits);
|
|
}
|
|
else if (patchFlag & 8 /* PROPS */) {
|
|
const dynamicProps = nextVNode.dynamicProps;
|
|
for (let i = 0; i < dynamicProps.length; i++) {
|
|
const key = dynamicProps[i];
|
|
if (nextProps[key] !== prevProps[key] &&
|
|
!isEmitListener(emits, key)) {
|
|
return true;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
// this path is only taken by manually written render functions
|
|
// so presence of any children leads to a forced update
|
|
if (prevChildren || nextChildren) {
|
|
if (!nextChildren || !nextChildren.$stable) {
|
|
return true;
|
|
}
|
|
}
|
|
if (prevProps === nextProps) {
|
|
return false;
|
|
}
|
|
if (!prevProps) {
|
|
return !!nextProps;
|
|
}
|
|
if (!nextProps) {
|
|
return true;
|
|
}
|
|
return hasPropsChanged(prevProps, nextProps, emits);
|
|
}
|
|
return false;
|
|
}
|
|
function hasPropsChanged(prevProps, nextProps, emitsOptions) {
|
|
const nextKeys = Object.keys(nextProps);
|
|
if (nextKeys.length !== Object.keys(prevProps).length) {
|
|
return true;
|
|
}
|
|
for (let i = 0; i < nextKeys.length; i++) {
|
|
const key = nextKeys[i];
|
|
if (nextProps[key] !== prevProps[key] &&
|
|
!isEmitListener(emitsOptions, key)) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
function updateHOCHostEl({ vnode, parent }, el // HostNode
|
|
) {
|
|
while (parent && parent.subTree === vnode) {
|
|
(vnode = parent.vnode).el = el;
|
|
parent = parent.parent;
|
|
}
|
|
}
|
|
|
|
const isSuspense = (type) => type.__isSuspense;
|
|
// Suspense exposes a component-like API, and is treated like a component
|
|
// in the compiler, but internally it's a special built-in type that hooks
|
|
// directly into the renderer.
|
|
const SuspenseImpl = {
|
|
name: 'Suspense',
|
|
// In order to make Suspense tree-shakable, we need to avoid importing it
|
|
// directly in the renderer. The renderer checks for the __isSuspense flag
|
|
// on a vnode's type and calls the `process` method, passing in renderer
|
|
// internals.
|
|
__isSuspense: true,
|
|
process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized,
|
|
// platform-specific impl passed from renderer
|
|
rendererInternals) {
|
|
if (n1 == null) {
|
|
mountSuspense(n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, rendererInternals);
|
|
}
|
|
else {
|
|
patchSuspense(n1, n2, container, anchor, parentComponent, isSVG, slotScopeIds, optimized, rendererInternals);
|
|
}
|
|
},
|
|
hydrate: hydrateSuspense,
|
|
create: createSuspenseBoundary,
|
|
normalize: normalizeSuspenseChildren
|
|
};
|
|
// Force-casted public typing for h and TSX props inference
|
|
const Suspense = (SuspenseImpl );
|
|
function triggerEvent(vnode, name) {
|
|
const eventListener = vnode.props && vnode.props[name];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(eventListener)) {
|
|
eventListener();
|
|
}
|
|
}
|
|
function mountSuspense(vnode, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, rendererInternals) {
|
|
const { p: patch, o: { createElement } } = rendererInternals;
|
|
const hiddenContainer = createElement('div');
|
|
const suspense = (vnode.suspense = createSuspenseBoundary(vnode, parentSuspense, parentComponent, container, hiddenContainer, anchor, isSVG, slotScopeIds, optimized, rendererInternals));
|
|
// start mounting the content subtree in an off-dom container
|
|
patch(null, (suspense.pendingBranch = vnode.ssContent), hiddenContainer, null, parentComponent, suspense, isSVG, slotScopeIds);
|
|
// now check if we have encountered any async deps
|
|
if (suspense.deps > 0) {
|
|
// has async
|
|
// invoke @fallback event
|
|
triggerEvent(vnode, 'onPending');
|
|
triggerEvent(vnode, 'onFallback');
|
|
// mount the fallback tree
|
|
patch(null, vnode.ssFallback, container, anchor, parentComponent, null, // fallback tree will not have suspense context
|
|
isSVG, slotScopeIds);
|
|
setActiveBranch(suspense, vnode.ssFallback);
|
|
}
|
|
else {
|
|
// Suspense has no async deps. Just resolve.
|
|
suspense.resolve();
|
|
}
|
|
}
|
|
function patchSuspense(n1, n2, container, anchor, parentComponent, isSVG, slotScopeIds, optimized, { p: patch, um: unmount, o: { createElement } }) {
|
|
const suspense = (n2.suspense = n1.suspense);
|
|
suspense.vnode = n2;
|
|
n2.el = n1.el;
|
|
const newBranch = n2.ssContent;
|
|
const newFallback = n2.ssFallback;
|
|
const { activeBranch, pendingBranch, isInFallback, isHydrating } = suspense;
|
|
if (pendingBranch) {
|
|
suspense.pendingBranch = newBranch;
|
|
if (isSameVNodeType(newBranch, pendingBranch)) {
|
|
// same root type but content may have changed.
|
|
patch(pendingBranch, newBranch, suspense.hiddenContainer, null, parentComponent, suspense, isSVG, slotScopeIds, optimized);
|
|
if (suspense.deps <= 0) {
|
|
suspense.resolve();
|
|
}
|
|
else if (isInFallback) {
|
|
patch(activeBranch, newFallback, container, anchor, parentComponent, null, // fallback tree will not have suspense context
|
|
isSVG, slotScopeIds, optimized);
|
|
setActiveBranch(suspense, newFallback);
|
|
}
|
|
}
|
|
else {
|
|
// toggled before pending tree is resolved
|
|
suspense.pendingId++;
|
|
if (isHydrating) {
|
|
// if toggled before hydration is finished, the current DOM tree is
|
|
// no longer valid. set it as the active branch so it will be unmounted
|
|
// when resolved
|
|
suspense.isHydrating = false;
|
|
suspense.activeBranch = pendingBranch;
|
|
}
|
|
else {
|
|
unmount(pendingBranch, parentComponent, suspense);
|
|
}
|
|
// increment pending ID. this is used to invalidate async callbacks
|
|
// reset suspense state
|
|
suspense.deps = 0;
|
|
// discard effects from pending branch
|
|
suspense.effects.length = 0;
|
|
// discard previous container
|
|
suspense.hiddenContainer = createElement('div');
|
|
if (isInFallback) {
|
|
// already in fallback state
|
|
patch(null, newBranch, suspense.hiddenContainer, null, parentComponent, suspense, isSVG, slotScopeIds, optimized);
|
|
if (suspense.deps <= 0) {
|
|
suspense.resolve();
|
|
}
|
|
else {
|
|
patch(activeBranch, newFallback, container, anchor, parentComponent, null, // fallback tree will not have suspense context
|
|
isSVG, slotScopeIds, optimized);
|
|
setActiveBranch(suspense, newFallback);
|
|
}
|
|
}
|
|
else if (activeBranch && isSameVNodeType(newBranch, activeBranch)) {
|
|
// toggled "back" to current active branch
|
|
patch(activeBranch, newBranch, container, anchor, parentComponent, suspense, isSVG, slotScopeIds, optimized);
|
|
// force resolve
|
|
suspense.resolve(true);
|
|
}
|
|
else {
|
|
// switched to a 3rd branch
|
|
patch(null, newBranch, suspense.hiddenContainer, null, parentComponent, suspense, isSVG, slotScopeIds, optimized);
|
|
if (suspense.deps <= 0) {
|
|
suspense.resolve();
|
|
}
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
if (activeBranch && isSameVNodeType(newBranch, activeBranch)) {
|
|
// root did not change, just normal patch
|
|
patch(activeBranch, newBranch, container, anchor, parentComponent, suspense, isSVG, slotScopeIds, optimized);
|
|
setActiveBranch(suspense, newBranch);
|
|
}
|
|
else {
|
|
// root node toggled
|
|
// invoke @pending event
|
|
triggerEvent(n2, 'onPending');
|
|
// mount pending branch in off-dom container
|
|
suspense.pendingBranch = newBranch;
|
|
suspense.pendingId++;
|
|
patch(null, newBranch, suspense.hiddenContainer, null, parentComponent, suspense, isSVG, slotScopeIds, optimized);
|
|
if (suspense.deps <= 0) {
|
|
// incoming branch has no async deps, resolve now.
|
|
suspense.resolve();
|
|
}
|
|
else {
|
|
const { timeout, pendingId } = suspense;
|
|
if (timeout > 0) {
|
|
setTimeout(() => {
|
|
if (suspense.pendingId === pendingId) {
|
|
suspense.fallback(newFallback);
|
|
}
|
|
}, timeout);
|
|
}
|
|
else if (timeout === 0) {
|
|
suspense.fallback(newFallback);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
let hasWarned = false;
|
|
function createSuspenseBoundary(vnode, parent, parentComponent, container, hiddenContainer, anchor, isSVG, slotScopeIds, optimized, rendererInternals, isHydrating = false) {
|
|
/* istanbul ignore if */
|
|
if ( true && !hasWarned) {
|
|
hasWarned = true;
|
|
// @ts-ignore `console.info` cannot be null error
|
|
console[console.info ? 'info' : 'log'](`<Suspense> is an experimental feature and its API will likely change.`);
|
|
}
|
|
const { p: patch, m: move, um: unmount, n: next, o: { parentNode, remove } } = rendererInternals;
|
|
const timeout = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toNumber)(vnode.props && vnode.props.timeout);
|
|
const suspense = {
|
|
vnode,
|
|
parent,
|
|
parentComponent,
|
|
isSVG,
|
|
container,
|
|
hiddenContainer,
|
|
anchor,
|
|
deps: 0,
|
|
pendingId: 0,
|
|
timeout: typeof timeout === 'number' ? timeout : -1,
|
|
activeBranch: null,
|
|
pendingBranch: null,
|
|
isInFallback: true,
|
|
isHydrating,
|
|
isUnmounted: false,
|
|
effects: [],
|
|
resolve(resume = false) {
|
|
if ((true)) {
|
|
if (!resume && !suspense.pendingBranch) {
|
|
throw new Error(`suspense.resolve() is called without a pending branch.`);
|
|
}
|
|
if (suspense.isUnmounted) {
|
|
throw new Error(`suspense.resolve() is called on an already unmounted suspense boundary.`);
|
|
}
|
|
}
|
|
const { vnode, activeBranch, pendingBranch, pendingId, effects, parentComponent, container } = suspense;
|
|
if (suspense.isHydrating) {
|
|
suspense.isHydrating = false;
|
|
}
|
|
else if (!resume) {
|
|
const delayEnter = activeBranch &&
|
|
pendingBranch.transition &&
|
|
pendingBranch.transition.mode === 'out-in';
|
|
if (delayEnter) {
|
|
activeBranch.transition.afterLeave = () => {
|
|
if (pendingId === suspense.pendingId) {
|
|
move(pendingBranch, container, anchor, 0 /* ENTER */);
|
|
}
|
|
};
|
|
}
|
|
// this is initial anchor on mount
|
|
let { anchor } = suspense;
|
|
// unmount current active tree
|
|
if (activeBranch) {
|
|
// if the fallback tree was mounted, it may have been moved
|
|
// as part of a parent suspense. get the latest anchor for insertion
|
|
anchor = next(activeBranch);
|
|
unmount(activeBranch, parentComponent, suspense, true);
|
|
}
|
|
if (!delayEnter) {
|
|
// move content from off-dom container to actual container
|
|
move(pendingBranch, container, anchor, 0 /* ENTER */);
|
|
}
|
|
}
|
|
setActiveBranch(suspense, pendingBranch);
|
|
suspense.pendingBranch = null;
|
|
suspense.isInFallback = false;
|
|
// flush buffered effects
|
|
// check if there is a pending parent suspense
|
|
let parent = suspense.parent;
|
|
let hasUnresolvedAncestor = false;
|
|
while (parent) {
|
|
if (parent.pendingBranch) {
|
|
// found a pending parent suspense, merge buffered post jobs
|
|
// into that parent
|
|
parent.effects.push(...effects);
|
|
hasUnresolvedAncestor = true;
|
|
break;
|
|
}
|
|
parent = parent.parent;
|
|
}
|
|
// no pending parent suspense, flush all jobs
|
|
if (!hasUnresolvedAncestor) {
|
|
queuePostFlushCb(effects);
|
|
}
|
|
suspense.effects = [];
|
|
// invoke @resolve event
|
|
triggerEvent(vnode, 'onResolve');
|
|
},
|
|
fallback(fallbackVNode) {
|
|
if (!suspense.pendingBranch) {
|
|
return;
|
|
}
|
|
const { vnode, activeBranch, parentComponent, container, isSVG } = suspense;
|
|
// invoke @fallback event
|
|
triggerEvent(vnode, 'onFallback');
|
|
const anchor = next(activeBranch);
|
|
const mountFallback = () => {
|
|
if (!suspense.isInFallback) {
|
|
return;
|
|
}
|
|
// mount the fallback tree
|
|
patch(null, fallbackVNode, container, anchor, parentComponent, null, // fallback tree will not have suspense context
|
|
isSVG, slotScopeIds, optimized);
|
|
setActiveBranch(suspense, fallbackVNode);
|
|
};
|
|
const delayEnter = fallbackVNode.transition && fallbackVNode.transition.mode === 'out-in';
|
|
if (delayEnter) {
|
|
activeBranch.transition.afterLeave = mountFallback;
|
|
}
|
|
suspense.isInFallback = true;
|
|
// unmount current active branch
|
|
unmount(activeBranch, parentComponent, null, // no suspense so unmount hooks fire now
|
|
true // shouldRemove
|
|
);
|
|
if (!delayEnter) {
|
|
mountFallback();
|
|
}
|
|
},
|
|
move(container, anchor, type) {
|
|
suspense.activeBranch &&
|
|
move(suspense.activeBranch, container, anchor, type);
|
|
suspense.container = container;
|
|
},
|
|
next() {
|
|
return suspense.activeBranch && next(suspense.activeBranch);
|
|
},
|
|
registerDep(instance, setupRenderEffect) {
|
|
const isInPendingSuspense = !!suspense.pendingBranch;
|
|
if (isInPendingSuspense) {
|
|
suspense.deps++;
|
|
}
|
|
const hydratedEl = instance.vnode.el;
|
|
instance
|
|
.asyncDep.catch(err => {
|
|
handleError(err, instance, 0 /* SETUP_FUNCTION */);
|
|
})
|
|
.then(asyncSetupResult => {
|
|
// retry when the setup() promise resolves.
|
|
// component may have been unmounted before resolve.
|
|
if (instance.isUnmounted ||
|
|
suspense.isUnmounted ||
|
|
suspense.pendingId !== instance.suspenseId) {
|
|
return;
|
|
}
|
|
// retry from this component
|
|
instance.asyncResolved = true;
|
|
const { vnode } = instance;
|
|
if ((true)) {
|
|
pushWarningContext(vnode);
|
|
}
|
|
handleSetupResult(instance, asyncSetupResult, false);
|
|
if (hydratedEl) {
|
|
// vnode may have been replaced if an update happened before the
|
|
// async dep is resolved.
|
|
vnode.el = hydratedEl;
|
|
}
|
|
const placeholder = !hydratedEl && instance.subTree.el;
|
|
setupRenderEffect(instance, vnode,
|
|
// component may have been moved before resolve.
|
|
// if this is not a hydration, instance.subTree will be the comment
|
|
// placeholder.
|
|
parentNode(hydratedEl || instance.subTree.el),
|
|
// anchor will not be used if this is hydration, so only need to
|
|
// consider the comment placeholder case.
|
|
hydratedEl ? null : next(instance.subTree), suspense, isSVG, optimized);
|
|
if (placeholder) {
|
|
remove(placeholder);
|
|
}
|
|
updateHOCHostEl(instance, vnode.el);
|
|
if ((true)) {
|
|
popWarningContext();
|
|
}
|
|
// only decrease deps count if suspense is not already resolved
|
|
if (isInPendingSuspense && --suspense.deps === 0) {
|
|
suspense.resolve();
|
|
}
|
|
});
|
|
},
|
|
unmount(parentSuspense, doRemove) {
|
|
suspense.isUnmounted = true;
|
|
if (suspense.activeBranch) {
|
|
unmount(suspense.activeBranch, parentComponent, parentSuspense, doRemove);
|
|
}
|
|
if (suspense.pendingBranch) {
|
|
unmount(suspense.pendingBranch, parentComponent, parentSuspense, doRemove);
|
|
}
|
|
}
|
|
};
|
|
return suspense;
|
|
}
|
|
function hydrateSuspense(node, vnode, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, rendererInternals, hydrateNode) {
|
|
/* eslint-disable no-restricted-globals */
|
|
const suspense = (vnode.suspense = createSuspenseBoundary(vnode, parentSuspense, parentComponent, node.parentNode, document.createElement('div'), null, isSVG, slotScopeIds, optimized, rendererInternals, true /* hydrating */));
|
|
// there are two possible scenarios for server-rendered suspense:
|
|
// - success: ssr content should be fully resolved
|
|
// - failure: ssr content should be the fallback branch.
|
|
// however, on the client we don't really know if it has failed or not
|
|
// attempt to hydrate the DOM assuming it has succeeded, but we still
|
|
// need to construct a suspense boundary first
|
|
const result = hydrateNode(node, (suspense.pendingBranch = vnode.ssContent), parentComponent, suspense, slotScopeIds, optimized);
|
|
if (suspense.deps === 0) {
|
|
suspense.resolve();
|
|
}
|
|
return result;
|
|
/* eslint-enable no-restricted-globals */
|
|
}
|
|
function normalizeSuspenseChildren(vnode) {
|
|
const { shapeFlag, children } = vnode;
|
|
const isSlotChildren = shapeFlag & 32 /* SLOTS_CHILDREN */;
|
|
vnode.ssContent = normalizeSuspenseSlot(isSlotChildren ? children.default : children);
|
|
vnode.ssFallback = isSlotChildren
|
|
? normalizeSuspenseSlot(children.fallback)
|
|
: createVNode(Comment);
|
|
}
|
|
function normalizeSuspenseSlot(s) {
|
|
let block;
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(s)) {
|
|
const isCompiledSlot = s._c;
|
|
if (isCompiledSlot) {
|
|
// disableTracking: false
|
|
// allow block tracking for compiled slots
|
|
// (see ./componentRenderContext.ts)
|
|
s._d = false;
|
|
openBlock();
|
|
}
|
|
s = s();
|
|
if (isCompiledSlot) {
|
|
s._d = true;
|
|
block = currentBlock;
|
|
closeBlock();
|
|
}
|
|
}
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(s)) {
|
|
const singleChild = filterSingleRoot(s);
|
|
if (( true) && !singleChild) {
|
|
warn(`<Suspense> slots expect a single root node.`);
|
|
}
|
|
s = singleChild;
|
|
}
|
|
s = normalizeVNode(s);
|
|
if (block && !s.dynamicChildren) {
|
|
s.dynamicChildren = block.filter(c => c !== s);
|
|
}
|
|
return s;
|
|
}
|
|
function queueEffectWithSuspense(fn, suspense) {
|
|
if (suspense && suspense.pendingBranch) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(fn)) {
|
|
suspense.effects.push(...fn);
|
|
}
|
|
else {
|
|
suspense.effects.push(fn);
|
|
}
|
|
}
|
|
else {
|
|
queuePostFlushCb(fn);
|
|
}
|
|
}
|
|
function setActiveBranch(suspense, branch) {
|
|
suspense.activeBranch = branch;
|
|
const { vnode, parentComponent } = suspense;
|
|
const el = (vnode.el = branch.el);
|
|
// in case suspense is the root node of a component,
|
|
// recursively update the HOC el
|
|
if (parentComponent && parentComponent.subTree === vnode) {
|
|
parentComponent.vnode.el = el;
|
|
updateHOCHostEl(parentComponent, el);
|
|
}
|
|
}
|
|
|
|
function provide(key, value) {
|
|
if (!currentInstance) {
|
|
if ((true)) {
|
|
warn(`provide() can only be used inside setup().`);
|
|
}
|
|
}
|
|
else {
|
|
let provides = currentInstance.provides;
|
|
// by default an instance inherits its parent's provides object
|
|
// but when it needs to provide values of its own, it creates its
|
|
// own provides object using parent provides object as prototype.
|
|
// this way in `inject` we can simply look up injections from direct
|
|
// parent and let the prototype chain do the work.
|
|
const parentProvides = currentInstance.parent && currentInstance.parent.provides;
|
|
if (parentProvides === provides) {
|
|
provides = currentInstance.provides = Object.create(parentProvides);
|
|
}
|
|
// TS doesn't allow symbol as index type
|
|
provides[key] = value;
|
|
}
|
|
}
|
|
function inject(key, defaultValue, treatDefaultAsFactory = false) {
|
|
// fallback to `currentRenderingInstance` so that this can be called in
|
|
// a functional component
|
|
const instance = currentInstance || currentRenderingInstance;
|
|
if (instance) {
|
|
// #2400
|
|
// to support `app.use` plugins,
|
|
// fallback to appContext's `provides` if the intance is at root
|
|
const provides = instance.parent == null
|
|
? instance.vnode.appContext && instance.vnode.appContext.provides
|
|
: instance.parent.provides;
|
|
if (provides && key in provides) {
|
|
// TS doesn't allow symbol as index type
|
|
return provides[key];
|
|
}
|
|
else if (arguments.length > 1) {
|
|
return treatDefaultAsFactory && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(defaultValue)
|
|
? defaultValue.call(instance.proxy)
|
|
: defaultValue;
|
|
}
|
|
else if ((true)) {
|
|
warn(`injection "${String(key)}" not found.`);
|
|
}
|
|
}
|
|
else if ((true)) {
|
|
warn(`inject() can only be used inside setup() or functional components.`);
|
|
}
|
|
}
|
|
|
|
function useTransitionState() {
|
|
const state = {
|
|
isMounted: false,
|
|
isLeaving: false,
|
|
isUnmounting: false,
|
|
leavingVNodes: new Map()
|
|
};
|
|
onMounted(() => {
|
|
state.isMounted = true;
|
|
});
|
|
onBeforeUnmount(() => {
|
|
state.isUnmounting = true;
|
|
});
|
|
return state;
|
|
}
|
|
const TransitionHookValidator = [Function, Array];
|
|
const BaseTransitionImpl = {
|
|
name: `BaseTransition`,
|
|
props: {
|
|
mode: String,
|
|
appear: Boolean,
|
|
persisted: Boolean,
|
|
// enter
|
|
onBeforeEnter: TransitionHookValidator,
|
|
onEnter: TransitionHookValidator,
|
|
onAfterEnter: TransitionHookValidator,
|
|
onEnterCancelled: TransitionHookValidator,
|
|
// leave
|
|
onBeforeLeave: TransitionHookValidator,
|
|
onLeave: TransitionHookValidator,
|
|
onAfterLeave: TransitionHookValidator,
|
|
onLeaveCancelled: TransitionHookValidator,
|
|
// appear
|
|
onBeforeAppear: TransitionHookValidator,
|
|
onAppear: TransitionHookValidator,
|
|
onAfterAppear: TransitionHookValidator,
|
|
onAppearCancelled: TransitionHookValidator
|
|
},
|
|
setup(props, { slots }) {
|
|
const instance = getCurrentInstance();
|
|
const state = useTransitionState();
|
|
let prevTransitionKey;
|
|
return () => {
|
|
const children = slots.default && getTransitionRawChildren(slots.default(), true);
|
|
if (!children || !children.length) {
|
|
return;
|
|
}
|
|
// warn multiple elements
|
|
if (( true) && children.length > 1) {
|
|
warn('<transition> can only be used on a single element or component. Use ' +
|
|
'<transition-group> for lists.');
|
|
}
|
|
// there's no need to track reactivity for these props so use the raw
|
|
// props for a bit better perf
|
|
const rawProps = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw)(props);
|
|
const { mode } = rawProps;
|
|
// check mode
|
|
if (( true) && mode && !['in-out', 'out-in', 'default'].includes(mode)) {
|
|
warn(`invalid <transition> mode: ${mode}`);
|
|
}
|
|
// at this point children has a guaranteed length of 1.
|
|
const child = children[0];
|
|
if (state.isLeaving) {
|
|
return emptyPlaceholder(child);
|
|
}
|
|
// in the case of <transition><keep-alive/></transition>, we need to
|
|
// compare the type of the kept-alive children.
|
|
const innerChild = getKeepAliveChild(child);
|
|
if (!innerChild) {
|
|
return emptyPlaceholder(child);
|
|
}
|
|
const enterHooks = resolveTransitionHooks(innerChild, rawProps, state, instance);
|
|
setTransitionHooks(innerChild, enterHooks);
|
|
const oldChild = instance.subTree;
|
|
const oldInnerChild = oldChild && getKeepAliveChild(oldChild);
|
|
let transitionKeyChanged = false;
|
|
const { getTransitionKey } = innerChild.type;
|
|
if (getTransitionKey) {
|
|
const key = getTransitionKey();
|
|
if (prevTransitionKey === undefined) {
|
|
prevTransitionKey = key;
|
|
}
|
|
else if (key !== prevTransitionKey) {
|
|
prevTransitionKey = key;
|
|
transitionKeyChanged = true;
|
|
}
|
|
}
|
|
// handle mode
|
|
if (oldInnerChild &&
|
|
oldInnerChild.type !== Comment$1 &&
|
|
(!isSameVNodeType(innerChild, oldInnerChild) || transitionKeyChanged)) {
|
|
const leavingHooks = resolveTransitionHooks(oldInnerChild, rawProps, state, instance);
|
|
// update old tree's hooks in case of dynamic transition
|
|
setTransitionHooks(oldInnerChild, leavingHooks);
|
|
// switching between different views
|
|
if (mode === 'out-in') {
|
|
state.isLeaving = true;
|
|
// return placeholder node and queue update when leave finishes
|
|
leavingHooks.afterLeave = () => {
|
|
state.isLeaving = false;
|
|
instance.update();
|
|
};
|
|
return emptyPlaceholder(child);
|
|
}
|
|
else if (mode === 'in-out' && innerChild.type !== Comment$1) {
|
|
leavingHooks.delayLeave = (el, earlyRemove, delayedLeave) => {
|
|
const leavingVNodesCache = getLeavingNodesForType(state, oldInnerChild);
|
|
leavingVNodesCache[String(oldInnerChild.key)] = oldInnerChild;
|
|
// early removal callback
|
|
el._leaveCb = () => {
|
|
earlyRemove();
|
|
el._leaveCb = undefined;
|
|
delete enterHooks.delayedLeave;
|
|
};
|
|
enterHooks.delayedLeave = delayedLeave;
|
|
};
|
|
}
|
|
}
|
|
return child;
|
|
};
|
|
}
|
|
};
|
|
// export the public type for h/tsx inference
|
|
// also to avoid inline import() in generated d.ts files
|
|
const BaseTransition = BaseTransitionImpl;
|
|
function getLeavingNodesForType(state, vnode) {
|
|
const { leavingVNodes } = state;
|
|
let leavingVNodesCache = leavingVNodes.get(vnode.type);
|
|
if (!leavingVNodesCache) {
|
|
leavingVNodesCache = Object.create(null);
|
|
leavingVNodes.set(vnode.type, leavingVNodesCache);
|
|
}
|
|
return leavingVNodesCache;
|
|
}
|
|
// The transition hooks are attached to the vnode as vnode.transition
|
|
// and will be called at appropriate timing in the renderer.
|
|
function resolveTransitionHooks(vnode, props, state, instance) {
|
|
const { appear, mode, persisted = false, onBeforeEnter, onEnter, onAfterEnter, onEnterCancelled, onBeforeLeave, onLeave, onAfterLeave, onLeaveCancelled, onBeforeAppear, onAppear, onAfterAppear, onAppearCancelled } = props;
|
|
const key = String(vnode.key);
|
|
const leavingVNodesCache = getLeavingNodesForType(state, vnode);
|
|
const callHook = (hook, args) => {
|
|
hook &&
|
|
callWithAsyncErrorHandling(hook, instance, 9 /* TRANSITION_HOOK */, args);
|
|
};
|
|
const hooks = {
|
|
mode,
|
|
persisted,
|
|
beforeEnter(el) {
|
|
let hook = onBeforeEnter;
|
|
if (!state.isMounted) {
|
|
if (appear) {
|
|
hook = onBeforeAppear || onBeforeEnter;
|
|
}
|
|
else {
|
|
return;
|
|
}
|
|
}
|
|
// for same element (v-show)
|
|
if (el._leaveCb) {
|
|
el._leaveCb(true /* cancelled */);
|
|
}
|
|
// for toggled element with same key (v-if)
|
|
const leavingVNode = leavingVNodesCache[key];
|
|
if (leavingVNode &&
|
|
isSameVNodeType(vnode, leavingVNode) &&
|
|
leavingVNode.el._leaveCb) {
|
|
// force early removal (not cancelled)
|
|
leavingVNode.el._leaveCb();
|
|
}
|
|
callHook(hook, [el]);
|
|
},
|
|
enter(el) {
|
|
let hook = onEnter;
|
|
let afterHook = onAfterEnter;
|
|
let cancelHook = onEnterCancelled;
|
|
if (!state.isMounted) {
|
|
if (appear) {
|
|
hook = onAppear || onEnter;
|
|
afterHook = onAfterAppear || onAfterEnter;
|
|
cancelHook = onAppearCancelled || onEnterCancelled;
|
|
}
|
|
else {
|
|
return;
|
|
}
|
|
}
|
|
let called = false;
|
|
const done = (el._enterCb = (cancelled) => {
|
|
if (called)
|
|
return;
|
|
called = true;
|
|
if (cancelled) {
|
|
callHook(cancelHook, [el]);
|
|
}
|
|
else {
|
|
callHook(afterHook, [el]);
|
|
}
|
|
if (hooks.delayedLeave) {
|
|
hooks.delayedLeave();
|
|
}
|
|
el._enterCb = undefined;
|
|
});
|
|
if (hook) {
|
|
hook(el, done);
|
|
if (hook.length <= 1) {
|
|
done();
|
|
}
|
|
}
|
|
else {
|
|
done();
|
|
}
|
|
},
|
|
leave(el, remove) {
|
|
const key = String(vnode.key);
|
|
if (el._enterCb) {
|
|
el._enterCb(true /* cancelled */);
|
|
}
|
|
if (state.isUnmounting) {
|
|
return remove();
|
|
}
|
|
callHook(onBeforeLeave, [el]);
|
|
let called = false;
|
|
const done = (el._leaveCb = (cancelled) => {
|
|
if (called)
|
|
return;
|
|
called = true;
|
|
remove();
|
|
if (cancelled) {
|
|
callHook(onLeaveCancelled, [el]);
|
|
}
|
|
else {
|
|
callHook(onAfterLeave, [el]);
|
|
}
|
|
el._leaveCb = undefined;
|
|
if (leavingVNodesCache[key] === vnode) {
|
|
delete leavingVNodesCache[key];
|
|
}
|
|
});
|
|
leavingVNodesCache[key] = vnode;
|
|
if (onLeave) {
|
|
onLeave(el, done);
|
|
if (onLeave.length <= 1) {
|
|
done();
|
|
}
|
|
}
|
|
else {
|
|
done();
|
|
}
|
|
},
|
|
clone(vnode) {
|
|
return resolveTransitionHooks(vnode, props, state, instance);
|
|
}
|
|
};
|
|
return hooks;
|
|
}
|
|
// the placeholder really only handles one special case: KeepAlive
|
|
// in the case of a KeepAlive in a leave phase we need to return a KeepAlive
|
|
// placeholder with empty content to avoid the KeepAlive instance from being
|
|
// unmounted.
|
|
function emptyPlaceholder(vnode) {
|
|
if (isKeepAlive(vnode)) {
|
|
vnode = cloneVNode(vnode);
|
|
vnode.children = null;
|
|
return vnode;
|
|
}
|
|
}
|
|
function getKeepAliveChild(vnode) {
|
|
return isKeepAlive(vnode)
|
|
? vnode.children
|
|
? vnode.children[0]
|
|
: undefined
|
|
: vnode;
|
|
}
|
|
function setTransitionHooks(vnode, hooks) {
|
|
if (vnode.shapeFlag & 6 /* COMPONENT */ && vnode.component) {
|
|
setTransitionHooks(vnode.component.subTree, hooks);
|
|
}
|
|
else if (vnode.shapeFlag & 128 /* SUSPENSE */) {
|
|
vnode.ssContent.transition = hooks.clone(vnode.ssContent);
|
|
vnode.ssFallback.transition = hooks.clone(vnode.ssFallback);
|
|
}
|
|
else {
|
|
vnode.transition = hooks;
|
|
}
|
|
}
|
|
function getTransitionRawChildren(children, keepComment = false) {
|
|
let ret = [];
|
|
let keyedFragmentCount = 0;
|
|
for (let i = 0; i < children.length; i++) {
|
|
const child = children[i];
|
|
// handle fragment children case, e.g. v-for
|
|
if (child.type === Fragment) {
|
|
if (child.patchFlag & 128 /* KEYED_FRAGMENT */)
|
|
keyedFragmentCount++;
|
|
ret = ret.concat(getTransitionRawChildren(child.children, keepComment));
|
|
}
|
|
// comment placeholders should be skipped, e.g. v-if
|
|
else if (keepComment || child.type !== Comment$1) {
|
|
ret.push(child);
|
|
}
|
|
}
|
|
// #1126 if a transition children list contains multiple sub fragments, these
|
|
// fragments will be merged into a flat children array. Since each v-for
|
|
// fragment may contain different static bindings inside, we need to de-op
|
|
// these children to force full diffs to ensure correct behavior.
|
|
if (keyedFragmentCount > 1) {
|
|
for (let i = 0; i < ret.length; i++) {
|
|
ret[i].patchFlag = -2 /* BAIL */;
|
|
}
|
|
}
|
|
return ret;
|
|
}
|
|
|
|
// implementation, close to no-op
|
|
function defineComponent(options) {
|
|
return (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(options) ? { setup: options, name: options.name } : options;
|
|
}
|
|
|
|
const isAsyncWrapper = (i) => !!i.type.__asyncLoader;
|
|
function defineAsyncComponent(source) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(source)) {
|
|
source = { loader: source };
|
|
}
|
|
const { loader, loadingComponent, errorComponent, delay = 200, timeout, // undefined = never times out
|
|
suspensible = true, onError: userOnError } = source;
|
|
let pendingRequest = null;
|
|
let resolvedComp;
|
|
let retries = 0;
|
|
const retry = () => {
|
|
retries++;
|
|
pendingRequest = null;
|
|
return load();
|
|
};
|
|
const load = () => {
|
|
let thisRequest;
|
|
return (pendingRequest ||
|
|
(thisRequest = pendingRequest =
|
|
loader()
|
|
.catch(err => {
|
|
err = err instanceof Error ? err : new Error(String(err));
|
|
if (userOnError) {
|
|
return new Promise((resolve, reject) => {
|
|
const userRetry = () => resolve(retry());
|
|
const userFail = () => reject(err);
|
|
userOnError(err, userRetry, userFail, retries + 1);
|
|
});
|
|
}
|
|
else {
|
|
throw err;
|
|
}
|
|
})
|
|
.then((comp) => {
|
|
if (thisRequest !== pendingRequest && pendingRequest) {
|
|
return pendingRequest;
|
|
}
|
|
if (( true) && !comp) {
|
|
warn(`Async component loader resolved to undefined. ` +
|
|
`If you are using retry(), make sure to return its return value.`);
|
|
}
|
|
// interop module default
|
|
if (comp &&
|
|
(comp.__esModule || comp[Symbol.toStringTag] === 'Module')) {
|
|
comp = comp.default;
|
|
}
|
|
if (( true) && comp && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(comp) && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(comp)) {
|
|
throw new Error(`Invalid async component load result: ${comp}`);
|
|
}
|
|
resolvedComp = comp;
|
|
return comp;
|
|
})));
|
|
};
|
|
return defineComponent({
|
|
name: 'AsyncComponentWrapper',
|
|
__asyncLoader: load,
|
|
get __asyncResolved() {
|
|
return resolvedComp;
|
|
},
|
|
setup() {
|
|
const instance = currentInstance;
|
|
// already resolved
|
|
if (resolvedComp) {
|
|
return () => createInnerComp(resolvedComp, instance);
|
|
}
|
|
const onError = (err) => {
|
|
pendingRequest = null;
|
|
handleError(err, instance, 13 /* ASYNC_COMPONENT_LOADER */, !errorComponent /* do not throw in dev if user provided error component */);
|
|
};
|
|
// suspense-controlled or SSR.
|
|
if ((suspensible && instance.suspense) ||
|
|
(false )) {
|
|
return load()
|
|
.then(comp => {
|
|
return () => createInnerComp(comp, instance);
|
|
})
|
|
.catch(err => {
|
|
onError(err);
|
|
return () => errorComponent
|
|
? createVNode(errorComponent, {
|
|
error: err
|
|
})
|
|
: null;
|
|
});
|
|
}
|
|
const loaded = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.ref)(false);
|
|
const error = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.ref)();
|
|
const delayed = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.ref)(!!delay);
|
|
if (delay) {
|
|
setTimeout(() => {
|
|
delayed.value = false;
|
|
}, delay);
|
|
}
|
|
if (timeout != null) {
|
|
setTimeout(() => {
|
|
if (!loaded.value && !error.value) {
|
|
const err = new Error(`Async component timed out after ${timeout}ms.`);
|
|
onError(err);
|
|
error.value = err;
|
|
}
|
|
}, timeout);
|
|
}
|
|
load()
|
|
.then(() => {
|
|
loaded.value = true;
|
|
if (instance.parent && isKeepAlive(instance.parent.vnode)) {
|
|
// parent is keep-alive, force update so the loaded component's
|
|
// name is taken into account
|
|
queueJob(instance.parent.update);
|
|
}
|
|
})
|
|
.catch(err => {
|
|
onError(err);
|
|
error.value = err;
|
|
});
|
|
return () => {
|
|
if (loaded.value && resolvedComp) {
|
|
return createInnerComp(resolvedComp, instance);
|
|
}
|
|
else if (error.value && errorComponent) {
|
|
return createVNode(errorComponent, {
|
|
error: error.value
|
|
});
|
|
}
|
|
else if (loadingComponent && !delayed.value) {
|
|
return createVNode(loadingComponent);
|
|
}
|
|
};
|
|
}
|
|
});
|
|
}
|
|
function createInnerComp(comp, { vnode: { ref, props, children } }) {
|
|
const vnode = createVNode(comp, props, children);
|
|
// ensure inner component inherits the async wrapper's ref owner
|
|
vnode.ref = ref;
|
|
return vnode;
|
|
}
|
|
|
|
const isKeepAlive = (vnode) => vnode.type.__isKeepAlive;
|
|
const KeepAliveImpl = {
|
|
name: `KeepAlive`,
|
|
// Marker for special handling inside the renderer. We are not using a ===
|
|
// check directly on KeepAlive in the renderer, because importing it directly
|
|
// would prevent it from being tree-shaken.
|
|
__isKeepAlive: true,
|
|
props: {
|
|
include: [String, RegExp, Array],
|
|
exclude: [String, RegExp, Array],
|
|
max: [String, Number]
|
|
},
|
|
setup(props, { slots }) {
|
|
const instance = getCurrentInstance();
|
|
// KeepAlive communicates with the instantiated renderer via the
|
|
// ctx where the renderer passes in its internals,
|
|
// and the KeepAlive instance exposes activate/deactivate implementations.
|
|
// The whole point of this is to avoid importing KeepAlive directly in the
|
|
// renderer to facilitate tree-shaking.
|
|
const sharedContext = instance.ctx;
|
|
// if the internal renderer is not registered, it indicates that this is server-side rendering,
|
|
// for KeepAlive, we just need to render its children
|
|
if (!sharedContext.renderer) {
|
|
return slots.default;
|
|
}
|
|
const cache = new Map();
|
|
const keys = new Set();
|
|
let current = null;
|
|
if (true) {
|
|
instance.__v_cache = cache;
|
|
}
|
|
const parentSuspense = instance.suspense;
|
|
const { renderer: { p: patch, m: move, um: _unmount, o: { createElement } } } = sharedContext;
|
|
const storageContainer = createElement('div');
|
|
sharedContext.activate = (vnode, container, anchor, isSVG, optimized) => {
|
|
const instance = vnode.component;
|
|
move(vnode, container, anchor, 0 /* ENTER */, parentSuspense);
|
|
// in case props have changed
|
|
patch(instance.vnode, vnode, container, anchor, instance, parentSuspense, isSVG, vnode.slotScopeIds, optimized);
|
|
queuePostRenderEffect(() => {
|
|
instance.isDeactivated = false;
|
|
if (instance.a) {
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.invokeArrayFns)(instance.a);
|
|
}
|
|
const vnodeHook = vnode.props && vnode.props.onVnodeMounted;
|
|
if (vnodeHook) {
|
|
invokeVNodeHook(vnodeHook, instance.parent, vnode);
|
|
}
|
|
}, parentSuspense);
|
|
if (true) {
|
|
// Update components tree
|
|
devtoolsComponentAdded(instance);
|
|
}
|
|
};
|
|
sharedContext.deactivate = (vnode) => {
|
|
const instance = vnode.component;
|
|
move(vnode, storageContainer, null, 1 /* LEAVE */, parentSuspense);
|
|
queuePostRenderEffect(() => {
|
|
if (instance.da) {
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.invokeArrayFns)(instance.da);
|
|
}
|
|
const vnodeHook = vnode.props && vnode.props.onVnodeUnmounted;
|
|
if (vnodeHook) {
|
|
invokeVNodeHook(vnodeHook, instance.parent, vnode);
|
|
}
|
|
instance.isDeactivated = true;
|
|
}, parentSuspense);
|
|
if (true) {
|
|
// Update components tree
|
|
devtoolsComponentAdded(instance);
|
|
}
|
|
};
|
|
function unmount(vnode) {
|
|
// reset the shapeFlag so it can be properly unmounted
|
|
resetShapeFlag(vnode);
|
|
_unmount(vnode, instance, parentSuspense);
|
|
}
|
|
function pruneCache(filter) {
|
|
cache.forEach((vnode, key) => {
|
|
const name = getComponentName(vnode.type);
|
|
if (name && (!filter || !filter(name))) {
|
|
pruneCacheEntry(key);
|
|
}
|
|
});
|
|
}
|
|
function pruneCacheEntry(key) {
|
|
const cached = cache.get(key);
|
|
if (!current || cached.type !== current.type) {
|
|
unmount(cached);
|
|
}
|
|
else if (current) {
|
|
// current active instance should no longer be kept-alive.
|
|
// we can't unmount it now but it might be later, so reset its flag now.
|
|
resetShapeFlag(current);
|
|
}
|
|
cache.delete(key);
|
|
keys.delete(key);
|
|
}
|
|
// prune cache on include/exclude prop change
|
|
watch(() => [props.include, props.exclude], ([include, exclude]) => {
|
|
include && pruneCache(name => matches(include, name));
|
|
exclude && pruneCache(name => !matches(exclude, name));
|
|
},
|
|
// prune post-render after `current` has been updated
|
|
{ flush: 'post', deep: true });
|
|
// cache sub tree after render
|
|
let pendingCacheKey = null;
|
|
const cacheSubtree = () => {
|
|
// fix #1621, the pendingCacheKey could be 0
|
|
if (pendingCacheKey != null) {
|
|
cache.set(pendingCacheKey, getInnerChild(instance.subTree));
|
|
}
|
|
};
|
|
onMounted(cacheSubtree);
|
|
onUpdated(cacheSubtree);
|
|
onBeforeUnmount(() => {
|
|
cache.forEach(cached => {
|
|
const { subTree, suspense } = instance;
|
|
const vnode = getInnerChild(subTree);
|
|
if (cached.type === vnode.type) {
|
|
// current instance will be unmounted as part of keep-alive's unmount
|
|
resetShapeFlag(vnode);
|
|
// but invoke its deactivated hook here
|
|
const da = vnode.component.da;
|
|
da && queuePostRenderEffect(da, suspense);
|
|
return;
|
|
}
|
|
unmount(cached);
|
|
});
|
|
});
|
|
return () => {
|
|
pendingCacheKey = null;
|
|
if (!slots.default) {
|
|
return null;
|
|
}
|
|
const children = slots.default();
|
|
const rawVNode = children[0];
|
|
if (children.length > 1) {
|
|
if ((true)) {
|
|
warn(`KeepAlive should contain exactly one component child.`);
|
|
}
|
|
current = null;
|
|
return children;
|
|
}
|
|
else if (!isVNode(rawVNode) ||
|
|
(!(rawVNode.shapeFlag & 4 /* STATEFUL_COMPONENT */) &&
|
|
!(rawVNode.shapeFlag & 128 /* SUSPENSE */))) {
|
|
current = null;
|
|
return rawVNode;
|
|
}
|
|
let vnode = getInnerChild(rawVNode);
|
|
const comp = vnode.type;
|
|
// for async components, name check should be based in its loaded
|
|
// inner component if available
|
|
const name = getComponentName(isAsyncWrapper(vnode)
|
|
? vnode.type.__asyncResolved || {}
|
|
: comp);
|
|
const { include, exclude, max } = props;
|
|
if ((include && (!name || !matches(include, name))) ||
|
|
(exclude && name && matches(exclude, name))) {
|
|
current = vnode;
|
|
return rawVNode;
|
|
}
|
|
const key = vnode.key == null ? comp : vnode.key;
|
|
const cachedVNode = cache.get(key);
|
|
// clone vnode if it's reused because we are going to mutate it
|
|
if (vnode.el) {
|
|
vnode = cloneVNode(vnode);
|
|
if (rawVNode.shapeFlag & 128 /* SUSPENSE */) {
|
|
rawVNode.ssContent = vnode;
|
|
}
|
|
}
|
|
// #1513 it's possible for the returned vnode to be cloned due to attr
|
|
// fallthrough or scopeId, so the vnode here may not be the final vnode
|
|
// that is mounted. Instead of caching it directly, we store the pending
|
|
// key and cache `instance.subTree` (the normalized vnode) in
|
|
// beforeMount/beforeUpdate hooks.
|
|
pendingCacheKey = key;
|
|
if (cachedVNode) {
|
|
// copy over mounted state
|
|
vnode.el = cachedVNode.el;
|
|
vnode.component = cachedVNode.component;
|
|
if (vnode.transition) {
|
|
// recursively update transition hooks on subTree
|
|
setTransitionHooks(vnode, vnode.transition);
|
|
}
|
|
// avoid vnode being mounted as fresh
|
|
vnode.shapeFlag |= 512 /* COMPONENT_KEPT_ALIVE */;
|
|
// make this key the freshest
|
|
keys.delete(key);
|
|
keys.add(key);
|
|
}
|
|
else {
|
|
keys.add(key);
|
|
// prune oldest entry
|
|
if (max && keys.size > parseInt(max, 10)) {
|
|
pruneCacheEntry(keys.values().next().value);
|
|
}
|
|
}
|
|
// avoid vnode being unmounted
|
|
vnode.shapeFlag |= 256 /* COMPONENT_SHOULD_KEEP_ALIVE */;
|
|
current = vnode;
|
|
return rawVNode;
|
|
};
|
|
}
|
|
};
|
|
// export the public type for h/tsx inference
|
|
// also to avoid inline import() in generated d.ts files
|
|
const KeepAlive = KeepAliveImpl;
|
|
function matches(pattern, name) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(pattern)) {
|
|
return pattern.some((p) => matches(p, name));
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(pattern)) {
|
|
return pattern.split(',').indexOf(name) > -1;
|
|
}
|
|
else if (pattern.test) {
|
|
return pattern.test(name);
|
|
}
|
|
/* istanbul ignore next */
|
|
return false;
|
|
}
|
|
function onActivated(hook, target) {
|
|
registerKeepAliveHook(hook, "a" /* ACTIVATED */, target);
|
|
}
|
|
function onDeactivated(hook, target) {
|
|
registerKeepAliveHook(hook, "da" /* DEACTIVATED */, target);
|
|
}
|
|
function registerKeepAliveHook(hook, type, target = currentInstance) {
|
|
// cache the deactivate branch check wrapper for injected hooks so the same
|
|
// hook can be properly deduped by the scheduler. "__wdc" stands for "with
|
|
// deactivation check".
|
|
const wrappedHook = hook.__wdc ||
|
|
(hook.__wdc = () => {
|
|
// only fire the hook if the target instance is NOT in a deactivated branch.
|
|
let current = target;
|
|
while (current) {
|
|
if (current.isDeactivated) {
|
|
return;
|
|
}
|
|
current = current.parent;
|
|
}
|
|
hook();
|
|
});
|
|
injectHook(type, wrappedHook, target);
|
|
// In addition to registering it on the target instance, we walk up the parent
|
|
// chain and register it on all ancestor instances that are keep-alive roots.
|
|
// This avoids the need to walk the entire component tree when invoking these
|
|
// hooks, and more importantly, avoids the need to track child components in
|
|
// arrays.
|
|
if (target) {
|
|
let current = target.parent;
|
|
while (current && current.parent) {
|
|
if (isKeepAlive(current.parent.vnode)) {
|
|
injectToKeepAliveRoot(wrappedHook, type, target, current);
|
|
}
|
|
current = current.parent;
|
|
}
|
|
}
|
|
}
|
|
function injectToKeepAliveRoot(hook, type, target, keepAliveRoot) {
|
|
// injectHook wraps the original for error handling, so make sure to remove
|
|
// the wrapped version.
|
|
const injected = injectHook(type, hook, keepAliveRoot, true /* prepend */);
|
|
onUnmounted(() => {
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.remove)(keepAliveRoot[type], injected);
|
|
}, target);
|
|
}
|
|
function resetShapeFlag(vnode) {
|
|
let shapeFlag = vnode.shapeFlag;
|
|
if (shapeFlag & 256 /* COMPONENT_SHOULD_KEEP_ALIVE */) {
|
|
shapeFlag -= 256 /* COMPONENT_SHOULD_KEEP_ALIVE */;
|
|
}
|
|
if (shapeFlag & 512 /* COMPONENT_KEPT_ALIVE */) {
|
|
shapeFlag -= 512 /* COMPONENT_KEPT_ALIVE */;
|
|
}
|
|
vnode.shapeFlag = shapeFlag;
|
|
}
|
|
function getInnerChild(vnode) {
|
|
return vnode.shapeFlag & 128 /* SUSPENSE */ ? vnode.ssContent : vnode;
|
|
}
|
|
|
|
function injectHook(type, hook, target = currentInstance, prepend = false) {
|
|
if (target) {
|
|
const hooks = target[type] || (target[type] = []);
|
|
// cache the error handling wrapper for injected hooks so the same hook
|
|
// can be properly deduped by the scheduler. "__weh" stands for "with error
|
|
// handling".
|
|
const wrappedHook = hook.__weh ||
|
|
(hook.__weh = (...args) => {
|
|
if (target.isUnmounted) {
|
|
return;
|
|
}
|
|
// disable tracking inside all lifecycle hooks
|
|
// since they can potentially be called inside effects.
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.pauseTracking)();
|
|
// Set currentInstance during hook invocation.
|
|
// This assumes the hook does not synchronously trigger other hooks, which
|
|
// can only be false when the user does something really funky.
|
|
setCurrentInstance(target);
|
|
const res = callWithAsyncErrorHandling(hook, target, type, args);
|
|
unsetCurrentInstance();
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.resetTracking)();
|
|
return res;
|
|
});
|
|
if (prepend) {
|
|
hooks.unshift(wrappedHook);
|
|
}
|
|
else {
|
|
hooks.push(wrappedHook);
|
|
}
|
|
return wrappedHook;
|
|
}
|
|
else if ((true)) {
|
|
const apiName = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toHandlerKey)(ErrorTypeStrings[type].replace(/ hook$/, ''));
|
|
warn(`${apiName} is called when there is no active component instance to be ` +
|
|
`associated with. ` +
|
|
`Lifecycle injection APIs can only be used during execution of setup().` +
|
|
(` If you are using async setup(), make sure to register lifecycle ` +
|
|
`hooks before the first await statement.`
|
|
));
|
|
}
|
|
}
|
|
const createHook = (lifecycle) => (hook, target = currentInstance) =>
|
|
// post-create lifecycle registrations are noops during SSR (except for serverPrefetch)
|
|
(!isInSSRComponentSetup || lifecycle === "sp" /* SERVER_PREFETCH */) &&
|
|
injectHook(lifecycle, hook, target);
|
|
const onBeforeMount = createHook("bm" /* BEFORE_MOUNT */);
|
|
const onMounted = createHook("m" /* MOUNTED */);
|
|
const onBeforeUpdate = createHook("bu" /* BEFORE_UPDATE */);
|
|
const onUpdated = createHook("u" /* UPDATED */);
|
|
const onBeforeUnmount = createHook("bum" /* BEFORE_UNMOUNT */);
|
|
const onUnmounted = createHook("um" /* UNMOUNTED */);
|
|
const onServerPrefetch = createHook("sp" /* SERVER_PREFETCH */);
|
|
const onRenderTriggered = createHook("rtg" /* RENDER_TRIGGERED */);
|
|
const onRenderTracked = createHook("rtc" /* RENDER_TRACKED */);
|
|
function onErrorCaptured(hook, target = currentInstance) {
|
|
injectHook("ec" /* ERROR_CAPTURED */, hook, target);
|
|
}
|
|
|
|
function createDuplicateChecker() {
|
|
const cache = Object.create(null);
|
|
return (type, key) => {
|
|
if (cache[key]) {
|
|
warn(`${type} property "${key}" is already defined in ${cache[key]}.`);
|
|
}
|
|
else {
|
|
cache[key] = type;
|
|
}
|
|
};
|
|
}
|
|
let shouldCacheAccess = true;
|
|
function applyOptions(instance) {
|
|
const options = resolveMergedOptions(instance);
|
|
const publicThis = instance.proxy;
|
|
const ctx = instance.ctx;
|
|
// do not cache property access on public proxy during state initialization
|
|
shouldCacheAccess = false;
|
|
// call beforeCreate first before accessing other options since
|
|
// the hook may mutate resolved options (#2791)
|
|
if (options.beforeCreate) {
|
|
callHook(options.beforeCreate, instance, "bc" /* BEFORE_CREATE */);
|
|
}
|
|
const {
|
|
// state
|
|
data: dataOptions, computed: computedOptions, methods, watch: watchOptions, provide: provideOptions, inject: injectOptions,
|
|
// lifecycle
|
|
created, beforeMount, mounted, beforeUpdate, updated, activated, deactivated, beforeDestroy, beforeUnmount, destroyed, unmounted, render, renderTracked, renderTriggered, errorCaptured, serverPrefetch,
|
|
// public API
|
|
expose, inheritAttrs,
|
|
// assets
|
|
components, directives, filters } = options;
|
|
const checkDuplicateProperties = ( true) ? createDuplicateChecker() : 0;
|
|
if ((true)) {
|
|
const [propsOptions] = instance.propsOptions;
|
|
if (propsOptions) {
|
|
for (const key in propsOptions) {
|
|
checkDuplicateProperties("Props" /* PROPS */, key);
|
|
}
|
|
}
|
|
}
|
|
// options initialization order (to be consistent with Vue 2):
|
|
// - props (already done outside of this function)
|
|
// - inject
|
|
// - methods
|
|
// - data (deferred since it relies on `this` access)
|
|
// - computed
|
|
// - watch (deferred since it relies on `this` access)
|
|
if (injectOptions) {
|
|
resolveInjections(injectOptions, ctx, checkDuplicateProperties, instance.appContext.config.unwrapInjectedRef);
|
|
}
|
|
if (methods) {
|
|
for (const key in methods) {
|
|
const methodHandler = methods[key];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(methodHandler)) {
|
|
// In dev mode, we use the `createRenderContext` function to define
|
|
// methods to the proxy target, and those are read-only but
|
|
// reconfigurable, so it needs to be redefined here
|
|
if ((true)) {
|
|
Object.defineProperty(ctx, key, {
|
|
value: methodHandler.bind(publicThis),
|
|
configurable: true,
|
|
enumerable: true,
|
|
writable: true
|
|
});
|
|
}
|
|
else {}
|
|
if ((true)) {
|
|
checkDuplicateProperties("Methods" /* METHODS */, key);
|
|
}
|
|
}
|
|
else if ((true)) {
|
|
warn(`Method "${key}" has type "${typeof methodHandler}" in the component definition. ` +
|
|
`Did you reference the function correctly?`);
|
|
}
|
|
}
|
|
}
|
|
if (dataOptions) {
|
|
if (( true) && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(dataOptions)) {
|
|
warn(`The data option must be a function. ` +
|
|
`Plain object usage is no longer supported.`);
|
|
}
|
|
const data = dataOptions.call(publicThis, publicThis);
|
|
if (( true) && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isPromise)(data)) {
|
|
warn(`data() returned a Promise - note data() cannot be async; If you ` +
|
|
`intend to perform data fetching before component renders, use ` +
|
|
`async setup() + <Suspense>.`);
|
|
}
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(data)) {
|
|
( true) && warn(`data() should return an object.`);
|
|
}
|
|
else {
|
|
instance.data = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.reactive)(data);
|
|
if ((true)) {
|
|
for (const key in data) {
|
|
checkDuplicateProperties("Data" /* DATA */, key);
|
|
// expose data on ctx during dev
|
|
if (key[0] !== '$' && key[0] !== '_') {
|
|
Object.defineProperty(ctx, key, {
|
|
configurable: true,
|
|
enumerable: true,
|
|
get: () => data[key],
|
|
set: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP
|
|
});
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
// state initialization complete at this point - start caching access
|
|
shouldCacheAccess = true;
|
|
if (computedOptions) {
|
|
for (const key in computedOptions) {
|
|
const opt = computedOptions[key];
|
|
const get = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(opt)
|
|
? opt.bind(publicThis, publicThis)
|
|
: (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(opt.get)
|
|
? opt.get.bind(publicThis, publicThis)
|
|
: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP;
|
|
if (( true) && get === _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP) {
|
|
warn(`Computed property "${key}" has no getter.`);
|
|
}
|
|
const set = !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(opt) && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(opt.set)
|
|
? opt.set.bind(publicThis)
|
|
: ( true)
|
|
? () => {
|
|
warn(`Write operation failed: computed property "${key}" is readonly.`);
|
|
}
|
|
: 0;
|
|
const c = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.computed)({
|
|
get,
|
|
set
|
|
});
|
|
Object.defineProperty(ctx, key, {
|
|
enumerable: true,
|
|
configurable: true,
|
|
get: () => c.value,
|
|
set: v => (c.value = v)
|
|
});
|
|
if ((true)) {
|
|
checkDuplicateProperties("Computed" /* COMPUTED */, key);
|
|
}
|
|
}
|
|
}
|
|
if (watchOptions) {
|
|
for (const key in watchOptions) {
|
|
createWatcher(watchOptions[key], ctx, publicThis, key);
|
|
}
|
|
}
|
|
if (provideOptions) {
|
|
const provides = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(provideOptions)
|
|
? provideOptions.call(publicThis)
|
|
: provideOptions;
|
|
Reflect.ownKeys(provides).forEach(key => {
|
|
provide(key, provides[key]);
|
|
});
|
|
}
|
|
if (created) {
|
|
callHook(created, instance, "c" /* CREATED */);
|
|
}
|
|
function registerLifecycleHook(register, hook) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(hook)) {
|
|
hook.forEach(_hook => register(_hook.bind(publicThis)));
|
|
}
|
|
else if (hook) {
|
|
register(hook.bind(publicThis));
|
|
}
|
|
}
|
|
registerLifecycleHook(onBeforeMount, beforeMount);
|
|
registerLifecycleHook(onMounted, mounted);
|
|
registerLifecycleHook(onBeforeUpdate, beforeUpdate);
|
|
registerLifecycleHook(onUpdated, updated);
|
|
registerLifecycleHook(onActivated, activated);
|
|
registerLifecycleHook(onDeactivated, deactivated);
|
|
registerLifecycleHook(onErrorCaptured, errorCaptured);
|
|
registerLifecycleHook(onRenderTracked, renderTracked);
|
|
registerLifecycleHook(onRenderTriggered, renderTriggered);
|
|
registerLifecycleHook(onBeforeUnmount, beforeUnmount);
|
|
registerLifecycleHook(onUnmounted, unmounted);
|
|
registerLifecycleHook(onServerPrefetch, serverPrefetch);
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(expose)) {
|
|
if (expose.length) {
|
|
const exposed = instance.exposed || (instance.exposed = {});
|
|
expose.forEach(key => {
|
|
Object.defineProperty(exposed, key, {
|
|
get: () => publicThis[key],
|
|
set: val => (publicThis[key] = val)
|
|
});
|
|
});
|
|
}
|
|
else if (!instance.exposed) {
|
|
instance.exposed = {};
|
|
}
|
|
}
|
|
// options that are handled when creating the instance but also need to be
|
|
// applied from mixins
|
|
if (render && instance.render === _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP) {
|
|
instance.render = render;
|
|
}
|
|
if (inheritAttrs != null) {
|
|
instance.inheritAttrs = inheritAttrs;
|
|
}
|
|
// asset options.
|
|
if (components)
|
|
instance.components = components;
|
|
if (directives)
|
|
instance.directives = directives;
|
|
}
|
|
function resolveInjections(injectOptions, ctx, checkDuplicateProperties = _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP, unwrapRef = false) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(injectOptions)) {
|
|
injectOptions = normalizeInject(injectOptions);
|
|
}
|
|
for (const key in injectOptions) {
|
|
const opt = injectOptions[key];
|
|
let injected;
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(opt)) {
|
|
if ('default' in opt) {
|
|
injected = inject(opt.from || key, opt.default, true /* treat default function as factory */);
|
|
}
|
|
else {
|
|
injected = inject(opt.from || key);
|
|
}
|
|
}
|
|
else {
|
|
injected = inject(opt);
|
|
}
|
|
if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isRef)(injected)) {
|
|
// TODO remove the check in 3.3
|
|
if (unwrapRef) {
|
|
Object.defineProperty(ctx, key, {
|
|
enumerable: true,
|
|
configurable: true,
|
|
get: () => injected.value,
|
|
set: v => (injected.value = v)
|
|
});
|
|
}
|
|
else {
|
|
if ((true)) {
|
|
warn(`injected property "${key}" is a ref and will be auto-unwrapped ` +
|
|
`and no longer needs \`.value\` in the next minor release. ` +
|
|
`To opt-in to the new behavior now, ` +
|
|
`set \`app.config.unwrapInjectedRef = true\` (this config is ` +
|
|
`temporary and will not be needed in the future.)`);
|
|
}
|
|
ctx[key] = injected;
|
|
}
|
|
}
|
|
else {
|
|
ctx[key] = injected;
|
|
}
|
|
if ((true)) {
|
|
checkDuplicateProperties("Inject" /* INJECT */, key);
|
|
}
|
|
}
|
|
}
|
|
function callHook(hook, instance, type) {
|
|
callWithAsyncErrorHandling((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(hook)
|
|
? hook.map(h => h.bind(instance.proxy))
|
|
: hook.bind(instance.proxy), instance, type);
|
|
}
|
|
function createWatcher(raw, ctx, publicThis, key) {
|
|
const getter = key.includes('.')
|
|
? createPathGetter(publicThis, key)
|
|
: () => publicThis[key];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(raw)) {
|
|
const handler = ctx[raw];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(handler)) {
|
|
watch(getter, handler);
|
|
}
|
|
else if ((true)) {
|
|
warn(`Invalid watch handler specified by key "${raw}"`, handler);
|
|
}
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(raw)) {
|
|
watch(getter, raw.bind(publicThis));
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(raw)) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(raw)) {
|
|
raw.forEach(r => createWatcher(r, ctx, publicThis, key));
|
|
}
|
|
else {
|
|
const handler = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(raw.handler)
|
|
? raw.handler.bind(publicThis)
|
|
: ctx[raw.handler];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(handler)) {
|
|
watch(getter, handler, raw);
|
|
}
|
|
else if ((true)) {
|
|
warn(`Invalid watch handler specified by key "${raw.handler}"`, handler);
|
|
}
|
|
}
|
|
}
|
|
else if ((true)) {
|
|
warn(`Invalid watch option: "${key}"`, raw);
|
|
}
|
|
}
|
|
/**
|
|
* Resolve merged options and cache it on the component.
|
|
* This is done only once per-component since the merging does not involve
|
|
* instances.
|
|
*/
|
|
function resolveMergedOptions(instance) {
|
|
const base = instance.type;
|
|
const { mixins, extends: extendsOptions } = base;
|
|
const { mixins: globalMixins, optionsCache: cache, config: { optionMergeStrategies } } = instance.appContext;
|
|
const cached = cache.get(base);
|
|
let resolved;
|
|
if (cached) {
|
|
resolved = cached;
|
|
}
|
|
else if (!globalMixins.length && !mixins && !extendsOptions) {
|
|
{
|
|
resolved = base;
|
|
}
|
|
}
|
|
else {
|
|
resolved = {};
|
|
if (globalMixins.length) {
|
|
globalMixins.forEach(m => mergeOptions(resolved, m, optionMergeStrategies, true));
|
|
}
|
|
mergeOptions(resolved, base, optionMergeStrategies);
|
|
}
|
|
cache.set(base, resolved);
|
|
return resolved;
|
|
}
|
|
function mergeOptions(to, from, strats, asMixin = false) {
|
|
const { mixins, extends: extendsOptions } = from;
|
|
if (extendsOptions) {
|
|
mergeOptions(to, extendsOptions, strats, true);
|
|
}
|
|
if (mixins) {
|
|
mixins.forEach((m) => mergeOptions(to, m, strats, true));
|
|
}
|
|
for (const key in from) {
|
|
if (asMixin && key === 'expose') {
|
|
( true) &&
|
|
warn(`"expose" option is ignored when declared in mixins or extends. ` +
|
|
`It should only be declared in the base component itself.`);
|
|
}
|
|
else {
|
|
const strat = internalOptionMergeStrats[key] || (strats && strats[key]);
|
|
to[key] = strat ? strat(to[key], from[key]) : from[key];
|
|
}
|
|
}
|
|
return to;
|
|
}
|
|
const internalOptionMergeStrats = {
|
|
data: mergeDataFn,
|
|
props: mergeObjectOptions,
|
|
emits: mergeObjectOptions,
|
|
// objects
|
|
methods: mergeObjectOptions,
|
|
computed: mergeObjectOptions,
|
|
// lifecycle
|
|
beforeCreate: mergeAsArray,
|
|
created: mergeAsArray,
|
|
beforeMount: mergeAsArray,
|
|
mounted: mergeAsArray,
|
|
beforeUpdate: mergeAsArray,
|
|
updated: mergeAsArray,
|
|
beforeDestroy: mergeAsArray,
|
|
destroyed: mergeAsArray,
|
|
activated: mergeAsArray,
|
|
deactivated: mergeAsArray,
|
|
errorCaptured: mergeAsArray,
|
|
serverPrefetch: mergeAsArray,
|
|
// assets
|
|
components: mergeObjectOptions,
|
|
directives: mergeObjectOptions,
|
|
// watch
|
|
watch: mergeWatchOptions,
|
|
// provide / inject
|
|
provide: mergeDataFn,
|
|
inject: mergeInject
|
|
};
|
|
function mergeDataFn(to, from) {
|
|
if (!from) {
|
|
return to;
|
|
}
|
|
if (!to) {
|
|
return from;
|
|
}
|
|
return function mergedDataFn() {
|
|
return ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend))((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(to) ? to.call(this, this) : to, (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(from) ? from.call(this, this) : from);
|
|
};
|
|
}
|
|
function mergeInject(to, from) {
|
|
return mergeObjectOptions(normalizeInject(to), normalizeInject(from));
|
|
}
|
|
function normalizeInject(raw) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(raw)) {
|
|
const res = {};
|
|
for (let i = 0; i < raw.length; i++) {
|
|
res[raw[i]] = raw[i];
|
|
}
|
|
return res;
|
|
}
|
|
return raw;
|
|
}
|
|
function mergeAsArray(to, from) {
|
|
return to ? [...new Set([].concat(to, from))] : from;
|
|
}
|
|
function mergeObjectOptions(to, from) {
|
|
return to ? (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)(Object.create(null), to), from) : from;
|
|
}
|
|
function mergeWatchOptions(to, from) {
|
|
if (!to)
|
|
return from;
|
|
if (!from)
|
|
return to;
|
|
const merged = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)(Object.create(null), to);
|
|
for (const key in from) {
|
|
merged[key] = mergeAsArray(to[key], from[key]);
|
|
}
|
|
return merged;
|
|
}
|
|
|
|
function initProps(instance, rawProps, isStateful, // result of bitwise flag comparison
|
|
isSSR = false) {
|
|
const props = {};
|
|
const attrs = {};
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.def)(attrs, InternalObjectKey, 1);
|
|
instance.propsDefaults = Object.create(null);
|
|
setFullProps(instance, rawProps, props, attrs);
|
|
// ensure all declared prop keys are present
|
|
for (const key in instance.propsOptions[0]) {
|
|
if (!(key in props)) {
|
|
props[key] = undefined;
|
|
}
|
|
}
|
|
// validation
|
|
if ((true)) {
|
|
validateProps(rawProps || {}, props, instance);
|
|
}
|
|
if (isStateful) {
|
|
// stateful
|
|
instance.props = isSSR ? props : (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.shallowReactive)(props);
|
|
}
|
|
else {
|
|
if (!instance.type.props) {
|
|
// functional w/ optional props, props === attrs
|
|
instance.props = attrs;
|
|
}
|
|
else {
|
|
// functional w/ declared props
|
|
instance.props = props;
|
|
}
|
|
}
|
|
instance.attrs = attrs;
|
|
}
|
|
function updateProps(instance, rawProps, rawPrevProps, optimized) {
|
|
const { props, attrs, vnode: { patchFlag } } = instance;
|
|
const rawCurrentProps = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw)(props);
|
|
const [options] = instance.propsOptions;
|
|
let hasAttrsChanged = false;
|
|
if (
|
|
// always force full diff in dev
|
|
// - #1942 if hmr is enabled with sfc component
|
|
// - vite#872 non-sfc component used by sfc component
|
|
!(( true) &&
|
|
(instance.type.__hmrId ||
|
|
(instance.parent && instance.parent.type.__hmrId))) &&
|
|
(optimized || patchFlag > 0) &&
|
|
!(patchFlag & 16 /* FULL_PROPS */)) {
|
|
if (patchFlag & 8 /* PROPS */) {
|
|
// Compiler-generated props & no keys change, just set the updated
|
|
// the props.
|
|
const propsToUpdate = instance.vnode.dynamicProps;
|
|
for (let i = 0; i < propsToUpdate.length; i++) {
|
|
let key = propsToUpdate[i];
|
|
// PROPS flag guarantees rawProps to be non-null
|
|
const value = rawProps[key];
|
|
if (options) {
|
|
// attr / props separation was done on init and will be consistent
|
|
// in this code path, so just check if attrs have it.
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(attrs, key)) {
|
|
if (value !== attrs[key]) {
|
|
attrs[key] = value;
|
|
hasAttrsChanged = true;
|
|
}
|
|
}
|
|
else {
|
|
const camelizedKey = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize)(key);
|
|
props[camelizedKey] = resolvePropValue(options, rawCurrentProps, camelizedKey, value, instance, false /* isAbsent */);
|
|
}
|
|
}
|
|
else {
|
|
if (value !== attrs[key]) {
|
|
attrs[key] = value;
|
|
hasAttrsChanged = true;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
// full props update.
|
|
if (setFullProps(instance, rawProps, props, attrs)) {
|
|
hasAttrsChanged = true;
|
|
}
|
|
// in case of dynamic props, check if we need to delete keys from
|
|
// the props object
|
|
let kebabKey;
|
|
for (const key in rawCurrentProps) {
|
|
if (!rawProps ||
|
|
// for camelCase
|
|
(!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(rawProps, key) &&
|
|
// it's possible the original props was passed in as kebab-case
|
|
// and converted to camelCase (#955)
|
|
((kebabKey = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hyphenate)(key)) === key || !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(rawProps, kebabKey)))) {
|
|
if (options) {
|
|
if (rawPrevProps &&
|
|
// for camelCase
|
|
(rawPrevProps[key] !== undefined ||
|
|
// for kebab-case
|
|
rawPrevProps[kebabKey] !== undefined)) {
|
|
props[key] = resolvePropValue(options, rawCurrentProps, key, undefined, instance, true /* isAbsent */);
|
|
}
|
|
}
|
|
else {
|
|
delete props[key];
|
|
}
|
|
}
|
|
}
|
|
// in the case of functional component w/o props declaration, props and
|
|
// attrs point to the same object so it should already have been updated.
|
|
if (attrs !== rawCurrentProps) {
|
|
for (const key in attrs) {
|
|
if (!rawProps || !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(rawProps, key)) {
|
|
delete attrs[key];
|
|
hasAttrsChanged = true;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
// trigger updates for $attrs in case it's used in component slots
|
|
if (hasAttrsChanged) {
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.trigger)(instance, "set" /* SET */, '$attrs');
|
|
}
|
|
if ((true)) {
|
|
validateProps(rawProps || {}, props, instance);
|
|
}
|
|
}
|
|
function setFullProps(instance, rawProps, props, attrs) {
|
|
const [options, needCastKeys] = instance.propsOptions;
|
|
let hasAttrsChanged = false;
|
|
let rawCastValues;
|
|
if (rawProps) {
|
|
for (let key in rawProps) {
|
|
// key, ref are reserved and never passed down
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isReservedProp)(key)) {
|
|
continue;
|
|
}
|
|
const value = rawProps[key];
|
|
// prop option names are camelized during normalization, so to support
|
|
// kebab -> camel conversion here we need to camelize the key.
|
|
let camelKey;
|
|
if (options && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(options, (camelKey = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize)(key)))) {
|
|
if (!needCastKeys || !needCastKeys.includes(camelKey)) {
|
|
props[camelKey] = value;
|
|
}
|
|
else {
|
|
(rawCastValues || (rawCastValues = {}))[camelKey] = value;
|
|
}
|
|
}
|
|
else if (!isEmitListener(instance.emitsOptions, key)) {
|
|
if (value !== attrs[key]) {
|
|
attrs[key] = value;
|
|
hasAttrsChanged = true;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
if (needCastKeys) {
|
|
const rawCurrentProps = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw)(props);
|
|
const castValues = rawCastValues || _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ;
|
|
for (let i = 0; i < needCastKeys.length; i++) {
|
|
const key = needCastKeys[i];
|
|
props[key] = resolvePropValue(options, rawCurrentProps, key, castValues[key], instance, !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(castValues, key));
|
|
}
|
|
}
|
|
return hasAttrsChanged;
|
|
}
|
|
function resolvePropValue(options, props, key, value, instance, isAbsent) {
|
|
const opt = options[key];
|
|
if (opt != null) {
|
|
const hasDefault = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(opt, 'default');
|
|
// default values
|
|
if (hasDefault && value === undefined) {
|
|
const defaultValue = opt.default;
|
|
if (opt.type !== Function && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(defaultValue)) {
|
|
const { propsDefaults } = instance;
|
|
if (key in propsDefaults) {
|
|
value = propsDefaults[key];
|
|
}
|
|
else {
|
|
setCurrentInstance(instance);
|
|
value = propsDefaults[key] = defaultValue.call(null, props);
|
|
unsetCurrentInstance();
|
|
}
|
|
}
|
|
else {
|
|
value = defaultValue;
|
|
}
|
|
}
|
|
// boolean casting
|
|
if (opt[0 /* shouldCast */]) {
|
|
if (isAbsent && !hasDefault) {
|
|
value = false;
|
|
}
|
|
else if (opt[1 /* shouldCastTrue */] &&
|
|
(value === '' || value === (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hyphenate)(key))) {
|
|
value = true;
|
|
}
|
|
}
|
|
}
|
|
return value;
|
|
}
|
|
function normalizePropsOptions(comp, appContext, asMixin = false) {
|
|
const cache = appContext.propsCache;
|
|
const cached = cache.get(comp);
|
|
if (cached) {
|
|
return cached;
|
|
}
|
|
const raw = comp.props;
|
|
const normalized = {};
|
|
const needCastKeys = [];
|
|
// apply mixin/extends props
|
|
let hasExtends = false;
|
|
if (__VUE_OPTIONS_API__ && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(comp)) {
|
|
const extendProps = (raw) => {
|
|
hasExtends = true;
|
|
const [props, keys] = normalizePropsOptions(raw, appContext, true);
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)(normalized, props);
|
|
if (keys)
|
|
needCastKeys.push(...keys);
|
|
};
|
|
if (!asMixin && appContext.mixins.length) {
|
|
appContext.mixins.forEach(extendProps);
|
|
}
|
|
if (comp.extends) {
|
|
extendProps(comp.extends);
|
|
}
|
|
if (comp.mixins) {
|
|
comp.mixins.forEach(extendProps);
|
|
}
|
|
}
|
|
if (!raw && !hasExtends) {
|
|
cache.set(comp, _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_ARR);
|
|
return _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_ARR;
|
|
}
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(raw)) {
|
|
for (let i = 0; i < raw.length; i++) {
|
|
if (( true) && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(raw[i])) {
|
|
warn(`props must be strings when using array syntax.`, raw[i]);
|
|
}
|
|
const normalizedKey = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize)(raw[i]);
|
|
if (validatePropName(normalizedKey)) {
|
|
normalized[normalizedKey] = _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ;
|
|
}
|
|
}
|
|
}
|
|
else if (raw) {
|
|
if (( true) && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(raw)) {
|
|
warn(`invalid props options`, raw);
|
|
}
|
|
for (const key in raw) {
|
|
const normalizedKey = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize)(key);
|
|
if (validatePropName(normalizedKey)) {
|
|
const opt = raw[key];
|
|
const prop = (normalized[normalizedKey] =
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(opt) || (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(opt) ? { type: opt } : opt);
|
|
if (prop) {
|
|
const booleanIndex = getTypeIndex(Boolean, prop.type);
|
|
const stringIndex = getTypeIndex(String, prop.type);
|
|
prop[0 /* shouldCast */] = booleanIndex > -1;
|
|
prop[1 /* shouldCastTrue */] =
|
|
stringIndex < 0 || booleanIndex < stringIndex;
|
|
// if the prop needs boolean casting or default value
|
|
if (booleanIndex > -1 || (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(prop, 'default')) {
|
|
needCastKeys.push(normalizedKey);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
const res = [normalized, needCastKeys];
|
|
cache.set(comp, res);
|
|
return res;
|
|
}
|
|
function validatePropName(key) {
|
|
if (key[0] !== '$') {
|
|
return true;
|
|
}
|
|
else if ((true)) {
|
|
warn(`Invalid prop name: "${key}" is a reserved property.`);
|
|
}
|
|
return false;
|
|
}
|
|
// use function string name to check type constructors
|
|
// so that it works across vms / iframes.
|
|
function getType(ctor) {
|
|
const match = ctor && ctor.toString().match(/^\s*function (\w+)/);
|
|
return match ? match[1] : ctor === null ? 'null' : '';
|
|
}
|
|
function isSameType(a, b) {
|
|
return getType(a) === getType(b);
|
|
}
|
|
function getTypeIndex(type, expectedTypes) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(expectedTypes)) {
|
|
return expectedTypes.findIndex(t => isSameType(t, type));
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(expectedTypes)) {
|
|
return isSameType(expectedTypes, type) ? 0 : -1;
|
|
}
|
|
return -1;
|
|
}
|
|
/**
|
|
* dev only
|
|
*/
|
|
function validateProps(rawProps, props, instance) {
|
|
const resolvedValues = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw)(props);
|
|
const options = instance.propsOptions[0];
|
|
for (const key in options) {
|
|
let opt = options[key];
|
|
if (opt == null)
|
|
continue;
|
|
validateProp(key, resolvedValues[key], opt, !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(rawProps, key) && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(rawProps, (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hyphenate)(key)));
|
|
}
|
|
}
|
|
/**
|
|
* dev only
|
|
*/
|
|
function validateProp(name, value, prop, isAbsent) {
|
|
const { type, required, validator } = prop;
|
|
// required!
|
|
if (required && isAbsent) {
|
|
warn('Missing required prop: "' + name + '"');
|
|
return;
|
|
}
|
|
// missing but optional
|
|
if (value == null && !prop.required) {
|
|
return;
|
|
}
|
|
// type check
|
|
if (type != null && type !== true) {
|
|
let isValid = false;
|
|
const types = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(type) ? type : [type];
|
|
const expectedTypes = [];
|
|
// value is valid as long as one of the specified types match
|
|
for (let i = 0; i < types.length && !isValid; i++) {
|
|
const { valid, expectedType } = assertType(value, types[i]);
|
|
expectedTypes.push(expectedType || '');
|
|
isValid = valid;
|
|
}
|
|
if (!isValid) {
|
|
warn(getInvalidTypeMessage(name, value, expectedTypes));
|
|
return;
|
|
}
|
|
}
|
|
// custom validator
|
|
if (validator && !validator(value)) {
|
|
warn('Invalid prop: custom validator check failed for prop "' + name + '".');
|
|
}
|
|
}
|
|
const isSimpleType = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.makeMap)('String,Number,Boolean,Function,Symbol,BigInt');
|
|
/**
|
|
* dev only
|
|
*/
|
|
function assertType(value, type) {
|
|
let valid;
|
|
const expectedType = getType(type);
|
|
if (isSimpleType(expectedType)) {
|
|
const t = typeof value;
|
|
valid = t === expectedType.toLowerCase();
|
|
// for primitive wrapper objects
|
|
if (!valid && t === 'object') {
|
|
valid = value instanceof type;
|
|
}
|
|
}
|
|
else if (expectedType === 'Object') {
|
|
valid = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(value);
|
|
}
|
|
else if (expectedType === 'Array') {
|
|
valid = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(value);
|
|
}
|
|
else if (expectedType === 'null') {
|
|
valid = value === null;
|
|
}
|
|
else {
|
|
valid = value instanceof type;
|
|
}
|
|
return {
|
|
valid,
|
|
expectedType
|
|
};
|
|
}
|
|
/**
|
|
* dev only
|
|
*/
|
|
function getInvalidTypeMessage(name, value, expectedTypes) {
|
|
let message = `Invalid prop: type check failed for prop "${name}".` +
|
|
` Expected ${expectedTypes.map(_vue_shared__WEBPACK_IMPORTED_MODULE_1__.capitalize).join(' | ')}`;
|
|
const expectedType = expectedTypes[0];
|
|
const receivedType = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toRawType)(value);
|
|
const expectedValue = styleValue(value, expectedType);
|
|
const receivedValue = styleValue(value, receivedType);
|
|
// check if we need to specify expected value
|
|
if (expectedTypes.length === 1 &&
|
|
isExplicable(expectedType) &&
|
|
!isBoolean(expectedType, receivedType)) {
|
|
message += ` with value ${expectedValue}`;
|
|
}
|
|
message += `, got ${receivedType} `;
|
|
// check if we need to specify received value
|
|
if (isExplicable(receivedType)) {
|
|
message += `with value ${receivedValue}.`;
|
|
}
|
|
return message;
|
|
}
|
|
/**
|
|
* dev only
|
|
*/
|
|
function styleValue(value, type) {
|
|
if (type === 'String') {
|
|
return `"${value}"`;
|
|
}
|
|
else if (type === 'Number') {
|
|
return `${Number(value)}`;
|
|
}
|
|
else {
|
|
return `${value}`;
|
|
}
|
|
}
|
|
/**
|
|
* dev only
|
|
*/
|
|
function isExplicable(type) {
|
|
const explicitTypes = ['string', 'number', 'boolean'];
|
|
return explicitTypes.some(elem => type.toLowerCase() === elem);
|
|
}
|
|
/**
|
|
* dev only
|
|
*/
|
|
function isBoolean(...args) {
|
|
return args.some(elem => elem.toLowerCase() === 'boolean');
|
|
}
|
|
|
|
const isInternalKey = (key) => key[0] === '_' || key === '$stable';
|
|
const normalizeSlotValue = (value) => (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(value)
|
|
? value.map(normalizeVNode)
|
|
: [normalizeVNode(value)];
|
|
const normalizeSlot = (key, rawSlot, ctx) => {
|
|
const normalized = withCtx((...args) => {
|
|
if (( true) && currentInstance) {
|
|
warn(`Slot "${key}" invoked outside of the render function: ` +
|
|
`this will not track dependencies used in the slot. ` +
|
|
`Invoke the slot function inside the render function instead.`);
|
|
}
|
|
return normalizeSlotValue(rawSlot(...args));
|
|
}, ctx);
|
|
normalized._c = false;
|
|
return normalized;
|
|
};
|
|
const normalizeObjectSlots = (rawSlots, slots, instance) => {
|
|
const ctx = rawSlots._ctx;
|
|
for (const key in rawSlots) {
|
|
if (isInternalKey(key))
|
|
continue;
|
|
const value = rawSlots[key];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(value)) {
|
|
slots[key] = normalizeSlot(key, value, ctx);
|
|
}
|
|
else if (value != null) {
|
|
if (true) {
|
|
warn(`Non-function value encountered for slot "${key}". ` +
|
|
`Prefer function slots for better performance.`);
|
|
}
|
|
const normalized = normalizeSlotValue(value);
|
|
slots[key] = () => normalized;
|
|
}
|
|
}
|
|
};
|
|
const normalizeVNodeSlots = (instance, children) => {
|
|
if (( true) &&
|
|
!isKeepAlive(instance.vnode) &&
|
|
!(false )) {
|
|
warn(`Non-function value encountered for default slot. ` +
|
|
`Prefer function slots for better performance.`);
|
|
}
|
|
const normalized = normalizeSlotValue(children);
|
|
instance.slots.default = () => normalized;
|
|
};
|
|
const initSlots = (instance, children) => {
|
|
if (instance.vnode.shapeFlag & 32 /* SLOTS_CHILDREN */) {
|
|
const type = children._;
|
|
if (type) {
|
|
// users can get the shallow readonly version of the slots object through `this.$slots`,
|
|
// we should avoid the proxy object polluting the slots of the internal instance
|
|
instance.slots = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw)(children);
|
|
// make compiler marker non-enumerable
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.def)(children, '_', type);
|
|
}
|
|
else {
|
|
normalizeObjectSlots(children, (instance.slots = {}));
|
|
}
|
|
}
|
|
else {
|
|
instance.slots = {};
|
|
if (children) {
|
|
normalizeVNodeSlots(instance, children);
|
|
}
|
|
}
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.def)(instance.slots, InternalObjectKey, 1);
|
|
};
|
|
const updateSlots = (instance, children, optimized) => {
|
|
const { vnode, slots } = instance;
|
|
let needDeletionCheck = true;
|
|
let deletionComparisonTarget = _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ;
|
|
if (vnode.shapeFlag & 32 /* SLOTS_CHILDREN */) {
|
|
const type = children._;
|
|
if (type) {
|
|
// compiled slots.
|
|
if (( true) && isHmrUpdating) {
|
|
// Parent was HMR updated so slot content may have changed.
|
|
// force update slots and mark instance for hmr as well
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)(slots, children);
|
|
}
|
|
else if (optimized && type === 1 /* STABLE */) {
|
|
// compiled AND stable.
|
|
// no need to update, and skip stale slots removal.
|
|
needDeletionCheck = false;
|
|
}
|
|
else {
|
|
// compiled but dynamic (v-if/v-for on slots) - update slots, but skip
|
|
// normalization.
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)(slots, children);
|
|
// #2893
|
|
// when rendering the optimized slots by manually written render function,
|
|
// we need to delete the `slots._` flag if necessary to make subsequent updates reliable,
|
|
// i.e. let the `renderSlot` create the bailed Fragment
|
|
if (!optimized && type === 1 /* STABLE */) {
|
|
delete slots._;
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
needDeletionCheck = !children.$stable;
|
|
normalizeObjectSlots(children, slots);
|
|
}
|
|
deletionComparisonTarget = children;
|
|
}
|
|
else if (children) {
|
|
// non slot object children (direct value) passed to a component
|
|
normalizeVNodeSlots(instance, children);
|
|
deletionComparisonTarget = { default: 1 };
|
|
}
|
|
// delete stale slots
|
|
if (needDeletionCheck) {
|
|
for (const key in slots) {
|
|
if (!isInternalKey(key) && !(key in deletionComparisonTarget)) {
|
|
delete slots[key];
|
|
}
|
|
}
|
|
}
|
|
};
|
|
|
|
/**
|
|
Runtime helper for applying directives to a vnode. Example usage:
|
|
|
|
const comp = resolveComponent('comp')
|
|
const foo = resolveDirective('foo')
|
|
const bar = resolveDirective('bar')
|
|
|
|
return withDirectives(h(comp), [
|
|
[foo, this.x],
|
|
[bar, this.y]
|
|
])
|
|
*/
|
|
const isBuiltInDirective = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.makeMap)('bind,cloak,else-if,else,for,html,if,model,on,once,pre,show,slot,text');
|
|
function validateDirectiveName(name) {
|
|
if (isBuiltInDirective(name)) {
|
|
warn('Do not use built-in directive ids as custom directive id: ' + name);
|
|
}
|
|
}
|
|
/**
|
|
* Adds directives to a VNode.
|
|
*/
|
|
function withDirectives(vnode, directives) {
|
|
const internalInstance = currentRenderingInstance;
|
|
if (internalInstance === null) {
|
|
( true) && warn(`withDirectives can only be used inside render functions.`);
|
|
return vnode;
|
|
}
|
|
const instance = internalInstance.proxy;
|
|
const bindings = vnode.dirs || (vnode.dirs = []);
|
|
for (let i = 0; i < directives.length; i++) {
|
|
let [dir, value, arg, modifiers = _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ] = directives[i];
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(dir)) {
|
|
dir = {
|
|
mounted: dir,
|
|
updated: dir
|
|
};
|
|
}
|
|
if (dir.deep) {
|
|
traverse(value);
|
|
}
|
|
bindings.push({
|
|
dir,
|
|
instance,
|
|
value,
|
|
oldValue: void 0,
|
|
arg,
|
|
modifiers
|
|
});
|
|
}
|
|
return vnode;
|
|
}
|
|
function invokeDirectiveHook(vnode, prevVNode, instance, name) {
|
|
const bindings = vnode.dirs;
|
|
const oldBindings = prevVNode && prevVNode.dirs;
|
|
for (let i = 0; i < bindings.length; i++) {
|
|
const binding = bindings[i];
|
|
if (oldBindings) {
|
|
binding.oldValue = oldBindings[i].value;
|
|
}
|
|
let hook = binding.dir[name];
|
|
if (hook) {
|
|
// disable tracking inside all lifecycle hooks
|
|
// since they can potentially be called inside effects.
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.pauseTracking)();
|
|
callWithAsyncErrorHandling(hook, instance, 8 /* DIRECTIVE_HOOK */, [
|
|
vnode.el,
|
|
binding,
|
|
vnode,
|
|
prevVNode
|
|
]);
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.resetTracking)();
|
|
}
|
|
}
|
|
}
|
|
|
|
function createAppContext() {
|
|
return {
|
|
app: null,
|
|
config: {
|
|
isNativeTag: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NO,
|
|
performance: false,
|
|
globalProperties: {},
|
|
optionMergeStrategies: {},
|
|
errorHandler: undefined,
|
|
warnHandler: undefined,
|
|
compilerOptions: {}
|
|
},
|
|
mixins: [],
|
|
components: {},
|
|
directives: {},
|
|
provides: Object.create(null),
|
|
optionsCache: new WeakMap(),
|
|
propsCache: new WeakMap(),
|
|
emitsCache: new WeakMap()
|
|
};
|
|
}
|
|
let uid = 0;
|
|
function createAppAPI(render, hydrate) {
|
|
return function createApp(rootComponent, rootProps = null) {
|
|
if (rootProps != null && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(rootProps)) {
|
|
( true) && warn(`root props passed to app.mount() must be an object.`);
|
|
rootProps = null;
|
|
}
|
|
const context = createAppContext();
|
|
const installedPlugins = new Set();
|
|
let isMounted = false;
|
|
const app = (context.app = {
|
|
_uid: uid++,
|
|
_component: rootComponent,
|
|
_props: rootProps,
|
|
_container: null,
|
|
_context: context,
|
|
_instance: null,
|
|
version,
|
|
get config() {
|
|
return context.config;
|
|
},
|
|
set config(v) {
|
|
if ((true)) {
|
|
warn(`app.config cannot be replaced. Modify individual options instead.`);
|
|
}
|
|
},
|
|
use(plugin, ...options) {
|
|
if (installedPlugins.has(plugin)) {
|
|
( true) && warn(`Plugin has already been applied to target app.`);
|
|
}
|
|
else if (plugin && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(plugin.install)) {
|
|
installedPlugins.add(plugin);
|
|
plugin.install(app, ...options);
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(plugin)) {
|
|
installedPlugins.add(plugin);
|
|
plugin(app, ...options);
|
|
}
|
|
else if ((true)) {
|
|
warn(`A plugin must either be a function or an object with an "install" ` +
|
|
`function.`);
|
|
}
|
|
return app;
|
|
},
|
|
mixin(mixin) {
|
|
if (__VUE_OPTIONS_API__) {
|
|
if (!context.mixins.includes(mixin)) {
|
|
context.mixins.push(mixin);
|
|
}
|
|
else if ((true)) {
|
|
warn('Mixin has already been applied to target app' +
|
|
(mixin.name ? `: ${mixin.name}` : ''));
|
|
}
|
|
}
|
|
else if ((true)) {
|
|
warn('Mixins are only available in builds supporting Options API');
|
|
}
|
|
return app;
|
|
},
|
|
component(name, component) {
|
|
if ((true)) {
|
|
validateComponentName(name, context.config);
|
|
}
|
|
if (!component) {
|
|
return context.components[name];
|
|
}
|
|
if (( true) && context.components[name]) {
|
|
warn(`Component "${name}" has already been registered in target app.`);
|
|
}
|
|
context.components[name] = component;
|
|
return app;
|
|
},
|
|
directive(name, directive) {
|
|
if ((true)) {
|
|
validateDirectiveName(name);
|
|
}
|
|
if (!directive) {
|
|
return context.directives[name];
|
|
}
|
|
if (( true) && context.directives[name]) {
|
|
warn(`Directive "${name}" has already been registered in target app.`);
|
|
}
|
|
context.directives[name] = directive;
|
|
return app;
|
|
},
|
|
mount(rootContainer, isHydrate, isSVG) {
|
|
if (!isMounted) {
|
|
const vnode = createVNode(rootComponent, rootProps);
|
|
// store app context on the root VNode.
|
|
// this will be set on the root instance on initial mount.
|
|
vnode.appContext = context;
|
|
// HMR root reload
|
|
if ((true)) {
|
|
context.reload = () => {
|
|
render(cloneVNode(vnode), rootContainer, isSVG);
|
|
};
|
|
}
|
|
if (isHydrate && hydrate) {
|
|
hydrate(vnode, rootContainer);
|
|
}
|
|
else {
|
|
render(vnode, rootContainer, isSVG);
|
|
}
|
|
isMounted = true;
|
|
app._container = rootContainer;
|
|
rootContainer.__vue_app__ = app;
|
|
if (true) {
|
|
app._instance = vnode.component;
|
|
devtoolsInitApp(app, version);
|
|
}
|
|
return vnode.component.proxy;
|
|
}
|
|
else if ((true)) {
|
|
warn(`App has already been mounted.\n` +
|
|
`If you want to remount the same app, move your app creation logic ` +
|
|
`into a factory function and create fresh app instances for each ` +
|
|
`mount - e.g. \`const createMyApp = () => createApp(App)\``);
|
|
}
|
|
},
|
|
unmount() {
|
|
if (isMounted) {
|
|
render(null, app._container);
|
|
if (true) {
|
|
app._instance = null;
|
|
devtoolsUnmountApp(app);
|
|
}
|
|
delete app._container.__vue_app__;
|
|
}
|
|
else if ((true)) {
|
|
warn(`Cannot unmount an app that is not mounted.`);
|
|
}
|
|
},
|
|
provide(key, value) {
|
|
if (( true) && key in context.provides) {
|
|
warn(`App already provides property with key "${String(key)}". ` +
|
|
`It will be overwritten with the new value.`);
|
|
}
|
|
// TypeScript doesn't allow symbols as index type
|
|
// https://github.com/Microsoft/TypeScript/issues/24587
|
|
context.provides[key] = value;
|
|
return app;
|
|
}
|
|
});
|
|
return app;
|
|
};
|
|
}
|
|
|
|
let hasMismatch = false;
|
|
const isSVGContainer = (container) => /svg/.test(container.namespaceURI) && container.tagName !== 'foreignObject';
|
|
const isComment = (node) => node.nodeType === 8 /* COMMENT */;
|
|
// Note: hydration is DOM-specific
|
|
// But we have to place it in core due to tight coupling with core - splitting
|
|
// it out creates a ton of unnecessary complexity.
|
|
// Hydration also depends on some renderer internal logic which needs to be
|
|
// passed in via arguments.
|
|
function createHydrationFunctions(rendererInternals) {
|
|
const { mt: mountComponent, p: patch, o: { patchProp, nextSibling, parentNode, remove, insert, createComment } } = rendererInternals;
|
|
const hydrate = (vnode, container) => {
|
|
if (!container.hasChildNodes()) {
|
|
( true) &&
|
|
warn(`Attempting to hydrate existing markup but container is empty. ` +
|
|
`Performing full mount instead.`);
|
|
patch(null, vnode, container);
|
|
flushPostFlushCbs();
|
|
return;
|
|
}
|
|
hasMismatch = false;
|
|
hydrateNode(container.firstChild, vnode, null, null, null);
|
|
flushPostFlushCbs();
|
|
if (hasMismatch && !false) {
|
|
// this error should show up in production
|
|
console.error(`Hydration completed but contains mismatches.`);
|
|
}
|
|
};
|
|
const hydrateNode = (node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized = false) => {
|
|
const isFragmentStart = isComment(node) && node.data === '[';
|
|
const onMismatch = () => handleMismatch(node, vnode, parentComponent, parentSuspense, slotScopeIds, isFragmentStart);
|
|
const { type, ref, shapeFlag } = vnode;
|
|
const domType = node.nodeType;
|
|
vnode.el = node;
|
|
let nextNode = null;
|
|
switch (type) {
|
|
case Text:
|
|
if (domType !== 3 /* TEXT */) {
|
|
nextNode = onMismatch();
|
|
}
|
|
else {
|
|
if (node.data !== vnode.children) {
|
|
hasMismatch = true;
|
|
( true) &&
|
|
warn(`Hydration text mismatch:` +
|
|
`\n- Client: ${JSON.stringify(node.data)}` +
|
|
`\n- Server: ${JSON.stringify(vnode.children)}`);
|
|
node.data = vnode.children;
|
|
}
|
|
nextNode = nextSibling(node);
|
|
}
|
|
break;
|
|
case Comment$1:
|
|
if (domType !== 8 /* COMMENT */ || isFragmentStart) {
|
|
nextNode = onMismatch();
|
|
}
|
|
else {
|
|
nextNode = nextSibling(node);
|
|
}
|
|
break;
|
|
case Static:
|
|
if (domType !== 1 /* ELEMENT */) {
|
|
nextNode = onMismatch();
|
|
}
|
|
else {
|
|
// determine anchor, adopt content
|
|
nextNode = node;
|
|
// if the static vnode has its content stripped during build,
|
|
// adopt it from the server-rendered HTML.
|
|
const needToAdoptContent = !vnode.children.length;
|
|
for (let i = 0; i < vnode.staticCount; i++) {
|
|
if (needToAdoptContent)
|
|
vnode.children += nextNode.outerHTML;
|
|
if (i === vnode.staticCount - 1) {
|
|
vnode.anchor = nextNode;
|
|
}
|
|
nextNode = nextSibling(nextNode);
|
|
}
|
|
return nextNode;
|
|
}
|
|
break;
|
|
case Fragment:
|
|
if (!isFragmentStart) {
|
|
nextNode = onMismatch();
|
|
}
|
|
else {
|
|
nextNode = hydrateFragment(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized);
|
|
}
|
|
break;
|
|
default:
|
|
if (shapeFlag & 1 /* ELEMENT */) {
|
|
if (domType !== 1 /* ELEMENT */ ||
|
|
vnode.type.toLowerCase() !==
|
|
node.tagName.toLowerCase()) {
|
|
nextNode = onMismatch();
|
|
}
|
|
else {
|
|
nextNode = hydrateElement(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized);
|
|
}
|
|
}
|
|
else if (shapeFlag & 6 /* COMPONENT */) {
|
|
// when setting up the render effect, if the initial vnode already
|
|
// has .el set, the component will perform hydration instead of mount
|
|
// on its sub-tree.
|
|
vnode.slotScopeIds = slotScopeIds;
|
|
const container = parentNode(node);
|
|
mountComponent(vnode, container, null, parentComponent, parentSuspense, isSVGContainer(container), optimized);
|
|
// component may be async, so in the case of fragments we cannot rely
|
|
// on component's rendered output to determine the end of the fragment
|
|
// instead, we do a lookahead to find the end anchor node.
|
|
nextNode = isFragmentStart
|
|
? locateClosingAsyncAnchor(node)
|
|
: nextSibling(node);
|
|
// #3787
|
|
// if component is async, it may get moved / unmounted before its
|
|
// inner component is loaded, so we need to give it a placeholder
|
|
// vnode that matches its adopted DOM.
|
|
if (isAsyncWrapper(vnode)) {
|
|
let subTree;
|
|
if (isFragmentStart) {
|
|
subTree = createVNode(Fragment);
|
|
subTree.anchor = nextNode
|
|
? nextNode.previousSibling
|
|
: container.lastChild;
|
|
}
|
|
else {
|
|
subTree =
|
|
node.nodeType === 3 ? createTextVNode('') : createVNode('div');
|
|
}
|
|
subTree.el = node;
|
|
vnode.component.subTree = subTree;
|
|
}
|
|
}
|
|
else if (shapeFlag & 64 /* TELEPORT */) {
|
|
if (domType !== 8 /* COMMENT */) {
|
|
nextNode = onMismatch();
|
|
}
|
|
else {
|
|
nextNode = vnode.type.hydrate(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized, rendererInternals, hydrateChildren);
|
|
}
|
|
}
|
|
else if (shapeFlag & 128 /* SUSPENSE */) {
|
|
nextNode = vnode.type.hydrate(node, vnode, parentComponent, parentSuspense, isSVGContainer(parentNode(node)), slotScopeIds, optimized, rendererInternals, hydrateNode);
|
|
}
|
|
else if ((true)) {
|
|
warn('Invalid HostVNode type:', type, `(${typeof type})`);
|
|
}
|
|
}
|
|
if (ref != null) {
|
|
setRef(ref, null, parentSuspense, vnode);
|
|
}
|
|
return nextNode;
|
|
};
|
|
const hydrateElement = (el, vnode, parentComponent, parentSuspense, slotScopeIds, optimized) => {
|
|
optimized = optimized || !!vnode.dynamicChildren;
|
|
const { type, props, patchFlag, shapeFlag, dirs } = vnode;
|
|
// #4006 for form elements with non-string v-model value bindings
|
|
// e.g. <option :value="obj">, <input type="checkbox" :true-value="1">
|
|
const forcePatchValue = (type === 'input' && dirs) || type === 'option';
|
|
// skip props & children if this is hoisted static nodes
|
|
if (forcePatchValue || patchFlag !== -1 /* HOISTED */) {
|
|
if (dirs) {
|
|
invokeDirectiveHook(vnode, null, parentComponent, 'created');
|
|
}
|
|
// props
|
|
if (props) {
|
|
if (forcePatchValue ||
|
|
!optimized ||
|
|
patchFlag & (16 /* FULL_PROPS */ | 32 /* HYDRATE_EVENTS */)) {
|
|
for (const key in props) {
|
|
if ((forcePatchValue && key.endsWith('value')) ||
|
|
((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isOn)(key) && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isReservedProp)(key))) {
|
|
patchProp(el, key, null, props[key]);
|
|
}
|
|
}
|
|
}
|
|
else if (props.onClick) {
|
|
// Fast path for click listeners (which is most often) to avoid
|
|
// iterating through props.
|
|
patchProp(el, 'onClick', null, props.onClick);
|
|
}
|
|
}
|
|
// vnode / directive hooks
|
|
let vnodeHooks;
|
|
if ((vnodeHooks = props && props.onVnodeBeforeMount)) {
|
|
invokeVNodeHook(vnodeHooks, parentComponent, vnode);
|
|
}
|
|
if (dirs) {
|
|
invokeDirectiveHook(vnode, null, parentComponent, 'beforeMount');
|
|
}
|
|
if ((vnodeHooks = props && props.onVnodeMounted) || dirs) {
|
|
queueEffectWithSuspense(() => {
|
|
vnodeHooks && invokeVNodeHook(vnodeHooks, parentComponent, vnode);
|
|
dirs && invokeDirectiveHook(vnode, null, parentComponent, 'mounted');
|
|
}, parentSuspense);
|
|
}
|
|
// children
|
|
if (shapeFlag & 16 /* ARRAY_CHILDREN */ &&
|
|
// skip if element has innerHTML / textContent
|
|
!(props && (props.innerHTML || props.textContent))) {
|
|
let next = hydrateChildren(el.firstChild, vnode, el, parentComponent, parentSuspense, slotScopeIds, optimized);
|
|
let hasWarned = false;
|
|
while (next) {
|
|
hasMismatch = true;
|
|
if (( true) && !hasWarned) {
|
|
warn(`Hydration children mismatch in <${vnode.type}>: ` +
|
|
`server rendered element contains more child nodes than client vdom.`);
|
|
hasWarned = true;
|
|
}
|
|
// The SSRed DOM contains more nodes than it should. Remove them.
|
|
const cur = next;
|
|
next = next.nextSibling;
|
|
remove(cur);
|
|
}
|
|
}
|
|
else if (shapeFlag & 8 /* TEXT_CHILDREN */) {
|
|
if (el.textContent !== vnode.children) {
|
|
hasMismatch = true;
|
|
( true) &&
|
|
warn(`Hydration text content mismatch in <${vnode.type}>:\n` +
|
|
`- Client: ${el.textContent}\n` +
|
|
`- Server: ${vnode.children}`);
|
|
el.textContent = vnode.children;
|
|
}
|
|
}
|
|
}
|
|
return el.nextSibling;
|
|
};
|
|
const hydrateChildren = (node, parentVNode, container, parentComponent, parentSuspense, slotScopeIds, optimized) => {
|
|
optimized = optimized || !!parentVNode.dynamicChildren;
|
|
const children = parentVNode.children;
|
|
const l = children.length;
|
|
let hasWarned = false;
|
|
for (let i = 0; i < l; i++) {
|
|
const vnode = optimized
|
|
? children[i]
|
|
: (children[i] = normalizeVNode(children[i]));
|
|
if (node) {
|
|
node = hydrateNode(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized);
|
|
}
|
|
else if (vnode.type === Text && !vnode.children) {
|
|
continue;
|
|
}
|
|
else {
|
|
hasMismatch = true;
|
|
if (( true) && !hasWarned) {
|
|
warn(`Hydration children mismatch in <${container.tagName.toLowerCase()}>: ` +
|
|
`server rendered element contains fewer child nodes than client vdom.`);
|
|
hasWarned = true;
|
|
}
|
|
// the SSRed DOM didn't contain enough nodes. Mount the missing ones.
|
|
patch(null, vnode, container, null, parentComponent, parentSuspense, isSVGContainer(container), slotScopeIds);
|
|
}
|
|
}
|
|
return node;
|
|
};
|
|
const hydrateFragment = (node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized) => {
|
|
const { slotScopeIds: fragmentSlotScopeIds } = vnode;
|
|
if (fragmentSlotScopeIds) {
|
|
slotScopeIds = slotScopeIds
|
|
? slotScopeIds.concat(fragmentSlotScopeIds)
|
|
: fragmentSlotScopeIds;
|
|
}
|
|
const container = parentNode(node);
|
|
const next = hydrateChildren(nextSibling(node), vnode, container, parentComponent, parentSuspense, slotScopeIds, optimized);
|
|
if (next && isComment(next) && next.data === ']') {
|
|
return nextSibling((vnode.anchor = next));
|
|
}
|
|
else {
|
|
// fragment didn't hydrate successfully, since we didn't get a end anchor
|
|
// back. This should have led to node/children mismatch warnings.
|
|
hasMismatch = true;
|
|
// since the anchor is missing, we need to create one and insert it
|
|
insert((vnode.anchor = createComment(`]`)), container, next);
|
|
return next;
|
|
}
|
|
};
|
|
const handleMismatch = (node, vnode, parentComponent, parentSuspense, slotScopeIds, isFragment) => {
|
|
hasMismatch = true;
|
|
( true) &&
|
|
warn(`Hydration node mismatch:\n- Client vnode:`, vnode.type, `\n- Server rendered DOM:`, node, node.nodeType === 3 /* TEXT */
|
|
? `(text)`
|
|
: isComment(node) && node.data === '['
|
|
? `(start of fragment)`
|
|
: ``);
|
|
vnode.el = null;
|
|
if (isFragment) {
|
|
// remove excessive fragment nodes
|
|
const end = locateClosingAsyncAnchor(node);
|
|
while (true) {
|
|
const next = nextSibling(node);
|
|
if (next && next !== end) {
|
|
remove(next);
|
|
}
|
|
else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
const next = nextSibling(node);
|
|
const container = parentNode(node);
|
|
remove(node);
|
|
patch(null, vnode, container, next, parentComponent, parentSuspense, isSVGContainer(container), slotScopeIds);
|
|
return next;
|
|
};
|
|
const locateClosingAsyncAnchor = (node) => {
|
|
let match = 0;
|
|
while (node) {
|
|
node = nextSibling(node);
|
|
if (node && isComment(node)) {
|
|
if (node.data === '[')
|
|
match++;
|
|
if (node.data === ']') {
|
|
if (match === 0) {
|
|
return nextSibling(node);
|
|
}
|
|
else {
|
|
match--;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return node;
|
|
};
|
|
return [hydrate, hydrateNode];
|
|
}
|
|
|
|
let supported;
|
|
let perf;
|
|
function startMeasure(instance, type) {
|
|
if (instance.appContext.config.performance && isSupported()) {
|
|
perf.mark(`vue-${type}-${instance.uid}`);
|
|
}
|
|
if (true) {
|
|
devtoolsPerfStart(instance, type, supported ? perf.now() : Date.now());
|
|
}
|
|
}
|
|
function endMeasure(instance, type) {
|
|
if (instance.appContext.config.performance && isSupported()) {
|
|
const startTag = `vue-${type}-${instance.uid}`;
|
|
const endTag = startTag + `:end`;
|
|
perf.mark(endTag);
|
|
perf.measure(`<${formatComponentName(instance, instance.type)}> ${type}`, startTag, endTag);
|
|
perf.clearMarks(startTag);
|
|
perf.clearMarks(endTag);
|
|
}
|
|
if (true) {
|
|
devtoolsPerfEnd(instance, type, supported ? perf.now() : Date.now());
|
|
}
|
|
}
|
|
function isSupported() {
|
|
if (supported !== undefined) {
|
|
return supported;
|
|
}
|
|
/* eslint-disable no-restricted-globals */
|
|
if (typeof window !== 'undefined' && window.performance) {
|
|
supported = true;
|
|
perf = window.performance;
|
|
}
|
|
else {
|
|
supported = false;
|
|
}
|
|
/* eslint-enable no-restricted-globals */
|
|
return supported;
|
|
}
|
|
|
|
/**
|
|
* This is only called in esm-bundler builds.
|
|
* It is called when a renderer is created, in `baseCreateRenderer` so that
|
|
* importing runtime-core is side-effects free.
|
|
*
|
|
* istanbul-ignore-next
|
|
*/
|
|
function initFeatureFlags() {
|
|
let needWarn = false;
|
|
if (typeof __VUE_OPTIONS_API__ !== 'boolean') {
|
|
needWarn = true;
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.getGlobalThis)().__VUE_OPTIONS_API__ = true;
|
|
}
|
|
if (typeof __VUE_PROD_DEVTOOLS__ !== 'boolean') {
|
|
needWarn = true;
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.getGlobalThis)().__VUE_PROD_DEVTOOLS__ = false;
|
|
}
|
|
if (( true) && needWarn) {
|
|
console.warn(`You are running the esm-bundler build of Vue. It is recommended to ` +
|
|
`configure your bundler to explicitly replace feature flag globals ` +
|
|
`with boolean literals to get proper tree-shaking in the final bundle. ` +
|
|
`See http://link.vuejs.org/feature-flags for more details.`);
|
|
}
|
|
}
|
|
|
|
const queuePostRenderEffect = queueEffectWithSuspense
|
|
;
|
|
/**
|
|
* The createRenderer function accepts two generic arguments:
|
|
* HostNode and HostElement, corresponding to Node and Element types in the
|
|
* host environment. For example, for runtime-dom, HostNode would be the DOM
|
|
* `Node` interface and HostElement would be the DOM `Element` interface.
|
|
*
|
|
* Custom renderers can pass in the platform specific types like this:
|
|
*
|
|
* ``` js
|
|
* const { render, createApp } = createRenderer<Node, Element>({
|
|
* patchProp,
|
|
* ...nodeOps
|
|
* })
|
|
* ```
|
|
*/
|
|
function createRenderer(options) {
|
|
return baseCreateRenderer(options);
|
|
}
|
|
// Separate API for creating hydration-enabled renderer.
|
|
// Hydration logic is only used when calling this function, making it
|
|
// tree-shakable.
|
|
function createHydrationRenderer(options) {
|
|
return baseCreateRenderer(options, createHydrationFunctions);
|
|
}
|
|
// implementation
|
|
function baseCreateRenderer(options, createHydrationFns) {
|
|
// compile-time feature flags check
|
|
{
|
|
initFeatureFlags();
|
|
}
|
|
if (true) {
|
|
const target = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.getGlobalThis)();
|
|
target.__VUE__ = true;
|
|
setDevtoolsHook(target.__VUE_DEVTOOLS_GLOBAL_HOOK__);
|
|
}
|
|
const { insert: hostInsert, remove: hostRemove, patchProp: hostPatchProp, createElement: hostCreateElement, createText: hostCreateText, createComment: hostCreateComment, setText: hostSetText, setElementText: hostSetElementText, parentNode: hostParentNode, nextSibling: hostNextSibling, setScopeId: hostSetScopeId = _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP, cloneNode: hostCloneNode, insertStaticContent: hostInsertStaticContent } = options;
|
|
// Note: functions inside this closure should use `const xxx = () => {}`
|
|
// style in order to prevent being inlined by minifiers.
|
|
const patch = (n1, n2, container, anchor = null, parentComponent = null, parentSuspense = null, isSVG = false, slotScopeIds = null, optimized = ( true) && isHmrUpdating ? false : !!n2.dynamicChildren) => {
|
|
if (n1 === n2) {
|
|
return;
|
|
}
|
|
// patching & not same type, unmount old tree
|
|
if (n1 && !isSameVNodeType(n1, n2)) {
|
|
anchor = getNextHostNode(n1);
|
|
unmount(n1, parentComponent, parentSuspense, true);
|
|
n1 = null;
|
|
}
|
|
if (n2.patchFlag === -2 /* BAIL */) {
|
|
optimized = false;
|
|
n2.dynamicChildren = null;
|
|
}
|
|
const { type, ref, shapeFlag } = n2;
|
|
switch (type) {
|
|
case Text:
|
|
processText(n1, n2, container, anchor);
|
|
break;
|
|
case Comment$1:
|
|
processCommentNode(n1, n2, container, anchor);
|
|
break;
|
|
case Static:
|
|
if (n1 == null) {
|
|
mountStaticNode(n2, container, anchor, isSVG);
|
|
}
|
|
else if ((true)) {
|
|
patchStaticNode(n1, n2, container, isSVG);
|
|
}
|
|
break;
|
|
case Fragment:
|
|
processFragment(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
break;
|
|
default:
|
|
if (shapeFlag & 1 /* ELEMENT */) {
|
|
processElement(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
else if (shapeFlag & 6 /* COMPONENT */) {
|
|
processComponent(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
else if (shapeFlag & 64 /* TELEPORT */) {
|
|
type.process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, internals);
|
|
}
|
|
else if (shapeFlag & 128 /* SUSPENSE */) {
|
|
type.process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, internals);
|
|
}
|
|
else if ((true)) {
|
|
warn('Invalid VNode type:', type, `(${typeof type})`);
|
|
}
|
|
}
|
|
// set ref
|
|
if (ref != null && parentComponent) {
|
|
setRef(ref, n1 && n1.ref, parentSuspense, n2 || n1, !n2);
|
|
}
|
|
};
|
|
const processText = (n1, n2, container, anchor) => {
|
|
if (n1 == null) {
|
|
hostInsert((n2.el = hostCreateText(n2.children)), container, anchor);
|
|
}
|
|
else {
|
|
const el = (n2.el = n1.el);
|
|
if (n2.children !== n1.children) {
|
|
hostSetText(el, n2.children);
|
|
}
|
|
}
|
|
};
|
|
const processCommentNode = (n1, n2, container, anchor) => {
|
|
if (n1 == null) {
|
|
hostInsert((n2.el = hostCreateComment(n2.children || '')), container, anchor);
|
|
}
|
|
else {
|
|
// there's no support for dynamic comments
|
|
n2.el = n1.el;
|
|
}
|
|
};
|
|
const mountStaticNode = (n2, container, anchor, isSVG) => {
|
|
[n2.el, n2.anchor] = hostInsertStaticContent(n2.children, container, anchor, isSVG);
|
|
};
|
|
/**
|
|
* Dev / HMR only
|
|
*/
|
|
const patchStaticNode = (n1, n2, container, isSVG) => {
|
|
// static nodes are only patched during dev for HMR
|
|
if (n2.children !== n1.children) {
|
|
const anchor = hostNextSibling(n1.anchor);
|
|
// remove existing
|
|
removeStaticNode(n1);
|
|
[n2.el, n2.anchor] = hostInsertStaticContent(n2.children, container, anchor, isSVG);
|
|
}
|
|
else {
|
|
n2.el = n1.el;
|
|
n2.anchor = n1.anchor;
|
|
}
|
|
};
|
|
const moveStaticNode = ({ el, anchor }, container, nextSibling) => {
|
|
let next;
|
|
while (el && el !== anchor) {
|
|
next = hostNextSibling(el);
|
|
hostInsert(el, container, nextSibling);
|
|
el = next;
|
|
}
|
|
hostInsert(anchor, container, nextSibling);
|
|
};
|
|
const removeStaticNode = ({ el, anchor }) => {
|
|
let next;
|
|
while (el && el !== anchor) {
|
|
next = hostNextSibling(el);
|
|
hostRemove(el);
|
|
el = next;
|
|
}
|
|
hostRemove(anchor);
|
|
};
|
|
const processElement = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
|
|
isSVG = isSVG || n2.type === 'svg';
|
|
if (n1 == null) {
|
|
mountElement(n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
else {
|
|
patchElement(n1, n2, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
};
|
|
const mountElement = (vnode, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
|
|
let el;
|
|
let vnodeHook;
|
|
const { type, props, shapeFlag, transition, patchFlag, dirs } = vnode;
|
|
if (false /* HOISTED */) {}
|
|
else {
|
|
el = vnode.el = hostCreateElement(vnode.type, isSVG, props && props.is, props);
|
|
// mount children first, since some props may rely on child content
|
|
// being already rendered, e.g. `<select value>`
|
|
if (shapeFlag & 8 /* TEXT_CHILDREN */) {
|
|
hostSetElementText(el, vnode.children);
|
|
}
|
|
else if (shapeFlag & 16 /* ARRAY_CHILDREN */) {
|
|
mountChildren(vnode.children, el, null, parentComponent, parentSuspense, isSVG && type !== 'foreignObject', slotScopeIds, optimized);
|
|
}
|
|
if (dirs) {
|
|
invokeDirectiveHook(vnode, null, parentComponent, 'created');
|
|
}
|
|
// props
|
|
if (props) {
|
|
for (const key in props) {
|
|
if (key !== 'value' && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isReservedProp)(key)) {
|
|
hostPatchProp(el, key, null, props[key], isSVG, vnode.children, parentComponent, parentSuspense, unmountChildren);
|
|
}
|
|
}
|
|
/**
|
|
* Special case for setting value on DOM elements:
|
|
* - it can be order-sensitive (e.g. should be set *after* min/max, #2325, #4024)
|
|
* - it needs to be forced (#1471)
|
|
* #2353 proposes adding another renderer option to configure this, but
|
|
* the properties affects are so finite it is worth special casing it
|
|
* here to reduce the complexity. (Special casing it also should not
|
|
* affect non-DOM renderers)
|
|
*/
|
|
if ('value' in props) {
|
|
hostPatchProp(el, 'value', null, props.value);
|
|
}
|
|
if ((vnodeHook = props.onVnodeBeforeMount)) {
|
|
invokeVNodeHook(vnodeHook, parentComponent, vnode);
|
|
}
|
|
}
|
|
// scopeId
|
|
setScopeId(el, vnode, vnode.scopeId, slotScopeIds, parentComponent);
|
|
}
|
|
if (true) {
|
|
Object.defineProperty(el, '__vnode', {
|
|
value: vnode,
|
|
enumerable: false
|
|
});
|
|
Object.defineProperty(el, '__vueParentComponent', {
|
|
value: parentComponent,
|
|
enumerable: false
|
|
});
|
|
}
|
|
if (dirs) {
|
|
invokeDirectiveHook(vnode, null, parentComponent, 'beforeMount');
|
|
}
|
|
// #1583 For inside suspense + suspense not resolved case, enter hook should call when suspense resolved
|
|
// #1689 For inside suspense + suspense resolved case, just call it
|
|
const needCallTransitionHooks = (!parentSuspense || (parentSuspense && !parentSuspense.pendingBranch)) &&
|
|
transition &&
|
|
!transition.persisted;
|
|
if (needCallTransitionHooks) {
|
|
transition.beforeEnter(el);
|
|
}
|
|
hostInsert(el, container, anchor);
|
|
if ((vnodeHook = props && props.onVnodeMounted) ||
|
|
needCallTransitionHooks ||
|
|
dirs) {
|
|
queuePostRenderEffect(() => {
|
|
vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, vnode);
|
|
needCallTransitionHooks && transition.enter(el);
|
|
dirs && invokeDirectiveHook(vnode, null, parentComponent, 'mounted');
|
|
}, parentSuspense);
|
|
}
|
|
};
|
|
const setScopeId = (el, vnode, scopeId, slotScopeIds, parentComponent) => {
|
|
if (scopeId) {
|
|
hostSetScopeId(el, scopeId);
|
|
}
|
|
if (slotScopeIds) {
|
|
for (let i = 0; i < slotScopeIds.length; i++) {
|
|
hostSetScopeId(el, slotScopeIds[i]);
|
|
}
|
|
}
|
|
if (parentComponent) {
|
|
let subTree = parentComponent.subTree;
|
|
if (( true) &&
|
|
subTree.patchFlag > 0 &&
|
|
subTree.patchFlag & 2048 /* DEV_ROOT_FRAGMENT */) {
|
|
subTree =
|
|
filterSingleRoot(subTree.children) || subTree;
|
|
}
|
|
if (vnode === subTree) {
|
|
const parentVNode = parentComponent.vnode;
|
|
setScopeId(el, parentVNode, parentVNode.scopeId, parentVNode.slotScopeIds, parentComponent.parent);
|
|
}
|
|
}
|
|
};
|
|
const mountChildren = (children, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, start = 0) => {
|
|
for (let i = start; i < children.length; i++) {
|
|
const child = (children[i] = optimized
|
|
? cloneIfMounted(children[i])
|
|
: normalizeVNode(children[i]));
|
|
patch(null, child, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
};
|
|
const patchElement = (n1, n2, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
|
|
const el = (n2.el = n1.el);
|
|
let { patchFlag, dynamicChildren, dirs } = n2;
|
|
// #1426 take the old vnode's patch flag into account since user may clone a
|
|
// compiler-generated vnode, which de-opts to FULL_PROPS
|
|
patchFlag |= n1.patchFlag & 16 /* FULL_PROPS */;
|
|
const oldProps = n1.props || _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ;
|
|
const newProps = n2.props || _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ;
|
|
let vnodeHook;
|
|
if ((vnodeHook = newProps.onVnodeBeforeUpdate)) {
|
|
invokeVNodeHook(vnodeHook, parentComponent, n2, n1);
|
|
}
|
|
if (dirs) {
|
|
invokeDirectiveHook(n2, n1, parentComponent, 'beforeUpdate');
|
|
}
|
|
if (( true) && isHmrUpdating) {
|
|
// HMR updated, force full diff
|
|
patchFlag = 0;
|
|
optimized = false;
|
|
dynamicChildren = null;
|
|
}
|
|
const areChildrenSVG = isSVG && n2.type !== 'foreignObject';
|
|
if (dynamicChildren) {
|
|
patchBlockChildren(n1.dynamicChildren, dynamicChildren, el, parentComponent, parentSuspense, areChildrenSVG, slotScopeIds);
|
|
if (( true) && parentComponent && parentComponent.type.__hmrId) {
|
|
traverseStaticChildren(n1, n2);
|
|
}
|
|
}
|
|
else if (!optimized) {
|
|
// full diff
|
|
patchChildren(n1, n2, el, null, parentComponent, parentSuspense, areChildrenSVG, slotScopeIds, false);
|
|
}
|
|
if (patchFlag > 0) {
|
|
// the presence of a patchFlag means this element's render code was
|
|
// generated by the compiler and can take the fast path.
|
|
// in this path old node and new node are guaranteed to have the same shape
|
|
// (i.e. at the exact same position in the source template)
|
|
if (patchFlag & 16 /* FULL_PROPS */) {
|
|
// element props contain dynamic keys, full diff needed
|
|
patchProps(el, n2, oldProps, newProps, parentComponent, parentSuspense, isSVG);
|
|
}
|
|
else {
|
|
// class
|
|
// this flag is matched when the element has dynamic class bindings.
|
|
if (patchFlag & 2 /* CLASS */) {
|
|
if (oldProps.class !== newProps.class) {
|
|
hostPatchProp(el, 'class', null, newProps.class, isSVG);
|
|
}
|
|
}
|
|
// style
|
|
// this flag is matched when the element has dynamic style bindings
|
|
if (patchFlag & 4 /* STYLE */) {
|
|
hostPatchProp(el, 'style', oldProps.style, newProps.style, isSVG);
|
|
}
|
|
// props
|
|
// This flag is matched when the element has dynamic prop/attr bindings
|
|
// other than class and style. The keys of dynamic prop/attrs are saved for
|
|
// faster iteration.
|
|
// Note dynamic keys like :[foo]="bar" will cause this optimization to
|
|
// bail out and go through a full diff because we need to unset the old key
|
|
if (patchFlag & 8 /* PROPS */) {
|
|
// if the flag is present then dynamicProps must be non-null
|
|
const propsToUpdate = n2.dynamicProps;
|
|
for (let i = 0; i < propsToUpdate.length; i++) {
|
|
const key = propsToUpdate[i];
|
|
const prev = oldProps[key];
|
|
const next = newProps[key];
|
|
// #1471 force patch value
|
|
if (next !== prev || key === 'value') {
|
|
hostPatchProp(el, key, prev, next, isSVG, n1.children, parentComponent, parentSuspense, unmountChildren);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
// text
|
|
// This flag is matched when the element has only dynamic text children.
|
|
if (patchFlag & 1 /* TEXT */) {
|
|
if (n1.children !== n2.children) {
|
|
hostSetElementText(el, n2.children);
|
|
}
|
|
}
|
|
}
|
|
else if (!optimized && dynamicChildren == null) {
|
|
// unoptimized, full diff
|
|
patchProps(el, n2, oldProps, newProps, parentComponent, parentSuspense, isSVG);
|
|
}
|
|
if ((vnodeHook = newProps.onVnodeUpdated) || dirs) {
|
|
queuePostRenderEffect(() => {
|
|
vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, n2, n1);
|
|
dirs && invokeDirectiveHook(n2, n1, parentComponent, 'updated');
|
|
}, parentSuspense);
|
|
}
|
|
};
|
|
// The fast path for blocks.
|
|
const patchBlockChildren = (oldChildren, newChildren, fallbackContainer, parentComponent, parentSuspense, isSVG, slotScopeIds) => {
|
|
for (let i = 0; i < newChildren.length; i++) {
|
|
const oldVNode = oldChildren[i];
|
|
const newVNode = newChildren[i];
|
|
// Determine the container (parent element) for the patch.
|
|
const container =
|
|
// oldVNode may be an errored async setup() component inside Suspense
|
|
// which will not have a mounted element
|
|
oldVNode.el &&
|
|
// - In the case of a Fragment, we need to provide the actual parent
|
|
// of the Fragment itself so it can move its children.
|
|
(oldVNode.type === Fragment ||
|
|
// - In the case of different nodes, there is going to be a replacement
|
|
// which also requires the correct parent container
|
|
!isSameVNodeType(oldVNode, newVNode) ||
|
|
// - In the case of a component, it could contain anything.
|
|
oldVNode.shapeFlag & (6 /* COMPONENT */ | 64 /* TELEPORT */))
|
|
? hostParentNode(oldVNode.el)
|
|
: // In other cases, the parent container is not actually used so we
|
|
// just pass the block element here to avoid a DOM parentNode call.
|
|
fallbackContainer;
|
|
patch(oldVNode, newVNode, container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, true);
|
|
}
|
|
};
|
|
const patchProps = (el, vnode, oldProps, newProps, parentComponent, parentSuspense, isSVG) => {
|
|
if (oldProps !== newProps) {
|
|
for (const key in newProps) {
|
|
// empty string is not valid prop
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isReservedProp)(key))
|
|
continue;
|
|
const next = newProps[key];
|
|
const prev = oldProps[key];
|
|
// defer patching value
|
|
if (next !== prev && key !== 'value') {
|
|
hostPatchProp(el, key, prev, next, isSVG, vnode.children, parentComponent, parentSuspense, unmountChildren);
|
|
}
|
|
}
|
|
if (oldProps !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ) {
|
|
for (const key in oldProps) {
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isReservedProp)(key) && !(key in newProps)) {
|
|
hostPatchProp(el, key, oldProps[key], null, isSVG, vnode.children, parentComponent, parentSuspense, unmountChildren);
|
|
}
|
|
}
|
|
}
|
|
if ('value' in newProps) {
|
|
hostPatchProp(el, 'value', oldProps.value, newProps.value);
|
|
}
|
|
}
|
|
};
|
|
const processFragment = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
|
|
const fragmentStartAnchor = (n2.el = n1 ? n1.el : hostCreateText(''));
|
|
const fragmentEndAnchor = (n2.anchor = n1 ? n1.anchor : hostCreateText(''));
|
|
let { patchFlag, dynamicChildren, slotScopeIds: fragmentSlotScopeIds } = n2;
|
|
if (( true) && isHmrUpdating) {
|
|
// HMR updated, force full diff
|
|
patchFlag = 0;
|
|
optimized = false;
|
|
dynamicChildren = null;
|
|
}
|
|
// check if this is a slot fragment with :slotted scope ids
|
|
if (fragmentSlotScopeIds) {
|
|
slotScopeIds = slotScopeIds
|
|
? slotScopeIds.concat(fragmentSlotScopeIds)
|
|
: fragmentSlotScopeIds;
|
|
}
|
|
if (n1 == null) {
|
|
hostInsert(fragmentStartAnchor, container, anchor);
|
|
hostInsert(fragmentEndAnchor, container, anchor);
|
|
// a fragment can only have array children
|
|
// since they are either generated by the compiler, or implicitly created
|
|
// from arrays.
|
|
mountChildren(n2.children, container, fragmentEndAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
else {
|
|
if (patchFlag > 0 &&
|
|
patchFlag & 64 /* STABLE_FRAGMENT */ &&
|
|
dynamicChildren &&
|
|
// #2715 the previous fragment could've been a BAILed one as a result
|
|
// of renderSlot() with no valid children
|
|
n1.dynamicChildren) {
|
|
// a stable fragment (template root or <template v-for>) doesn't need to
|
|
// patch children order, but it may contain dynamicChildren.
|
|
patchBlockChildren(n1.dynamicChildren, dynamicChildren, container, parentComponent, parentSuspense, isSVG, slotScopeIds);
|
|
if (( true) && parentComponent && parentComponent.type.__hmrId) {
|
|
traverseStaticChildren(n1, n2);
|
|
}
|
|
else if (
|
|
// #2080 if the stable fragment has a key, it's a <template v-for> that may
|
|
// get moved around. Make sure all root level vnodes inherit el.
|
|
// #2134 or if it's a component root, it may also get moved around
|
|
// as the component is being moved.
|
|
n2.key != null ||
|
|
(parentComponent && n2 === parentComponent.subTree)) {
|
|
traverseStaticChildren(n1, n2, true /* shallow */);
|
|
}
|
|
}
|
|
else {
|
|
// keyed / unkeyed, or manual fragments.
|
|
// for keyed & unkeyed, since they are compiler generated from v-for,
|
|
// each child is guaranteed to be a block so the fragment will never
|
|
// have dynamicChildren.
|
|
patchChildren(n1, n2, container, fragmentEndAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
}
|
|
};
|
|
const processComponent = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
|
|
n2.slotScopeIds = slotScopeIds;
|
|
if (n1 == null) {
|
|
if (n2.shapeFlag & 512 /* COMPONENT_KEPT_ALIVE */) {
|
|
parentComponent.ctx.activate(n2, container, anchor, isSVG, optimized);
|
|
}
|
|
else {
|
|
mountComponent(n2, container, anchor, parentComponent, parentSuspense, isSVG, optimized);
|
|
}
|
|
}
|
|
else {
|
|
updateComponent(n1, n2, optimized);
|
|
}
|
|
};
|
|
const mountComponent = (initialVNode, container, anchor, parentComponent, parentSuspense, isSVG, optimized) => {
|
|
const instance = (initialVNode.component = createComponentInstance(initialVNode, parentComponent, parentSuspense));
|
|
if (( true) && instance.type.__hmrId) {
|
|
registerHMR(instance);
|
|
}
|
|
if ((true)) {
|
|
pushWarningContext(initialVNode);
|
|
startMeasure(instance, `mount`);
|
|
}
|
|
// inject renderer internals for keepAlive
|
|
if (isKeepAlive(initialVNode)) {
|
|
instance.ctx.renderer = internals;
|
|
}
|
|
// resolve props and slots for setup context
|
|
{
|
|
if ((true)) {
|
|
startMeasure(instance, `init`);
|
|
}
|
|
setupComponent(instance);
|
|
if ((true)) {
|
|
endMeasure(instance, `init`);
|
|
}
|
|
}
|
|
// setup() is async. This component relies on async logic to be resolved
|
|
// before proceeding
|
|
if (instance.asyncDep) {
|
|
parentSuspense && parentSuspense.registerDep(instance, setupRenderEffect);
|
|
// Give it a placeholder if this is not hydration
|
|
// TODO handle self-defined fallback
|
|
if (!initialVNode.el) {
|
|
const placeholder = (instance.subTree = createVNode(Comment$1));
|
|
processCommentNode(null, placeholder, container, anchor);
|
|
}
|
|
return;
|
|
}
|
|
setupRenderEffect(instance, initialVNode, container, anchor, parentSuspense, isSVG, optimized);
|
|
if ((true)) {
|
|
popWarningContext();
|
|
endMeasure(instance, `mount`);
|
|
}
|
|
};
|
|
const updateComponent = (n1, n2, optimized) => {
|
|
const instance = (n2.component = n1.component);
|
|
if (shouldUpdateComponent(n1, n2, optimized)) {
|
|
if (instance.asyncDep &&
|
|
!instance.asyncResolved) {
|
|
// async & still pending - just update props and slots
|
|
// since the component's reactive effect for render isn't set-up yet
|
|
if ((true)) {
|
|
pushWarningContext(n2);
|
|
}
|
|
updateComponentPreRender(instance, n2, optimized);
|
|
if ((true)) {
|
|
popWarningContext();
|
|
}
|
|
return;
|
|
}
|
|
else {
|
|
// normal update
|
|
instance.next = n2;
|
|
// in case the child component is also queued, remove it to avoid
|
|
// double updating the same child component in the same flush.
|
|
invalidateJob(instance.update);
|
|
// instance.update is the reactive effect.
|
|
instance.update();
|
|
}
|
|
}
|
|
else {
|
|
// no update needed. just copy over properties
|
|
n2.component = n1.component;
|
|
n2.el = n1.el;
|
|
instance.vnode = n2;
|
|
}
|
|
};
|
|
const setupRenderEffect = (instance, initialVNode, container, anchor, parentSuspense, isSVG, optimized) => {
|
|
const componentUpdateFn = () => {
|
|
if (!instance.isMounted) {
|
|
let vnodeHook;
|
|
const { el, props } = initialVNode;
|
|
const { bm, m, parent } = instance;
|
|
const isAsyncWrapperVNode = isAsyncWrapper(initialVNode);
|
|
effect.allowRecurse = false;
|
|
// beforeMount hook
|
|
if (bm) {
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.invokeArrayFns)(bm);
|
|
}
|
|
// onVnodeBeforeMount
|
|
if (!isAsyncWrapperVNode &&
|
|
(vnodeHook = props && props.onVnodeBeforeMount)) {
|
|
invokeVNodeHook(vnodeHook, parent, initialVNode);
|
|
}
|
|
effect.allowRecurse = true;
|
|
if (el && hydrateNode) {
|
|
// vnode has adopted host node - perform hydration instead of mount.
|
|
const hydrateSubTree = () => {
|
|
if ((true)) {
|
|
startMeasure(instance, `render`);
|
|
}
|
|
instance.subTree = renderComponentRoot(instance);
|
|
if ((true)) {
|
|
endMeasure(instance, `render`);
|
|
}
|
|
if ((true)) {
|
|
startMeasure(instance, `hydrate`);
|
|
}
|
|
hydrateNode(el, instance.subTree, instance, parentSuspense, null);
|
|
if ((true)) {
|
|
endMeasure(instance, `hydrate`);
|
|
}
|
|
};
|
|
if (isAsyncWrapperVNode) {
|
|
initialVNode.type.__asyncLoader().then(
|
|
// note: we are moving the render call into an async callback,
|
|
// which means it won't track dependencies - but it's ok because
|
|
// a server-rendered async wrapper is already in resolved state
|
|
// and it will never need to change.
|
|
() => !instance.isUnmounted && hydrateSubTree());
|
|
}
|
|
else {
|
|
hydrateSubTree();
|
|
}
|
|
}
|
|
else {
|
|
if ((true)) {
|
|
startMeasure(instance, `render`);
|
|
}
|
|
const subTree = (instance.subTree = renderComponentRoot(instance));
|
|
if ((true)) {
|
|
endMeasure(instance, `render`);
|
|
}
|
|
if ((true)) {
|
|
startMeasure(instance, `patch`);
|
|
}
|
|
patch(null, subTree, container, anchor, instance, parentSuspense, isSVG);
|
|
if ((true)) {
|
|
endMeasure(instance, `patch`);
|
|
}
|
|
initialVNode.el = subTree.el;
|
|
}
|
|
// mounted hook
|
|
if (m) {
|
|
queuePostRenderEffect(m, parentSuspense);
|
|
}
|
|
// onVnodeMounted
|
|
if (!isAsyncWrapperVNode &&
|
|
(vnodeHook = props && props.onVnodeMounted)) {
|
|
const scopedInitialVNode = initialVNode;
|
|
queuePostRenderEffect(() => invokeVNodeHook(vnodeHook, parent, scopedInitialVNode), parentSuspense);
|
|
}
|
|
// activated hook for keep-alive roots.
|
|
// #1742 activated hook must be accessed after first render
|
|
// since the hook may be injected by a child keep-alive
|
|
if (initialVNode.shapeFlag & 256 /* COMPONENT_SHOULD_KEEP_ALIVE */) {
|
|
instance.a && queuePostRenderEffect(instance.a, parentSuspense);
|
|
}
|
|
instance.isMounted = true;
|
|
if (true) {
|
|
devtoolsComponentAdded(instance);
|
|
}
|
|
// #2458: deference mount-only object parameters to prevent memleaks
|
|
initialVNode = container = anchor = null;
|
|
}
|
|
else {
|
|
// updateComponent
|
|
// This is triggered by mutation of component's own state (next: null)
|
|
// OR parent calling processComponent (next: VNode)
|
|
let { next, bu, u, parent, vnode } = instance;
|
|
let originNext = next;
|
|
let vnodeHook;
|
|
if ((true)) {
|
|
pushWarningContext(next || instance.vnode);
|
|
}
|
|
// Disallow component effect recursion during pre-lifecycle hooks.
|
|
effect.allowRecurse = false;
|
|
if (next) {
|
|
next.el = vnode.el;
|
|
updateComponentPreRender(instance, next, optimized);
|
|
}
|
|
else {
|
|
next = vnode;
|
|
}
|
|
// beforeUpdate hook
|
|
if (bu) {
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.invokeArrayFns)(bu);
|
|
}
|
|
// onVnodeBeforeUpdate
|
|
if ((vnodeHook = next.props && next.props.onVnodeBeforeUpdate)) {
|
|
invokeVNodeHook(vnodeHook, parent, next, vnode);
|
|
}
|
|
effect.allowRecurse = true;
|
|
// render
|
|
if ((true)) {
|
|
startMeasure(instance, `render`);
|
|
}
|
|
const nextTree = renderComponentRoot(instance);
|
|
if ((true)) {
|
|
endMeasure(instance, `render`);
|
|
}
|
|
const prevTree = instance.subTree;
|
|
instance.subTree = nextTree;
|
|
if ((true)) {
|
|
startMeasure(instance, `patch`);
|
|
}
|
|
patch(prevTree, nextTree,
|
|
// parent may have changed if it's in a teleport
|
|
hostParentNode(prevTree.el),
|
|
// anchor may have changed if it's in a fragment
|
|
getNextHostNode(prevTree), instance, parentSuspense, isSVG);
|
|
if ((true)) {
|
|
endMeasure(instance, `patch`);
|
|
}
|
|
next.el = nextTree.el;
|
|
if (originNext === null) {
|
|
// self-triggered update. In case of HOC, update parent component
|
|
// vnode el. HOC is indicated by parent instance's subTree pointing
|
|
// to child component's vnode
|
|
updateHOCHostEl(instance, nextTree.el);
|
|
}
|
|
// updated hook
|
|
if (u) {
|
|
queuePostRenderEffect(u, parentSuspense);
|
|
}
|
|
// onVnodeUpdated
|
|
if ((vnodeHook = next.props && next.props.onVnodeUpdated)) {
|
|
queuePostRenderEffect(() => invokeVNodeHook(vnodeHook, parent, next, vnode), parentSuspense);
|
|
}
|
|
if (true) {
|
|
devtoolsComponentUpdated(instance);
|
|
}
|
|
if ((true)) {
|
|
popWarningContext();
|
|
}
|
|
}
|
|
};
|
|
// create reactive effect for rendering
|
|
const effect = new _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.ReactiveEffect(componentUpdateFn, () => queueJob(instance.update), instance.scope // track it in component's effect scope
|
|
);
|
|
const update = (instance.update = effect.run.bind(effect));
|
|
update.id = instance.uid;
|
|
// allowRecurse
|
|
// #1801, #2043 component render effects should allow recursive updates
|
|
effect.allowRecurse = update.allowRecurse = true;
|
|
if ((true)) {
|
|
effect.onTrack = instance.rtc
|
|
? e => (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.invokeArrayFns)(instance.rtc, e)
|
|
: void 0;
|
|
effect.onTrigger = instance.rtg
|
|
? e => (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.invokeArrayFns)(instance.rtg, e)
|
|
: void 0;
|
|
// @ts-ignore (for scheduler)
|
|
update.ownerInstance = instance;
|
|
}
|
|
update();
|
|
};
|
|
const updateComponentPreRender = (instance, nextVNode, optimized) => {
|
|
nextVNode.component = instance;
|
|
const prevProps = instance.vnode.props;
|
|
instance.vnode = nextVNode;
|
|
instance.next = null;
|
|
updateProps(instance, nextVNode.props, prevProps, optimized);
|
|
updateSlots(instance, nextVNode.children, optimized);
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.pauseTracking)();
|
|
// props update may have triggered pre-flush watchers.
|
|
// flush them before the render update.
|
|
flushPreFlushCbs(undefined, instance.update);
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.resetTracking)();
|
|
};
|
|
const patchChildren = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized = false) => {
|
|
const c1 = n1 && n1.children;
|
|
const prevShapeFlag = n1 ? n1.shapeFlag : 0;
|
|
const c2 = n2.children;
|
|
const { patchFlag, shapeFlag } = n2;
|
|
// fast path
|
|
if (patchFlag > 0) {
|
|
if (patchFlag & 128 /* KEYED_FRAGMENT */) {
|
|
// this could be either fully-keyed or mixed (some keyed some not)
|
|
// presence of patchFlag means children are guaranteed to be arrays
|
|
patchKeyedChildren(c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
return;
|
|
}
|
|
else if (patchFlag & 256 /* UNKEYED_FRAGMENT */) {
|
|
// unkeyed
|
|
patchUnkeyedChildren(c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
return;
|
|
}
|
|
}
|
|
// children has 3 possibilities: text, array or no children.
|
|
if (shapeFlag & 8 /* TEXT_CHILDREN */) {
|
|
// text children fast path
|
|
if (prevShapeFlag & 16 /* ARRAY_CHILDREN */) {
|
|
unmountChildren(c1, parentComponent, parentSuspense);
|
|
}
|
|
if (c2 !== c1) {
|
|
hostSetElementText(container, c2);
|
|
}
|
|
}
|
|
else {
|
|
if (prevShapeFlag & 16 /* ARRAY_CHILDREN */) {
|
|
// prev children was array
|
|
if (shapeFlag & 16 /* ARRAY_CHILDREN */) {
|
|
// two arrays, cannot assume anything, do full diff
|
|
patchKeyedChildren(c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
else {
|
|
// no new children, just unmount old
|
|
unmountChildren(c1, parentComponent, parentSuspense, true);
|
|
}
|
|
}
|
|
else {
|
|
// prev children was text OR null
|
|
// new children is array OR null
|
|
if (prevShapeFlag & 8 /* TEXT_CHILDREN */) {
|
|
hostSetElementText(container, '');
|
|
}
|
|
// mount new if array
|
|
if (shapeFlag & 16 /* ARRAY_CHILDREN */) {
|
|
mountChildren(c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
}
|
|
}
|
|
};
|
|
const patchUnkeyedChildren = (c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
|
|
c1 = c1 || _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_ARR;
|
|
c2 = c2 || _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_ARR;
|
|
const oldLength = c1.length;
|
|
const newLength = c2.length;
|
|
const commonLength = Math.min(oldLength, newLength);
|
|
let i;
|
|
for (i = 0; i < commonLength; i++) {
|
|
const nextChild = (c2[i] = optimized
|
|
? cloneIfMounted(c2[i])
|
|
: normalizeVNode(c2[i]));
|
|
patch(c1[i], nextChild, container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
if (oldLength > newLength) {
|
|
// remove old
|
|
unmountChildren(c1, parentComponent, parentSuspense, true, false, commonLength);
|
|
}
|
|
else {
|
|
// mount new
|
|
mountChildren(c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, commonLength);
|
|
}
|
|
};
|
|
// can be all-keyed or mixed
|
|
const patchKeyedChildren = (c1, c2, container, parentAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
|
|
let i = 0;
|
|
const l2 = c2.length;
|
|
let e1 = c1.length - 1; // prev ending index
|
|
let e2 = l2 - 1; // next ending index
|
|
// 1. sync from start
|
|
// (a b) c
|
|
// (a b) d e
|
|
while (i <= e1 && i <= e2) {
|
|
const n1 = c1[i];
|
|
const n2 = (c2[i] = optimized
|
|
? cloneIfMounted(c2[i])
|
|
: normalizeVNode(c2[i]));
|
|
if (isSameVNodeType(n1, n2)) {
|
|
patch(n1, n2, container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
else {
|
|
break;
|
|
}
|
|
i++;
|
|
}
|
|
// 2. sync from end
|
|
// a (b c)
|
|
// d e (b c)
|
|
while (i <= e1 && i <= e2) {
|
|
const n1 = c1[e1];
|
|
const n2 = (c2[e2] = optimized
|
|
? cloneIfMounted(c2[e2])
|
|
: normalizeVNode(c2[e2]));
|
|
if (isSameVNodeType(n1, n2)) {
|
|
patch(n1, n2, container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
else {
|
|
break;
|
|
}
|
|
e1--;
|
|
e2--;
|
|
}
|
|
// 3. common sequence + mount
|
|
// (a b)
|
|
// (a b) c
|
|
// i = 2, e1 = 1, e2 = 2
|
|
// (a b)
|
|
// c (a b)
|
|
// i = 0, e1 = -1, e2 = 0
|
|
if (i > e1) {
|
|
if (i <= e2) {
|
|
const nextPos = e2 + 1;
|
|
const anchor = nextPos < l2 ? c2[nextPos].el : parentAnchor;
|
|
while (i <= e2) {
|
|
patch(null, (c2[i] = optimized
|
|
? cloneIfMounted(c2[i])
|
|
: normalizeVNode(c2[i])), container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
i++;
|
|
}
|
|
}
|
|
}
|
|
// 4. common sequence + unmount
|
|
// (a b) c
|
|
// (a b)
|
|
// i = 2, e1 = 2, e2 = 1
|
|
// a (b c)
|
|
// (b c)
|
|
// i = 0, e1 = 0, e2 = -1
|
|
else if (i > e2) {
|
|
while (i <= e1) {
|
|
unmount(c1[i], parentComponent, parentSuspense, true);
|
|
i++;
|
|
}
|
|
}
|
|
// 5. unknown sequence
|
|
// [i ... e1 + 1]: a b [c d e] f g
|
|
// [i ... e2 + 1]: a b [e d c h] f g
|
|
// i = 2, e1 = 4, e2 = 5
|
|
else {
|
|
const s1 = i; // prev starting index
|
|
const s2 = i; // next starting index
|
|
// 5.1 build key:index map for newChildren
|
|
const keyToNewIndexMap = new Map();
|
|
for (i = s2; i <= e2; i++) {
|
|
const nextChild = (c2[i] = optimized
|
|
? cloneIfMounted(c2[i])
|
|
: normalizeVNode(c2[i]));
|
|
if (nextChild.key != null) {
|
|
if (( true) && keyToNewIndexMap.has(nextChild.key)) {
|
|
warn(`Duplicate keys found during update:`, JSON.stringify(nextChild.key), `Make sure keys are unique.`);
|
|
}
|
|
keyToNewIndexMap.set(nextChild.key, i);
|
|
}
|
|
}
|
|
// 5.2 loop through old children left to be patched and try to patch
|
|
// matching nodes & remove nodes that are no longer present
|
|
let j;
|
|
let patched = 0;
|
|
const toBePatched = e2 - s2 + 1;
|
|
let moved = false;
|
|
// used to track whether any node has moved
|
|
let maxNewIndexSoFar = 0;
|
|
// works as Map<newIndex, oldIndex>
|
|
// Note that oldIndex is offset by +1
|
|
// and oldIndex = 0 is a special value indicating the new node has
|
|
// no corresponding old node.
|
|
// used for determining longest stable subsequence
|
|
const newIndexToOldIndexMap = new Array(toBePatched);
|
|
for (i = 0; i < toBePatched; i++)
|
|
newIndexToOldIndexMap[i] = 0;
|
|
for (i = s1; i <= e1; i++) {
|
|
const prevChild = c1[i];
|
|
if (patched >= toBePatched) {
|
|
// all new children have been patched so this can only be a removal
|
|
unmount(prevChild, parentComponent, parentSuspense, true);
|
|
continue;
|
|
}
|
|
let newIndex;
|
|
if (prevChild.key != null) {
|
|
newIndex = keyToNewIndexMap.get(prevChild.key);
|
|
}
|
|
else {
|
|
// key-less node, try to locate a key-less node of the same type
|
|
for (j = s2; j <= e2; j++) {
|
|
if (newIndexToOldIndexMap[j - s2] === 0 &&
|
|
isSameVNodeType(prevChild, c2[j])) {
|
|
newIndex = j;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
if (newIndex === undefined) {
|
|
unmount(prevChild, parentComponent, parentSuspense, true);
|
|
}
|
|
else {
|
|
newIndexToOldIndexMap[newIndex - s2] = i + 1;
|
|
if (newIndex >= maxNewIndexSoFar) {
|
|
maxNewIndexSoFar = newIndex;
|
|
}
|
|
else {
|
|
moved = true;
|
|
}
|
|
patch(prevChild, c2[newIndex], container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
patched++;
|
|
}
|
|
}
|
|
// 5.3 move and mount
|
|
// generate longest stable subsequence only when nodes have moved
|
|
const increasingNewIndexSequence = moved
|
|
? getSequence(newIndexToOldIndexMap)
|
|
: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_ARR;
|
|
j = increasingNewIndexSequence.length - 1;
|
|
// looping backwards so that we can use last patched node as anchor
|
|
for (i = toBePatched - 1; i >= 0; i--) {
|
|
const nextIndex = s2 + i;
|
|
const nextChild = c2[nextIndex];
|
|
const anchor = nextIndex + 1 < l2 ? c2[nextIndex + 1].el : parentAnchor;
|
|
if (newIndexToOldIndexMap[i] === 0) {
|
|
// mount new
|
|
patch(null, nextChild, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
else if (moved) {
|
|
// move if:
|
|
// There is no stable subsequence (e.g. a reverse)
|
|
// OR current node is not among the stable sequence
|
|
if (j < 0 || i !== increasingNewIndexSequence[j]) {
|
|
move(nextChild, container, anchor, 2 /* REORDER */);
|
|
}
|
|
else {
|
|
j--;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
};
|
|
const move = (vnode, container, anchor, moveType, parentSuspense = null) => {
|
|
const { el, type, transition, children, shapeFlag } = vnode;
|
|
if (shapeFlag & 6 /* COMPONENT */) {
|
|
move(vnode.component.subTree, container, anchor, moveType);
|
|
return;
|
|
}
|
|
if (shapeFlag & 128 /* SUSPENSE */) {
|
|
vnode.suspense.move(container, anchor, moveType);
|
|
return;
|
|
}
|
|
if (shapeFlag & 64 /* TELEPORT */) {
|
|
type.move(vnode, container, anchor, internals);
|
|
return;
|
|
}
|
|
if (type === Fragment) {
|
|
hostInsert(el, container, anchor);
|
|
for (let i = 0; i < children.length; i++) {
|
|
move(children[i], container, anchor, moveType);
|
|
}
|
|
hostInsert(vnode.anchor, container, anchor);
|
|
return;
|
|
}
|
|
if (type === Static) {
|
|
moveStaticNode(vnode, container, anchor);
|
|
return;
|
|
}
|
|
// single nodes
|
|
const needTransition = moveType !== 2 /* REORDER */ &&
|
|
shapeFlag & 1 /* ELEMENT */ &&
|
|
transition;
|
|
if (needTransition) {
|
|
if (moveType === 0 /* ENTER */) {
|
|
transition.beforeEnter(el);
|
|
hostInsert(el, container, anchor);
|
|
queuePostRenderEffect(() => transition.enter(el), parentSuspense);
|
|
}
|
|
else {
|
|
const { leave, delayLeave, afterLeave } = transition;
|
|
const remove = () => hostInsert(el, container, anchor);
|
|
const performLeave = () => {
|
|
leave(el, () => {
|
|
remove();
|
|
afterLeave && afterLeave();
|
|
});
|
|
};
|
|
if (delayLeave) {
|
|
delayLeave(el, remove, performLeave);
|
|
}
|
|
else {
|
|
performLeave();
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
hostInsert(el, container, anchor);
|
|
}
|
|
};
|
|
const unmount = (vnode, parentComponent, parentSuspense, doRemove = false, optimized = false) => {
|
|
const { type, props, ref, children, dynamicChildren, shapeFlag, patchFlag, dirs } = vnode;
|
|
// unset ref
|
|
if (ref != null) {
|
|
setRef(ref, null, parentSuspense, vnode, true);
|
|
}
|
|
if (shapeFlag & 256 /* COMPONENT_SHOULD_KEEP_ALIVE */) {
|
|
parentComponent.ctx.deactivate(vnode);
|
|
return;
|
|
}
|
|
const shouldInvokeDirs = shapeFlag & 1 /* ELEMENT */ && dirs;
|
|
const shouldInvokeVnodeHook = !isAsyncWrapper(vnode);
|
|
let vnodeHook;
|
|
if (shouldInvokeVnodeHook &&
|
|
(vnodeHook = props && props.onVnodeBeforeUnmount)) {
|
|
invokeVNodeHook(vnodeHook, parentComponent, vnode);
|
|
}
|
|
if (shapeFlag & 6 /* COMPONENT */) {
|
|
unmountComponent(vnode.component, parentSuspense, doRemove);
|
|
}
|
|
else {
|
|
if (shapeFlag & 128 /* SUSPENSE */) {
|
|
vnode.suspense.unmount(parentSuspense, doRemove);
|
|
return;
|
|
}
|
|
if (shouldInvokeDirs) {
|
|
invokeDirectiveHook(vnode, null, parentComponent, 'beforeUnmount');
|
|
}
|
|
if (shapeFlag & 64 /* TELEPORT */) {
|
|
vnode.type.remove(vnode, parentComponent, parentSuspense, optimized, internals, doRemove);
|
|
}
|
|
else if (dynamicChildren &&
|
|
// #1153: fast path should not be taken for non-stable (v-for) fragments
|
|
(type !== Fragment ||
|
|
(patchFlag > 0 && patchFlag & 64 /* STABLE_FRAGMENT */))) {
|
|
// fast path for block nodes: only need to unmount dynamic children.
|
|
unmountChildren(dynamicChildren, parentComponent, parentSuspense, false, true);
|
|
}
|
|
else if ((type === Fragment &&
|
|
patchFlag &
|
|
(128 /* KEYED_FRAGMENT */ | 256 /* UNKEYED_FRAGMENT */)) ||
|
|
(!optimized && shapeFlag & 16 /* ARRAY_CHILDREN */)) {
|
|
unmountChildren(children, parentComponent, parentSuspense);
|
|
}
|
|
if (doRemove) {
|
|
remove(vnode);
|
|
}
|
|
}
|
|
if ((shouldInvokeVnodeHook &&
|
|
(vnodeHook = props && props.onVnodeUnmounted)) ||
|
|
shouldInvokeDirs) {
|
|
queuePostRenderEffect(() => {
|
|
vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, vnode);
|
|
shouldInvokeDirs &&
|
|
invokeDirectiveHook(vnode, null, parentComponent, 'unmounted');
|
|
}, parentSuspense);
|
|
}
|
|
};
|
|
const remove = vnode => {
|
|
const { type, el, anchor, transition } = vnode;
|
|
if (type === Fragment) {
|
|
removeFragment(el, anchor);
|
|
return;
|
|
}
|
|
if (type === Static) {
|
|
removeStaticNode(vnode);
|
|
return;
|
|
}
|
|
const performRemove = () => {
|
|
hostRemove(el);
|
|
if (transition && !transition.persisted && transition.afterLeave) {
|
|
transition.afterLeave();
|
|
}
|
|
};
|
|
if (vnode.shapeFlag & 1 /* ELEMENT */ &&
|
|
transition &&
|
|
!transition.persisted) {
|
|
const { leave, delayLeave } = transition;
|
|
const performLeave = () => leave(el, performRemove);
|
|
if (delayLeave) {
|
|
delayLeave(vnode.el, performRemove, performLeave);
|
|
}
|
|
else {
|
|
performLeave();
|
|
}
|
|
}
|
|
else {
|
|
performRemove();
|
|
}
|
|
};
|
|
const removeFragment = (cur, end) => {
|
|
// For fragments, directly remove all contained DOM nodes.
|
|
// (fragment child nodes cannot have transition)
|
|
let next;
|
|
while (cur !== end) {
|
|
next = hostNextSibling(cur);
|
|
hostRemove(cur);
|
|
cur = next;
|
|
}
|
|
hostRemove(end);
|
|
};
|
|
const unmountComponent = (instance, parentSuspense, doRemove) => {
|
|
if (( true) && instance.type.__hmrId) {
|
|
unregisterHMR(instance);
|
|
}
|
|
const { bum, scope, update, subTree, um } = instance;
|
|
// beforeUnmount hook
|
|
if (bum) {
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.invokeArrayFns)(bum);
|
|
}
|
|
// stop effects in component scope
|
|
scope.stop();
|
|
// update may be null if a component is unmounted before its async
|
|
// setup has resolved.
|
|
if (update) {
|
|
// so that scheduler will no longer invoke it
|
|
update.active = false;
|
|
unmount(subTree, instance, parentSuspense, doRemove);
|
|
}
|
|
// unmounted hook
|
|
if (um) {
|
|
queuePostRenderEffect(um, parentSuspense);
|
|
}
|
|
queuePostRenderEffect(() => {
|
|
instance.isUnmounted = true;
|
|
}, parentSuspense);
|
|
// A component with async dep inside a pending suspense is unmounted before
|
|
// its async dep resolves. This should remove the dep from the suspense, and
|
|
// cause the suspense to resolve immediately if that was the last dep.
|
|
if (parentSuspense &&
|
|
parentSuspense.pendingBranch &&
|
|
!parentSuspense.isUnmounted &&
|
|
instance.asyncDep &&
|
|
!instance.asyncResolved &&
|
|
instance.suspenseId === parentSuspense.pendingId) {
|
|
parentSuspense.deps--;
|
|
if (parentSuspense.deps === 0) {
|
|
parentSuspense.resolve();
|
|
}
|
|
}
|
|
if (true) {
|
|
devtoolsComponentRemoved(instance);
|
|
}
|
|
};
|
|
const unmountChildren = (children, parentComponent, parentSuspense, doRemove = false, optimized = false, start = 0) => {
|
|
for (let i = start; i < children.length; i++) {
|
|
unmount(children[i], parentComponent, parentSuspense, doRemove, optimized);
|
|
}
|
|
};
|
|
const getNextHostNode = vnode => {
|
|
if (vnode.shapeFlag & 6 /* COMPONENT */) {
|
|
return getNextHostNode(vnode.component.subTree);
|
|
}
|
|
if (vnode.shapeFlag & 128 /* SUSPENSE */) {
|
|
return vnode.suspense.next();
|
|
}
|
|
return hostNextSibling((vnode.anchor || vnode.el));
|
|
};
|
|
const render = (vnode, container, isSVG) => {
|
|
if (vnode == null) {
|
|
if (container._vnode) {
|
|
unmount(container._vnode, null, null, true);
|
|
}
|
|
}
|
|
else {
|
|
patch(container._vnode || null, vnode, container, null, null, null, isSVG);
|
|
}
|
|
flushPostFlushCbs();
|
|
container._vnode = vnode;
|
|
};
|
|
const internals = {
|
|
p: patch,
|
|
um: unmount,
|
|
m: move,
|
|
r: remove,
|
|
mt: mountComponent,
|
|
mc: mountChildren,
|
|
pc: patchChildren,
|
|
pbc: patchBlockChildren,
|
|
n: getNextHostNode,
|
|
o: options
|
|
};
|
|
let hydrate;
|
|
let hydrateNode;
|
|
if (createHydrationFns) {
|
|
[hydrate, hydrateNode] = createHydrationFns(internals);
|
|
}
|
|
return {
|
|
render,
|
|
hydrate,
|
|
createApp: createAppAPI(render, hydrate)
|
|
};
|
|
}
|
|
function setRef(rawRef, oldRawRef, parentSuspense, vnode, isUnmount = false) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(rawRef)) {
|
|
rawRef.forEach((r, i) => setRef(r, oldRawRef && ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(oldRawRef) ? oldRawRef[i] : oldRawRef), parentSuspense, vnode, isUnmount));
|
|
return;
|
|
}
|
|
if (isAsyncWrapper(vnode) && !isUnmount) {
|
|
// when mounting async components, nothing needs to be done,
|
|
// because the template ref is forwarded to inner component
|
|
return;
|
|
}
|
|
const refValue = vnode.shapeFlag & 4 /* STATEFUL_COMPONENT */
|
|
? getExposeProxy(vnode.component) || vnode.component.proxy
|
|
: vnode.el;
|
|
const value = isUnmount ? null : refValue;
|
|
const { i: owner, r: ref } = rawRef;
|
|
if (( true) && !owner) {
|
|
warn(`Missing ref owner context. ref cannot be used on hoisted vnodes. ` +
|
|
`A vnode with ref must be created inside the render function.`);
|
|
return;
|
|
}
|
|
const oldRef = oldRawRef && oldRawRef.r;
|
|
const refs = owner.refs === _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ ? (owner.refs = {}) : owner.refs;
|
|
const setupState = owner.setupState;
|
|
// dynamic ref changed. unset old ref
|
|
if (oldRef != null && oldRef !== ref) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(oldRef)) {
|
|
refs[oldRef] = null;
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(setupState, oldRef)) {
|
|
setupState[oldRef] = null;
|
|
}
|
|
}
|
|
else if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isRef)(oldRef)) {
|
|
oldRef.value = null;
|
|
}
|
|
}
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(ref)) {
|
|
const doSet = () => {
|
|
{
|
|
refs[ref] = value;
|
|
}
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(setupState, ref)) {
|
|
setupState[ref] = value;
|
|
}
|
|
};
|
|
// #1789: for non-null values, set them after render
|
|
// null values means this is unmount and it should not overwrite another
|
|
// ref with the same key
|
|
if (value) {
|
|
doSet.id = -1;
|
|
queuePostRenderEffect(doSet, parentSuspense);
|
|
}
|
|
else {
|
|
doSet();
|
|
}
|
|
}
|
|
else if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isRef)(ref)) {
|
|
const doSet = () => {
|
|
ref.value = value;
|
|
};
|
|
if (value) {
|
|
doSet.id = -1;
|
|
queuePostRenderEffect(doSet, parentSuspense);
|
|
}
|
|
else {
|
|
doSet();
|
|
}
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(ref)) {
|
|
callWithErrorHandling(ref, owner, 12 /* FUNCTION_REF */, [value, refs]);
|
|
}
|
|
else if ((true)) {
|
|
warn('Invalid template ref type:', value, `(${typeof value})`);
|
|
}
|
|
}
|
|
function invokeVNodeHook(hook, instance, vnode, prevVNode = null) {
|
|
callWithAsyncErrorHandling(hook, instance, 7 /* VNODE_HOOK */, [
|
|
vnode,
|
|
prevVNode
|
|
]);
|
|
}
|
|
/**
|
|
* #1156
|
|
* When a component is HMR-enabled, we need to make sure that all static nodes
|
|
* inside a block also inherit the DOM element from the previous tree so that
|
|
* HMR updates (which are full updates) can retrieve the element for patching.
|
|
*
|
|
* #2080
|
|
* Inside keyed `template` fragment static children, if a fragment is moved,
|
|
* the children will always moved so that need inherit el form previous nodes
|
|
* to ensure correct moved position.
|
|
*/
|
|
function traverseStaticChildren(n1, n2, shallow = false) {
|
|
const ch1 = n1.children;
|
|
const ch2 = n2.children;
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(ch1) && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(ch2)) {
|
|
for (let i = 0; i < ch1.length; i++) {
|
|
// this is only called in the optimized path so array children are
|
|
// guaranteed to be vnodes
|
|
const c1 = ch1[i];
|
|
let c2 = ch2[i];
|
|
if (c2.shapeFlag & 1 /* ELEMENT */ && !c2.dynamicChildren) {
|
|
if (c2.patchFlag <= 0 || c2.patchFlag === 32 /* HYDRATE_EVENTS */) {
|
|
c2 = ch2[i] = cloneIfMounted(ch2[i]);
|
|
c2.el = c1.el;
|
|
}
|
|
if (!shallow)
|
|
traverseStaticChildren(c1, c2);
|
|
}
|
|
// also inherit for comment nodes, but not placeholders (e.g. v-if which
|
|
// would have received .el during block patch)
|
|
if (( true) && c2.type === Comment$1 && !c2.el) {
|
|
c2.el = c1.el;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
// https://en.wikipedia.org/wiki/Longest_increasing_subsequence
|
|
function getSequence(arr) {
|
|
const p = arr.slice();
|
|
const result = [0];
|
|
let i, j, u, v, c;
|
|
const len = arr.length;
|
|
for (i = 0; i < len; i++) {
|
|
const arrI = arr[i];
|
|
if (arrI !== 0) {
|
|
j = result[result.length - 1];
|
|
if (arr[j] < arrI) {
|
|
p[i] = j;
|
|
result.push(i);
|
|
continue;
|
|
}
|
|
u = 0;
|
|
v = result.length - 1;
|
|
while (u < v) {
|
|
c = (u + v) >> 1;
|
|
if (arr[result[c]] < arrI) {
|
|
u = c + 1;
|
|
}
|
|
else {
|
|
v = c;
|
|
}
|
|
}
|
|
if (arrI < arr[result[u]]) {
|
|
if (u > 0) {
|
|
p[i] = result[u - 1];
|
|
}
|
|
result[u] = i;
|
|
}
|
|
}
|
|
}
|
|
u = result.length;
|
|
v = result[u - 1];
|
|
while (u-- > 0) {
|
|
result[u] = v;
|
|
v = p[v];
|
|
}
|
|
return result;
|
|
}
|
|
|
|
const isTeleport = (type) => type.__isTeleport;
|
|
const isTeleportDisabled = (props) => props && (props.disabled || props.disabled === '');
|
|
const isTargetSVG = (target) => typeof SVGElement !== 'undefined' && target instanceof SVGElement;
|
|
const resolveTarget = (props, select) => {
|
|
const targetSelector = props && props.to;
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(targetSelector)) {
|
|
if (!select) {
|
|
( true) &&
|
|
warn(`Current renderer does not support string target for Teleports. ` +
|
|
`(missing querySelector renderer option)`);
|
|
return null;
|
|
}
|
|
else {
|
|
const target = select(targetSelector);
|
|
if (!target) {
|
|
( true) &&
|
|
warn(`Failed to locate Teleport target with selector "${targetSelector}". ` +
|
|
`Note the target element must exist before the component is mounted - ` +
|
|
`i.e. the target cannot be rendered by the component itself, and ` +
|
|
`ideally should be outside of the entire Vue component tree.`);
|
|
}
|
|
return target;
|
|
}
|
|
}
|
|
else {
|
|
if (( true) && !targetSelector && !isTeleportDisabled(props)) {
|
|
warn(`Invalid Teleport target: ${targetSelector}`);
|
|
}
|
|
return targetSelector;
|
|
}
|
|
};
|
|
const TeleportImpl = {
|
|
__isTeleport: true,
|
|
process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, internals) {
|
|
const { mc: mountChildren, pc: patchChildren, pbc: patchBlockChildren, o: { insert, querySelector, createText, createComment } } = internals;
|
|
const disabled = isTeleportDisabled(n2.props);
|
|
let { shapeFlag, children, dynamicChildren } = n2;
|
|
// #3302
|
|
// HMR updated, force full diff
|
|
if (( true) && isHmrUpdating) {
|
|
optimized = false;
|
|
dynamicChildren = null;
|
|
}
|
|
if (n1 == null) {
|
|
// insert anchors in the main view
|
|
const placeholder = (n2.el = ( true)
|
|
? createComment('teleport start')
|
|
: 0);
|
|
const mainAnchor = (n2.anchor = ( true)
|
|
? createComment('teleport end')
|
|
: 0);
|
|
insert(placeholder, container, anchor);
|
|
insert(mainAnchor, container, anchor);
|
|
const target = (n2.target = resolveTarget(n2.props, querySelector));
|
|
const targetAnchor = (n2.targetAnchor = createText(''));
|
|
if (target) {
|
|
insert(targetAnchor, target);
|
|
// #2652 we could be teleporting from a non-SVG tree into an SVG tree
|
|
isSVG = isSVG || isTargetSVG(target);
|
|
}
|
|
else if (( true) && !disabled) {
|
|
warn('Invalid Teleport target on mount:', target, `(${typeof target})`);
|
|
}
|
|
const mount = (container, anchor) => {
|
|
// Teleport *always* has Array children. This is enforced in both the
|
|
// compiler and vnode children normalization.
|
|
if (shapeFlag & 16 /* ARRAY_CHILDREN */) {
|
|
mountChildren(children, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
|
|
}
|
|
};
|
|
if (disabled) {
|
|
mount(container, mainAnchor);
|
|
}
|
|
else if (target) {
|
|
mount(target, targetAnchor);
|
|
}
|
|
}
|
|
else {
|
|
// update content
|
|
n2.el = n1.el;
|
|
const mainAnchor = (n2.anchor = n1.anchor);
|
|
const target = (n2.target = n1.target);
|
|
const targetAnchor = (n2.targetAnchor = n1.targetAnchor);
|
|
const wasDisabled = isTeleportDisabled(n1.props);
|
|
const currentContainer = wasDisabled ? container : target;
|
|
const currentAnchor = wasDisabled ? mainAnchor : targetAnchor;
|
|
isSVG = isSVG || isTargetSVG(target);
|
|
if (dynamicChildren) {
|
|
// fast path when the teleport happens to be a block root
|
|
patchBlockChildren(n1.dynamicChildren, dynamicChildren, currentContainer, parentComponent, parentSuspense, isSVG, slotScopeIds);
|
|
// even in block tree mode we need to make sure all root-level nodes
|
|
// in the teleport inherit previous DOM references so that they can
|
|
// be moved in future patches.
|
|
traverseStaticChildren(n1, n2, true);
|
|
}
|
|
else if (!optimized) {
|
|
patchChildren(n1, n2, currentContainer, currentAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, false);
|
|
}
|
|
if (disabled) {
|
|
if (!wasDisabled) {
|
|
// enabled -> disabled
|
|
// move into main container
|
|
moveTeleport(n2, container, mainAnchor, internals, 1 /* TOGGLE */);
|
|
}
|
|
}
|
|
else {
|
|
// target changed
|
|
if ((n2.props && n2.props.to) !== (n1.props && n1.props.to)) {
|
|
const nextTarget = (n2.target = resolveTarget(n2.props, querySelector));
|
|
if (nextTarget) {
|
|
moveTeleport(n2, nextTarget, null, internals, 0 /* TARGET_CHANGE */);
|
|
}
|
|
else if ((true)) {
|
|
warn('Invalid Teleport target on update:', target, `(${typeof target})`);
|
|
}
|
|
}
|
|
else if (wasDisabled) {
|
|
// disabled -> enabled
|
|
// move into teleport target
|
|
moveTeleport(n2, target, targetAnchor, internals, 1 /* TOGGLE */);
|
|
}
|
|
}
|
|
}
|
|
},
|
|
remove(vnode, parentComponent, parentSuspense, optimized, { um: unmount, o: { remove: hostRemove } }, doRemove) {
|
|
const { shapeFlag, children, anchor, targetAnchor, target, props } = vnode;
|
|
if (target) {
|
|
hostRemove(targetAnchor);
|
|
}
|
|
// an unmounted teleport should always remove its children if not disabled
|
|
if (doRemove || !isTeleportDisabled(props)) {
|
|
hostRemove(anchor);
|
|
if (shapeFlag & 16 /* ARRAY_CHILDREN */) {
|
|
for (let i = 0; i < children.length; i++) {
|
|
const child = children[i];
|
|
unmount(child, parentComponent, parentSuspense, true, !!child.dynamicChildren);
|
|
}
|
|
}
|
|
}
|
|
},
|
|
move: moveTeleport,
|
|
hydrate: hydrateTeleport
|
|
};
|
|
function moveTeleport(vnode, container, parentAnchor, { o: { insert }, m: move }, moveType = 2 /* REORDER */) {
|
|
// move target anchor if this is a target change.
|
|
if (moveType === 0 /* TARGET_CHANGE */) {
|
|
insert(vnode.targetAnchor, container, parentAnchor);
|
|
}
|
|
const { el, anchor, shapeFlag, children, props } = vnode;
|
|
const isReorder = moveType === 2 /* REORDER */;
|
|
// move main view anchor if this is a re-order.
|
|
if (isReorder) {
|
|
insert(el, container, parentAnchor);
|
|
}
|
|
// if this is a re-order and teleport is enabled (content is in target)
|
|
// do not move children. So the opposite is: only move children if this
|
|
// is not a reorder, or the teleport is disabled
|
|
if (!isReorder || isTeleportDisabled(props)) {
|
|
// Teleport has either Array children or no children.
|
|
if (shapeFlag & 16 /* ARRAY_CHILDREN */) {
|
|
for (let i = 0; i < children.length; i++) {
|
|
move(children[i], container, parentAnchor, 2 /* REORDER */);
|
|
}
|
|
}
|
|
}
|
|
// move main view anchor if this is a re-order.
|
|
if (isReorder) {
|
|
insert(anchor, container, parentAnchor);
|
|
}
|
|
}
|
|
function hydrateTeleport(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized, { o: { nextSibling, parentNode, querySelector } }, hydrateChildren) {
|
|
const target = (vnode.target = resolveTarget(vnode.props, querySelector));
|
|
if (target) {
|
|
// if multiple teleports rendered to the same target element, we need to
|
|
// pick up from where the last teleport finished instead of the first node
|
|
const targetNode = target._lpa || target.firstChild;
|
|
if (vnode.shapeFlag & 16 /* ARRAY_CHILDREN */) {
|
|
if (isTeleportDisabled(vnode.props)) {
|
|
vnode.anchor = hydrateChildren(nextSibling(node), vnode, parentNode(node), parentComponent, parentSuspense, slotScopeIds, optimized);
|
|
vnode.targetAnchor = targetNode;
|
|
}
|
|
else {
|
|
vnode.anchor = nextSibling(node);
|
|
vnode.targetAnchor = hydrateChildren(targetNode, vnode, target, parentComponent, parentSuspense, slotScopeIds, optimized);
|
|
}
|
|
target._lpa =
|
|
vnode.targetAnchor && nextSibling(vnode.targetAnchor);
|
|
}
|
|
}
|
|
return vnode.anchor && nextSibling(vnode.anchor);
|
|
}
|
|
// Force-casted public typing for h and TSX props inference
|
|
const Teleport = TeleportImpl;
|
|
|
|
const COMPONENTS = 'components';
|
|
const DIRECTIVES = 'directives';
|
|
/**
|
|
* @private
|
|
*/
|
|
function resolveComponent(name, maybeSelfReference) {
|
|
return resolveAsset(COMPONENTS, name, true, maybeSelfReference) || name;
|
|
}
|
|
const NULL_DYNAMIC_COMPONENT = Symbol();
|
|
/**
|
|
* @private
|
|
*/
|
|
function resolveDynamicComponent(component) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(component)) {
|
|
return resolveAsset(COMPONENTS, component, false) || component;
|
|
}
|
|
else {
|
|
// invalid types will fallthrough to createVNode and raise warning
|
|
return (component || NULL_DYNAMIC_COMPONENT);
|
|
}
|
|
}
|
|
/**
|
|
* @private
|
|
*/
|
|
function resolveDirective(name) {
|
|
return resolveAsset(DIRECTIVES, name);
|
|
}
|
|
// implementation
|
|
function resolveAsset(type, name, warnMissing = true, maybeSelfReference = false) {
|
|
const instance = currentRenderingInstance || currentInstance;
|
|
if (instance) {
|
|
const Component = instance.type;
|
|
// explicit self name has highest priority
|
|
if (type === COMPONENTS) {
|
|
const selfName = getComponentName(Component);
|
|
if (selfName &&
|
|
(selfName === name ||
|
|
selfName === (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize)(name) ||
|
|
selfName === (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.capitalize)((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize)(name)))) {
|
|
return Component;
|
|
}
|
|
}
|
|
const res =
|
|
// local registration
|
|
// check instance[type] first which is resolved for options API
|
|
resolve(instance[type] || Component[type], name) ||
|
|
// global registration
|
|
resolve(instance.appContext[type], name);
|
|
if (!res && maybeSelfReference) {
|
|
// fallback to implicit self-reference
|
|
return Component;
|
|
}
|
|
if (( true) && warnMissing && !res) {
|
|
warn(`Failed to resolve ${type.slice(0, -1)}: ${name}`);
|
|
}
|
|
return res;
|
|
}
|
|
else if ((true)) {
|
|
warn(`resolve${(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.capitalize)(type.slice(0, -1))} ` +
|
|
`can only be used in render() or setup().`);
|
|
}
|
|
}
|
|
function resolve(registry, name) {
|
|
return (registry &&
|
|
(registry[name] ||
|
|
registry[(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize)(name)] ||
|
|
registry[(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.capitalize)((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize)(name))]));
|
|
}
|
|
|
|
const Fragment = Symbol(( true) ? 'Fragment' : 0);
|
|
const Text = Symbol(( true) ? 'Text' : 0);
|
|
const Comment$1 = Symbol(( true) ? 'Comment' : 0);
|
|
const Static = Symbol(( true) ? 'Static' : 0);
|
|
// Since v-if and v-for are the two possible ways node structure can dynamically
|
|
// change, once we consider v-if branches and each v-for fragment a block, we
|
|
// can divide a template into nested blocks, and within each block the node
|
|
// structure would be stable. This allows us to skip most children diffing
|
|
// and only worry about the dynamic nodes (indicated by patch flags).
|
|
const blockStack = [];
|
|
let currentBlock = null;
|
|
/**
|
|
* Open a block.
|
|
* This must be called before `createBlock`. It cannot be part of `createBlock`
|
|
* because the children of the block are evaluated before `createBlock` itself
|
|
* is called. The generated code typically looks like this:
|
|
*
|
|
* ```js
|
|
* function render() {
|
|
* return (openBlock(),createBlock('div', null, [...]))
|
|
* }
|
|
* ```
|
|
* disableTracking is true when creating a v-for fragment block, since a v-for
|
|
* fragment always diffs its children.
|
|
*
|
|
* @private
|
|
*/
|
|
function openBlock(disableTracking = false) {
|
|
blockStack.push((currentBlock = disableTracking ? null : []));
|
|
}
|
|
function closeBlock() {
|
|
blockStack.pop();
|
|
currentBlock = blockStack[blockStack.length - 1] || null;
|
|
}
|
|
// Whether we should be tracking dynamic child nodes inside a block.
|
|
// Only tracks when this value is > 0
|
|
// We are not using a simple boolean because this value may need to be
|
|
// incremented/decremented by nested usage of v-once (see below)
|
|
let isBlockTreeEnabled = 1;
|
|
/**
|
|
* Block tracking sometimes needs to be disabled, for example during the
|
|
* creation of a tree that needs to be cached by v-once. The compiler generates
|
|
* code like this:
|
|
*
|
|
* ``` js
|
|
* _cache[1] || (
|
|
* setBlockTracking(-1),
|
|
* _cache[1] = createVNode(...),
|
|
* setBlockTracking(1),
|
|
* _cache[1]
|
|
* )
|
|
* ```
|
|
*
|
|
* @private
|
|
*/
|
|
function setBlockTracking(value) {
|
|
isBlockTreeEnabled += value;
|
|
}
|
|
function setupBlock(vnode) {
|
|
// save current block children on the block vnode
|
|
vnode.dynamicChildren =
|
|
isBlockTreeEnabled > 0 ? currentBlock || _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_ARR : null;
|
|
// close block
|
|
closeBlock();
|
|
// a block is always going to be patched, so track it as a child of its
|
|
// parent block
|
|
if (isBlockTreeEnabled > 0 && currentBlock) {
|
|
currentBlock.push(vnode);
|
|
}
|
|
return vnode;
|
|
}
|
|
/**
|
|
* @private
|
|
*/
|
|
function createElementBlock(type, props, children, patchFlag, dynamicProps, shapeFlag) {
|
|
return setupBlock(createBaseVNode(type, props, children, patchFlag, dynamicProps, shapeFlag, true /* isBlock */));
|
|
}
|
|
/**
|
|
* Create a block root vnode. Takes the same exact arguments as `createVNode`.
|
|
* A block root keeps track of dynamic nodes within the block in the
|
|
* `dynamicChildren` array.
|
|
*
|
|
* @private
|
|
*/
|
|
function createBlock(type, props, children, patchFlag, dynamicProps) {
|
|
return setupBlock(createVNode(type, props, children, patchFlag, dynamicProps, true /* isBlock: prevent a block from tracking itself */));
|
|
}
|
|
function isVNode(value) {
|
|
return value ? value.__v_isVNode === true : false;
|
|
}
|
|
function isSameVNodeType(n1, n2) {
|
|
if (( true) &&
|
|
n2.shapeFlag & 6 /* COMPONENT */ &&
|
|
hmrDirtyComponents.has(n2.type)) {
|
|
// HMR only: if the component has been hot-updated, force a reload.
|
|
return false;
|
|
}
|
|
return n1.type === n2.type && n1.key === n2.key;
|
|
}
|
|
let vnodeArgsTransformer;
|
|
/**
|
|
* Internal API for registering an arguments transform for createVNode
|
|
* used for creating stubs in the test-utils
|
|
* It is *internal* but needs to be exposed for test-utils to pick up proper
|
|
* typings
|
|
*/
|
|
function transformVNodeArgs(transformer) {
|
|
vnodeArgsTransformer = transformer;
|
|
}
|
|
const createVNodeWithArgsTransform = (...args) => {
|
|
return _createVNode(...(vnodeArgsTransformer
|
|
? vnodeArgsTransformer(args, currentRenderingInstance)
|
|
: args));
|
|
};
|
|
const InternalObjectKey = `__vInternal`;
|
|
const normalizeKey = ({ key }) => key != null ? key : null;
|
|
const normalizeRef = ({ ref }) => {
|
|
return (ref != null
|
|
? (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(ref) || (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isRef)(ref) || (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(ref)
|
|
? { i: currentRenderingInstance, r: ref }
|
|
: ref
|
|
: null);
|
|
};
|
|
function createBaseVNode(type, props = null, children = null, patchFlag = 0, dynamicProps = null, shapeFlag = type === Fragment ? 0 : 1 /* ELEMENT */, isBlockNode = false, needFullChildrenNormalization = false) {
|
|
const vnode = {
|
|
__v_isVNode: true,
|
|
__v_skip: true,
|
|
type,
|
|
props,
|
|
key: props && normalizeKey(props),
|
|
ref: props && normalizeRef(props),
|
|
scopeId: currentScopeId,
|
|
slotScopeIds: null,
|
|
children,
|
|
component: null,
|
|
suspense: null,
|
|
ssContent: null,
|
|
ssFallback: null,
|
|
dirs: null,
|
|
transition: null,
|
|
el: null,
|
|
anchor: null,
|
|
target: null,
|
|
targetAnchor: null,
|
|
staticCount: 0,
|
|
shapeFlag,
|
|
patchFlag,
|
|
dynamicProps,
|
|
dynamicChildren: null,
|
|
appContext: null
|
|
};
|
|
if (needFullChildrenNormalization) {
|
|
normalizeChildren(vnode, children);
|
|
// normalize suspense children
|
|
if (shapeFlag & 128 /* SUSPENSE */) {
|
|
type.normalize(vnode);
|
|
}
|
|
}
|
|
else if (children) {
|
|
// compiled element vnode - if children is passed, only possible types are
|
|
// string or Array.
|
|
vnode.shapeFlag |= (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(children)
|
|
? 8 /* TEXT_CHILDREN */
|
|
: 16 /* ARRAY_CHILDREN */;
|
|
}
|
|
// validate key
|
|
if (( true) && vnode.key !== vnode.key) {
|
|
warn(`VNode created with invalid key (NaN). VNode type:`, vnode.type);
|
|
}
|
|
// track vnode for block tree
|
|
if (isBlockTreeEnabled > 0 &&
|
|
// avoid a block node from tracking itself
|
|
!isBlockNode &&
|
|
// has current parent block
|
|
currentBlock &&
|
|
// presence of a patch flag indicates this node needs patching on updates.
|
|
// component nodes also should always be patched, because even if the
|
|
// component doesn't need to update, it needs to persist the instance on to
|
|
// the next vnode so that it can be properly unmounted later.
|
|
(vnode.patchFlag > 0 || shapeFlag & 6 /* COMPONENT */) &&
|
|
// the EVENTS flag is only for hydration and if it is the only flag, the
|
|
// vnode should not be considered dynamic due to handler caching.
|
|
vnode.patchFlag !== 32 /* HYDRATE_EVENTS */) {
|
|
currentBlock.push(vnode);
|
|
}
|
|
return vnode;
|
|
}
|
|
const createVNode = (( true) ? createVNodeWithArgsTransform : 0);
|
|
function _createVNode(type, props = null, children = null, patchFlag = 0, dynamicProps = null, isBlockNode = false) {
|
|
if (!type || type === NULL_DYNAMIC_COMPONENT) {
|
|
if (( true) && !type) {
|
|
warn(`Invalid vnode type when creating vnode: ${type}.`);
|
|
}
|
|
type = Comment$1;
|
|
}
|
|
if (isVNode(type)) {
|
|
// createVNode receiving an existing vnode. This happens in cases like
|
|
// <component :is="vnode"/>
|
|
// #2078 make sure to merge refs during the clone instead of overwriting it
|
|
const cloned = cloneVNode(type, props, true /* mergeRef: true */);
|
|
if (children) {
|
|
normalizeChildren(cloned, children);
|
|
}
|
|
return cloned;
|
|
}
|
|
// class component normalization.
|
|
if (isClassComponent(type)) {
|
|
type = type.__vccOpts;
|
|
}
|
|
// class & style normalization.
|
|
if (props) {
|
|
// for reactive or proxy objects, we need to clone it to enable mutation.
|
|
props = guardReactiveProps(props);
|
|
let { class: klass, style } = props;
|
|
if (klass && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(klass)) {
|
|
props.class = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.normalizeClass)(klass);
|
|
}
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(style)) {
|
|
// reactive state objects need to be cloned since they are likely to be
|
|
// mutated
|
|
if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isProxy)(style) && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(style)) {
|
|
style = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({}, style);
|
|
}
|
|
props.style = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.normalizeStyle)(style);
|
|
}
|
|
}
|
|
// encode the vnode type information into a bitmap
|
|
const shapeFlag = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(type)
|
|
? 1 /* ELEMENT */
|
|
: isSuspense(type)
|
|
? 128 /* SUSPENSE */
|
|
: isTeleport(type)
|
|
? 64 /* TELEPORT */
|
|
: (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(type)
|
|
? 4 /* STATEFUL_COMPONENT */
|
|
: (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(type)
|
|
? 2 /* FUNCTIONAL_COMPONENT */
|
|
: 0;
|
|
if (( true) && shapeFlag & 4 /* STATEFUL_COMPONENT */ && (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isProxy)(type)) {
|
|
type = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw)(type);
|
|
warn(`Vue received a Component which was made a reactive object. This can ` +
|
|
`lead to unnecessary performance overhead, and should be avoided by ` +
|
|
`marking the component with \`markRaw\` or using \`shallowRef\` ` +
|
|
`instead of \`ref\`.`, `\nComponent that was made reactive: `, type);
|
|
}
|
|
return createBaseVNode(type, props, children, patchFlag, dynamicProps, shapeFlag, isBlockNode, true);
|
|
}
|
|
function guardReactiveProps(props) {
|
|
if (!props)
|
|
return null;
|
|
return (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isProxy)(props) || InternalObjectKey in props
|
|
? (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({}, props)
|
|
: props;
|
|
}
|
|
function cloneVNode(vnode, extraProps, mergeRef = false) {
|
|
// This is intentionally NOT using spread or extend to avoid the runtime
|
|
// key enumeration cost.
|
|
const { props, ref, patchFlag, children } = vnode;
|
|
const mergedProps = extraProps ? mergeProps(props || {}, extraProps) : props;
|
|
const cloned = {
|
|
__v_isVNode: true,
|
|
__v_skip: true,
|
|
type: vnode.type,
|
|
props: mergedProps,
|
|
key: mergedProps && normalizeKey(mergedProps),
|
|
ref: extraProps && extraProps.ref
|
|
? // #2078 in the case of <component :is="vnode" ref="extra"/>
|
|
// if the vnode itself already has a ref, cloneVNode will need to merge
|
|
// the refs so the single vnode can be set on multiple refs
|
|
mergeRef && ref
|
|
? (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(ref)
|
|
? ref.concat(normalizeRef(extraProps))
|
|
: [ref, normalizeRef(extraProps)]
|
|
: normalizeRef(extraProps)
|
|
: ref,
|
|
scopeId: vnode.scopeId,
|
|
slotScopeIds: vnode.slotScopeIds,
|
|
children: ( true) && patchFlag === -1 /* HOISTED */ && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(children)
|
|
? children.map(deepCloneVNode)
|
|
: children,
|
|
target: vnode.target,
|
|
targetAnchor: vnode.targetAnchor,
|
|
staticCount: vnode.staticCount,
|
|
shapeFlag: vnode.shapeFlag,
|
|
// if the vnode is cloned with extra props, we can no longer assume its
|
|
// existing patch flag to be reliable and need to add the FULL_PROPS flag.
|
|
// note: perserve flag for fragments since they use the flag for children
|
|
// fast paths only.
|
|
patchFlag: extraProps && vnode.type !== Fragment
|
|
? patchFlag === -1 // hoisted node
|
|
? 16 /* FULL_PROPS */
|
|
: patchFlag | 16 /* FULL_PROPS */
|
|
: patchFlag,
|
|
dynamicProps: vnode.dynamicProps,
|
|
dynamicChildren: vnode.dynamicChildren,
|
|
appContext: vnode.appContext,
|
|
dirs: vnode.dirs,
|
|
transition: vnode.transition,
|
|
// These should technically only be non-null on mounted VNodes. However,
|
|
// they *should* be copied for kept-alive vnodes. So we just always copy
|
|
// them since them being non-null during a mount doesn't affect the logic as
|
|
// they will simply be overwritten.
|
|
component: vnode.component,
|
|
suspense: vnode.suspense,
|
|
ssContent: vnode.ssContent && cloneVNode(vnode.ssContent),
|
|
ssFallback: vnode.ssFallback && cloneVNode(vnode.ssFallback),
|
|
el: vnode.el,
|
|
anchor: vnode.anchor
|
|
};
|
|
return cloned;
|
|
}
|
|
/**
|
|
* Dev only, for HMR of hoisted vnodes reused in v-for
|
|
* https://github.com/vitejs/vite/issues/2022
|
|
*/
|
|
function deepCloneVNode(vnode) {
|
|
const cloned = cloneVNode(vnode);
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(vnode.children)) {
|
|
cloned.children = vnode.children.map(deepCloneVNode);
|
|
}
|
|
return cloned;
|
|
}
|
|
/**
|
|
* @private
|
|
*/
|
|
function createTextVNode(text = ' ', flag = 0) {
|
|
return createVNode(Text, null, text, flag);
|
|
}
|
|
/**
|
|
* @private
|
|
*/
|
|
function createStaticVNode(content, numberOfNodes) {
|
|
// A static vnode can contain multiple stringified elements, and the number
|
|
// of elements is necessary for hydration.
|
|
const vnode = createVNode(Static, null, content);
|
|
vnode.staticCount = numberOfNodes;
|
|
return vnode;
|
|
}
|
|
/**
|
|
* @private
|
|
*/
|
|
function createCommentVNode(text = '',
|
|
// when used as the v-else branch, the comment node must be created as a
|
|
// block to ensure correct updates.
|
|
asBlock = false) {
|
|
return asBlock
|
|
? (openBlock(), createBlock(Comment$1, null, text))
|
|
: createVNode(Comment$1, null, text);
|
|
}
|
|
function normalizeVNode(child) {
|
|
if (child == null || typeof child === 'boolean') {
|
|
// empty placeholder
|
|
return createVNode(Comment$1);
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(child)) {
|
|
// fragment
|
|
return createVNode(Fragment, null,
|
|
// #3666, avoid reference pollution when reusing vnode
|
|
child.slice());
|
|
}
|
|
else if (typeof child === 'object') {
|
|
// already vnode, this should be the most common since compiled templates
|
|
// always produce all-vnode children arrays
|
|
return cloneIfMounted(child);
|
|
}
|
|
else {
|
|
// strings and numbers
|
|
return createVNode(Text, null, String(child));
|
|
}
|
|
}
|
|
// optimized normalization for template-compiled render fns
|
|
function cloneIfMounted(child) {
|
|
return child.el === null || child.memo ? child : cloneVNode(child);
|
|
}
|
|
function normalizeChildren(vnode, children) {
|
|
let type = 0;
|
|
const { shapeFlag } = vnode;
|
|
if (children == null) {
|
|
children = null;
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(children)) {
|
|
type = 16 /* ARRAY_CHILDREN */;
|
|
}
|
|
else if (typeof children === 'object') {
|
|
if (shapeFlag & (1 /* ELEMENT */ | 64 /* TELEPORT */)) {
|
|
// Normalize slot to plain children for plain element and Teleport
|
|
const slot = children.default;
|
|
if (slot) {
|
|
// _c marker is added by withCtx() indicating this is a compiled slot
|
|
slot._c && (slot._d = false);
|
|
normalizeChildren(vnode, slot());
|
|
slot._c && (slot._d = true);
|
|
}
|
|
return;
|
|
}
|
|
else {
|
|
type = 32 /* SLOTS_CHILDREN */;
|
|
const slotFlag = children._;
|
|
if (!slotFlag && !(InternalObjectKey in children)) {
|
|
children._ctx = currentRenderingInstance;
|
|
}
|
|
else if (slotFlag === 3 /* FORWARDED */ && currentRenderingInstance) {
|
|
// a child component receives forwarded slots from the parent.
|
|
// its slot type is determined by its parent's slot type.
|
|
if (currentRenderingInstance.slots._ === 1 /* STABLE */) {
|
|
children._ = 1 /* STABLE */;
|
|
}
|
|
else {
|
|
children._ = 2 /* DYNAMIC */;
|
|
vnode.patchFlag |= 1024 /* DYNAMIC_SLOTS */;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(children)) {
|
|
children = { default: children, _ctx: currentRenderingInstance };
|
|
type = 32 /* SLOTS_CHILDREN */;
|
|
}
|
|
else {
|
|
children = String(children);
|
|
// force teleport children to array so it can be moved around
|
|
if (shapeFlag & 64 /* TELEPORT */) {
|
|
type = 16 /* ARRAY_CHILDREN */;
|
|
children = [createTextVNode(children)];
|
|
}
|
|
else {
|
|
type = 8 /* TEXT_CHILDREN */;
|
|
}
|
|
}
|
|
vnode.children = children;
|
|
vnode.shapeFlag |= type;
|
|
}
|
|
function mergeProps(...args) {
|
|
const ret = {};
|
|
for (let i = 0; i < args.length; i++) {
|
|
const toMerge = args[i];
|
|
for (const key in toMerge) {
|
|
if (key === 'class') {
|
|
if (ret.class !== toMerge.class) {
|
|
ret.class = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.normalizeClass)([ret.class, toMerge.class]);
|
|
}
|
|
}
|
|
else if (key === 'style') {
|
|
ret.style = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.normalizeStyle)([ret.style, toMerge.style]);
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isOn)(key)) {
|
|
const existing = ret[key];
|
|
const incoming = toMerge[key];
|
|
if (existing !== incoming) {
|
|
ret[key] = existing
|
|
? [].concat(existing, incoming)
|
|
: incoming;
|
|
}
|
|
}
|
|
else if (key !== '') {
|
|
ret[key] = toMerge[key];
|
|
}
|
|
}
|
|
}
|
|
return ret;
|
|
}
|
|
|
|
/**
|
|
* Actual implementation
|
|
*/
|
|
function renderList(source, renderItem, cache, index) {
|
|
let ret;
|
|
const cached = (cache && cache[index]);
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(source) || (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(source)) {
|
|
ret = new Array(source.length);
|
|
for (let i = 0, l = source.length; i < l; i++) {
|
|
ret[i] = renderItem(source[i], i, undefined, cached && cached[i]);
|
|
}
|
|
}
|
|
else if (typeof source === 'number') {
|
|
if (( true) && !Number.isInteger(source)) {
|
|
warn(`The v-for range expect an integer value but got ${source}.`);
|
|
return [];
|
|
}
|
|
ret = new Array(source);
|
|
for (let i = 0; i < source; i++) {
|
|
ret[i] = renderItem(i + 1, i, undefined, cached && cached[i]);
|
|
}
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(source)) {
|
|
if (source[Symbol.iterator]) {
|
|
ret = Array.from(source, (item, i) => renderItem(item, i, undefined, cached && cached[i]));
|
|
}
|
|
else {
|
|
const keys = Object.keys(source);
|
|
ret = new Array(keys.length);
|
|
for (let i = 0, l = keys.length; i < l; i++) {
|
|
const key = keys[i];
|
|
ret[i] = renderItem(source[key], key, i, cached && cached[i]);
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
ret = [];
|
|
}
|
|
if (cache) {
|
|
cache[index] = ret;
|
|
}
|
|
return ret;
|
|
}
|
|
|
|
/**
|
|
* Compiler runtime helper for creating dynamic slots object
|
|
* @private
|
|
*/
|
|
function createSlots(slots, dynamicSlots) {
|
|
for (let i = 0; i < dynamicSlots.length; i++) {
|
|
const slot = dynamicSlots[i];
|
|
// array of dynamic slot generated by <template v-for="..." #[...]>
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(slot)) {
|
|
for (let j = 0; j < slot.length; j++) {
|
|
slots[slot[j].name] = slot[j].fn;
|
|
}
|
|
}
|
|
else if (slot) {
|
|
// conditional single slot generated by <template v-if="..." #foo>
|
|
slots[slot.name] = slot.fn;
|
|
}
|
|
}
|
|
return slots;
|
|
}
|
|
|
|
/**
|
|
* Compiler runtime helper for rendering `<slot/>`
|
|
* @private
|
|
*/
|
|
function renderSlot(slots, name, props = {},
|
|
// this is not a user-facing function, so the fallback is always generated by
|
|
// the compiler and guaranteed to be a function returning an array
|
|
fallback, noSlotted) {
|
|
if (currentRenderingInstance.isCE) {
|
|
return createVNode('slot', name === 'default' ? null : { name }, fallback && fallback());
|
|
}
|
|
let slot = slots[name];
|
|
if (( true) && slot && slot.length > 1) {
|
|
warn(`SSR-optimized slot function detected in a non-SSR-optimized render ` +
|
|
`function. You need to mark this component with $dynamic-slots in the ` +
|
|
`parent template.`);
|
|
slot = () => [];
|
|
}
|
|
// a compiled slot disables block tracking by default to avoid manual
|
|
// invocation interfering with template-based block tracking, but in
|
|
// `renderSlot` we can be sure that it's template-based so we can force
|
|
// enable it.
|
|
if (slot && slot._c) {
|
|
slot._d = false;
|
|
}
|
|
openBlock();
|
|
const validSlotContent = slot && ensureValidVNode(slot(props));
|
|
const rendered = createBlock(Fragment, { key: props.key || `_${name}` }, validSlotContent || (fallback ? fallback() : []), validSlotContent && slots._ === 1 /* STABLE */
|
|
? 64 /* STABLE_FRAGMENT */
|
|
: -2 /* BAIL */);
|
|
if (!noSlotted && rendered.scopeId) {
|
|
rendered.slotScopeIds = [rendered.scopeId + '-s'];
|
|
}
|
|
if (slot && slot._c) {
|
|
slot._d = true;
|
|
}
|
|
return rendered;
|
|
}
|
|
function ensureValidVNode(vnodes) {
|
|
return vnodes.some(child => {
|
|
if (!isVNode(child))
|
|
return true;
|
|
if (child.type === Comment$1)
|
|
return false;
|
|
if (child.type === Fragment &&
|
|
!ensureValidVNode(child.children))
|
|
return false;
|
|
return true;
|
|
})
|
|
? vnodes
|
|
: null;
|
|
}
|
|
|
|
/**
|
|
* For prefixing keys in v-on="obj" with "on"
|
|
* @private
|
|
*/
|
|
function toHandlers(obj) {
|
|
const ret = {};
|
|
if (( true) && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(obj)) {
|
|
warn(`v-on with no argument expects an object value.`);
|
|
return ret;
|
|
}
|
|
for (const key in obj) {
|
|
ret[(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toHandlerKey)(key)] = obj[key];
|
|
}
|
|
return ret;
|
|
}
|
|
|
|
/**
|
|
* #2437 In Vue 3, functional components do not have a public instance proxy but
|
|
* they exist in the internal parent chain. For code that relies on traversing
|
|
* public $parent chains, skip functional ones and go to the parent instead.
|
|
*/
|
|
const getPublicInstance = (i) => {
|
|
if (!i)
|
|
return null;
|
|
if (isStatefulComponent(i))
|
|
return getExposeProxy(i) || i.proxy;
|
|
return getPublicInstance(i.parent);
|
|
};
|
|
const publicPropertiesMap = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)(Object.create(null), {
|
|
$: i => i,
|
|
$el: i => i.vnode.el,
|
|
$data: i => i.data,
|
|
$props: i => (( true) ? (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.shallowReadonly)(i.props) : 0),
|
|
$attrs: i => (( true) ? (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.shallowReadonly)(i.attrs) : 0),
|
|
$slots: i => (( true) ? (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.shallowReadonly)(i.slots) : 0),
|
|
$refs: i => (( true) ? (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.shallowReadonly)(i.refs) : 0),
|
|
$parent: i => getPublicInstance(i.parent),
|
|
$root: i => getPublicInstance(i.root),
|
|
$emit: i => i.emit,
|
|
$options: i => (__VUE_OPTIONS_API__ ? resolveMergedOptions(i) : i.type),
|
|
$forceUpdate: i => () => queueJob(i.update),
|
|
$nextTick: i => nextTick.bind(i.proxy),
|
|
$watch: i => (__VUE_OPTIONS_API__ ? instanceWatch.bind(i) : _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP)
|
|
});
|
|
const PublicInstanceProxyHandlers = {
|
|
get({ _: instance }, key) {
|
|
const { ctx, setupState, data, props, accessCache, type, appContext } = instance;
|
|
// for internal formatters to know that this is a Vue instance
|
|
if (( true) && key === '__isVue') {
|
|
return true;
|
|
}
|
|
// prioritize <script setup> bindings during dev.
|
|
// this allows even properties that start with _ or $ to be used - so that
|
|
// it aligns with the production behavior where the render fn is inlined and
|
|
// indeed has access to all declared variables.
|
|
if (( true) &&
|
|
setupState !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ &&
|
|
setupState.__isScriptSetup &&
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(setupState, key)) {
|
|
return setupState[key];
|
|
}
|
|
// data / props / ctx
|
|
// This getter gets called for every property access on the render context
|
|
// during render and is a major hotspot. The most expensive part of this
|
|
// is the multiple hasOwn() calls. It's much faster to do a simple property
|
|
// access on a plain object, so we use an accessCache object (with null
|
|
// prototype) to memoize what access type a key corresponds to.
|
|
let normalizedProps;
|
|
if (key[0] !== '$') {
|
|
const n = accessCache[key];
|
|
if (n !== undefined) {
|
|
switch (n) {
|
|
case 0 /* SETUP */:
|
|
return setupState[key];
|
|
case 1 /* DATA */:
|
|
return data[key];
|
|
case 3 /* CONTEXT */:
|
|
return ctx[key];
|
|
case 2 /* PROPS */:
|
|
return props[key];
|
|
// default: just fallthrough
|
|
}
|
|
}
|
|
else if (setupState !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(setupState, key)) {
|
|
accessCache[key] = 0 /* SETUP */;
|
|
return setupState[key];
|
|
}
|
|
else if (data !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(data, key)) {
|
|
accessCache[key] = 1 /* DATA */;
|
|
return data[key];
|
|
}
|
|
else if (
|
|
// only cache other properties when instance has declared (thus stable)
|
|
// props
|
|
(normalizedProps = instance.propsOptions[0]) &&
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(normalizedProps, key)) {
|
|
accessCache[key] = 2 /* PROPS */;
|
|
return props[key];
|
|
}
|
|
else if (ctx !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(ctx, key)) {
|
|
accessCache[key] = 3 /* CONTEXT */;
|
|
return ctx[key];
|
|
}
|
|
else if (!__VUE_OPTIONS_API__ || shouldCacheAccess) {
|
|
accessCache[key] = 4 /* OTHER */;
|
|
}
|
|
}
|
|
const publicGetter = publicPropertiesMap[key];
|
|
let cssModule, globalProperties;
|
|
// public $xxx properties
|
|
if (publicGetter) {
|
|
if (key === '$attrs') {
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.track)(instance, "get" /* GET */, key);
|
|
( true) && markAttrsAccessed();
|
|
}
|
|
return publicGetter(instance);
|
|
}
|
|
else if (
|
|
// css module (injected by vue-loader)
|
|
(cssModule = type.__cssModules) &&
|
|
(cssModule = cssModule[key])) {
|
|
return cssModule;
|
|
}
|
|
else if (ctx !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(ctx, key)) {
|
|
// user may set custom properties to `this` that start with `$`
|
|
accessCache[key] = 3 /* CONTEXT */;
|
|
return ctx[key];
|
|
}
|
|
else if (
|
|
// global properties
|
|
((globalProperties = appContext.config.globalProperties),
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(globalProperties, key))) {
|
|
{
|
|
return globalProperties[key];
|
|
}
|
|
}
|
|
else if (( true) &&
|
|
currentRenderingInstance &&
|
|
(!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(key) ||
|
|
// #1091 avoid internal isRef/isVNode checks on component instance leading
|
|
// to infinite warning loop
|
|
key.indexOf('__v') !== 0)) {
|
|
if (data !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ &&
|
|
(key[0] === '$' || key[0] === '_') &&
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(data, key)) {
|
|
warn(`Property ${JSON.stringify(key)} must be accessed via $data because it starts with a reserved ` +
|
|
`character ("$" or "_") and is not proxied on the render context.`);
|
|
}
|
|
else if (instance === currentRenderingInstance) {
|
|
warn(`Property ${JSON.stringify(key)} was accessed during render ` +
|
|
`but is not defined on instance.`);
|
|
}
|
|
}
|
|
},
|
|
set({ _: instance }, key, value) {
|
|
const { data, setupState, ctx } = instance;
|
|
if (setupState !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(setupState, key)) {
|
|
setupState[key] = value;
|
|
}
|
|
else if (data !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(data, key)) {
|
|
data[key] = value;
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(instance.props, key)) {
|
|
( true) &&
|
|
warn(`Attempting to mutate prop "${key}". Props are readonly.`, instance);
|
|
return false;
|
|
}
|
|
if (key[0] === '$' && key.slice(1) in instance) {
|
|
( true) &&
|
|
warn(`Attempting to mutate public property "${key}". ` +
|
|
`Properties starting with $ are reserved and readonly.`, instance);
|
|
return false;
|
|
}
|
|
else {
|
|
if (( true) && key in instance.appContext.config.globalProperties) {
|
|
Object.defineProperty(ctx, key, {
|
|
enumerable: true,
|
|
configurable: true,
|
|
value
|
|
});
|
|
}
|
|
else {
|
|
ctx[key] = value;
|
|
}
|
|
}
|
|
return true;
|
|
},
|
|
has({ _: { data, setupState, accessCache, ctx, appContext, propsOptions } }, key) {
|
|
let normalizedProps;
|
|
return (accessCache[key] !== undefined ||
|
|
(data !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(data, key)) ||
|
|
(setupState !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(setupState, key)) ||
|
|
((normalizedProps = propsOptions[0]) && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(normalizedProps, key)) ||
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(ctx, key) ||
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(publicPropertiesMap, key) ||
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasOwn)(appContext.config.globalProperties, key));
|
|
}
|
|
};
|
|
if (true) {
|
|
PublicInstanceProxyHandlers.ownKeys = (target) => {
|
|
warn(`Avoid app logic that relies on enumerating keys on a component instance. ` +
|
|
`The keys will be empty in production mode to avoid performance overhead.`);
|
|
return Reflect.ownKeys(target);
|
|
};
|
|
}
|
|
const RuntimeCompiledPublicInstanceProxyHandlers = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({}, PublicInstanceProxyHandlers, {
|
|
get(target, key) {
|
|
// fast path for unscopables when using `with` block
|
|
if (key === Symbol.unscopables) {
|
|
return;
|
|
}
|
|
return PublicInstanceProxyHandlers.get(target, key, target);
|
|
},
|
|
has(_, key) {
|
|
const has = key[0] !== '_' && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isGloballyWhitelisted)(key);
|
|
if (( true) && !has && PublicInstanceProxyHandlers.has(_, key)) {
|
|
warn(`Property ${JSON.stringify(key)} should not start with _ which is a reserved prefix for Vue internals.`);
|
|
}
|
|
return has;
|
|
}
|
|
});
|
|
// dev only
|
|
// In dev mode, the proxy target exposes the same properties as seen on `this`
|
|
// for easier console inspection. In prod mode it will be an empty object so
|
|
// these properties definitions can be skipped.
|
|
function createDevRenderContext(instance) {
|
|
const target = {};
|
|
// expose internal instance for proxy handlers
|
|
Object.defineProperty(target, `_`, {
|
|
configurable: true,
|
|
enumerable: false,
|
|
get: () => instance
|
|
});
|
|
// expose public properties
|
|
Object.keys(publicPropertiesMap).forEach(key => {
|
|
Object.defineProperty(target, key, {
|
|
configurable: true,
|
|
enumerable: false,
|
|
get: () => publicPropertiesMap[key](instance),
|
|
// intercepted by the proxy so no need for implementation,
|
|
// but needed to prevent set errors
|
|
set: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP
|
|
});
|
|
});
|
|
return target;
|
|
}
|
|
// dev only
|
|
function exposePropsOnRenderContext(instance) {
|
|
const { ctx, propsOptions: [propsOptions] } = instance;
|
|
if (propsOptions) {
|
|
Object.keys(propsOptions).forEach(key => {
|
|
Object.defineProperty(ctx, key, {
|
|
enumerable: true,
|
|
configurable: true,
|
|
get: () => instance.props[key],
|
|
set: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP
|
|
});
|
|
});
|
|
}
|
|
}
|
|
// dev only
|
|
function exposeSetupStateOnRenderContext(instance) {
|
|
const { ctx, setupState } = instance;
|
|
Object.keys((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw)(setupState)).forEach(key => {
|
|
if (!setupState.__isScriptSetup && (key[0] === '$' || key[0] === '_')) {
|
|
warn(`setup() return property ${JSON.stringify(key)} should not start with "$" or "_" ` +
|
|
`which are reserved prefixes for Vue internals.`);
|
|
return;
|
|
}
|
|
Object.defineProperty(ctx, key, {
|
|
enumerable: true,
|
|
configurable: true,
|
|
get: () => setupState[key],
|
|
set: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP
|
|
});
|
|
});
|
|
}
|
|
|
|
const emptyAppContext = createAppContext();
|
|
let uid$1 = 0;
|
|
function createComponentInstance(vnode, parent, suspense) {
|
|
const type = vnode.type;
|
|
// inherit parent app context - or - if root, adopt from root vnode
|
|
const appContext = (parent ? parent.appContext : vnode.appContext) || emptyAppContext;
|
|
const instance = {
|
|
uid: uid$1++,
|
|
vnode,
|
|
type,
|
|
parent,
|
|
appContext,
|
|
root: null,
|
|
next: null,
|
|
subTree: null,
|
|
update: null,
|
|
scope: new _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.EffectScope(true /* detached */),
|
|
render: null,
|
|
proxy: null,
|
|
exposed: null,
|
|
exposeProxy: null,
|
|
withProxy: null,
|
|
provides: parent ? parent.provides : Object.create(appContext.provides),
|
|
accessCache: null,
|
|
renderCache: [],
|
|
// local resovled assets
|
|
components: null,
|
|
directives: null,
|
|
// resolved props and emits options
|
|
propsOptions: normalizePropsOptions(type, appContext),
|
|
emitsOptions: normalizeEmitsOptions(type, appContext),
|
|
// emit
|
|
emit: null,
|
|
emitted: null,
|
|
// props default value
|
|
propsDefaults: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ,
|
|
// inheritAttrs
|
|
inheritAttrs: type.inheritAttrs,
|
|
// state
|
|
ctx: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ,
|
|
data: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ,
|
|
props: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ,
|
|
attrs: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ,
|
|
slots: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ,
|
|
refs: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ,
|
|
setupState: _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ,
|
|
setupContext: null,
|
|
// suspense related
|
|
suspense,
|
|
suspenseId: suspense ? suspense.pendingId : 0,
|
|
asyncDep: null,
|
|
asyncResolved: false,
|
|
// lifecycle hooks
|
|
// not using enums here because it results in computed properties
|
|
isMounted: false,
|
|
isUnmounted: false,
|
|
isDeactivated: false,
|
|
bc: null,
|
|
c: null,
|
|
bm: null,
|
|
m: null,
|
|
bu: null,
|
|
u: null,
|
|
um: null,
|
|
bum: null,
|
|
da: null,
|
|
a: null,
|
|
rtg: null,
|
|
rtc: null,
|
|
ec: null,
|
|
sp: null
|
|
};
|
|
if ((true)) {
|
|
instance.ctx = createDevRenderContext(instance);
|
|
}
|
|
else {}
|
|
instance.root = parent ? parent.root : instance;
|
|
instance.emit = emit.bind(null, instance);
|
|
// apply custom element special handling
|
|
if (vnode.ce) {
|
|
vnode.ce(instance);
|
|
}
|
|
return instance;
|
|
}
|
|
let currentInstance = null;
|
|
const getCurrentInstance = () => currentInstance || currentRenderingInstance;
|
|
const setCurrentInstance = (instance) => {
|
|
currentInstance = instance;
|
|
instance.scope.on();
|
|
};
|
|
const unsetCurrentInstance = () => {
|
|
currentInstance && currentInstance.scope.off();
|
|
currentInstance = null;
|
|
};
|
|
const isBuiltInTag = /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.makeMap)('slot,component');
|
|
function validateComponentName(name, config) {
|
|
const appIsNativeTag = config.isNativeTag || _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NO;
|
|
if (isBuiltInTag(name) || appIsNativeTag(name)) {
|
|
warn('Do not use built-in or reserved HTML elements as component id: ' + name);
|
|
}
|
|
}
|
|
function isStatefulComponent(instance) {
|
|
return instance.vnode.shapeFlag & 4 /* STATEFUL_COMPONENT */;
|
|
}
|
|
let isInSSRComponentSetup = false;
|
|
function setupComponent(instance, isSSR = false) {
|
|
isInSSRComponentSetup = isSSR;
|
|
const { props, children } = instance.vnode;
|
|
const isStateful = isStatefulComponent(instance);
|
|
initProps(instance, props, isStateful, isSSR);
|
|
initSlots(instance, children);
|
|
const setupResult = isStateful
|
|
? setupStatefulComponent(instance, isSSR)
|
|
: undefined;
|
|
isInSSRComponentSetup = false;
|
|
return setupResult;
|
|
}
|
|
function setupStatefulComponent(instance, isSSR) {
|
|
const Component = instance.type;
|
|
if ((true)) {
|
|
if (Component.name) {
|
|
validateComponentName(Component.name, instance.appContext.config);
|
|
}
|
|
if (Component.components) {
|
|
const names = Object.keys(Component.components);
|
|
for (let i = 0; i < names.length; i++) {
|
|
validateComponentName(names[i], instance.appContext.config);
|
|
}
|
|
}
|
|
if (Component.directives) {
|
|
const names = Object.keys(Component.directives);
|
|
for (let i = 0; i < names.length; i++) {
|
|
validateDirectiveName(names[i]);
|
|
}
|
|
}
|
|
if (Component.compilerOptions && isRuntimeOnly()) {
|
|
warn(`"compilerOptions" is only supported when using a build of Vue that ` +
|
|
`includes the runtime compiler. Since you are using a runtime-only ` +
|
|
`build, the options should be passed via your build tool config instead.`);
|
|
}
|
|
}
|
|
// 0. create render proxy property access cache
|
|
instance.accessCache = Object.create(null);
|
|
// 1. create public instance / render proxy
|
|
// also mark it raw so it's never observed
|
|
instance.proxy = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.markRaw)(new Proxy(instance.ctx, PublicInstanceProxyHandlers));
|
|
if ((true)) {
|
|
exposePropsOnRenderContext(instance);
|
|
}
|
|
// 2. call setup()
|
|
const { setup } = Component;
|
|
if (setup) {
|
|
const setupContext = (instance.setupContext =
|
|
setup.length > 1 ? createSetupContext(instance) : null);
|
|
setCurrentInstance(instance);
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.pauseTracking)();
|
|
const setupResult = callWithErrorHandling(setup, instance, 0 /* SETUP_FUNCTION */, [( true) ? (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.shallowReadonly)(instance.props) : 0, setupContext]);
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.resetTracking)();
|
|
unsetCurrentInstance();
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isPromise)(setupResult)) {
|
|
setupResult.then(unsetCurrentInstance, unsetCurrentInstance);
|
|
if (isSSR) {
|
|
// return the promise so server-renderer can wait on it
|
|
return setupResult
|
|
.then((resolvedResult) => {
|
|
handleSetupResult(instance, resolvedResult, isSSR);
|
|
})
|
|
.catch(e => {
|
|
handleError(e, instance, 0 /* SETUP_FUNCTION */);
|
|
});
|
|
}
|
|
else {
|
|
// async setup returned Promise.
|
|
// bail here and wait for re-entry.
|
|
instance.asyncDep = setupResult;
|
|
}
|
|
}
|
|
else {
|
|
handleSetupResult(instance, setupResult, isSSR);
|
|
}
|
|
}
|
|
else {
|
|
finishComponentSetup(instance, isSSR);
|
|
}
|
|
}
|
|
function handleSetupResult(instance, setupResult, isSSR) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(setupResult)) {
|
|
// setup returned an inline render function
|
|
{
|
|
instance.render = setupResult;
|
|
}
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(setupResult)) {
|
|
if (( true) && isVNode(setupResult)) {
|
|
warn(`setup() should not return VNodes directly - ` +
|
|
`return a render function instead.`);
|
|
}
|
|
// setup returned bindings.
|
|
// assuming a render function compiled from template is present.
|
|
if (true) {
|
|
instance.devtoolsRawSetupState = setupResult;
|
|
}
|
|
instance.setupState = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.proxyRefs)(setupResult);
|
|
if ((true)) {
|
|
exposeSetupStateOnRenderContext(instance);
|
|
}
|
|
}
|
|
else if (( true) && setupResult !== undefined) {
|
|
warn(`setup() should return an object. Received: ${setupResult === null ? 'null' : typeof setupResult}`);
|
|
}
|
|
finishComponentSetup(instance, isSSR);
|
|
}
|
|
let compile;
|
|
let installWithProxy;
|
|
/**
|
|
* For runtime-dom to register the compiler.
|
|
* Note the exported method uses any to avoid d.ts relying on the compiler types.
|
|
*/
|
|
function registerRuntimeCompiler(_compile) {
|
|
compile = _compile;
|
|
installWithProxy = i => {
|
|
if (i.render._rc) {
|
|
i.withProxy = new Proxy(i.ctx, RuntimeCompiledPublicInstanceProxyHandlers);
|
|
}
|
|
};
|
|
}
|
|
// dev only
|
|
const isRuntimeOnly = () => !compile;
|
|
function finishComponentSetup(instance, isSSR, skipOptions) {
|
|
const Component = instance.type;
|
|
// template / render function normalization
|
|
if (!instance.render) {
|
|
// could be set from setup()
|
|
if (compile && !Component.render) {
|
|
const template = Component.template;
|
|
if (template) {
|
|
if ((true)) {
|
|
startMeasure(instance, `compile`);
|
|
}
|
|
const { isCustomElement, compilerOptions } = instance.appContext.config;
|
|
const { delimiters, compilerOptions: componentCompilerOptions } = Component;
|
|
const finalCompilerOptions = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({
|
|
isCustomElement,
|
|
delimiters
|
|
}, compilerOptions), componentCompilerOptions);
|
|
Component.render = compile(template, finalCompilerOptions);
|
|
if ((true)) {
|
|
endMeasure(instance, `compile`);
|
|
}
|
|
}
|
|
}
|
|
instance.render = (Component.render || _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP);
|
|
// for runtime-compiled render functions using `with` blocks, the render
|
|
// proxy used needs a different `has` handler which is more performant and
|
|
// also only allows a whitelist of globals to fallthrough.
|
|
if (installWithProxy) {
|
|
installWithProxy(instance);
|
|
}
|
|
}
|
|
// support for 2.x options
|
|
if (__VUE_OPTIONS_API__ && !(false )) {
|
|
setCurrentInstance(instance);
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.pauseTracking)();
|
|
applyOptions(instance);
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.resetTracking)();
|
|
unsetCurrentInstance();
|
|
}
|
|
// warn missing template/render
|
|
// the runtime compilation of template in SSR is done by server-render
|
|
if (( true) && !Component.render && instance.render === _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP && !isSSR) {
|
|
/* istanbul ignore if */
|
|
if (!compile && Component.template) {
|
|
warn(`Component provided template option but ` +
|
|
`runtime compilation is not supported in this build of Vue.` +
|
|
(` Configure your bundler to alias "vue" to "vue/dist/vue.esm-bundler.js".`
|
|
) /* should not happen */);
|
|
}
|
|
else {
|
|
warn(`Component is missing template or render function.`);
|
|
}
|
|
}
|
|
}
|
|
function createAttrsProxy(instance) {
|
|
return new Proxy(instance.attrs, ( true)
|
|
? {
|
|
get(target, key) {
|
|
markAttrsAccessed();
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.track)(instance, "get" /* GET */, '$attrs');
|
|
return target[key];
|
|
},
|
|
set() {
|
|
warn(`setupContext.attrs is readonly.`);
|
|
return false;
|
|
},
|
|
deleteProperty() {
|
|
warn(`setupContext.attrs is readonly.`);
|
|
return false;
|
|
}
|
|
}
|
|
: 0);
|
|
}
|
|
function createSetupContext(instance) {
|
|
const expose = exposed => {
|
|
if (( true) && instance.exposed) {
|
|
warn(`expose() should be called only once per setup().`);
|
|
}
|
|
instance.exposed = exposed || {};
|
|
};
|
|
let attrs;
|
|
if ((true)) {
|
|
// We use getters in dev in case libs like test-utils overwrite instance
|
|
// properties (overwrites should not be done in prod)
|
|
return Object.freeze({
|
|
get attrs() {
|
|
return attrs || (attrs = createAttrsProxy(instance));
|
|
},
|
|
get slots() {
|
|
return (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.shallowReadonly)(instance.slots);
|
|
},
|
|
get emit() {
|
|
return (event, ...args) => instance.emit(event, ...args);
|
|
},
|
|
expose
|
|
});
|
|
}
|
|
else {}
|
|
}
|
|
function getExposeProxy(instance) {
|
|
if (instance.exposed) {
|
|
return (instance.exposeProxy ||
|
|
(instance.exposeProxy = new Proxy((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.proxyRefs)((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.markRaw)(instance.exposed)), {
|
|
get(target, key) {
|
|
if (key in target) {
|
|
return target[key];
|
|
}
|
|
else if (key in publicPropertiesMap) {
|
|
return publicPropertiesMap[key](instance);
|
|
}
|
|
}
|
|
})));
|
|
}
|
|
}
|
|
const classifyRE = /(?:^|[-_])(\w)/g;
|
|
const classify = (str) => str.replace(classifyRE, c => c.toUpperCase()).replace(/[-_]/g, '');
|
|
function getComponentName(Component) {
|
|
return (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(Component)
|
|
? Component.displayName || Component.name
|
|
: Component.name;
|
|
}
|
|
/* istanbul ignore next */
|
|
function formatComponentName(instance, Component, isRoot = false) {
|
|
let name = getComponentName(Component);
|
|
if (!name && Component.__file) {
|
|
const match = Component.__file.match(/([^/\\]+)\.\w+$/);
|
|
if (match) {
|
|
name = match[1];
|
|
}
|
|
}
|
|
if (!name && instance && instance.parent) {
|
|
// try to infer the name based on reverse resolution
|
|
const inferFromRegistry = (registry) => {
|
|
for (const key in registry) {
|
|
if (registry[key] === Component) {
|
|
return key;
|
|
}
|
|
}
|
|
};
|
|
name =
|
|
inferFromRegistry(instance.components ||
|
|
instance.parent.type.components) || inferFromRegistry(instance.appContext.components);
|
|
}
|
|
return name ? classify(name) : isRoot ? `App` : `Anonymous`;
|
|
}
|
|
function isClassComponent(value) {
|
|
return (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(value) && '__vccOpts' in value;
|
|
}
|
|
|
|
const stack = [];
|
|
function pushWarningContext(vnode) {
|
|
stack.push(vnode);
|
|
}
|
|
function popWarningContext() {
|
|
stack.pop();
|
|
}
|
|
function warn(msg, ...args) {
|
|
// avoid props formatting or warn handler tracking deps that might be mutated
|
|
// during patch, leading to infinite recursion.
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.pauseTracking)();
|
|
const instance = stack.length ? stack[stack.length - 1].component : null;
|
|
const appWarnHandler = instance && instance.appContext.config.warnHandler;
|
|
const trace = getComponentTrace();
|
|
if (appWarnHandler) {
|
|
callWithErrorHandling(appWarnHandler, instance, 11 /* APP_WARN_HANDLER */, [
|
|
msg + args.join(''),
|
|
instance && instance.proxy,
|
|
trace
|
|
.map(({ vnode }) => `at <${formatComponentName(instance, vnode.type)}>`)
|
|
.join('\n'),
|
|
trace
|
|
]);
|
|
}
|
|
else {
|
|
const warnArgs = [`[Vue warn]: ${msg}`, ...args];
|
|
/* istanbul ignore if */
|
|
if (trace.length &&
|
|
// avoid spamming console during tests
|
|
!false) {
|
|
warnArgs.push(`\n`, ...formatTrace(trace));
|
|
}
|
|
console.warn(...warnArgs);
|
|
}
|
|
(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.resetTracking)();
|
|
}
|
|
function getComponentTrace() {
|
|
let currentVNode = stack[stack.length - 1];
|
|
if (!currentVNode) {
|
|
return [];
|
|
}
|
|
// we can't just use the stack because it will be incomplete during updates
|
|
// that did not start from the root. Re-construct the parent chain using
|
|
// instance parent pointers.
|
|
const normalizedStack = [];
|
|
while (currentVNode) {
|
|
const last = normalizedStack[0];
|
|
if (last && last.vnode === currentVNode) {
|
|
last.recurseCount++;
|
|
}
|
|
else {
|
|
normalizedStack.push({
|
|
vnode: currentVNode,
|
|
recurseCount: 0
|
|
});
|
|
}
|
|
const parentInstance = currentVNode.component && currentVNode.component.parent;
|
|
currentVNode = parentInstance && parentInstance.vnode;
|
|
}
|
|
return normalizedStack;
|
|
}
|
|
/* istanbul ignore next */
|
|
function formatTrace(trace) {
|
|
const logs = [];
|
|
trace.forEach((entry, i) => {
|
|
logs.push(...(i === 0 ? [] : [`\n`]), ...formatTraceEntry(entry));
|
|
});
|
|
return logs;
|
|
}
|
|
function formatTraceEntry({ vnode, recurseCount }) {
|
|
const postfix = recurseCount > 0 ? `... (${recurseCount} recursive calls)` : ``;
|
|
const isRoot = vnode.component ? vnode.component.parent == null : false;
|
|
const open = ` at <${formatComponentName(vnode.component, vnode.type, isRoot)}`;
|
|
const close = `>` + postfix;
|
|
return vnode.props
|
|
? [open, ...formatProps(vnode.props), close]
|
|
: [open + close];
|
|
}
|
|
/* istanbul ignore next */
|
|
function formatProps(props) {
|
|
const res = [];
|
|
const keys = Object.keys(props);
|
|
keys.slice(0, 3).forEach(key => {
|
|
res.push(...formatProp(key, props[key]));
|
|
});
|
|
if (keys.length > 3) {
|
|
res.push(` ...`);
|
|
}
|
|
return res;
|
|
}
|
|
/* istanbul ignore next */
|
|
function formatProp(key, value, raw) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(value)) {
|
|
value = JSON.stringify(value);
|
|
return raw ? value : [`${key}=${value}`];
|
|
}
|
|
else if (typeof value === 'number' ||
|
|
typeof value === 'boolean' ||
|
|
value == null) {
|
|
return raw ? value : [`${key}=${value}`];
|
|
}
|
|
else if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isRef)(value)) {
|
|
value = formatProp(key, (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw)(value.value), true);
|
|
return raw ? value : [`${key}=Ref<`, value, `>`];
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(value)) {
|
|
return [`${key}=fn${value.name ? `<${value.name}>` : ``}`];
|
|
}
|
|
else {
|
|
value = (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw)(value);
|
|
return raw ? value : [`${key}=`, value];
|
|
}
|
|
}
|
|
|
|
const ErrorTypeStrings = {
|
|
["sp" /* SERVER_PREFETCH */]: 'serverPrefetch hook',
|
|
["bc" /* BEFORE_CREATE */]: 'beforeCreate hook',
|
|
["c" /* CREATED */]: 'created hook',
|
|
["bm" /* BEFORE_MOUNT */]: 'beforeMount hook',
|
|
["m" /* MOUNTED */]: 'mounted hook',
|
|
["bu" /* BEFORE_UPDATE */]: 'beforeUpdate hook',
|
|
["u" /* UPDATED */]: 'updated',
|
|
["bum" /* BEFORE_UNMOUNT */]: 'beforeUnmount hook',
|
|
["um" /* UNMOUNTED */]: 'unmounted hook',
|
|
["a" /* ACTIVATED */]: 'activated hook',
|
|
["da" /* DEACTIVATED */]: 'deactivated hook',
|
|
["ec" /* ERROR_CAPTURED */]: 'errorCaptured hook',
|
|
["rtc" /* RENDER_TRACKED */]: 'renderTracked hook',
|
|
["rtg" /* RENDER_TRIGGERED */]: 'renderTriggered hook',
|
|
[0 /* SETUP_FUNCTION */]: 'setup function',
|
|
[1 /* RENDER_FUNCTION */]: 'render function',
|
|
[2 /* WATCH_GETTER */]: 'watcher getter',
|
|
[3 /* WATCH_CALLBACK */]: 'watcher callback',
|
|
[4 /* WATCH_CLEANUP */]: 'watcher cleanup function',
|
|
[5 /* NATIVE_EVENT_HANDLER */]: 'native event handler',
|
|
[6 /* COMPONENT_EVENT_HANDLER */]: 'component event handler',
|
|
[7 /* VNODE_HOOK */]: 'vnode hook',
|
|
[8 /* DIRECTIVE_HOOK */]: 'directive hook',
|
|
[9 /* TRANSITION_HOOK */]: 'transition hook',
|
|
[10 /* APP_ERROR_HANDLER */]: 'app errorHandler',
|
|
[11 /* APP_WARN_HANDLER */]: 'app warnHandler',
|
|
[12 /* FUNCTION_REF */]: 'ref function',
|
|
[13 /* ASYNC_COMPONENT_LOADER */]: 'async component loader',
|
|
[14 /* SCHEDULER */]: 'scheduler flush. This is likely a Vue internals bug. ' +
|
|
'Please open an issue at https://new-issue.vuejs.org/?repo=vuejs/vue-next'
|
|
};
|
|
function callWithErrorHandling(fn, instance, type, args) {
|
|
let res;
|
|
try {
|
|
res = args ? fn(...args) : fn();
|
|
}
|
|
catch (err) {
|
|
handleError(err, instance, type);
|
|
}
|
|
return res;
|
|
}
|
|
function callWithAsyncErrorHandling(fn, instance, type, args) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(fn)) {
|
|
const res = callWithErrorHandling(fn, instance, type, args);
|
|
if (res && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isPromise)(res)) {
|
|
res.catch(err => {
|
|
handleError(err, instance, type);
|
|
});
|
|
}
|
|
return res;
|
|
}
|
|
const values = [];
|
|
for (let i = 0; i < fn.length; i++) {
|
|
values.push(callWithAsyncErrorHandling(fn[i], instance, type, args));
|
|
}
|
|
return values;
|
|
}
|
|
function handleError(err, instance, type, throwInDev = true) {
|
|
const contextVNode = instance ? instance.vnode : null;
|
|
if (instance) {
|
|
let cur = instance.parent;
|
|
// the exposed instance is the render proxy to keep it consistent with 2.x
|
|
const exposedInstance = instance.proxy;
|
|
// in production the hook receives only the error code
|
|
const errorInfo = ( true) ? ErrorTypeStrings[type] : 0;
|
|
while (cur) {
|
|
const errorCapturedHooks = cur.ec;
|
|
if (errorCapturedHooks) {
|
|
for (let i = 0; i < errorCapturedHooks.length; i++) {
|
|
if (errorCapturedHooks[i](err, exposedInstance, errorInfo) === false) {
|
|
return;
|
|
}
|
|
}
|
|
}
|
|
cur = cur.parent;
|
|
}
|
|
// app-level handling
|
|
const appErrorHandler = instance.appContext.config.errorHandler;
|
|
if (appErrorHandler) {
|
|
callWithErrorHandling(appErrorHandler, null, 10 /* APP_ERROR_HANDLER */, [err, exposedInstance, errorInfo]);
|
|
return;
|
|
}
|
|
}
|
|
logError(err, type, contextVNode, throwInDev);
|
|
}
|
|
function logError(err, type, contextVNode, throwInDev = true) {
|
|
if ((true)) {
|
|
const info = ErrorTypeStrings[type];
|
|
if (contextVNode) {
|
|
pushWarningContext(contextVNode);
|
|
}
|
|
warn(`Unhandled error${info ? ` during execution of ${info}` : ``}`);
|
|
if (contextVNode) {
|
|
popWarningContext();
|
|
}
|
|
// crash in dev by default so it's more noticeable
|
|
if (throwInDev) {
|
|
throw err;
|
|
}
|
|
else {
|
|
console.error(err);
|
|
}
|
|
}
|
|
else {}
|
|
}
|
|
|
|
let isFlushing = false;
|
|
let isFlushPending = false;
|
|
const queue = [];
|
|
let flushIndex = 0;
|
|
const pendingPreFlushCbs = [];
|
|
let activePreFlushCbs = null;
|
|
let preFlushIndex = 0;
|
|
const pendingPostFlushCbs = [];
|
|
let activePostFlushCbs = null;
|
|
let postFlushIndex = 0;
|
|
const resolvedPromise = Promise.resolve();
|
|
let currentFlushPromise = null;
|
|
let currentPreFlushParentJob = null;
|
|
const RECURSION_LIMIT = 100;
|
|
function nextTick(fn) {
|
|
const p = currentFlushPromise || resolvedPromise;
|
|
return fn ? p.then(this ? fn.bind(this) : fn) : p;
|
|
}
|
|
// #2768
|
|
// Use binary-search to find a suitable position in the queue,
|
|
// so that the queue maintains the increasing order of job's id,
|
|
// which can prevent the job from being skipped and also can avoid repeated patching.
|
|
function findInsertionIndex(id) {
|
|
// the start index should be `flushIndex + 1`
|
|
let start = flushIndex + 1;
|
|
let end = queue.length;
|
|
while (start < end) {
|
|
const middle = (start + end) >>> 1;
|
|
const middleJobId = getId(queue[middle]);
|
|
middleJobId < id ? (start = middle + 1) : (end = middle);
|
|
}
|
|
return start;
|
|
}
|
|
function queueJob(job) {
|
|
// the dedupe search uses the startIndex argument of Array.includes()
|
|
// by default the search index includes the current job that is being run
|
|
// so it cannot recursively trigger itself again.
|
|
// if the job is a watch() callback, the search will start with a +1 index to
|
|
// allow it recursively trigger itself - it is the user's responsibility to
|
|
// ensure it doesn't end up in an infinite loop.
|
|
if ((!queue.length ||
|
|
!queue.includes(job, isFlushing && job.allowRecurse ? flushIndex + 1 : flushIndex)) &&
|
|
job !== currentPreFlushParentJob) {
|
|
if (job.id == null) {
|
|
queue.push(job);
|
|
}
|
|
else {
|
|
queue.splice(findInsertionIndex(job.id), 0, job);
|
|
}
|
|
queueFlush();
|
|
}
|
|
}
|
|
function queueFlush() {
|
|
if (!isFlushing && !isFlushPending) {
|
|
isFlushPending = true;
|
|
currentFlushPromise = resolvedPromise.then(flushJobs);
|
|
}
|
|
}
|
|
function invalidateJob(job) {
|
|
const i = queue.indexOf(job);
|
|
if (i > flushIndex) {
|
|
queue.splice(i, 1);
|
|
}
|
|
}
|
|
function queueCb(cb, activeQueue, pendingQueue, index) {
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(cb)) {
|
|
if (!activeQueue ||
|
|
!activeQueue.includes(cb, cb.allowRecurse ? index + 1 : index)) {
|
|
pendingQueue.push(cb);
|
|
}
|
|
}
|
|
else {
|
|
// if cb is an array, it is a component lifecycle hook which can only be
|
|
// triggered by a job, which is already deduped in the main queue, so
|
|
// we can skip duplicate check here to improve perf
|
|
pendingQueue.push(...cb);
|
|
}
|
|
queueFlush();
|
|
}
|
|
function queuePreFlushCb(cb) {
|
|
queueCb(cb, activePreFlushCbs, pendingPreFlushCbs, preFlushIndex);
|
|
}
|
|
function queuePostFlushCb(cb) {
|
|
queueCb(cb, activePostFlushCbs, pendingPostFlushCbs, postFlushIndex);
|
|
}
|
|
function flushPreFlushCbs(seen, parentJob = null) {
|
|
if (pendingPreFlushCbs.length) {
|
|
currentPreFlushParentJob = parentJob;
|
|
activePreFlushCbs = [...new Set(pendingPreFlushCbs)];
|
|
pendingPreFlushCbs.length = 0;
|
|
if ((true)) {
|
|
seen = seen || new Map();
|
|
}
|
|
for (preFlushIndex = 0; preFlushIndex < activePreFlushCbs.length; preFlushIndex++) {
|
|
if (( true) &&
|
|
checkRecursiveUpdates(seen, activePreFlushCbs[preFlushIndex])) {
|
|
continue;
|
|
}
|
|
activePreFlushCbs[preFlushIndex]();
|
|
}
|
|
activePreFlushCbs = null;
|
|
preFlushIndex = 0;
|
|
currentPreFlushParentJob = null;
|
|
// recursively flush until it drains
|
|
flushPreFlushCbs(seen, parentJob);
|
|
}
|
|
}
|
|
function flushPostFlushCbs(seen) {
|
|
if (pendingPostFlushCbs.length) {
|
|
const deduped = [...new Set(pendingPostFlushCbs)];
|
|
pendingPostFlushCbs.length = 0;
|
|
// #1947 already has active queue, nested flushPostFlushCbs call
|
|
if (activePostFlushCbs) {
|
|
activePostFlushCbs.push(...deduped);
|
|
return;
|
|
}
|
|
activePostFlushCbs = deduped;
|
|
if ((true)) {
|
|
seen = seen || new Map();
|
|
}
|
|
activePostFlushCbs.sort((a, b) => getId(a) - getId(b));
|
|
for (postFlushIndex = 0; postFlushIndex < activePostFlushCbs.length; postFlushIndex++) {
|
|
if (( true) &&
|
|
checkRecursiveUpdates(seen, activePostFlushCbs[postFlushIndex])) {
|
|
continue;
|
|
}
|
|
activePostFlushCbs[postFlushIndex]();
|
|
}
|
|
activePostFlushCbs = null;
|
|
postFlushIndex = 0;
|
|
}
|
|
}
|
|
const getId = (job) => job.id == null ? Infinity : job.id;
|
|
function flushJobs(seen) {
|
|
isFlushPending = false;
|
|
isFlushing = true;
|
|
if ((true)) {
|
|
seen = seen || new Map();
|
|
}
|
|
flushPreFlushCbs(seen);
|
|
// Sort queue before flush.
|
|
// This ensures that:
|
|
// 1. Components are updated from parent to child. (because parent is always
|
|
// created before the child so its render effect will have smaller
|
|
// priority number)
|
|
// 2. If a component is unmounted during a parent component's update,
|
|
// its update can be skipped.
|
|
queue.sort((a, b) => getId(a) - getId(b));
|
|
try {
|
|
for (flushIndex = 0; flushIndex < queue.length; flushIndex++) {
|
|
const job = queue[flushIndex];
|
|
if (job && job.active !== false) {
|
|
if (( true) && checkRecursiveUpdates(seen, job)) {
|
|
continue;
|
|
}
|
|
// console.log(`running:`, job.id)
|
|
callWithErrorHandling(job, null, 14 /* SCHEDULER */);
|
|
}
|
|
}
|
|
}
|
|
finally {
|
|
flushIndex = 0;
|
|
queue.length = 0;
|
|
flushPostFlushCbs(seen);
|
|
isFlushing = false;
|
|
currentFlushPromise = null;
|
|
// some postFlushCb queued jobs!
|
|
// keep flushing until it drains.
|
|
if (queue.length ||
|
|
pendingPreFlushCbs.length ||
|
|
pendingPostFlushCbs.length) {
|
|
flushJobs(seen);
|
|
}
|
|
}
|
|
}
|
|
function checkRecursiveUpdates(seen, fn) {
|
|
if (!seen.has(fn)) {
|
|
seen.set(fn, 1);
|
|
}
|
|
else {
|
|
const count = seen.get(fn);
|
|
if (count > RECURSION_LIMIT) {
|
|
const instance = fn.ownerInstance;
|
|
const componentName = instance && getComponentName(instance.type);
|
|
warn(`Maximum recursive updates exceeded${componentName ? ` in component <${componentName}>` : ``}. ` +
|
|
`This means you have a reactive effect that is mutating its own ` +
|
|
`dependencies and thus recursively triggering itself. Possible sources ` +
|
|
`include component template, render function, updated hook or ` +
|
|
`watcher source function.`);
|
|
return true;
|
|
}
|
|
else {
|
|
seen.set(fn, count + 1);
|
|
}
|
|
}
|
|
}
|
|
|
|
// Simple effect.
|
|
function watchEffect(effect, options) {
|
|
return doWatch(effect, null, options);
|
|
}
|
|
function watchPostEffect(effect, options) {
|
|
return doWatch(effect, null, (( true)
|
|
? Object.assign(options || {}, { flush: 'post' })
|
|
: 0));
|
|
}
|
|
function watchSyncEffect(effect, options) {
|
|
return doWatch(effect, null, (( true)
|
|
? Object.assign(options || {}, { flush: 'sync' })
|
|
: 0));
|
|
}
|
|
// initial value for watchers to trigger on undefined initial values
|
|
const INITIAL_WATCHER_VALUE = {};
|
|
// implementation
|
|
function watch(source, cb, options) {
|
|
if (( true) && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(cb)) {
|
|
warn(`\`watch(fn, options?)\` signature has been moved to a separate API. ` +
|
|
`Use \`watchEffect(fn, options?)\` instead. \`watch\` now only ` +
|
|
`supports \`watch(source, cb, options?) signature.`);
|
|
}
|
|
return doWatch(source, cb, options);
|
|
}
|
|
function doWatch(source, cb, { immediate, deep, flush, onTrack, onTrigger } = _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ) {
|
|
if (( true) && !cb) {
|
|
if (immediate !== undefined) {
|
|
warn(`watch() "immediate" option is only respected when using the ` +
|
|
`watch(source, callback, options?) signature.`);
|
|
}
|
|
if (deep !== undefined) {
|
|
warn(`watch() "deep" option is only respected when using the ` +
|
|
`watch(source, callback, options?) signature.`);
|
|
}
|
|
}
|
|
const warnInvalidSource = (s) => {
|
|
warn(`Invalid watch source: `, s, `A watch source can only be a getter/effect function, a ref, ` +
|
|
`a reactive object, or an array of these types.`);
|
|
};
|
|
const instance = currentInstance;
|
|
let getter;
|
|
let forceTrigger = false;
|
|
let isMultiSource = false;
|
|
if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isRef)(source)) {
|
|
getter = () => source.value;
|
|
forceTrigger = !!source._shallow;
|
|
}
|
|
else if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isReactive)(source)) {
|
|
getter = () => source;
|
|
deep = true;
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(source)) {
|
|
isMultiSource = true;
|
|
forceTrigger = source.some(_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isReactive);
|
|
getter = () => source.map(s => {
|
|
if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isRef)(s)) {
|
|
return s.value;
|
|
}
|
|
else if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isReactive)(s)) {
|
|
return traverse(s);
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(s)) {
|
|
return callWithErrorHandling(s, instance, 2 /* WATCH_GETTER */);
|
|
}
|
|
else {
|
|
( true) && warnInvalidSource(s);
|
|
}
|
|
});
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(source)) {
|
|
if (cb) {
|
|
// getter with cb
|
|
getter = () => callWithErrorHandling(source, instance, 2 /* WATCH_GETTER */);
|
|
}
|
|
else {
|
|
// no cb -> simple effect
|
|
getter = () => {
|
|
if (instance && instance.isUnmounted) {
|
|
return;
|
|
}
|
|
if (cleanup) {
|
|
cleanup();
|
|
}
|
|
return callWithAsyncErrorHandling(source, instance, 3 /* WATCH_CALLBACK */, [onInvalidate]);
|
|
};
|
|
}
|
|
}
|
|
else {
|
|
getter = _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP;
|
|
( true) && warnInvalidSource(source);
|
|
}
|
|
if (cb && deep) {
|
|
const baseGetter = getter;
|
|
getter = () => traverse(baseGetter());
|
|
}
|
|
let cleanup;
|
|
let onInvalidate = (fn) => {
|
|
cleanup = effect.onStop = () => {
|
|
callWithErrorHandling(fn, instance, 4 /* WATCH_CLEANUP */);
|
|
};
|
|
};
|
|
let oldValue = isMultiSource ? [] : INITIAL_WATCHER_VALUE;
|
|
const job = () => {
|
|
if (!effect.active) {
|
|
return;
|
|
}
|
|
if (cb) {
|
|
// watch(source, cb)
|
|
const newValue = effect.run();
|
|
if (deep ||
|
|
forceTrigger ||
|
|
(isMultiSource
|
|
? newValue.some((v, i) => (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasChanged)(v, oldValue[i]))
|
|
: (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hasChanged)(newValue, oldValue)) ||
|
|
(false )) {
|
|
// cleanup before running cb again
|
|
if (cleanup) {
|
|
cleanup();
|
|
}
|
|
callWithAsyncErrorHandling(cb, instance, 3 /* WATCH_CALLBACK */, [
|
|
newValue,
|
|
// pass undefined as the old value when it's changed for the first time
|
|
oldValue === INITIAL_WATCHER_VALUE ? undefined : oldValue,
|
|
onInvalidate
|
|
]);
|
|
oldValue = newValue;
|
|
}
|
|
}
|
|
else {
|
|
// watchEffect
|
|
effect.run();
|
|
}
|
|
};
|
|
// important: mark the job as a watcher callback so that scheduler knows
|
|
// it is allowed to self-trigger (#1727)
|
|
job.allowRecurse = !!cb;
|
|
let scheduler;
|
|
if (flush === 'sync') {
|
|
scheduler = job; // the scheduler function gets called directly
|
|
}
|
|
else if (flush === 'post') {
|
|
scheduler = () => queuePostRenderEffect(job, instance && instance.suspense);
|
|
}
|
|
else {
|
|
// default: 'pre'
|
|
scheduler = () => {
|
|
if (!instance || instance.isMounted) {
|
|
queuePreFlushCb(job);
|
|
}
|
|
else {
|
|
// with 'pre' option, the first call must happen before
|
|
// the component is mounted so it is called synchronously.
|
|
job();
|
|
}
|
|
};
|
|
}
|
|
const effect = new _vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.ReactiveEffect(getter, scheduler);
|
|
if ((true)) {
|
|
effect.onTrack = onTrack;
|
|
effect.onTrigger = onTrigger;
|
|
}
|
|
// initial run
|
|
if (cb) {
|
|
if (immediate) {
|
|
job();
|
|
}
|
|
else {
|
|
oldValue = effect.run();
|
|
}
|
|
}
|
|
else if (flush === 'post') {
|
|
queuePostRenderEffect(effect.run.bind(effect), instance && instance.suspense);
|
|
}
|
|
else {
|
|
effect.run();
|
|
}
|
|
return () => {
|
|
effect.stop();
|
|
if (instance && instance.scope) {
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.remove)(instance.scope.effects, effect);
|
|
}
|
|
};
|
|
}
|
|
// this.$watch
|
|
function instanceWatch(source, value, options) {
|
|
const publicThis = this.proxy;
|
|
const getter = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(source)
|
|
? source.includes('.')
|
|
? createPathGetter(publicThis, source)
|
|
: () => publicThis[source]
|
|
: source.bind(publicThis, publicThis);
|
|
let cb;
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(value)) {
|
|
cb = value;
|
|
}
|
|
else {
|
|
cb = value.handler;
|
|
options = value;
|
|
}
|
|
const cur = currentInstance;
|
|
setCurrentInstance(this);
|
|
const res = doWatch(getter, cb.bind(publicThis), options);
|
|
if (cur) {
|
|
setCurrentInstance(cur);
|
|
}
|
|
else {
|
|
unsetCurrentInstance();
|
|
}
|
|
return res;
|
|
}
|
|
function createPathGetter(ctx, path) {
|
|
const segments = path.split('.');
|
|
return () => {
|
|
let cur = ctx;
|
|
for (let i = 0; i < segments.length && cur; i++) {
|
|
cur = cur[segments[i]];
|
|
}
|
|
return cur;
|
|
};
|
|
}
|
|
function traverse(value, seen = new Set()) {
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(value) || value["__v_skip" /* SKIP */]) {
|
|
return value;
|
|
}
|
|
seen = seen || new Set();
|
|
if (seen.has(value)) {
|
|
return value;
|
|
}
|
|
seen.add(value);
|
|
if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isRef)(value)) {
|
|
traverse(value.value, seen);
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(value)) {
|
|
for (let i = 0; i < value.length; i++) {
|
|
traverse(value[i], seen);
|
|
}
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isSet)(value) || (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isMap)(value)) {
|
|
value.forEach((v) => {
|
|
traverse(v, seen);
|
|
});
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isPlainObject)(value)) {
|
|
for (const key in value) {
|
|
traverse(value[key], seen);
|
|
}
|
|
}
|
|
return value;
|
|
}
|
|
|
|
( true)
|
|
? Object.freeze({})
|
|
: 0;
|
|
( true) ? Object.freeze([]) : 0;
|
|
const isFunction = (val) => typeof val === 'function';
|
|
const isObject = (val) => val !== null && typeof val === 'object';
|
|
const isPromise = (val) => {
|
|
return isObject(val) && isFunction(val.then) && isFunction(val.catch);
|
|
};
|
|
|
|
// dev only
|
|
const warnRuntimeUsage = (method) => warn(`${method}() is a compiler-hint helper that is only usable inside ` +
|
|
`<script setup> of a single file component. Its arguments should be ` +
|
|
`compiled away and passing it at runtime has no effect.`);
|
|
// implementation
|
|
function defineProps() {
|
|
if ((true)) {
|
|
warnRuntimeUsage(`defineProps`);
|
|
}
|
|
return null;
|
|
}
|
|
// implementation
|
|
function defineEmits() {
|
|
if ((true)) {
|
|
warnRuntimeUsage(`defineEmits`);
|
|
}
|
|
return null;
|
|
}
|
|
/**
|
|
* Vue `<script setup>` compiler macro for declaring a component's exposed
|
|
* instance properties when it is accessed by a parent component via template
|
|
* refs.
|
|
*
|
|
* `<script setup>` components are closed by default - i.e. varaibles inside
|
|
* the `<script setup>` scope is not exposed to parent unless explicitly exposed
|
|
* via `defineExpose`.
|
|
*
|
|
* This is only usable inside `<script setup>`, is compiled away in the
|
|
* output and should **not** be actually called at runtime.
|
|
*/
|
|
function defineExpose(exposed) {
|
|
if ((true)) {
|
|
warnRuntimeUsage(`defineExpose`);
|
|
}
|
|
}
|
|
/**
|
|
* Vue `<script setup>` compiler macro for providing props default values when
|
|
* using type-based `defineProps` decalration.
|
|
*
|
|
* Example usage:
|
|
* ```ts
|
|
* withDefaults(defineProps<{
|
|
* size?: number
|
|
* labels?: string[]
|
|
* }>(), {
|
|
* size: 3,
|
|
* labels: () => ['default label']
|
|
* })
|
|
* ```
|
|
*
|
|
* This is only usable inside `<script setup>`, is compiled away in the output
|
|
* and should **not** be actually called at runtime.
|
|
*/
|
|
function withDefaults(props, defaults) {
|
|
if ((true)) {
|
|
warnRuntimeUsage(`withDefaults`);
|
|
}
|
|
return null;
|
|
}
|
|
function useSlots() {
|
|
return getContext().slots;
|
|
}
|
|
function useAttrs() {
|
|
return getContext().attrs;
|
|
}
|
|
function getContext() {
|
|
const i = getCurrentInstance();
|
|
if (( true) && !i) {
|
|
warn(`useContext() called without active instance.`);
|
|
}
|
|
return i.setupContext || (i.setupContext = createSetupContext(i));
|
|
}
|
|
/**
|
|
* Runtime helper for merging default declarations. Imported by compiled code
|
|
* only.
|
|
* @internal
|
|
*/
|
|
function mergeDefaults(
|
|
// the base props is compiler-generated and guaranteed to be in this shape.
|
|
props, defaults) {
|
|
for (const key in defaults) {
|
|
const val = props[key];
|
|
if (val) {
|
|
val.default = defaults[key];
|
|
}
|
|
else if (val === null) {
|
|
props[key] = { default: defaults[key] };
|
|
}
|
|
else if ((true)) {
|
|
warn(`props default key "${key}" has no corresponding declaration.`);
|
|
}
|
|
}
|
|
return props;
|
|
}
|
|
/**
|
|
* `<script setup>` helper for persisting the current instance context over
|
|
* async/await flows.
|
|
*
|
|
* `@vue/compiler-sfc` converts the following:
|
|
*
|
|
* ```ts
|
|
* const x = await foo()
|
|
* ```
|
|
*
|
|
* into:
|
|
*
|
|
* ```ts
|
|
* let __temp, __restore
|
|
* const x = (([__temp, __restore] = withAsyncContext(() => foo())),__temp=await __temp,__restore(),__temp)
|
|
* ```
|
|
* @internal
|
|
*/
|
|
function withAsyncContext(getAwaitable) {
|
|
const ctx = getCurrentInstance();
|
|
if (( true) && !ctx) {
|
|
warn(`withAsyncContext called without active current instance. ` +
|
|
`This is likely a bug.`);
|
|
}
|
|
let awaitable = getAwaitable();
|
|
unsetCurrentInstance();
|
|
if (isPromise(awaitable)) {
|
|
awaitable = awaitable.catch(e => {
|
|
setCurrentInstance(ctx);
|
|
throw e;
|
|
});
|
|
}
|
|
return [awaitable, () => setCurrentInstance(ctx)];
|
|
}
|
|
|
|
// Actual implementation
|
|
function h(type, propsOrChildren, children) {
|
|
const l = arguments.length;
|
|
if (l === 2) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(propsOrChildren) && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(propsOrChildren)) {
|
|
// single vnode without props
|
|
if (isVNode(propsOrChildren)) {
|
|
return createVNode(type, null, [propsOrChildren]);
|
|
}
|
|
// props without children
|
|
return createVNode(type, propsOrChildren);
|
|
}
|
|
else {
|
|
// omit props
|
|
return createVNode(type, null, propsOrChildren);
|
|
}
|
|
}
|
|
else {
|
|
if (l > 3) {
|
|
children = Array.prototype.slice.call(arguments, 2);
|
|
}
|
|
else if (l === 3 && isVNode(children)) {
|
|
children = [children];
|
|
}
|
|
return createVNode(type, propsOrChildren, children);
|
|
}
|
|
}
|
|
|
|
const ssrContextKey = Symbol(( true) ? `ssrContext` : 0);
|
|
const useSSRContext = () => {
|
|
{
|
|
const ctx = inject(ssrContextKey);
|
|
if (!ctx) {
|
|
warn(`Server rendering context not provided. Make sure to only call ` +
|
|
`useSSRContext() conditionally in the server build.`);
|
|
}
|
|
return ctx;
|
|
}
|
|
};
|
|
|
|
function initCustomFormatter() {
|
|
/* eslint-disable no-restricted-globals */
|
|
if ( false || typeof window === 'undefined') {
|
|
return;
|
|
}
|
|
const vueStyle = { style: 'color:#3ba776' };
|
|
const numberStyle = { style: 'color:#0b1bc9' };
|
|
const stringStyle = { style: 'color:#b62e24' };
|
|
const keywordStyle = { style: 'color:#9d288c' };
|
|
// custom formatter for Chrome
|
|
// https://www.mattzeunert.com/2016/02/19/custom-chrome-devtools-object-formatters.html
|
|
const formatter = {
|
|
header(obj) {
|
|
// TODO also format ComponentPublicInstance & ctx.slots/attrs in setup
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(obj)) {
|
|
return null;
|
|
}
|
|
if (obj.__isVue) {
|
|
return ['div', vueStyle, `VueInstance`];
|
|
}
|
|
else if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isRef)(obj)) {
|
|
return [
|
|
'div',
|
|
{},
|
|
['span', vueStyle, genRefFlag(obj)],
|
|
'<',
|
|
formatValue(obj.value),
|
|
`>`
|
|
];
|
|
}
|
|
else if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isReactive)(obj)) {
|
|
return [
|
|
'div',
|
|
{},
|
|
['span', vueStyle, 'Reactive'],
|
|
'<',
|
|
formatValue(obj),
|
|
`>${(0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isReadonly)(obj) ? ` (readonly)` : ``}`
|
|
];
|
|
}
|
|
else if ((0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.isReadonly)(obj)) {
|
|
return [
|
|
'div',
|
|
{},
|
|
['span', vueStyle, 'Readonly'],
|
|
'<',
|
|
formatValue(obj),
|
|
'>'
|
|
];
|
|
}
|
|
return null;
|
|
},
|
|
hasBody(obj) {
|
|
return obj && obj.__isVue;
|
|
},
|
|
body(obj) {
|
|
if (obj && obj.__isVue) {
|
|
return [
|
|
'div',
|
|
{},
|
|
...formatInstance(obj.$)
|
|
];
|
|
}
|
|
}
|
|
};
|
|
function formatInstance(instance) {
|
|
const blocks = [];
|
|
if (instance.type.props && instance.props) {
|
|
blocks.push(createInstanceBlock('props', (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw)(instance.props)));
|
|
}
|
|
if (instance.setupState !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ) {
|
|
blocks.push(createInstanceBlock('setup', instance.setupState));
|
|
}
|
|
if (instance.data !== _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ) {
|
|
blocks.push(createInstanceBlock('data', (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw)(instance.data)));
|
|
}
|
|
const computed = extractKeys(instance, 'computed');
|
|
if (computed) {
|
|
blocks.push(createInstanceBlock('computed', computed));
|
|
}
|
|
const injected = extractKeys(instance, 'inject');
|
|
if (injected) {
|
|
blocks.push(createInstanceBlock('injected', injected));
|
|
}
|
|
blocks.push([
|
|
'div',
|
|
{},
|
|
[
|
|
'span',
|
|
{
|
|
style: keywordStyle.style + ';opacity:0.66'
|
|
},
|
|
'$ (internal): '
|
|
],
|
|
['object', { object: instance }]
|
|
]);
|
|
return blocks;
|
|
}
|
|
function createInstanceBlock(type, target) {
|
|
target = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({}, target);
|
|
if (!Object.keys(target).length) {
|
|
return ['span', {}];
|
|
}
|
|
return [
|
|
'div',
|
|
{ style: 'line-height:1.25em;margin-bottom:0.6em' },
|
|
[
|
|
'div',
|
|
{
|
|
style: 'color:#476582'
|
|
},
|
|
type
|
|
],
|
|
[
|
|
'div',
|
|
{
|
|
style: 'padding-left:1.25em'
|
|
},
|
|
...Object.keys(target).map(key => {
|
|
return [
|
|
'div',
|
|
{},
|
|
['span', keywordStyle, key + ': '],
|
|
formatValue(target[key], false)
|
|
];
|
|
})
|
|
]
|
|
];
|
|
}
|
|
function formatValue(v, asRaw = true) {
|
|
if (typeof v === 'number') {
|
|
return ['span', numberStyle, v];
|
|
}
|
|
else if (typeof v === 'string') {
|
|
return ['span', stringStyle, JSON.stringify(v)];
|
|
}
|
|
else if (typeof v === 'boolean') {
|
|
return ['span', keywordStyle, v];
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(v)) {
|
|
return ['object', { object: asRaw ? (0,_vue_reactivity__WEBPACK_IMPORTED_MODULE_0__.toRaw)(v) : v }];
|
|
}
|
|
else {
|
|
return ['span', stringStyle, String(v)];
|
|
}
|
|
}
|
|
function extractKeys(instance, type) {
|
|
const Comp = instance.type;
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(Comp)) {
|
|
return;
|
|
}
|
|
const extracted = {};
|
|
for (const key in instance.ctx) {
|
|
if (isKeyOfType(Comp, key, type)) {
|
|
extracted[key] = instance.ctx[key];
|
|
}
|
|
}
|
|
return extracted;
|
|
}
|
|
function isKeyOfType(Comp, key, type) {
|
|
const opts = Comp[type];
|
|
if (((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(opts) && opts.includes(key)) ||
|
|
((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(opts) && key in opts)) {
|
|
return true;
|
|
}
|
|
if (Comp.extends && isKeyOfType(Comp.extends, key, type)) {
|
|
return true;
|
|
}
|
|
if (Comp.mixins && Comp.mixins.some(m => isKeyOfType(m, key, type))) {
|
|
return true;
|
|
}
|
|
}
|
|
function genRefFlag(v) {
|
|
if (v._shallow) {
|
|
return `ShallowRef`;
|
|
}
|
|
if (v.effect) {
|
|
return `ComputedRef`;
|
|
}
|
|
return `Ref`;
|
|
}
|
|
if (window.devtoolsFormatters) {
|
|
window.devtoolsFormatters.push(formatter);
|
|
}
|
|
else {
|
|
window.devtoolsFormatters = [formatter];
|
|
}
|
|
}
|
|
|
|
function withMemo(memo, render, cache, index) {
|
|
const cached = cache[index];
|
|
if (cached && isMemoSame(cached, memo)) {
|
|
return cached;
|
|
}
|
|
const ret = render();
|
|
// shallow clone
|
|
ret.memo = memo.slice();
|
|
return (cache[index] = ret);
|
|
}
|
|
function isMemoSame(cached, memo) {
|
|
const prev = cached.memo;
|
|
if (prev.length != memo.length) {
|
|
return false;
|
|
}
|
|
for (let i = 0; i < prev.length; i++) {
|
|
if (prev[i] !== memo[i]) {
|
|
return false;
|
|
}
|
|
}
|
|
// make sure to let parent block track it when returning cached
|
|
if (isBlockTreeEnabled > 0 && currentBlock) {
|
|
currentBlock.push(cached);
|
|
}
|
|
return true;
|
|
}
|
|
|
|
// Core API ------------------------------------------------------------------
|
|
const version = "3.2.6";
|
|
const _ssrUtils = {
|
|
createComponentInstance,
|
|
setupComponent,
|
|
renderComponentRoot,
|
|
setCurrentRenderingInstance,
|
|
isVNode,
|
|
normalizeVNode
|
|
};
|
|
/**
|
|
* SSR utils for \@vue/server-renderer. Only exposed in cjs builds.
|
|
* @internal
|
|
*/
|
|
const ssrUtils = (_ssrUtils );
|
|
/**
|
|
* @internal only exposed in compat builds
|
|
*/
|
|
const resolveFilter = null;
|
|
/**
|
|
* @internal only exposed in compat builds.
|
|
*/
|
|
const compatUtils = (null);
|
|
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/runtime-dom/dist/runtime-dom.esm-bundler.js":
|
|
/*!***********************************************************************!*\
|
|
!*** ./node_modules/@vue/runtime-dom/dist/runtime-dom.esm-bundler.js ***!
|
|
\***********************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "BaseTransition": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.BaseTransition),
|
|
/* harmony export */ "Comment": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.Comment),
|
|
/* harmony export */ "EffectScope": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.EffectScope),
|
|
/* harmony export */ "Fragment": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.Fragment),
|
|
/* harmony export */ "KeepAlive": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.KeepAlive),
|
|
/* harmony export */ "ReactiveEffect": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.ReactiveEffect),
|
|
/* harmony export */ "Static": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.Static),
|
|
/* harmony export */ "Suspense": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.Suspense),
|
|
/* harmony export */ "Teleport": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.Teleport),
|
|
/* harmony export */ "Text": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.Text),
|
|
/* harmony export */ "callWithAsyncErrorHandling": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.callWithAsyncErrorHandling),
|
|
/* harmony export */ "callWithErrorHandling": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.callWithErrorHandling),
|
|
/* harmony export */ "camelize": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.camelize),
|
|
/* harmony export */ "capitalize": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.capitalize),
|
|
/* harmony export */ "cloneVNode": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.cloneVNode),
|
|
/* harmony export */ "compatUtils": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.compatUtils),
|
|
/* harmony export */ "computed": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.computed),
|
|
/* harmony export */ "createBlock": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createBlock),
|
|
/* harmony export */ "createCommentVNode": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createCommentVNode),
|
|
/* harmony export */ "createElementBlock": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createElementBlock),
|
|
/* harmony export */ "createElementVNode": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createElementVNode),
|
|
/* harmony export */ "createHydrationRenderer": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createHydrationRenderer),
|
|
/* harmony export */ "createRenderer": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createRenderer),
|
|
/* harmony export */ "createSlots": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createSlots),
|
|
/* harmony export */ "createStaticVNode": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createStaticVNode),
|
|
/* harmony export */ "createTextVNode": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createTextVNode),
|
|
/* harmony export */ "createVNode": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createVNode),
|
|
/* harmony export */ "customRef": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.customRef),
|
|
/* harmony export */ "defineAsyncComponent": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.defineAsyncComponent),
|
|
/* harmony export */ "defineComponent": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.defineComponent),
|
|
/* harmony export */ "defineEmits": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.defineEmits),
|
|
/* harmony export */ "defineExpose": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.defineExpose),
|
|
/* harmony export */ "defineProps": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.defineProps),
|
|
/* harmony export */ "devtools": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.devtools),
|
|
/* harmony export */ "effect": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.effect),
|
|
/* harmony export */ "effectScope": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.effectScope),
|
|
/* harmony export */ "getCurrentInstance": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.getCurrentInstance),
|
|
/* harmony export */ "getCurrentScope": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.getCurrentScope),
|
|
/* harmony export */ "getTransitionRawChildren": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.getTransitionRawChildren),
|
|
/* harmony export */ "guardReactiveProps": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.guardReactiveProps),
|
|
/* harmony export */ "h": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.h),
|
|
/* harmony export */ "handleError": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.handleError),
|
|
/* harmony export */ "initCustomFormatter": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.initCustomFormatter),
|
|
/* harmony export */ "inject": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.inject),
|
|
/* harmony export */ "isMemoSame": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.isMemoSame),
|
|
/* harmony export */ "isProxy": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.isProxy),
|
|
/* harmony export */ "isReactive": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.isReactive),
|
|
/* harmony export */ "isReadonly": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.isReadonly),
|
|
/* harmony export */ "isRef": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.isRef),
|
|
/* harmony export */ "isRuntimeOnly": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.isRuntimeOnly),
|
|
/* harmony export */ "isVNode": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.isVNode),
|
|
/* harmony export */ "markRaw": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.markRaw),
|
|
/* harmony export */ "mergeDefaults": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.mergeDefaults),
|
|
/* harmony export */ "mergeProps": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.mergeProps),
|
|
/* harmony export */ "nextTick": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.nextTick),
|
|
/* harmony export */ "normalizeClass": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.normalizeClass),
|
|
/* harmony export */ "normalizeProps": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.normalizeProps),
|
|
/* harmony export */ "normalizeStyle": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.normalizeStyle),
|
|
/* harmony export */ "onActivated": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onActivated),
|
|
/* harmony export */ "onBeforeMount": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onBeforeMount),
|
|
/* harmony export */ "onBeforeUnmount": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onBeforeUnmount),
|
|
/* harmony export */ "onBeforeUpdate": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onBeforeUpdate),
|
|
/* harmony export */ "onDeactivated": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onDeactivated),
|
|
/* harmony export */ "onErrorCaptured": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onErrorCaptured),
|
|
/* harmony export */ "onMounted": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onMounted),
|
|
/* harmony export */ "onRenderTracked": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onRenderTracked),
|
|
/* harmony export */ "onRenderTriggered": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onRenderTriggered),
|
|
/* harmony export */ "onScopeDispose": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onScopeDispose),
|
|
/* harmony export */ "onServerPrefetch": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onServerPrefetch),
|
|
/* harmony export */ "onUnmounted": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onUnmounted),
|
|
/* harmony export */ "onUpdated": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onUpdated),
|
|
/* harmony export */ "openBlock": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.openBlock),
|
|
/* harmony export */ "popScopeId": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.popScopeId),
|
|
/* harmony export */ "provide": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.provide),
|
|
/* harmony export */ "proxyRefs": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.proxyRefs),
|
|
/* harmony export */ "pushScopeId": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.pushScopeId),
|
|
/* harmony export */ "queuePostFlushCb": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.queuePostFlushCb),
|
|
/* harmony export */ "reactive": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.reactive),
|
|
/* harmony export */ "readonly": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.readonly),
|
|
/* harmony export */ "ref": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.ref),
|
|
/* harmony export */ "registerRuntimeCompiler": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.registerRuntimeCompiler),
|
|
/* harmony export */ "renderList": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.renderList),
|
|
/* harmony export */ "renderSlot": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.renderSlot),
|
|
/* harmony export */ "resolveComponent": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.resolveComponent),
|
|
/* harmony export */ "resolveDirective": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.resolveDirective),
|
|
/* harmony export */ "resolveDynamicComponent": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.resolveDynamicComponent),
|
|
/* harmony export */ "resolveFilter": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.resolveFilter),
|
|
/* harmony export */ "resolveTransitionHooks": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.resolveTransitionHooks),
|
|
/* harmony export */ "setBlockTracking": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.setBlockTracking),
|
|
/* harmony export */ "setDevtoolsHook": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.setDevtoolsHook),
|
|
/* harmony export */ "setTransitionHooks": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.setTransitionHooks),
|
|
/* harmony export */ "shallowReactive": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.shallowReactive),
|
|
/* harmony export */ "shallowReadonly": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.shallowReadonly),
|
|
/* harmony export */ "shallowRef": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.shallowRef),
|
|
/* harmony export */ "ssrContextKey": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.ssrContextKey),
|
|
/* harmony export */ "ssrUtils": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.ssrUtils),
|
|
/* harmony export */ "stop": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.stop),
|
|
/* harmony export */ "toDisplayString": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.toDisplayString),
|
|
/* harmony export */ "toHandlerKey": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.toHandlerKey),
|
|
/* harmony export */ "toHandlers": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.toHandlers),
|
|
/* harmony export */ "toRaw": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.toRaw),
|
|
/* harmony export */ "toRef": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.toRef),
|
|
/* harmony export */ "toRefs": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.toRefs),
|
|
/* harmony export */ "transformVNodeArgs": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.transformVNodeArgs),
|
|
/* harmony export */ "triggerRef": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.triggerRef),
|
|
/* harmony export */ "unref": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.unref),
|
|
/* harmony export */ "useAttrs": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.useAttrs),
|
|
/* harmony export */ "useSSRContext": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.useSSRContext),
|
|
/* harmony export */ "useSlots": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.useSlots),
|
|
/* harmony export */ "useTransitionState": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.useTransitionState),
|
|
/* harmony export */ "version": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.version),
|
|
/* harmony export */ "warn": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn),
|
|
/* harmony export */ "watch": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.watch),
|
|
/* harmony export */ "watchEffect": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.watchEffect),
|
|
/* harmony export */ "watchPostEffect": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.watchPostEffect),
|
|
/* harmony export */ "watchSyncEffect": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.watchSyncEffect),
|
|
/* harmony export */ "withAsyncContext": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.withAsyncContext),
|
|
/* harmony export */ "withCtx": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.withCtx),
|
|
/* harmony export */ "withDefaults": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.withDefaults),
|
|
/* harmony export */ "withDirectives": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.withDirectives),
|
|
/* harmony export */ "withMemo": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.withMemo),
|
|
/* harmony export */ "withScopeId": () => (/* reexport safe */ _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.withScopeId),
|
|
/* harmony export */ "Transition": () => (/* binding */ Transition),
|
|
/* harmony export */ "TransitionGroup": () => (/* binding */ TransitionGroup),
|
|
/* harmony export */ "VueElement": () => (/* binding */ VueElement),
|
|
/* harmony export */ "createApp": () => (/* binding */ createApp),
|
|
/* harmony export */ "createSSRApp": () => (/* binding */ createSSRApp),
|
|
/* harmony export */ "defineCustomElement": () => (/* binding */ defineCustomElement),
|
|
/* harmony export */ "defineSSRCustomElement": () => (/* binding */ defineSSRCustomElement),
|
|
/* harmony export */ "hydrate": () => (/* binding */ hydrate),
|
|
/* harmony export */ "render": () => (/* binding */ render),
|
|
/* harmony export */ "useCssModule": () => (/* binding */ useCssModule),
|
|
/* harmony export */ "useCssVars": () => (/* binding */ useCssVars),
|
|
/* harmony export */ "vModelCheckbox": () => (/* binding */ vModelCheckbox),
|
|
/* harmony export */ "vModelDynamic": () => (/* binding */ vModelDynamic),
|
|
/* harmony export */ "vModelRadio": () => (/* binding */ vModelRadio),
|
|
/* harmony export */ "vModelSelect": () => (/* binding */ vModelSelect),
|
|
/* harmony export */ "vModelText": () => (/* binding */ vModelText),
|
|
/* harmony export */ "vShow": () => (/* binding */ vShow),
|
|
/* harmony export */ "withKeys": () => (/* binding */ withKeys),
|
|
/* harmony export */ "withModifiers": () => (/* binding */ withModifiers)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _vue_shared__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @vue/shared */ "./node_modules/@vue/shared/dist/shared.esm-bundler.js");
|
|
/* harmony import */ var _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @vue/runtime-core */ "./node_modules/@vue/runtime-core/dist/runtime-core.esm-bundler.js");
|
|
/* harmony import */ var _vue_runtime_core__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! @vue/runtime-core */ "./node_modules/@vue/reactivity/dist/reactivity.esm-bundler.js");
|
|
|
|
|
|
|
|
|
|
const svgNS = 'http://www.w3.org/2000/svg';
|
|
const doc = (typeof document !== 'undefined' ? document : null);
|
|
const staticTemplateCache = new Map();
|
|
const nodeOps = {
|
|
insert: (child, parent, anchor) => {
|
|
parent.insertBefore(child, anchor || null);
|
|
},
|
|
remove: child => {
|
|
const parent = child.parentNode;
|
|
if (parent) {
|
|
parent.removeChild(child);
|
|
}
|
|
},
|
|
createElement: (tag, isSVG, is, props) => {
|
|
const el = isSVG
|
|
? doc.createElementNS(svgNS, tag)
|
|
: doc.createElement(tag, is ? { is } : undefined);
|
|
if (tag === 'select' && props && props.multiple != null) {
|
|
el.setAttribute('multiple', props.multiple);
|
|
}
|
|
return el;
|
|
},
|
|
createText: text => doc.createTextNode(text),
|
|
createComment: text => doc.createComment(text),
|
|
setText: (node, text) => {
|
|
node.nodeValue = text;
|
|
},
|
|
setElementText: (el, text) => {
|
|
el.textContent = text;
|
|
},
|
|
parentNode: node => node.parentNode,
|
|
nextSibling: node => node.nextSibling,
|
|
querySelector: selector => doc.querySelector(selector),
|
|
setScopeId(el, id) {
|
|
el.setAttribute(id, '');
|
|
},
|
|
cloneNode(el) {
|
|
const cloned = el.cloneNode(true);
|
|
// #3072
|
|
// - in `patchDOMProp`, we store the actual value in the `el._value` property.
|
|
// - normally, elements using `:value` bindings will not be hoisted, but if
|
|
// the bound value is a constant, e.g. `:value="true"` - they do get
|
|
// hoisted.
|
|
// - in production, hoisted nodes are cloned when subsequent inserts, but
|
|
// cloneNode() does not copy the custom property we attached.
|
|
// - This may need to account for other custom DOM properties we attach to
|
|
// elements in addition to `_value` in the future.
|
|
if (`_value` in el) {
|
|
cloned._value = el._value;
|
|
}
|
|
return cloned;
|
|
},
|
|
// __UNSAFE__
|
|
// Reason: innerHTML.
|
|
// Static content here can only come from compiled templates.
|
|
// As long as the user only uses trusted templates, this is safe.
|
|
insertStaticContent(content, parent, anchor, isSVG) {
|
|
// <parent> before | first ... last | anchor </parent>
|
|
const before = anchor ? anchor.previousSibling : parent.lastChild;
|
|
let template = staticTemplateCache.get(content);
|
|
if (!template) {
|
|
const t = doc.createElement('template');
|
|
t.innerHTML = isSVG ? `<svg>${content}</svg>` : content;
|
|
template = t.content;
|
|
if (isSVG) {
|
|
// remove outer svg wrapper
|
|
const wrapper = template.firstChild;
|
|
while (wrapper.firstChild) {
|
|
template.appendChild(wrapper.firstChild);
|
|
}
|
|
template.removeChild(wrapper);
|
|
}
|
|
staticTemplateCache.set(content, template);
|
|
}
|
|
parent.insertBefore(template.cloneNode(true), anchor);
|
|
return [
|
|
// first
|
|
before ? before.nextSibling : parent.firstChild,
|
|
// last
|
|
anchor ? anchor.previousSibling : parent.lastChild
|
|
];
|
|
}
|
|
};
|
|
|
|
// compiler should normalize class + :class bindings on the same element
|
|
// into a single binding ['staticClass', dynamic]
|
|
function patchClass(el, value, isSVG) {
|
|
// directly setting className should be faster than setAttribute in theory
|
|
// if this is an element during a transition, take the temporary transition
|
|
// classes into account.
|
|
const transitionClasses = el._vtc;
|
|
if (transitionClasses) {
|
|
value = (value ? [value, ...transitionClasses] : [...transitionClasses]).join(' ');
|
|
}
|
|
if (value == null) {
|
|
el.removeAttribute('class');
|
|
}
|
|
else if (isSVG) {
|
|
el.setAttribute('class', value);
|
|
}
|
|
else {
|
|
el.className = value;
|
|
}
|
|
}
|
|
|
|
function patchStyle(el, prev, next) {
|
|
const style = el.style;
|
|
if (!next) {
|
|
el.removeAttribute('style');
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(next)) {
|
|
if (prev !== next) {
|
|
const current = style.display;
|
|
style.cssText = next;
|
|
// indicates that the `display` of the element is controlled by `v-show`,
|
|
// so we always keep the current `display` value regardless of the `style` value,
|
|
// thus handing over control to `v-show`.
|
|
if ('_vod' in el) {
|
|
style.display = current;
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
for (const key in next) {
|
|
setStyle(style, key, next[key]);
|
|
}
|
|
if (prev && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(prev)) {
|
|
for (const key in prev) {
|
|
if (next[key] == null) {
|
|
setStyle(style, key, '');
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
const importantRE = /\s*!important$/;
|
|
function setStyle(style, name, val) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(val)) {
|
|
val.forEach(v => setStyle(style, name, v));
|
|
}
|
|
else {
|
|
if (name.startsWith('--')) {
|
|
// custom property definition
|
|
style.setProperty(name, val);
|
|
}
|
|
else {
|
|
const prefixed = autoPrefix(style, name);
|
|
if (importantRE.test(val)) {
|
|
// !important
|
|
style.setProperty((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hyphenate)(prefixed), val.replace(importantRE, ''), 'important');
|
|
}
|
|
else {
|
|
style[prefixed] = val;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
const prefixes = ['Webkit', 'Moz', 'ms'];
|
|
const prefixCache = {};
|
|
function autoPrefix(style, rawName) {
|
|
const cached = prefixCache[rawName];
|
|
if (cached) {
|
|
return cached;
|
|
}
|
|
let name = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize)(rawName);
|
|
if (name !== 'filter' && name in style) {
|
|
return (prefixCache[rawName] = name);
|
|
}
|
|
name = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.capitalize)(name);
|
|
for (let i = 0; i < prefixes.length; i++) {
|
|
const prefixed = prefixes[i] + name;
|
|
if (prefixed in style) {
|
|
return (prefixCache[rawName] = prefixed);
|
|
}
|
|
}
|
|
return rawName;
|
|
}
|
|
|
|
const xlinkNS = 'http://www.w3.org/1999/xlink';
|
|
function patchAttr(el, key, value, isSVG, instance) {
|
|
if (isSVG && key.startsWith('xlink:')) {
|
|
if (value == null) {
|
|
el.removeAttributeNS(xlinkNS, key.slice(6, key.length));
|
|
}
|
|
else {
|
|
el.setAttributeNS(xlinkNS, key, value);
|
|
}
|
|
}
|
|
else {
|
|
// note we are only checking boolean attributes that don't have a
|
|
// corresponding dom prop of the same name here.
|
|
const isBoolean = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isSpecialBooleanAttr)(key);
|
|
if (value == null || (isBoolean && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.includeBooleanAttr)(value))) {
|
|
el.removeAttribute(key);
|
|
}
|
|
else {
|
|
el.setAttribute(key, isBoolean ? '' : value);
|
|
}
|
|
}
|
|
}
|
|
|
|
// __UNSAFE__
|
|
// functions. The user is responsible for using them with only trusted content.
|
|
function patchDOMProp(el, key, value,
|
|
// the following args are passed only due to potential innerHTML/textContent
|
|
// overriding existing VNodes, in which case the old tree must be properly
|
|
// unmounted.
|
|
prevChildren, parentComponent, parentSuspense, unmountChildren) {
|
|
if (key === 'innerHTML' || key === 'textContent') {
|
|
if (prevChildren) {
|
|
unmountChildren(prevChildren, parentComponent, parentSuspense);
|
|
}
|
|
el[key] = value == null ? '' : value;
|
|
return;
|
|
}
|
|
if (key === 'value' && el.tagName !== 'PROGRESS') {
|
|
// store value as _value as well since
|
|
// non-string values will be stringified.
|
|
el._value = value;
|
|
const newValue = value == null ? '' : value;
|
|
if (el.value !== newValue) {
|
|
el.value = newValue;
|
|
}
|
|
if (value == null) {
|
|
el.removeAttribute(key);
|
|
}
|
|
return;
|
|
}
|
|
if (value === '' || value == null) {
|
|
const type = typeof el[key];
|
|
if (type === 'boolean') {
|
|
// e.g. <select multiple> compiles to { multiple: '' }
|
|
el[key] = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.includeBooleanAttr)(value);
|
|
return;
|
|
}
|
|
else if (value == null && type === 'string') {
|
|
// e.g. <div :id="null">
|
|
el[key] = '';
|
|
el.removeAttribute(key);
|
|
return;
|
|
}
|
|
else if (type === 'number') {
|
|
// e.g. <img :width="null">
|
|
// the value of some IDL attr must be greater than 0, e.g. input.size = 0 -> error
|
|
try {
|
|
el[key] = 0;
|
|
}
|
|
catch (_a) { }
|
|
el.removeAttribute(key);
|
|
return;
|
|
}
|
|
}
|
|
// some properties perform value validation and throw
|
|
try {
|
|
el[key] = value;
|
|
}
|
|
catch (e) {
|
|
if ((true)) {
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`Failed setting prop "${key}" on <${el.tagName.toLowerCase()}>: ` +
|
|
`value ${value} is invalid.`, e);
|
|
}
|
|
}
|
|
}
|
|
|
|
// Async edge case fix requires storing an event listener's attach timestamp.
|
|
let _getNow = Date.now;
|
|
let skipTimestampCheck = false;
|
|
if (typeof window !== 'undefined') {
|
|
// Determine what event timestamp the browser is using. Annoyingly, the
|
|
// timestamp can either be hi-res (relative to page load) or low-res
|
|
// (relative to UNIX epoch), so in order to compare time we have to use the
|
|
// same timestamp type when saving the flush timestamp.
|
|
if (_getNow() > document.createEvent('Event').timeStamp) {
|
|
// if the low-res timestamp which is bigger than the event timestamp
|
|
// (which is evaluated AFTER) it means the event is using a hi-res timestamp,
|
|
// and we need to use the hi-res version for event listeners as well.
|
|
_getNow = () => performance.now();
|
|
}
|
|
// #3485: Firefox <= 53 has incorrect Event.timeStamp implementation
|
|
// and does not fire microtasks in between event propagation, so safe to exclude.
|
|
const ffMatch = navigator.userAgent.match(/firefox\/(\d+)/i);
|
|
skipTimestampCheck = !!(ffMatch && Number(ffMatch[1]) <= 53);
|
|
}
|
|
// To avoid the overhead of repeatedly calling performance.now(), we cache
|
|
// and use the same timestamp for all event listeners attached in the same tick.
|
|
let cachedNow = 0;
|
|
const p = Promise.resolve();
|
|
const reset = () => {
|
|
cachedNow = 0;
|
|
};
|
|
const getNow = () => cachedNow || (p.then(reset), (cachedNow = _getNow()));
|
|
function addEventListener(el, event, handler, options) {
|
|
el.addEventListener(event, handler, options);
|
|
}
|
|
function removeEventListener(el, event, handler, options) {
|
|
el.removeEventListener(event, handler, options);
|
|
}
|
|
function patchEvent(el, rawName, prevValue, nextValue, instance = null) {
|
|
// vei = vue event invokers
|
|
const invokers = el._vei || (el._vei = {});
|
|
const existingInvoker = invokers[rawName];
|
|
if (nextValue && existingInvoker) {
|
|
// patch
|
|
existingInvoker.value = nextValue;
|
|
}
|
|
else {
|
|
const [name, options] = parseName(rawName);
|
|
if (nextValue) {
|
|
// add
|
|
const invoker = (invokers[rawName] = createInvoker(nextValue, instance));
|
|
addEventListener(el, name, invoker, options);
|
|
}
|
|
else if (existingInvoker) {
|
|
// remove
|
|
removeEventListener(el, name, existingInvoker, options);
|
|
invokers[rawName] = undefined;
|
|
}
|
|
}
|
|
}
|
|
const optionsModifierRE = /(?:Once|Passive|Capture)$/;
|
|
function parseName(name) {
|
|
let options;
|
|
if (optionsModifierRE.test(name)) {
|
|
options = {};
|
|
let m;
|
|
while ((m = name.match(optionsModifierRE))) {
|
|
name = name.slice(0, name.length - m[0].length);
|
|
options[m[0].toLowerCase()] = true;
|
|
}
|
|
}
|
|
return [(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hyphenate)(name.slice(2)), options];
|
|
}
|
|
function createInvoker(initialValue, instance) {
|
|
const invoker = (e) => {
|
|
// async edge case #6566: inner click event triggers patch, event handler
|
|
// attached to outer element during patch, and triggered again. This
|
|
// happens because browsers fire microtask ticks between event propagation.
|
|
// the solution is simple: we save the timestamp when a handler is attached,
|
|
// and the handler would only fire if the event passed to it was fired
|
|
// AFTER it was attached.
|
|
const timeStamp = e.timeStamp || _getNow();
|
|
if (skipTimestampCheck || timeStamp >= invoker.attached - 1) {
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.callWithAsyncErrorHandling)(patchStopImmediatePropagation(e, invoker.value), instance, 5 /* NATIVE_EVENT_HANDLER */, [e]);
|
|
}
|
|
};
|
|
invoker.value = initialValue;
|
|
invoker.attached = getNow();
|
|
return invoker;
|
|
}
|
|
function patchStopImmediatePropagation(e, value) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(value)) {
|
|
const originalStop = e.stopImmediatePropagation;
|
|
e.stopImmediatePropagation = () => {
|
|
originalStop.call(e);
|
|
e._stopped = true;
|
|
};
|
|
return value.map(fn => (e) => !e._stopped && fn(e));
|
|
}
|
|
else {
|
|
return value;
|
|
}
|
|
}
|
|
|
|
const nativeOnRE = /^on[a-z]/;
|
|
const patchProp = (el, key, prevValue, nextValue, isSVG = false, prevChildren, parentComponent, parentSuspense, unmountChildren) => {
|
|
if (key === 'class') {
|
|
patchClass(el, nextValue, isSVG);
|
|
}
|
|
else if (key === 'style') {
|
|
patchStyle(el, prevValue, nextValue);
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isOn)(key)) {
|
|
// ignore v-model listeners
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isModelListener)(key)) {
|
|
patchEvent(el, key, prevValue, nextValue, parentComponent);
|
|
}
|
|
}
|
|
else if (key[0] === '.'
|
|
? ((key = key.slice(1)), true)
|
|
: key[0] === '^'
|
|
? ((key = key.slice(1)), false)
|
|
: shouldSetAsProp(el, key, nextValue, isSVG)) {
|
|
patchDOMProp(el, key, nextValue, prevChildren, parentComponent, parentSuspense, unmountChildren);
|
|
}
|
|
else {
|
|
// special case for <input v-model type="checkbox"> with
|
|
// :true-value & :false-value
|
|
// store value as dom properties since non-string values will be
|
|
// stringified.
|
|
if (key === 'true-value') {
|
|
el._trueValue = nextValue;
|
|
}
|
|
else if (key === 'false-value') {
|
|
el._falseValue = nextValue;
|
|
}
|
|
patchAttr(el, key, nextValue, isSVG);
|
|
}
|
|
};
|
|
function shouldSetAsProp(el, key, value, isSVG) {
|
|
if (isSVG) {
|
|
// most keys must be set as attribute on svg elements to work
|
|
// ...except innerHTML & textContent
|
|
if (key === 'innerHTML' || key === 'textContent') {
|
|
return true;
|
|
}
|
|
// or native onclick with function values
|
|
if (key in el && nativeOnRE.test(key) && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(value)) {
|
|
return true;
|
|
}
|
|
return false;
|
|
}
|
|
// spellcheck and draggable are numerated attrs, however their
|
|
// corresponding DOM properties are actually booleans - this leads to
|
|
// setting it with a string "false" value leading it to be coerced to
|
|
// `true`, so we need to always treat them as attributes.
|
|
// Note that `contentEditable` doesn't have this problem: its DOM
|
|
// property is also enumerated string values.
|
|
if (key === 'spellcheck' || key === 'draggable') {
|
|
return false;
|
|
}
|
|
// #1787, #2840 form property on form elements is readonly and must be set as
|
|
// attribute.
|
|
if (key === 'form') {
|
|
return false;
|
|
}
|
|
// #1526 <input list> must be set as attribute
|
|
if (key === 'list' && el.tagName === 'INPUT') {
|
|
return false;
|
|
}
|
|
// #2766 <textarea type> must be set as attribute
|
|
if (key === 'type' && el.tagName === 'TEXTAREA') {
|
|
return false;
|
|
}
|
|
// native onclick with string value, must be set as attribute
|
|
if (nativeOnRE.test(key) && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(value)) {
|
|
return false;
|
|
}
|
|
return key in el;
|
|
}
|
|
|
|
function defineCustomElement(options, hydate) {
|
|
const Comp = (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.defineComponent)(options);
|
|
class VueCustomElement extends VueElement {
|
|
constructor(initialProps) {
|
|
super(Comp, initialProps, hydate);
|
|
}
|
|
}
|
|
VueCustomElement.def = Comp;
|
|
return VueCustomElement;
|
|
}
|
|
const defineSSRCustomElement = ((options) => {
|
|
// @ts-ignore
|
|
return defineCustomElement(options, hydrate);
|
|
});
|
|
const BaseClass = (typeof HTMLElement !== 'undefined' ? HTMLElement : class {
|
|
});
|
|
class VueElement extends BaseClass {
|
|
constructor(_def, _props = {}, hydrate) {
|
|
super();
|
|
this._def = _def;
|
|
this._props = _props;
|
|
/**
|
|
* @internal
|
|
*/
|
|
this._instance = null;
|
|
this._connected = false;
|
|
this._resolved = false;
|
|
if (this.shadowRoot && hydrate) {
|
|
hydrate(this._createVNode(), this.shadowRoot);
|
|
}
|
|
else {
|
|
if (( true) && this.shadowRoot) {
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`Custom element has pre-rendered declarative shadow root but is not ` +
|
|
`defined as hydratable. Use \`defineSSRCustomElement\`.`);
|
|
}
|
|
this.attachShadow({ mode: 'open' });
|
|
}
|
|
// set initial attrs
|
|
for (let i = 0; i < this.attributes.length; i++) {
|
|
this._setAttr(this.attributes[i].name);
|
|
}
|
|
// watch future attr changes
|
|
const observer = new MutationObserver(mutations => {
|
|
for (const m of mutations) {
|
|
this._setAttr(m.attributeName);
|
|
}
|
|
});
|
|
observer.observe(this, { attributes: true });
|
|
}
|
|
connectedCallback() {
|
|
this._connected = true;
|
|
if (!this._instance) {
|
|
this._resolveDef();
|
|
render(this._createVNode(), this.shadowRoot);
|
|
}
|
|
}
|
|
disconnectedCallback() {
|
|
this._connected = false;
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.nextTick)(() => {
|
|
if (!this._connected) {
|
|
render(null, this.shadowRoot);
|
|
this._instance = null;
|
|
}
|
|
});
|
|
}
|
|
/**
|
|
* resolve inner component definition (handle possible async component)
|
|
*/
|
|
_resolveDef() {
|
|
if (this._resolved) {
|
|
return;
|
|
}
|
|
const resolve = (def) => {
|
|
this._resolved = true;
|
|
// check if there are props set pre-upgrade or connect
|
|
for (const key of Object.keys(this)) {
|
|
if (key[0] !== '_') {
|
|
this._setProp(key, this[key]);
|
|
}
|
|
}
|
|
const { props, styles } = def;
|
|
// defining getter/setters on prototype
|
|
const rawKeys = props ? ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(props) ? props : Object.keys(props)) : [];
|
|
for (const key of rawKeys.map(_vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize)) {
|
|
Object.defineProperty(this, key, {
|
|
get() {
|
|
return this._getProp(key);
|
|
},
|
|
set(val) {
|
|
this._setProp(key, val);
|
|
}
|
|
});
|
|
}
|
|
this._applyStyles(styles);
|
|
};
|
|
const asyncDef = this._def.__asyncLoader;
|
|
if (asyncDef) {
|
|
asyncDef().then(resolve);
|
|
}
|
|
else {
|
|
resolve(this._def);
|
|
}
|
|
}
|
|
_setAttr(key) {
|
|
this._setProp((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.camelize)(key), (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toNumber)(this.getAttribute(key)), false);
|
|
}
|
|
/**
|
|
* @internal
|
|
*/
|
|
_getProp(key) {
|
|
return this._props[key];
|
|
}
|
|
/**
|
|
* @internal
|
|
*/
|
|
_setProp(key, val, shouldReflect = true) {
|
|
if (val !== this._props[key]) {
|
|
this._props[key] = val;
|
|
if (this._instance) {
|
|
render(this._createVNode(), this.shadowRoot);
|
|
}
|
|
// reflect
|
|
if (shouldReflect) {
|
|
if (val === true) {
|
|
this.setAttribute((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hyphenate)(key), '');
|
|
}
|
|
else if (typeof val === 'string' || typeof val === 'number') {
|
|
this.setAttribute((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hyphenate)(key), val + '');
|
|
}
|
|
else if (!val) {
|
|
this.removeAttribute((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hyphenate)(key));
|
|
}
|
|
}
|
|
}
|
|
}
|
|
_createVNode() {
|
|
const vnode = (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createVNode)(this._def, (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({}, this._props));
|
|
if (!this._instance) {
|
|
vnode.ce = instance => {
|
|
this._instance = instance;
|
|
instance.isCE = true;
|
|
// HMR
|
|
if ((true)) {
|
|
instance.ceReload = newStyles => {
|
|
// alawys reset styles
|
|
if (this._styles) {
|
|
this._styles.forEach(s => this.shadowRoot.removeChild(s));
|
|
this._styles.length = 0;
|
|
}
|
|
this._applyStyles(newStyles);
|
|
// if this is an async component, ceReload is called from the inner
|
|
// component so no need to reload the async wrapper
|
|
if (!this._def.__asyncLoader) {
|
|
// reload
|
|
this._instance = null;
|
|
render(this._createVNode(), this.shadowRoot);
|
|
}
|
|
};
|
|
}
|
|
// intercept emit
|
|
instance.emit = (event, ...args) => {
|
|
this.dispatchEvent(new CustomEvent(event, {
|
|
detail: args
|
|
}));
|
|
};
|
|
// locate nearest Vue custom element parent for provide/inject
|
|
let parent = this;
|
|
while ((parent =
|
|
parent && (parent.parentNode || parent.host))) {
|
|
if (parent instanceof VueElement) {
|
|
instance.parent = parent._instance;
|
|
break;
|
|
}
|
|
}
|
|
};
|
|
}
|
|
return vnode;
|
|
}
|
|
_applyStyles(styles) {
|
|
if (styles) {
|
|
styles.forEach(css => {
|
|
const s = document.createElement('style');
|
|
s.textContent = css;
|
|
this.shadowRoot.appendChild(s);
|
|
// record for HMR
|
|
if ((true)) {
|
|
(this._styles || (this._styles = [])).push(s);
|
|
}
|
|
});
|
|
}
|
|
}
|
|
}
|
|
|
|
function useCssModule(name = '$style') {
|
|
/* istanbul ignore else */
|
|
{
|
|
const instance = (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.getCurrentInstance)();
|
|
if (!instance) {
|
|
( true) && (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`useCssModule must be called inside setup()`);
|
|
return _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ;
|
|
}
|
|
const modules = instance.type.__cssModules;
|
|
if (!modules) {
|
|
( true) && (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`Current instance does not have CSS modules injected.`);
|
|
return _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ;
|
|
}
|
|
const mod = modules[name];
|
|
if (!mod) {
|
|
( true) &&
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`Current instance does not have CSS module named "${name}".`);
|
|
return _vue_shared__WEBPACK_IMPORTED_MODULE_1__.EMPTY_OBJ;
|
|
}
|
|
return mod;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Runtime helper for SFC's CSS variable injection feature.
|
|
* @private
|
|
*/
|
|
function useCssVars(getter) {
|
|
const instance = (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.getCurrentInstance)();
|
|
/* istanbul ignore next */
|
|
if (!instance) {
|
|
( true) &&
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`useCssVars is called without current active component instance.`);
|
|
return;
|
|
}
|
|
const setVars = () => setVarsOnVNode(instance.subTree, getter(instance.proxy));
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.watchPostEffect)(setVars);
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onMounted)(() => {
|
|
const ob = new MutationObserver(setVars);
|
|
ob.observe(instance.subTree.el.parentNode, { childList: true });
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onUnmounted)(() => ob.disconnect());
|
|
});
|
|
}
|
|
function setVarsOnVNode(vnode, vars) {
|
|
if (vnode.shapeFlag & 128 /* SUSPENSE */) {
|
|
const suspense = vnode.suspense;
|
|
vnode = suspense.activeBranch;
|
|
if (suspense.pendingBranch && !suspense.isHydrating) {
|
|
suspense.effects.push(() => {
|
|
setVarsOnVNode(suspense.activeBranch, vars);
|
|
});
|
|
}
|
|
}
|
|
// drill down HOCs until it's a non-component vnode
|
|
while (vnode.component) {
|
|
vnode = vnode.component.subTree;
|
|
}
|
|
if (vnode.shapeFlag & 1 /* ELEMENT */ && vnode.el) {
|
|
setVarsOnNode(vnode.el, vars);
|
|
}
|
|
else if (vnode.type === _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.Fragment) {
|
|
vnode.children.forEach(c => setVarsOnVNode(c, vars));
|
|
}
|
|
else if (vnode.type === _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.Static) {
|
|
let { el, anchor } = vnode;
|
|
while (el) {
|
|
setVarsOnNode(el, vars);
|
|
if (el === anchor)
|
|
break;
|
|
el = el.nextSibling;
|
|
}
|
|
}
|
|
}
|
|
function setVarsOnNode(el, vars) {
|
|
if (el.nodeType === 1) {
|
|
const style = el.style;
|
|
for (const key in vars) {
|
|
style.setProperty(`--${key}`, vars[key]);
|
|
}
|
|
}
|
|
}
|
|
|
|
const TRANSITION = 'transition';
|
|
const ANIMATION = 'animation';
|
|
// DOM Transition is a higher-order-component based on the platform-agnostic
|
|
// base Transition component, with DOM-specific logic.
|
|
const Transition = (props, { slots }) => (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.h)(_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.BaseTransition, resolveTransitionProps(props), slots);
|
|
Transition.displayName = 'Transition';
|
|
const DOMTransitionPropsValidators = {
|
|
name: String,
|
|
type: String,
|
|
css: {
|
|
type: Boolean,
|
|
default: true
|
|
},
|
|
duration: [String, Number, Object],
|
|
enterFromClass: String,
|
|
enterActiveClass: String,
|
|
enterToClass: String,
|
|
appearFromClass: String,
|
|
appearActiveClass: String,
|
|
appearToClass: String,
|
|
leaveFromClass: String,
|
|
leaveActiveClass: String,
|
|
leaveToClass: String
|
|
};
|
|
const TransitionPropsValidators = (Transition.props =
|
|
/*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({}, _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.BaseTransition.props, DOMTransitionPropsValidators));
|
|
/**
|
|
* #3227 Incoming hooks may be merged into arrays when wrapping Transition
|
|
* with custom HOCs.
|
|
*/
|
|
const callHook = (hook, args = []) => {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(hook)) {
|
|
hook.forEach(h => h(...args));
|
|
}
|
|
else if (hook) {
|
|
hook(...args);
|
|
}
|
|
};
|
|
/**
|
|
* Check if a hook expects a callback (2nd arg), which means the user
|
|
* intends to explicitly control the end of the transition.
|
|
*/
|
|
const hasExplicitCallback = (hook) => {
|
|
return hook
|
|
? (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(hook)
|
|
? hook.some(h => h.length > 1)
|
|
: hook.length > 1
|
|
: false;
|
|
};
|
|
function resolveTransitionProps(rawProps) {
|
|
const baseProps = {};
|
|
for (const key in rawProps) {
|
|
if (!(key in DOMTransitionPropsValidators)) {
|
|
baseProps[key] = rawProps[key];
|
|
}
|
|
}
|
|
if (rawProps.css === false) {
|
|
return baseProps;
|
|
}
|
|
const { name = 'v', type, duration, enterFromClass = `${name}-enter-from`, enterActiveClass = `${name}-enter-active`, enterToClass = `${name}-enter-to`, appearFromClass = enterFromClass, appearActiveClass = enterActiveClass, appearToClass = enterToClass, leaveFromClass = `${name}-leave-from`, leaveActiveClass = `${name}-leave-active`, leaveToClass = `${name}-leave-to` } = rawProps;
|
|
const durations = normalizeDuration(duration);
|
|
const enterDuration = durations && durations[0];
|
|
const leaveDuration = durations && durations[1];
|
|
const { onBeforeEnter, onEnter, onEnterCancelled, onLeave, onLeaveCancelled, onBeforeAppear = onBeforeEnter, onAppear = onEnter, onAppearCancelled = onEnterCancelled } = baseProps;
|
|
const finishEnter = (el, isAppear, done) => {
|
|
removeTransitionClass(el, isAppear ? appearToClass : enterToClass);
|
|
removeTransitionClass(el, isAppear ? appearActiveClass : enterActiveClass);
|
|
done && done();
|
|
};
|
|
const finishLeave = (el, done) => {
|
|
removeTransitionClass(el, leaveToClass);
|
|
removeTransitionClass(el, leaveActiveClass);
|
|
done && done();
|
|
};
|
|
const makeEnterHook = (isAppear) => {
|
|
return (el, done) => {
|
|
const hook = isAppear ? onAppear : onEnter;
|
|
const resolve = () => finishEnter(el, isAppear, done);
|
|
callHook(hook, [el, resolve]);
|
|
nextFrame(() => {
|
|
removeTransitionClass(el, isAppear ? appearFromClass : enterFromClass);
|
|
addTransitionClass(el, isAppear ? appearToClass : enterToClass);
|
|
if (!hasExplicitCallback(hook)) {
|
|
whenTransitionEnds(el, type, enterDuration, resolve);
|
|
}
|
|
});
|
|
};
|
|
};
|
|
return (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)(baseProps, {
|
|
onBeforeEnter(el) {
|
|
callHook(onBeforeEnter, [el]);
|
|
addTransitionClass(el, enterFromClass);
|
|
addTransitionClass(el, enterActiveClass);
|
|
},
|
|
onBeforeAppear(el) {
|
|
callHook(onBeforeAppear, [el]);
|
|
addTransitionClass(el, appearFromClass);
|
|
addTransitionClass(el, appearActiveClass);
|
|
},
|
|
onEnter: makeEnterHook(false),
|
|
onAppear: makeEnterHook(true),
|
|
onLeave(el, done) {
|
|
const resolve = () => finishLeave(el, done);
|
|
addTransitionClass(el, leaveFromClass);
|
|
// force reflow so *-leave-from classes immediately take effect (#2593)
|
|
forceReflow();
|
|
addTransitionClass(el, leaveActiveClass);
|
|
nextFrame(() => {
|
|
removeTransitionClass(el, leaveFromClass);
|
|
addTransitionClass(el, leaveToClass);
|
|
if (!hasExplicitCallback(onLeave)) {
|
|
whenTransitionEnds(el, type, leaveDuration, resolve);
|
|
}
|
|
});
|
|
callHook(onLeave, [el, resolve]);
|
|
},
|
|
onEnterCancelled(el) {
|
|
finishEnter(el, false);
|
|
callHook(onEnterCancelled, [el]);
|
|
},
|
|
onAppearCancelled(el) {
|
|
finishEnter(el, true);
|
|
callHook(onAppearCancelled, [el]);
|
|
},
|
|
onLeaveCancelled(el) {
|
|
finishLeave(el);
|
|
callHook(onLeaveCancelled, [el]);
|
|
}
|
|
});
|
|
}
|
|
function normalizeDuration(duration) {
|
|
if (duration == null) {
|
|
return null;
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isObject)(duration)) {
|
|
return [NumberOf(duration.enter), NumberOf(duration.leave)];
|
|
}
|
|
else {
|
|
const n = NumberOf(duration);
|
|
return [n, n];
|
|
}
|
|
}
|
|
function NumberOf(val) {
|
|
const res = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toNumber)(val);
|
|
if ((true))
|
|
validateDuration(res);
|
|
return res;
|
|
}
|
|
function validateDuration(val) {
|
|
if (typeof val !== 'number') {
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`<transition> explicit duration is not a valid number - ` +
|
|
`got ${JSON.stringify(val)}.`);
|
|
}
|
|
else if (isNaN(val)) {
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`<transition> explicit duration is NaN - ` +
|
|
'the duration expression might be incorrect.');
|
|
}
|
|
}
|
|
function addTransitionClass(el, cls) {
|
|
cls.split(/\s+/).forEach(c => c && el.classList.add(c));
|
|
(el._vtc ||
|
|
(el._vtc = new Set())).add(cls);
|
|
}
|
|
function removeTransitionClass(el, cls) {
|
|
cls.split(/\s+/).forEach(c => c && el.classList.remove(c));
|
|
const { _vtc } = el;
|
|
if (_vtc) {
|
|
_vtc.delete(cls);
|
|
if (!_vtc.size) {
|
|
el._vtc = undefined;
|
|
}
|
|
}
|
|
}
|
|
function nextFrame(cb) {
|
|
requestAnimationFrame(() => {
|
|
requestAnimationFrame(cb);
|
|
});
|
|
}
|
|
let endId = 0;
|
|
function whenTransitionEnds(el, expectedType, explicitTimeout, resolve) {
|
|
const id = (el._endId = ++endId);
|
|
const resolveIfNotStale = () => {
|
|
if (id === el._endId) {
|
|
resolve();
|
|
}
|
|
};
|
|
if (explicitTimeout) {
|
|
return setTimeout(resolveIfNotStale, explicitTimeout);
|
|
}
|
|
const { type, timeout, propCount } = getTransitionInfo(el, expectedType);
|
|
if (!type) {
|
|
return resolve();
|
|
}
|
|
const endEvent = type + 'end';
|
|
let ended = 0;
|
|
const end = () => {
|
|
el.removeEventListener(endEvent, onEnd);
|
|
resolveIfNotStale();
|
|
};
|
|
const onEnd = (e) => {
|
|
if (e.target === el && ++ended >= propCount) {
|
|
end();
|
|
}
|
|
};
|
|
setTimeout(() => {
|
|
if (ended < propCount) {
|
|
end();
|
|
}
|
|
}, timeout + 1);
|
|
el.addEventListener(endEvent, onEnd);
|
|
}
|
|
function getTransitionInfo(el, expectedType) {
|
|
const styles = window.getComputedStyle(el);
|
|
// JSDOM may return undefined for transition properties
|
|
const getStyleProperties = (key) => (styles[key] || '').split(', ');
|
|
const transitionDelays = getStyleProperties(TRANSITION + 'Delay');
|
|
const transitionDurations = getStyleProperties(TRANSITION + 'Duration');
|
|
const transitionTimeout = getTimeout(transitionDelays, transitionDurations);
|
|
const animationDelays = getStyleProperties(ANIMATION + 'Delay');
|
|
const animationDurations = getStyleProperties(ANIMATION + 'Duration');
|
|
const animationTimeout = getTimeout(animationDelays, animationDurations);
|
|
let type = null;
|
|
let timeout = 0;
|
|
let propCount = 0;
|
|
/* istanbul ignore if */
|
|
if (expectedType === TRANSITION) {
|
|
if (transitionTimeout > 0) {
|
|
type = TRANSITION;
|
|
timeout = transitionTimeout;
|
|
propCount = transitionDurations.length;
|
|
}
|
|
}
|
|
else if (expectedType === ANIMATION) {
|
|
if (animationTimeout > 0) {
|
|
type = ANIMATION;
|
|
timeout = animationTimeout;
|
|
propCount = animationDurations.length;
|
|
}
|
|
}
|
|
else {
|
|
timeout = Math.max(transitionTimeout, animationTimeout);
|
|
type =
|
|
timeout > 0
|
|
? transitionTimeout > animationTimeout
|
|
? TRANSITION
|
|
: ANIMATION
|
|
: null;
|
|
propCount = type
|
|
? type === TRANSITION
|
|
? transitionDurations.length
|
|
: animationDurations.length
|
|
: 0;
|
|
}
|
|
const hasTransform = type === TRANSITION &&
|
|
/\b(transform|all)(,|$)/.test(styles[TRANSITION + 'Property']);
|
|
return {
|
|
type,
|
|
timeout,
|
|
propCount,
|
|
hasTransform
|
|
};
|
|
}
|
|
function getTimeout(delays, durations) {
|
|
while (delays.length < durations.length) {
|
|
delays = delays.concat(delays);
|
|
}
|
|
return Math.max(...durations.map((d, i) => toMs(d) + toMs(delays[i])));
|
|
}
|
|
// Old versions of Chromium (below 61.0.3163.100) formats floating pointer
|
|
// numbers in a locale-dependent way, using a comma instead of a dot.
|
|
// If comma is not replaced with a dot, the input will be rounded down
|
|
// (i.e. acting as a floor function) causing unexpected behaviors
|
|
function toMs(s) {
|
|
return Number(s.slice(0, -1).replace(',', '.')) * 1000;
|
|
}
|
|
// synchronously force layout to put elements into a certain state
|
|
function forceReflow() {
|
|
return document.body.offsetHeight;
|
|
}
|
|
|
|
const positionMap = new WeakMap();
|
|
const newPositionMap = new WeakMap();
|
|
const TransitionGroupImpl = {
|
|
name: 'TransitionGroup',
|
|
props: /*#__PURE__*/ (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({}, TransitionPropsValidators, {
|
|
tag: String,
|
|
moveClass: String
|
|
}),
|
|
setup(props, { slots }) {
|
|
const instance = (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.getCurrentInstance)();
|
|
const state = (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.useTransitionState)();
|
|
let prevChildren;
|
|
let children;
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.onUpdated)(() => {
|
|
// children is guaranteed to exist after initial render
|
|
if (!prevChildren.length) {
|
|
return;
|
|
}
|
|
const moveClass = props.moveClass || `${props.name || 'v'}-move`;
|
|
if (!hasCSSTransform(prevChildren[0].el, instance.vnode.el, moveClass)) {
|
|
return;
|
|
}
|
|
// we divide the work into three loops to avoid mixing DOM reads and writes
|
|
// in each iteration - which helps prevent layout thrashing.
|
|
prevChildren.forEach(callPendingCbs);
|
|
prevChildren.forEach(recordPosition);
|
|
const movedChildren = prevChildren.filter(applyTranslation);
|
|
// force reflow to put everything in position
|
|
forceReflow();
|
|
movedChildren.forEach(c => {
|
|
const el = c.el;
|
|
const style = el.style;
|
|
addTransitionClass(el, moveClass);
|
|
style.transform = style.webkitTransform = style.transitionDuration = '';
|
|
const cb = (el._moveCb = (e) => {
|
|
if (e && e.target !== el) {
|
|
return;
|
|
}
|
|
if (!e || /transform$/.test(e.propertyName)) {
|
|
el.removeEventListener('transitionend', cb);
|
|
el._moveCb = null;
|
|
removeTransitionClass(el, moveClass);
|
|
}
|
|
});
|
|
el.addEventListener('transitionend', cb);
|
|
});
|
|
});
|
|
return () => {
|
|
const rawProps = (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_2__.toRaw)(props);
|
|
const cssTransitionProps = resolveTransitionProps(rawProps);
|
|
let tag = rawProps.tag || _vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.Fragment;
|
|
prevChildren = children;
|
|
children = slots.default ? (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.getTransitionRawChildren)(slots.default()) : [];
|
|
for (let i = 0; i < children.length; i++) {
|
|
const child = children[i];
|
|
if (child.key != null) {
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.setTransitionHooks)(child, (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.resolveTransitionHooks)(child, cssTransitionProps, state, instance));
|
|
}
|
|
else if ((true)) {
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`<TransitionGroup> children must be keyed.`);
|
|
}
|
|
}
|
|
if (prevChildren) {
|
|
for (let i = 0; i < prevChildren.length; i++) {
|
|
const child = prevChildren[i];
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.setTransitionHooks)(child, (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.resolveTransitionHooks)(child, cssTransitionProps, state, instance));
|
|
positionMap.set(child, child.el.getBoundingClientRect());
|
|
}
|
|
}
|
|
return (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createVNode)(tag, null, children);
|
|
};
|
|
}
|
|
};
|
|
const TransitionGroup = TransitionGroupImpl;
|
|
function callPendingCbs(c) {
|
|
const el = c.el;
|
|
if (el._moveCb) {
|
|
el._moveCb();
|
|
}
|
|
if (el._enterCb) {
|
|
el._enterCb();
|
|
}
|
|
}
|
|
function recordPosition(c) {
|
|
newPositionMap.set(c, c.el.getBoundingClientRect());
|
|
}
|
|
function applyTranslation(c) {
|
|
const oldPos = positionMap.get(c);
|
|
const newPos = newPositionMap.get(c);
|
|
const dx = oldPos.left - newPos.left;
|
|
const dy = oldPos.top - newPos.top;
|
|
if (dx || dy) {
|
|
const s = c.el.style;
|
|
s.transform = s.webkitTransform = `translate(${dx}px,${dy}px)`;
|
|
s.transitionDuration = '0s';
|
|
return c;
|
|
}
|
|
}
|
|
function hasCSSTransform(el, root, moveClass) {
|
|
// Detect whether an element with the move class applied has
|
|
// CSS transitions. Since the element may be inside an entering
|
|
// transition at this very moment, we make a clone of it and remove
|
|
// all other transition classes applied to ensure only the move class
|
|
// is applied.
|
|
const clone = el.cloneNode();
|
|
if (el._vtc) {
|
|
el._vtc.forEach(cls => {
|
|
cls.split(/\s+/).forEach(c => c && clone.classList.remove(c));
|
|
});
|
|
}
|
|
moveClass.split(/\s+/).forEach(c => c && clone.classList.add(c));
|
|
clone.style.display = 'none';
|
|
const container = (root.nodeType === 1 ? root : root.parentNode);
|
|
container.appendChild(clone);
|
|
const { hasTransform } = getTransitionInfo(clone);
|
|
container.removeChild(clone);
|
|
return hasTransform;
|
|
}
|
|
|
|
const getModelAssigner = (vnode) => {
|
|
const fn = vnode.props['onUpdate:modelValue'];
|
|
return (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(fn) ? value => (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.invokeArrayFns)(fn, value) : fn;
|
|
};
|
|
function onCompositionStart(e) {
|
|
e.target.composing = true;
|
|
}
|
|
function onCompositionEnd(e) {
|
|
const target = e.target;
|
|
if (target.composing) {
|
|
target.composing = false;
|
|
trigger(target, 'input');
|
|
}
|
|
}
|
|
function trigger(el, type) {
|
|
const e = document.createEvent('HTMLEvents');
|
|
e.initEvent(type, true, true);
|
|
el.dispatchEvent(e);
|
|
}
|
|
// We are exporting the v-model runtime directly as vnode hooks so that it can
|
|
// be tree-shaken in case v-model is never used.
|
|
const vModelText = {
|
|
created(el, { modifiers: { lazy, trim, number } }, vnode) {
|
|
el._assign = getModelAssigner(vnode);
|
|
const castToNumber = number || (vnode.props && vnode.props.type === 'number');
|
|
addEventListener(el, lazy ? 'change' : 'input', e => {
|
|
if (e.target.composing)
|
|
return;
|
|
let domValue = el.value;
|
|
if (trim) {
|
|
domValue = domValue.trim();
|
|
}
|
|
else if (castToNumber) {
|
|
domValue = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toNumber)(domValue);
|
|
}
|
|
el._assign(domValue);
|
|
});
|
|
if (trim) {
|
|
addEventListener(el, 'change', () => {
|
|
el.value = el.value.trim();
|
|
});
|
|
}
|
|
if (!lazy) {
|
|
addEventListener(el, 'compositionstart', onCompositionStart);
|
|
addEventListener(el, 'compositionend', onCompositionEnd);
|
|
// Safari < 10.2 & UIWebView doesn't fire compositionend when
|
|
// switching focus before confirming composition choice
|
|
// this also fixes the issue where some browsers e.g. iOS Chrome
|
|
// fires "change" instead of "input" on autocomplete.
|
|
addEventListener(el, 'change', onCompositionEnd);
|
|
}
|
|
},
|
|
// set value on mounted so it's after min/max for type="range"
|
|
mounted(el, { value }) {
|
|
el.value = value == null ? '' : value;
|
|
},
|
|
beforeUpdate(el, { value, modifiers: { lazy, trim, number } }, vnode) {
|
|
el._assign = getModelAssigner(vnode);
|
|
// avoid clearing unresolved text. #2302
|
|
if (el.composing)
|
|
return;
|
|
if (document.activeElement === el) {
|
|
if (lazy) {
|
|
return;
|
|
}
|
|
if (trim && el.value.trim() === value) {
|
|
return;
|
|
}
|
|
if ((number || el.type === 'number') && (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toNumber)(el.value) === value) {
|
|
return;
|
|
}
|
|
}
|
|
const newValue = value == null ? '' : value;
|
|
if (el.value !== newValue) {
|
|
el.value = newValue;
|
|
}
|
|
}
|
|
};
|
|
const vModelCheckbox = {
|
|
// #4096 array checkboxes need to be deep traversed
|
|
deep: true,
|
|
created(el, _, vnode) {
|
|
el._assign = getModelAssigner(vnode);
|
|
addEventListener(el, 'change', () => {
|
|
const modelValue = el._modelValue;
|
|
const elementValue = getValue(el);
|
|
const checked = el.checked;
|
|
const assign = el._assign;
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(modelValue)) {
|
|
const index = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.looseIndexOf)(modelValue, elementValue);
|
|
const found = index !== -1;
|
|
if (checked && !found) {
|
|
assign(modelValue.concat(elementValue));
|
|
}
|
|
else if (!checked && found) {
|
|
const filtered = [...modelValue];
|
|
filtered.splice(index, 1);
|
|
assign(filtered);
|
|
}
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isSet)(modelValue)) {
|
|
const cloned = new Set(modelValue);
|
|
if (checked) {
|
|
cloned.add(elementValue);
|
|
}
|
|
else {
|
|
cloned.delete(elementValue);
|
|
}
|
|
assign(cloned);
|
|
}
|
|
else {
|
|
assign(getCheckboxValue(el, checked));
|
|
}
|
|
});
|
|
},
|
|
// set initial checked on mount to wait for true-value/false-value
|
|
mounted: setChecked,
|
|
beforeUpdate(el, binding, vnode) {
|
|
el._assign = getModelAssigner(vnode);
|
|
setChecked(el, binding, vnode);
|
|
}
|
|
};
|
|
function setChecked(el, { value, oldValue }, vnode) {
|
|
el._modelValue = value;
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(value)) {
|
|
el.checked = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.looseIndexOf)(value, vnode.props.value) > -1;
|
|
}
|
|
else if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isSet)(value)) {
|
|
el.checked = value.has(vnode.props.value);
|
|
}
|
|
else if (value !== oldValue) {
|
|
el.checked = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.looseEqual)(value, getCheckboxValue(el, true));
|
|
}
|
|
}
|
|
const vModelRadio = {
|
|
created(el, { value }, vnode) {
|
|
el.checked = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.looseEqual)(value, vnode.props.value);
|
|
el._assign = getModelAssigner(vnode);
|
|
addEventListener(el, 'change', () => {
|
|
el._assign(getValue(el));
|
|
});
|
|
},
|
|
beforeUpdate(el, { value, oldValue }, vnode) {
|
|
el._assign = getModelAssigner(vnode);
|
|
if (value !== oldValue) {
|
|
el.checked = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.looseEqual)(value, vnode.props.value);
|
|
}
|
|
}
|
|
};
|
|
const vModelSelect = {
|
|
// <select multiple> value need to be deep traversed
|
|
deep: true,
|
|
created(el, { value, modifiers: { number } }, vnode) {
|
|
const isSetModel = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isSet)(value);
|
|
addEventListener(el, 'change', () => {
|
|
const selectedVal = Array.prototype.filter
|
|
.call(el.options, (o) => o.selected)
|
|
.map((o) => number ? (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.toNumber)(getValue(o)) : getValue(o));
|
|
el._assign(el.multiple
|
|
? isSetModel
|
|
? new Set(selectedVal)
|
|
: selectedVal
|
|
: selectedVal[0]);
|
|
});
|
|
el._assign = getModelAssigner(vnode);
|
|
},
|
|
// set value in mounted & updated because <select> relies on its children
|
|
// <option>s.
|
|
mounted(el, { value }) {
|
|
setSelected(el, value);
|
|
},
|
|
beforeUpdate(el, _binding, vnode) {
|
|
el._assign = getModelAssigner(vnode);
|
|
},
|
|
updated(el, { value }) {
|
|
setSelected(el, value);
|
|
}
|
|
};
|
|
function setSelected(el, value) {
|
|
const isMultiple = el.multiple;
|
|
if (isMultiple && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(value) && !(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isSet)(value)) {
|
|
( true) &&
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`<select multiple v-model> expects an Array or Set value for its binding, ` +
|
|
`but got ${Object.prototype.toString.call(value).slice(8, -1)}.`);
|
|
return;
|
|
}
|
|
for (let i = 0, l = el.options.length; i < l; i++) {
|
|
const option = el.options[i];
|
|
const optionValue = getValue(option);
|
|
if (isMultiple) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isArray)(value)) {
|
|
option.selected = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.looseIndexOf)(value, optionValue) > -1;
|
|
}
|
|
else {
|
|
option.selected = value.has(optionValue);
|
|
}
|
|
}
|
|
else {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.looseEqual)(getValue(option), value)) {
|
|
if (el.selectedIndex !== i)
|
|
el.selectedIndex = i;
|
|
return;
|
|
}
|
|
}
|
|
}
|
|
if (!isMultiple && el.selectedIndex !== -1) {
|
|
el.selectedIndex = -1;
|
|
}
|
|
}
|
|
// retrieve raw value set via :value bindings
|
|
function getValue(el) {
|
|
return '_value' in el ? el._value : el.value;
|
|
}
|
|
// retrieve raw value for true-value and false-value set via :true-value or :false-value bindings
|
|
function getCheckboxValue(el, checked) {
|
|
const key = checked ? '_trueValue' : '_falseValue';
|
|
return key in el ? el[key] : checked;
|
|
}
|
|
const vModelDynamic = {
|
|
created(el, binding, vnode) {
|
|
callModelHook(el, binding, vnode, null, 'created');
|
|
},
|
|
mounted(el, binding, vnode) {
|
|
callModelHook(el, binding, vnode, null, 'mounted');
|
|
},
|
|
beforeUpdate(el, binding, vnode, prevVNode) {
|
|
callModelHook(el, binding, vnode, prevVNode, 'beforeUpdate');
|
|
},
|
|
updated(el, binding, vnode, prevVNode) {
|
|
callModelHook(el, binding, vnode, prevVNode, 'updated');
|
|
}
|
|
};
|
|
function callModelHook(el, binding, vnode, prevVNode, hook) {
|
|
let modelToUse;
|
|
switch (el.tagName) {
|
|
case 'SELECT':
|
|
modelToUse = vModelSelect;
|
|
break;
|
|
case 'TEXTAREA':
|
|
modelToUse = vModelText;
|
|
break;
|
|
default:
|
|
switch (vnode.props && vnode.props.type) {
|
|
case 'checkbox':
|
|
modelToUse = vModelCheckbox;
|
|
break;
|
|
case 'radio':
|
|
modelToUse = vModelRadio;
|
|
break;
|
|
default:
|
|
modelToUse = vModelText;
|
|
}
|
|
}
|
|
const fn = modelToUse[hook];
|
|
fn && fn(el, binding, vnode, prevVNode);
|
|
}
|
|
|
|
const systemModifiers = ['ctrl', 'shift', 'alt', 'meta'];
|
|
const modifierGuards = {
|
|
stop: e => e.stopPropagation(),
|
|
prevent: e => e.preventDefault(),
|
|
self: e => e.target !== e.currentTarget,
|
|
ctrl: e => !e.ctrlKey,
|
|
shift: e => !e.shiftKey,
|
|
alt: e => !e.altKey,
|
|
meta: e => !e.metaKey,
|
|
left: e => 'button' in e && e.button !== 0,
|
|
middle: e => 'button' in e && e.button !== 1,
|
|
right: e => 'button' in e && e.button !== 2,
|
|
exact: (e, modifiers) => systemModifiers.some(m => e[`${m}Key`] && !modifiers.includes(m))
|
|
};
|
|
/**
|
|
* @private
|
|
*/
|
|
const withModifiers = (fn, modifiers) => {
|
|
return (event, ...args) => {
|
|
for (let i = 0; i < modifiers.length; i++) {
|
|
const guard = modifierGuards[modifiers[i]];
|
|
if (guard && guard(event, modifiers))
|
|
return;
|
|
}
|
|
return fn(event, ...args);
|
|
};
|
|
};
|
|
// Kept for 2.x compat.
|
|
// Note: IE11 compat for `spacebar` and `del` is removed for now.
|
|
const keyNames = {
|
|
esc: 'escape',
|
|
space: ' ',
|
|
up: 'arrow-up',
|
|
left: 'arrow-left',
|
|
right: 'arrow-right',
|
|
down: 'arrow-down',
|
|
delete: 'backspace'
|
|
};
|
|
/**
|
|
* @private
|
|
*/
|
|
const withKeys = (fn, modifiers) => {
|
|
return (event) => {
|
|
if (!('key' in event)) {
|
|
return;
|
|
}
|
|
const eventKey = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.hyphenate)(event.key);
|
|
if (modifiers.some(k => k === eventKey || keyNames[k] === eventKey)) {
|
|
return fn(event);
|
|
}
|
|
};
|
|
};
|
|
|
|
const vShow = {
|
|
beforeMount(el, { value }, { transition }) {
|
|
el._vod = el.style.display === 'none' ? '' : el.style.display;
|
|
if (transition && value) {
|
|
transition.beforeEnter(el);
|
|
}
|
|
else {
|
|
setDisplay(el, value);
|
|
}
|
|
},
|
|
mounted(el, { value }, { transition }) {
|
|
if (transition && value) {
|
|
transition.enter(el);
|
|
}
|
|
},
|
|
updated(el, { value, oldValue }, { transition }) {
|
|
if (!value === !oldValue)
|
|
return;
|
|
if (transition) {
|
|
if (value) {
|
|
transition.beforeEnter(el);
|
|
setDisplay(el, true);
|
|
transition.enter(el);
|
|
}
|
|
else {
|
|
transition.leave(el, () => {
|
|
setDisplay(el, false);
|
|
});
|
|
}
|
|
}
|
|
else {
|
|
setDisplay(el, value);
|
|
}
|
|
},
|
|
beforeUnmount(el, { value }) {
|
|
setDisplay(el, value);
|
|
}
|
|
};
|
|
function setDisplay(el, value) {
|
|
el.style.display = value ? el._vod : 'none';
|
|
}
|
|
|
|
const rendererOptions = (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({ patchProp }, nodeOps);
|
|
// lazy create the renderer - this makes core renderer logic tree-shakable
|
|
// in case the user only imports reactivity utilities from Vue.
|
|
let renderer;
|
|
let enabledHydration = false;
|
|
function ensureRenderer() {
|
|
return (renderer ||
|
|
(renderer = (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createRenderer)(rendererOptions)));
|
|
}
|
|
function ensureHydrationRenderer() {
|
|
renderer = enabledHydration
|
|
? renderer
|
|
: (0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.createHydrationRenderer)(rendererOptions);
|
|
enabledHydration = true;
|
|
return renderer;
|
|
}
|
|
// use explicit type casts here to avoid import() calls in rolled-up d.ts
|
|
const render = ((...args) => {
|
|
ensureRenderer().render(...args);
|
|
});
|
|
const hydrate = ((...args) => {
|
|
ensureHydrationRenderer().hydrate(...args);
|
|
});
|
|
const createApp = ((...args) => {
|
|
const app = ensureRenderer().createApp(...args);
|
|
if ((true)) {
|
|
injectNativeTagCheck(app);
|
|
injectCompilerOptionsCheck(app);
|
|
}
|
|
const { mount } = app;
|
|
app.mount = (containerOrSelector) => {
|
|
const container = normalizeContainer(containerOrSelector);
|
|
if (!container)
|
|
return;
|
|
const component = app._component;
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isFunction)(component) && !component.render && !component.template) {
|
|
// __UNSAFE__
|
|
// Reason: potential execution of JS expressions in in-DOM template.
|
|
// The user must make sure the in-DOM template is trusted. If it's
|
|
// rendered by the server, the template should not contain any user data.
|
|
component.template = container.innerHTML;
|
|
}
|
|
// clear content before mounting
|
|
container.innerHTML = '';
|
|
const proxy = mount(container, false, container instanceof SVGElement);
|
|
if (container instanceof Element) {
|
|
container.removeAttribute('v-cloak');
|
|
container.setAttribute('data-v-app', '');
|
|
}
|
|
return proxy;
|
|
};
|
|
return app;
|
|
});
|
|
const createSSRApp = ((...args) => {
|
|
const app = ensureHydrationRenderer().createApp(...args);
|
|
if ((true)) {
|
|
injectNativeTagCheck(app);
|
|
injectCompilerOptionsCheck(app);
|
|
}
|
|
const { mount } = app;
|
|
app.mount = (containerOrSelector) => {
|
|
const container = normalizeContainer(containerOrSelector);
|
|
if (container) {
|
|
return mount(container, true, container instanceof SVGElement);
|
|
}
|
|
};
|
|
return app;
|
|
});
|
|
function injectNativeTagCheck(app) {
|
|
// Inject `isNativeTag`
|
|
// this is used for component name validation (dev only)
|
|
Object.defineProperty(app.config, 'isNativeTag', {
|
|
value: (tag) => (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isHTMLTag)(tag) || (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isSVGTag)(tag),
|
|
writable: false
|
|
});
|
|
}
|
|
// dev only
|
|
function injectCompilerOptionsCheck(app) {
|
|
if ((0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.isRuntimeOnly)()) {
|
|
const isCustomElement = app.config.isCustomElement;
|
|
Object.defineProperty(app.config, 'isCustomElement', {
|
|
get() {
|
|
return isCustomElement;
|
|
},
|
|
set() {
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`The \`isCustomElement\` config option is deprecated. Use ` +
|
|
`\`compilerOptions.isCustomElement\` instead.`);
|
|
}
|
|
});
|
|
const compilerOptions = app.config.compilerOptions;
|
|
const msg = `The \`compilerOptions\` config option is only respected when using ` +
|
|
`a build of Vue.js that includes the runtime compiler (aka "full build"). ` +
|
|
`Since you are using the runtime-only build, \`compilerOptions\` ` +
|
|
`must be passed to \`@vue/compiler-dom\` in the build setup instead.\n` +
|
|
`- For vue-loader: pass it via vue-loader's \`compilerOptions\` loader option.\n` +
|
|
`- For vue-cli: see https://cli.vuejs.org/guide/webpack.html#modifying-options-of-a-loader\n` +
|
|
`- For vite: pass it via @vitejs/plugin-vue options. See https://github.com/vitejs/vite/tree/main/packages/plugin-vue#example-for-passing-options-to-vuecompiler-dom`;
|
|
Object.defineProperty(app.config, 'compilerOptions', {
|
|
get() {
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(msg);
|
|
return compilerOptions;
|
|
},
|
|
set() {
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(msg);
|
|
}
|
|
});
|
|
}
|
|
}
|
|
function normalizeContainer(container) {
|
|
if ((0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(container)) {
|
|
const res = document.querySelector(container);
|
|
if (( true) && !res) {
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`Failed to mount app: mount target selector "${container}" returned null.`);
|
|
}
|
|
return res;
|
|
}
|
|
if (( true) &&
|
|
window.ShadowRoot &&
|
|
container instanceof window.ShadowRoot &&
|
|
container.mode === 'closed') {
|
|
(0,_vue_runtime_core__WEBPACK_IMPORTED_MODULE_0__.warn)(`mounting on a ShadowRoot with \`{mode: "closed"}\` may lead to unpredictable bugs`);
|
|
}
|
|
return container;
|
|
}
|
|
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/@vue/shared/dist/shared.esm-bundler.js":
|
|
/*!*************************************************************!*\
|
|
!*** ./node_modules/@vue/shared/dist/shared.esm-bundler.js ***!
|
|
\*************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "EMPTY_ARR": () => (/* binding */ EMPTY_ARR),
|
|
/* harmony export */ "EMPTY_OBJ": () => (/* binding */ EMPTY_OBJ),
|
|
/* harmony export */ "NO": () => (/* binding */ NO),
|
|
/* harmony export */ "NOOP": () => (/* binding */ NOOP),
|
|
/* harmony export */ "PatchFlagNames": () => (/* binding */ PatchFlagNames),
|
|
/* harmony export */ "babelParserDefaultPlugins": () => (/* binding */ babelParserDefaultPlugins),
|
|
/* harmony export */ "camelize": () => (/* binding */ camelize),
|
|
/* harmony export */ "capitalize": () => (/* binding */ capitalize),
|
|
/* harmony export */ "def": () => (/* binding */ def),
|
|
/* harmony export */ "escapeHtml": () => (/* binding */ escapeHtml),
|
|
/* harmony export */ "escapeHtmlComment": () => (/* binding */ escapeHtmlComment),
|
|
/* harmony export */ "extend": () => (/* binding */ extend),
|
|
/* harmony export */ "generateCodeFrame": () => (/* binding */ generateCodeFrame),
|
|
/* harmony export */ "getGlobalThis": () => (/* binding */ getGlobalThis),
|
|
/* harmony export */ "hasChanged": () => (/* binding */ hasChanged),
|
|
/* harmony export */ "hasOwn": () => (/* binding */ hasOwn),
|
|
/* harmony export */ "hyphenate": () => (/* binding */ hyphenate),
|
|
/* harmony export */ "includeBooleanAttr": () => (/* binding */ includeBooleanAttr),
|
|
/* harmony export */ "invokeArrayFns": () => (/* binding */ invokeArrayFns),
|
|
/* harmony export */ "isArray": () => (/* binding */ isArray),
|
|
/* harmony export */ "isBooleanAttr": () => (/* binding */ isBooleanAttr),
|
|
/* harmony export */ "isDate": () => (/* binding */ isDate),
|
|
/* harmony export */ "isFunction": () => (/* binding */ isFunction),
|
|
/* harmony export */ "isGloballyWhitelisted": () => (/* binding */ isGloballyWhitelisted),
|
|
/* harmony export */ "isHTMLTag": () => (/* binding */ isHTMLTag),
|
|
/* harmony export */ "isIntegerKey": () => (/* binding */ isIntegerKey),
|
|
/* harmony export */ "isKnownHtmlAttr": () => (/* binding */ isKnownHtmlAttr),
|
|
/* harmony export */ "isKnownSvgAttr": () => (/* binding */ isKnownSvgAttr),
|
|
/* harmony export */ "isMap": () => (/* binding */ isMap),
|
|
/* harmony export */ "isModelListener": () => (/* binding */ isModelListener),
|
|
/* harmony export */ "isNoUnitNumericStyleProp": () => (/* binding */ isNoUnitNumericStyleProp),
|
|
/* harmony export */ "isObject": () => (/* binding */ isObject),
|
|
/* harmony export */ "isOn": () => (/* binding */ isOn),
|
|
/* harmony export */ "isPlainObject": () => (/* binding */ isPlainObject),
|
|
/* harmony export */ "isPromise": () => (/* binding */ isPromise),
|
|
/* harmony export */ "isReservedProp": () => (/* binding */ isReservedProp),
|
|
/* harmony export */ "isSSRSafeAttrName": () => (/* binding */ isSSRSafeAttrName),
|
|
/* harmony export */ "isSVGTag": () => (/* binding */ isSVGTag),
|
|
/* harmony export */ "isSet": () => (/* binding */ isSet),
|
|
/* harmony export */ "isSpecialBooleanAttr": () => (/* binding */ isSpecialBooleanAttr),
|
|
/* harmony export */ "isString": () => (/* binding */ isString),
|
|
/* harmony export */ "isSymbol": () => (/* binding */ isSymbol),
|
|
/* harmony export */ "isVoidTag": () => (/* binding */ isVoidTag),
|
|
/* harmony export */ "looseEqual": () => (/* binding */ looseEqual),
|
|
/* harmony export */ "looseIndexOf": () => (/* binding */ looseIndexOf),
|
|
/* harmony export */ "makeMap": () => (/* binding */ makeMap),
|
|
/* harmony export */ "normalizeClass": () => (/* binding */ normalizeClass),
|
|
/* harmony export */ "normalizeProps": () => (/* binding */ normalizeProps),
|
|
/* harmony export */ "normalizeStyle": () => (/* binding */ normalizeStyle),
|
|
/* harmony export */ "objectToString": () => (/* binding */ objectToString),
|
|
/* harmony export */ "parseStringStyle": () => (/* binding */ parseStringStyle),
|
|
/* harmony export */ "propsToAttrMap": () => (/* binding */ propsToAttrMap),
|
|
/* harmony export */ "remove": () => (/* binding */ remove),
|
|
/* harmony export */ "slotFlagsText": () => (/* binding */ slotFlagsText),
|
|
/* harmony export */ "stringifyStyle": () => (/* binding */ stringifyStyle),
|
|
/* harmony export */ "toDisplayString": () => (/* binding */ toDisplayString),
|
|
/* harmony export */ "toHandlerKey": () => (/* binding */ toHandlerKey),
|
|
/* harmony export */ "toNumber": () => (/* binding */ toNumber),
|
|
/* harmony export */ "toRawType": () => (/* binding */ toRawType),
|
|
/* harmony export */ "toTypeString": () => (/* binding */ toTypeString)
|
|
/* harmony export */ });
|
|
/**
|
|
* Make a map and return a function for checking if a key
|
|
* is in that map.
|
|
* IMPORTANT: all calls of this function must be prefixed with
|
|
* \/\*#\_\_PURE\_\_\*\/
|
|
* So that rollup can tree-shake them if necessary.
|
|
*/
|
|
function makeMap(str, expectsLowerCase) {
|
|
const map = Object.create(null);
|
|
const list = str.split(',');
|
|
for (let i = 0; i < list.length; i++) {
|
|
map[list[i]] = true;
|
|
}
|
|
return expectsLowerCase ? val => !!map[val.toLowerCase()] : val => !!map[val];
|
|
}
|
|
|
|
/**
|
|
* dev only flag -> name mapping
|
|
*/
|
|
const PatchFlagNames = {
|
|
[1 /* TEXT */]: `TEXT`,
|
|
[2 /* CLASS */]: `CLASS`,
|
|
[4 /* STYLE */]: `STYLE`,
|
|
[8 /* PROPS */]: `PROPS`,
|
|
[16 /* FULL_PROPS */]: `FULL_PROPS`,
|
|
[32 /* HYDRATE_EVENTS */]: `HYDRATE_EVENTS`,
|
|
[64 /* STABLE_FRAGMENT */]: `STABLE_FRAGMENT`,
|
|
[128 /* KEYED_FRAGMENT */]: `KEYED_FRAGMENT`,
|
|
[256 /* UNKEYED_FRAGMENT */]: `UNKEYED_FRAGMENT`,
|
|
[512 /* NEED_PATCH */]: `NEED_PATCH`,
|
|
[1024 /* DYNAMIC_SLOTS */]: `DYNAMIC_SLOTS`,
|
|
[2048 /* DEV_ROOT_FRAGMENT */]: `DEV_ROOT_FRAGMENT`,
|
|
[-1 /* HOISTED */]: `HOISTED`,
|
|
[-2 /* BAIL */]: `BAIL`
|
|
};
|
|
|
|
/**
|
|
* Dev only
|
|
*/
|
|
const slotFlagsText = {
|
|
[1 /* STABLE */]: 'STABLE',
|
|
[2 /* DYNAMIC */]: 'DYNAMIC',
|
|
[3 /* FORWARDED */]: 'FORWARDED'
|
|
};
|
|
|
|
const GLOBALS_WHITE_LISTED = 'Infinity,undefined,NaN,isFinite,isNaN,parseFloat,parseInt,decodeURI,' +
|
|
'decodeURIComponent,encodeURI,encodeURIComponent,Math,Number,Date,Array,' +
|
|
'Object,Boolean,String,RegExp,Map,Set,JSON,Intl,BigInt';
|
|
const isGloballyWhitelisted = /*#__PURE__*/ makeMap(GLOBALS_WHITE_LISTED);
|
|
|
|
const range = 2;
|
|
function generateCodeFrame(source, start = 0, end = source.length) {
|
|
// Split the content into individual lines but capture the newline sequence
|
|
// that separated each line. This is important because the actual sequence is
|
|
// needed to properly take into account the full line length for offset
|
|
// comparison
|
|
let lines = source.split(/(\r?\n)/);
|
|
// Separate the lines and newline sequences into separate arrays for easier referencing
|
|
const newlineSequences = lines.filter((_, idx) => idx % 2 === 1);
|
|
lines = lines.filter((_, idx) => idx % 2 === 0);
|
|
let count = 0;
|
|
const res = [];
|
|
for (let i = 0; i < lines.length; i++) {
|
|
count +=
|
|
lines[i].length +
|
|
((newlineSequences[i] && newlineSequences[i].length) || 0);
|
|
if (count >= start) {
|
|
for (let j = i - range; j <= i + range || end > count; j++) {
|
|
if (j < 0 || j >= lines.length)
|
|
continue;
|
|
const line = j + 1;
|
|
res.push(`${line}${' '.repeat(Math.max(3 - String(line).length, 0))}| ${lines[j]}`);
|
|
const lineLength = lines[j].length;
|
|
const newLineSeqLength = (newlineSequences[j] && newlineSequences[j].length) || 0;
|
|
if (j === i) {
|
|
// push underline
|
|
const pad = start - (count - (lineLength + newLineSeqLength));
|
|
const length = Math.max(1, end > count ? lineLength - pad : end - start);
|
|
res.push(` | ` + ' '.repeat(pad) + '^'.repeat(length));
|
|
}
|
|
else if (j > i) {
|
|
if (end > count) {
|
|
const length = Math.max(Math.min(end - count, lineLength), 1);
|
|
res.push(` | ` + '^'.repeat(length));
|
|
}
|
|
count += lineLength + newLineSeqLength;
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
}
|
|
return res.join('\n');
|
|
}
|
|
|
|
/**
|
|
* On the client we only need to offer special cases for boolean attributes that
|
|
* have different names from their corresponding dom properties:
|
|
* - itemscope -> N/A
|
|
* - allowfullscreen -> allowFullscreen
|
|
* - formnovalidate -> formNoValidate
|
|
* - ismap -> isMap
|
|
* - nomodule -> noModule
|
|
* - novalidate -> noValidate
|
|
* - readonly -> readOnly
|
|
*/
|
|
const specialBooleanAttrs = `itemscope,allowfullscreen,formnovalidate,ismap,nomodule,novalidate,readonly`;
|
|
const isSpecialBooleanAttr = /*#__PURE__*/ makeMap(specialBooleanAttrs);
|
|
/**
|
|
* The full list is needed during SSR to produce the correct initial markup.
|
|
*/
|
|
const isBooleanAttr = /*#__PURE__*/ makeMap(specialBooleanAttrs +
|
|
`,async,autofocus,autoplay,controls,default,defer,disabled,hidden,` +
|
|
`loop,open,required,reversed,scoped,seamless,` +
|
|
`checked,muted,multiple,selected`);
|
|
/**
|
|
* Boolean attributes should be included if the value is truthy or ''.
|
|
* e.g. <select multiple> compiles to { multiple: '' }
|
|
*/
|
|
function includeBooleanAttr(value) {
|
|
return !!value || value === '';
|
|
}
|
|
const unsafeAttrCharRE = /[>/="'\u0009\u000a\u000c\u0020]/;
|
|
const attrValidationCache = {};
|
|
function isSSRSafeAttrName(name) {
|
|
if (attrValidationCache.hasOwnProperty(name)) {
|
|
return attrValidationCache[name];
|
|
}
|
|
const isUnsafe = unsafeAttrCharRE.test(name);
|
|
if (isUnsafe) {
|
|
console.error(`unsafe attribute name: ${name}`);
|
|
}
|
|
return (attrValidationCache[name] = !isUnsafe);
|
|
}
|
|
const propsToAttrMap = {
|
|
acceptCharset: 'accept-charset',
|
|
className: 'class',
|
|
htmlFor: 'for',
|
|
httpEquiv: 'http-equiv'
|
|
};
|
|
/**
|
|
* CSS properties that accept plain numbers
|
|
*/
|
|
const isNoUnitNumericStyleProp = /*#__PURE__*/ makeMap(`animation-iteration-count,border-image-outset,border-image-slice,` +
|
|
`border-image-width,box-flex,box-flex-group,box-ordinal-group,column-count,` +
|
|
`columns,flex,flex-grow,flex-positive,flex-shrink,flex-negative,flex-order,` +
|
|
`grid-row,grid-row-end,grid-row-span,grid-row-start,grid-column,` +
|
|
`grid-column-end,grid-column-span,grid-column-start,font-weight,line-clamp,` +
|
|
`line-height,opacity,order,orphans,tab-size,widows,z-index,zoom,` +
|
|
// SVG
|
|
`fill-opacity,flood-opacity,stop-opacity,stroke-dasharray,stroke-dashoffset,` +
|
|
`stroke-miterlimit,stroke-opacity,stroke-width`);
|
|
/**
|
|
* Known attributes, this is used for stringification of runtime static nodes
|
|
* so that we don't stringify bindings that cannot be set from HTML.
|
|
* Don't also forget to allow `data-*` and `aria-*`!
|
|
* Generated from https://developer.mozilla.org/en-US/docs/Web/HTML/Attributes
|
|
*/
|
|
const isKnownHtmlAttr = /*#__PURE__*/ makeMap(`accept,accept-charset,accesskey,action,align,allow,alt,async,` +
|
|
`autocapitalize,autocomplete,autofocus,autoplay,background,bgcolor,` +
|
|
`border,buffered,capture,challenge,charset,checked,cite,class,code,` +
|
|
`codebase,color,cols,colspan,content,contenteditable,contextmenu,controls,` +
|
|
`coords,crossorigin,csp,data,datetime,decoding,default,defer,dir,dirname,` +
|
|
`disabled,download,draggable,dropzone,enctype,enterkeyhint,for,form,` +
|
|
`formaction,formenctype,formmethod,formnovalidate,formtarget,headers,` +
|
|
`height,hidden,high,href,hreflang,http-equiv,icon,id,importance,integrity,` +
|
|
`ismap,itemprop,keytype,kind,label,lang,language,loading,list,loop,low,` +
|
|
`manifest,max,maxlength,minlength,media,min,multiple,muted,name,novalidate,` +
|
|
`open,optimum,pattern,ping,placeholder,poster,preload,radiogroup,readonly,` +
|
|
`referrerpolicy,rel,required,reversed,rows,rowspan,sandbox,scope,scoped,` +
|
|
`selected,shape,size,sizes,slot,span,spellcheck,src,srcdoc,srclang,srcset,` +
|
|
`start,step,style,summary,tabindex,target,title,translate,type,usemap,` +
|
|
`value,width,wrap`);
|
|
/**
|
|
* Generated from https://developer.mozilla.org/en-US/docs/Web/SVG/Attribute
|
|
*/
|
|
const isKnownSvgAttr = /*#__PURE__*/ makeMap(`xmlns,accent-height,accumulate,additive,alignment-baseline,alphabetic,amplitude,` +
|
|
`arabic-form,ascent,attributeName,attributeType,azimuth,baseFrequency,` +
|
|
`baseline-shift,baseProfile,bbox,begin,bias,by,calcMode,cap-height,class,` +
|
|
`clip,clipPathUnits,clip-path,clip-rule,color,color-interpolation,` +
|
|
`color-interpolation-filters,color-profile,color-rendering,` +
|
|
`contentScriptType,contentStyleType,crossorigin,cursor,cx,cy,d,decelerate,` +
|
|
`descent,diffuseConstant,direction,display,divisor,dominant-baseline,dur,dx,` +
|
|
`dy,edgeMode,elevation,enable-background,end,exponent,fill,fill-opacity,` +
|
|
`fill-rule,filter,filterRes,filterUnits,flood-color,flood-opacity,` +
|
|
`font-family,font-size,font-size-adjust,font-stretch,font-style,` +
|
|
`font-variant,font-weight,format,from,fr,fx,fy,g1,g2,glyph-name,` +
|
|
`glyph-orientation-horizontal,glyph-orientation-vertical,glyphRef,` +
|
|
`gradientTransform,gradientUnits,hanging,height,href,hreflang,horiz-adv-x,` +
|
|
`horiz-origin-x,id,ideographic,image-rendering,in,in2,intercept,k,k1,k2,k3,` +
|
|
`k4,kernelMatrix,kernelUnitLength,kerning,keyPoints,keySplines,keyTimes,` +
|
|
`lang,lengthAdjust,letter-spacing,lighting-color,limitingConeAngle,local,` +
|
|
`marker-end,marker-mid,marker-start,markerHeight,markerUnits,markerWidth,` +
|
|
`mask,maskContentUnits,maskUnits,mathematical,max,media,method,min,mode,` +
|
|
`name,numOctaves,offset,opacity,operator,order,orient,orientation,origin,` +
|
|
`overflow,overline-position,overline-thickness,panose-1,paint-order,path,` +
|
|
`pathLength,patternContentUnits,patternTransform,patternUnits,ping,` +
|
|
`pointer-events,points,pointsAtX,pointsAtY,pointsAtZ,preserveAlpha,` +
|
|
`preserveAspectRatio,primitiveUnits,r,radius,referrerPolicy,refX,refY,rel,` +
|
|
`rendering-intent,repeatCount,repeatDur,requiredExtensions,requiredFeatures,` +
|
|
`restart,result,rotate,rx,ry,scale,seed,shape-rendering,slope,spacing,` +
|
|
`specularConstant,specularExponent,speed,spreadMethod,startOffset,` +
|
|
`stdDeviation,stemh,stemv,stitchTiles,stop-color,stop-opacity,` +
|
|
`strikethrough-position,strikethrough-thickness,string,stroke,` +
|
|
`stroke-dasharray,stroke-dashoffset,stroke-linecap,stroke-linejoin,` +
|
|
`stroke-miterlimit,stroke-opacity,stroke-width,style,surfaceScale,` +
|
|
`systemLanguage,tabindex,tableValues,target,targetX,targetY,text-anchor,` +
|
|
`text-decoration,text-rendering,textLength,to,transform,transform-origin,` +
|
|
`type,u1,u2,underline-position,underline-thickness,unicode,unicode-bidi,` +
|
|
`unicode-range,units-per-em,v-alphabetic,v-hanging,v-ideographic,` +
|
|
`v-mathematical,values,vector-effect,version,vert-adv-y,vert-origin-x,` +
|
|
`vert-origin-y,viewBox,viewTarget,visibility,width,widths,word-spacing,` +
|
|
`writing-mode,x,x-height,x1,x2,xChannelSelector,xlink:actuate,xlink:arcrole,` +
|
|
`xlink:href,xlink:role,xlink:show,xlink:title,xlink:type,xml:base,xml:lang,` +
|
|
`xml:space,y,y1,y2,yChannelSelector,z,zoomAndPan`);
|
|
|
|
function normalizeStyle(value) {
|
|
if (isArray(value)) {
|
|
const res = {};
|
|
for (let i = 0; i < value.length; i++) {
|
|
const item = value[i];
|
|
const normalized = isString(item)
|
|
? parseStringStyle(item)
|
|
: normalizeStyle(item);
|
|
if (normalized) {
|
|
for (const key in normalized) {
|
|
res[key] = normalized[key];
|
|
}
|
|
}
|
|
}
|
|
return res;
|
|
}
|
|
else if (isString(value)) {
|
|
return value;
|
|
}
|
|
else if (isObject(value)) {
|
|
return value;
|
|
}
|
|
}
|
|
const listDelimiterRE = /;(?![^(]*\))/g;
|
|
const propertyDelimiterRE = /:(.+)/;
|
|
function parseStringStyle(cssText) {
|
|
const ret = {};
|
|
cssText.split(listDelimiterRE).forEach(item => {
|
|
if (item) {
|
|
const tmp = item.split(propertyDelimiterRE);
|
|
tmp.length > 1 && (ret[tmp[0].trim()] = tmp[1].trim());
|
|
}
|
|
});
|
|
return ret;
|
|
}
|
|
function stringifyStyle(styles) {
|
|
let ret = '';
|
|
if (!styles || isString(styles)) {
|
|
return ret;
|
|
}
|
|
for (const key in styles) {
|
|
const value = styles[key];
|
|
const normalizedKey = key.startsWith(`--`) ? key : hyphenate(key);
|
|
if (isString(value) ||
|
|
(typeof value === 'number' && isNoUnitNumericStyleProp(normalizedKey))) {
|
|
// only render valid values
|
|
ret += `${normalizedKey}:${value};`;
|
|
}
|
|
}
|
|
return ret;
|
|
}
|
|
function normalizeClass(value) {
|
|
let res = '';
|
|
if (isString(value)) {
|
|
res = value;
|
|
}
|
|
else if (isArray(value)) {
|
|
for (let i = 0; i < value.length; i++) {
|
|
const normalized = normalizeClass(value[i]);
|
|
if (normalized) {
|
|
res += normalized + ' ';
|
|
}
|
|
}
|
|
}
|
|
else if (isObject(value)) {
|
|
for (const name in value) {
|
|
if (value[name]) {
|
|
res += name + ' ';
|
|
}
|
|
}
|
|
}
|
|
return res.trim();
|
|
}
|
|
function normalizeProps(props) {
|
|
if (!props)
|
|
return null;
|
|
let { class: klass, style } = props;
|
|
if (klass && !isString(klass)) {
|
|
props.class = normalizeClass(klass);
|
|
}
|
|
if (style) {
|
|
props.style = normalizeStyle(style);
|
|
}
|
|
return props;
|
|
}
|
|
|
|
// These tag configs are shared between compiler-dom and runtime-dom, so they
|
|
// https://developer.mozilla.org/en-US/docs/Web/HTML/Element
|
|
const HTML_TAGS = 'html,body,base,head,link,meta,style,title,address,article,aside,footer,' +
|
|
'header,h1,h2,h3,h4,h5,h6,nav,section,div,dd,dl,dt,figcaption,' +
|
|
'figure,picture,hr,img,li,main,ol,p,pre,ul,a,b,abbr,bdi,bdo,br,cite,code,' +
|
|
'data,dfn,em,i,kbd,mark,q,rp,rt,ruby,s,samp,small,span,strong,sub,sup,' +
|
|
'time,u,var,wbr,area,audio,map,track,video,embed,object,param,source,' +
|
|
'canvas,script,noscript,del,ins,caption,col,colgroup,table,thead,tbody,td,' +
|
|
'th,tr,button,datalist,fieldset,form,input,label,legend,meter,optgroup,' +
|
|
'option,output,progress,select,textarea,details,dialog,menu,' +
|
|
'summary,template,blockquote,iframe,tfoot';
|
|
// https://developer.mozilla.org/en-US/docs/Web/SVG/Element
|
|
const SVG_TAGS = 'svg,animate,animateMotion,animateTransform,circle,clipPath,color-profile,' +
|
|
'defs,desc,discard,ellipse,feBlend,feColorMatrix,feComponentTransfer,' +
|
|
'feComposite,feConvolveMatrix,feDiffuseLighting,feDisplacementMap,' +
|
|
'feDistanceLight,feDropShadow,feFlood,feFuncA,feFuncB,feFuncG,feFuncR,' +
|
|
'feGaussianBlur,feImage,feMerge,feMergeNode,feMorphology,feOffset,' +
|
|
'fePointLight,feSpecularLighting,feSpotLight,feTile,feTurbulence,filter,' +
|
|
'foreignObject,g,hatch,hatchpath,image,line,linearGradient,marker,mask,' +
|
|
'mesh,meshgradient,meshpatch,meshrow,metadata,mpath,path,pattern,' +
|
|
'polygon,polyline,radialGradient,rect,set,solidcolor,stop,switch,symbol,' +
|
|
'text,textPath,title,tspan,unknown,use,view';
|
|
const VOID_TAGS = 'area,base,br,col,embed,hr,img,input,link,meta,param,source,track,wbr';
|
|
const isHTMLTag = /*#__PURE__*/ makeMap(HTML_TAGS);
|
|
const isSVGTag = /*#__PURE__*/ makeMap(SVG_TAGS);
|
|
const isVoidTag = /*#__PURE__*/ makeMap(VOID_TAGS);
|
|
|
|
const escapeRE = /["'&<>]/;
|
|
function escapeHtml(string) {
|
|
const str = '' + string;
|
|
const match = escapeRE.exec(str);
|
|
if (!match) {
|
|
return str;
|
|
}
|
|
let html = '';
|
|
let escaped;
|
|
let index;
|
|
let lastIndex = 0;
|
|
for (index = match.index; index < str.length; index++) {
|
|
switch (str.charCodeAt(index)) {
|
|
case 34: // "
|
|
escaped = '"';
|
|
break;
|
|
case 38: // &
|
|
escaped = '&';
|
|
break;
|
|
case 39: // '
|
|
escaped = ''';
|
|
break;
|
|
case 60: // <
|
|
escaped = '<';
|
|
break;
|
|
case 62: // >
|
|
escaped = '>';
|
|
break;
|
|
default:
|
|
continue;
|
|
}
|
|
if (lastIndex !== index) {
|
|
html += str.substring(lastIndex, index);
|
|
}
|
|
lastIndex = index + 1;
|
|
html += escaped;
|
|
}
|
|
return lastIndex !== index ? html + str.substring(lastIndex, index) : html;
|
|
}
|
|
// https://www.w3.org/TR/html52/syntax.html#comments
|
|
const commentStripRE = /^-?>|<!--|-->|--!>|<!-$/g;
|
|
function escapeHtmlComment(src) {
|
|
return src.replace(commentStripRE, '');
|
|
}
|
|
|
|
function looseCompareArrays(a, b) {
|
|
if (a.length !== b.length)
|
|
return false;
|
|
let equal = true;
|
|
for (let i = 0; equal && i < a.length; i++) {
|
|
equal = looseEqual(a[i], b[i]);
|
|
}
|
|
return equal;
|
|
}
|
|
function looseEqual(a, b) {
|
|
if (a === b)
|
|
return true;
|
|
let aValidType = isDate(a);
|
|
let bValidType = isDate(b);
|
|
if (aValidType || bValidType) {
|
|
return aValidType && bValidType ? a.getTime() === b.getTime() : false;
|
|
}
|
|
aValidType = isArray(a);
|
|
bValidType = isArray(b);
|
|
if (aValidType || bValidType) {
|
|
return aValidType && bValidType ? looseCompareArrays(a, b) : false;
|
|
}
|
|
aValidType = isObject(a);
|
|
bValidType = isObject(b);
|
|
if (aValidType || bValidType) {
|
|
/* istanbul ignore if: this if will probably never be called */
|
|
if (!aValidType || !bValidType) {
|
|
return false;
|
|
}
|
|
const aKeysCount = Object.keys(a).length;
|
|
const bKeysCount = Object.keys(b).length;
|
|
if (aKeysCount !== bKeysCount) {
|
|
return false;
|
|
}
|
|
for (const key in a) {
|
|
const aHasKey = a.hasOwnProperty(key);
|
|
const bHasKey = b.hasOwnProperty(key);
|
|
if ((aHasKey && !bHasKey) ||
|
|
(!aHasKey && bHasKey) ||
|
|
!looseEqual(a[key], b[key])) {
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
return String(a) === String(b);
|
|
}
|
|
function looseIndexOf(arr, val) {
|
|
return arr.findIndex(item => looseEqual(item, val));
|
|
}
|
|
|
|
/**
|
|
* For converting {{ interpolation }} values to displayed strings.
|
|
* @private
|
|
*/
|
|
const toDisplayString = (val) => {
|
|
return val == null
|
|
? ''
|
|
: isArray(val) ||
|
|
(isObject(val) &&
|
|
(val.toString === objectToString || !isFunction(val.toString)))
|
|
? JSON.stringify(val, replacer, 2)
|
|
: String(val);
|
|
};
|
|
const replacer = (_key, val) => {
|
|
// can't use isRef here since @vue/shared has no deps
|
|
if (val && val.__v_isRef) {
|
|
return replacer(_key, val.value);
|
|
}
|
|
else if (isMap(val)) {
|
|
return {
|
|
[`Map(${val.size})`]: [...val.entries()].reduce((entries, [key, val]) => {
|
|
entries[`${key} =>`] = val;
|
|
return entries;
|
|
}, {})
|
|
};
|
|
}
|
|
else if (isSet(val)) {
|
|
return {
|
|
[`Set(${val.size})`]: [...val.values()]
|
|
};
|
|
}
|
|
else if (isObject(val) && !isArray(val) && !isPlainObject(val)) {
|
|
return String(val);
|
|
}
|
|
return val;
|
|
};
|
|
|
|
/**
|
|
* List of @babel/parser plugins that are used for template expression
|
|
* transforms and SFC script transforms. By default we enable proposals slated
|
|
* for ES2020. This will need to be updated as the spec moves forward.
|
|
* Full list at https://babeljs.io/docs/en/next/babel-parser#plugins
|
|
*/
|
|
const babelParserDefaultPlugins = [
|
|
'bigInt',
|
|
'optionalChaining',
|
|
'nullishCoalescingOperator'
|
|
];
|
|
const EMPTY_OBJ = ( true)
|
|
? Object.freeze({})
|
|
: 0;
|
|
const EMPTY_ARR = ( true) ? Object.freeze([]) : 0;
|
|
const NOOP = () => { };
|
|
/**
|
|
* Always return false.
|
|
*/
|
|
const NO = () => false;
|
|
const onRE = /^on[^a-z]/;
|
|
const isOn = (key) => onRE.test(key);
|
|
const isModelListener = (key) => key.startsWith('onUpdate:');
|
|
const extend = Object.assign;
|
|
const remove = (arr, el) => {
|
|
const i = arr.indexOf(el);
|
|
if (i > -1) {
|
|
arr.splice(i, 1);
|
|
}
|
|
};
|
|
const hasOwnProperty = Object.prototype.hasOwnProperty;
|
|
const hasOwn = (val, key) => hasOwnProperty.call(val, key);
|
|
const isArray = Array.isArray;
|
|
const isMap = (val) => toTypeString(val) === '[object Map]';
|
|
const isSet = (val) => toTypeString(val) === '[object Set]';
|
|
const isDate = (val) => val instanceof Date;
|
|
const isFunction = (val) => typeof val === 'function';
|
|
const isString = (val) => typeof val === 'string';
|
|
const isSymbol = (val) => typeof val === 'symbol';
|
|
const isObject = (val) => val !== null && typeof val === 'object';
|
|
const isPromise = (val) => {
|
|
return isObject(val) && isFunction(val.then) && isFunction(val.catch);
|
|
};
|
|
const objectToString = Object.prototype.toString;
|
|
const toTypeString = (value) => objectToString.call(value);
|
|
const toRawType = (value) => {
|
|
// extract "RawType" from strings like "[object RawType]"
|
|
return toTypeString(value).slice(8, -1);
|
|
};
|
|
const isPlainObject = (val) => toTypeString(val) === '[object Object]';
|
|
const isIntegerKey = (key) => isString(key) &&
|
|
key !== 'NaN' &&
|
|
key[0] !== '-' &&
|
|
'' + parseInt(key, 10) === key;
|
|
const isReservedProp = /*#__PURE__*/ makeMap(
|
|
// the leading comma is intentional so empty string "" is also included
|
|
',key,ref,' +
|
|
'onVnodeBeforeMount,onVnodeMounted,' +
|
|
'onVnodeBeforeUpdate,onVnodeUpdated,' +
|
|
'onVnodeBeforeUnmount,onVnodeUnmounted');
|
|
const cacheStringFunction = (fn) => {
|
|
const cache = Object.create(null);
|
|
return ((str) => {
|
|
const hit = cache[str];
|
|
return hit || (cache[str] = fn(str));
|
|
});
|
|
};
|
|
const camelizeRE = /-(\w)/g;
|
|
/**
|
|
* @private
|
|
*/
|
|
const camelize = cacheStringFunction((str) => {
|
|
return str.replace(camelizeRE, (_, c) => (c ? c.toUpperCase() : ''));
|
|
});
|
|
const hyphenateRE = /\B([A-Z])/g;
|
|
/**
|
|
* @private
|
|
*/
|
|
const hyphenate = cacheStringFunction((str) => str.replace(hyphenateRE, '-$1').toLowerCase());
|
|
/**
|
|
* @private
|
|
*/
|
|
const capitalize = cacheStringFunction((str) => str.charAt(0).toUpperCase() + str.slice(1));
|
|
/**
|
|
* @private
|
|
*/
|
|
const toHandlerKey = cacheStringFunction((str) => str ? `on${capitalize(str)}` : ``);
|
|
// compare whether a value has changed, accounting for NaN.
|
|
const hasChanged = (value, oldValue) => !Object.is(value, oldValue);
|
|
const invokeArrayFns = (fns, arg) => {
|
|
for (let i = 0; i < fns.length; i++) {
|
|
fns[i](arg);
|
|
}
|
|
};
|
|
const def = (obj, key, value) => {
|
|
Object.defineProperty(obj, key, {
|
|
configurable: true,
|
|
enumerable: false,
|
|
value
|
|
});
|
|
};
|
|
const toNumber = (val) => {
|
|
const n = parseFloat(val);
|
|
return isNaN(n) ? val : n;
|
|
};
|
|
let _globalThis;
|
|
const getGlobalThis = () => {
|
|
return (_globalThis ||
|
|
(_globalThis =
|
|
typeof globalThis !== 'undefined'
|
|
? globalThis
|
|
: typeof self !== 'undefined'
|
|
? self
|
|
: typeof window !== 'undefined'
|
|
? window
|
|
: typeof __webpack_require__.g !== 'undefined'
|
|
? __webpack_require__.g
|
|
: {}));
|
|
};
|
|
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/index.js":
|
|
/*!*************************************!*\
|
|
!*** ./node_modules/axios/index.js ***!
|
|
\*************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
module.exports = __webpack_require__(/*! ./lib/axios */ "./node_modules/axios/lib/axios.js");
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/adapters/xhr.js":
|
|
/*!************************************************!*\
|
|
!*** ./node_modules/axios/lib/adapters/xhr.js ***!
|
|
\************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
|
|
var settle = __webpack_require__(/*! ./../core/settle */ "./node_modules/axios/lib/core/settle.js");
|
|
var cookies = __webpack_require__(/*! ./../helpers/cookies */ "./node_modules/axios/lib/helpers/cookies.js");
|
|
var buildURL = __webpack_require__(/*! ./../helpers/buildURL */ "./node_modules/axios/lib/helpers/buildURL.js");
|
|
var buildFullPath = __webpack_require__(/*! ../core/buildFullPath */ "./node_modules/axios/lib/core/buildFullPath.js");
|
|
var parseHeaders = __webpack_require__(/*! ./../helpers/parseHeaders */ "./node_modules/axios/lib/helpers/parseHeaders.js");
|
|
var isURLSameOrigin = __webpack_require__(/*! ./../helpers/isURLSameOrigin */ "./node_modules/axios/lib/helpers/isURLSameOrigin.js");
|
|
var createError = __webpack_require__(/*! ../core/createError */ "./node_modules/axios/lib/core/createError.js");
|
|
|
|
module.exports = function xhrAdapter(config) {
|
|
return new Promise(function dispatchXhrRequest(resolve, reject) {
|
|
var requestData = config.data;
|
|
var requestHeaders = config.headers;
|
|
|
|
if (utils.isFormData(requestData)) {
|
|
delete requestHeaders['Content-Type']; // Let the browser set it
|
|
}
|
|
|
|
var request = new XMLHttpRequest();
|
|
|
|
// HTTP basic authentication
|
|
if (config.auth) {
|
|
var username = config.auth.username || '';
|
|
var password = config.auth.password ? unescape(encodeURIComponent(config.auth.password)) : '';
|
|
requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);
|
|
}
|
|
|
|
var fullPath = buildFullPath(config.baseURL, config.url);
|
|
request.open(config.method.toUpperCase(), buildURL(fullPath, config.params, config.paramsSerializer), true);
|
|
|
|
// Set the request timeout in MS
|
|
request.timeout = config.timeout;
|
|
|
|
// Listen for ready state
|
|
request.onreadystatechange = function handleLoad() {
|
|
if (!request || request.readyState !== 4) {
|
|
return;
|
|
}
|
|
|
|
// The request errored out and we didn't get a response, this will be
|
|
// handled by onerror instead
|
|
// With one exception: request that using file: protocol, most browsers
|
|
// will return status as 0 even though it's a successful request
|
|
if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {
|
|
return;
|
|
}
|
|
|
|
// Prepare the response
|
|
var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;
|
|
var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;
|
|
var response = {
|
|
data: responseData,
|
|
status: request.status,
|
|
statusText: request.statusText,
|
|
headers: responseHeaders,
|
|
config: config,
|
|
request: request
|
|
};
|
|
|
|
settle(resolve, reject, response);
|
|
|
|
// Clean up request
|
|
request = null;
|
|
};
|
|
|
|
// Handle browser request cancellation (as opposed to a manual cancellation)
|
|
request.onabort = function handleAbort() {
|
|
if (!request) {
|
|
return;
|
|
}
|
|
|
|
reject(createError('Request aborted', config, 'ECONNABORTED', request));
|
|
|
|
// Clean up request
|
|
request = null;
|
|
};
|
|
|
|
// Handle low level network errors
|
|
request.onerror = function handleError() {
|
|
// Real errors are hidden from us by the browser
|
|
// onerror should only fire if it's a network error
|
|
reject(createError('Network Error', config, null, request));
|
|
|
|
// Clean up request
|
|
request = null;
|
|
};
|
|
|
|
// Handle timeout
|
|
request.ontimeout = function handleTimeout() {
|
|
var timeoutErrorMessage = 'timeout of ' + config.timeout + 'ms exceeded';
|
|
if (config.timeoutErrorMessage) {
|
|
timeoutErrorMessage = config.timeoutErrorMessage;
|
|
}
|
|
reject(createError(timeoutErrorMessage, config, 'ECONNABORTED',
|
|
request));
|
|
|
|
// Clean up request
|
|
request = null;
|
|
};
|
|
|
|
// Add xsrf header
|
|
// This is only done if running in a standard browser environment.
|
|
// Specifically not if we're in a web worker, or react-native.
|
|
if (utils.isStandardBrowserEnv()) {
|
|
// Add xsrf header
|
|
var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ?
|
|
cookies.read(config.xsrfCookieName) :
|
|
undefined;
|
|
|
|
if (xsrfValue) {
|
|
requestHeaders[config.xsrfHeaderName] = xsrfValue;
|
|
}
|
|
}
|
|
|
|
// Add headers to the request
|
|
if ('setRequestHeader' in request) {
|
|
utils.forEach(requestHeaders, function setRequestHeader(val, key) {
|
|
if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {
|
|
// Remove Content-Type if data is undefined
|
|
delete requestHeaders[key];
|
|
} else {
|
|
// Otherwise add header to the request
|
|
request.setRequestHeader(key, val);
|
|
}
|
|
});
|
|
}
|
|
|
|
// Add withCredentials to request if needed
|
|
if (!utils.isUndefined(config.withCredentials)) {
|
|
request.withCredentials = !!config.withCredentials;
|
|
}
|
|
|
|
// Add responseType to request if needed
|
|
if (config.responseType) {
|
|
try {
|
|
request.responseType = config.responseType;
|
|
} catch (e) {
|
|
// Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.
|
|
// But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.
|
|
if (config.responseType !== 'json') {
|
|
throw e;
|
|
}
|
|
}
|
|
}
|
|
|
|
// Handle progress if needed
|
|
if (typeof config.onDownloadProgress === 'function') {
|
|
request.addEventListener('progress', config.onDownloadProgress);
|
|
}
|
|
|
|
// Not all browsers support upload events
|
|
if (typeof config.onUploadProgress === 'function' && request.upload) {
|
|
request.upload.addEventListener('progress', config.onUploadProgress);
|
|
}
|
|
|
|
if (config.cancelToken) {
|
|
// Handle cancellation
|
|
config.cancelToken.promise.then(function onCanceled(cancel) {
|
|
if (!request) {
|
|
return;
|
|
}
|
|
|
|
request.abort();
|
|
reject(cancel);
|
|
// Clean up request
|
|
request = null;
|
|
});
|
|
}
|
|
|
|
if (!requestData) {
|
|
requestData = null;
|
|
}
|
|
|
|
// Send the request
|
|
request.send(requestData);
|
|
});
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/axios.js":
|
|
/*!*****************************************!*\
|
|
!*** ./node_modules/axios/lib/axios.js ***!
|
|
\*****************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var utils = __webpack_require__(/*! ./utils */ "./node_modules/axios/lib/utils.js");
|
|
var bind = __webpack_require__(/*! ./helpers/bind */ "./node_modules/axios/lib/helpers/bind.js");
|
|
var Axios = __webpack_require__(/*! ./core/Axios */ "./node_modules/axios/lib/core/Axios.js");
|
|
var mergeConfig = __webpack_require__(/*! ./core/mergeConfig */ "./node_modules/axios/lib/core/mergeConfig.js");
|
|
var defaults = __webpack_require__(/*! ./defaults */ "./node_modules/axios/lib/defaults.js");
|
|
|
|
/**
|
|
* Create an instance of Axios
|
|
*
|
|
* @param {Object} defaultConfig The default config for the instance
|
|
* @return {Axios} A new instance of Axios
|
|
*/
|
|
function createInstance(defaultConfig) {
|
|
var context = new Axios(defaultConfig);
|
|
var instance = bind(Axios.prototype.request, context);
|
|
|
|
// Copy axios.prototype to instance
|
|
utils.extend(instance, Axios.prototype, context);
|
|
|
|
// Copy context to instance
|
|
utils.extend(instance, context);
|
|
|
|
return instance;
|
|
}
|
|
|
|
// Create the default instance to be exported
|
|
var axios = createInstance(defaults);
|
|
|
|
// Expose Axios class to allow class inheritance
|
|
axios.Axios = Axios;
|
|
|
|
// Factory for creating new instances
|
|
axios.create = function create(instanceConfig) {
|
|
return createInstance(mergeConfig(axios.defaults, instanceConfig));
|
|
};
|
|
|
|
// Expose Cancel & CancelToken
|
|
axios.Cancel = __webpack_require__(/*! ./cancel/Cancel */ "./node_modules/axios/lib/cancel/Cancel.js");
|
|
axios.CancelToken = __webpack_require__(/*! ./cancel/CancelToken */ "./node_modules/axios/lib/cancel/CancelToken.js");
|
|
axios.isCancel = __webpack_require__(/*! ./cancel/isCancel */ "./node_modules/axios/lib/cancel/isCancel.js");
|
|
|
|
// Expose all/spread
|
|
axios.all = function all(promises) {
|
|
return Promise.all(promises);
|
|
};
|
|
axios.spread = __webpack_require__(/*! ./helpers/spread */ "./node_modules/axios/lib/helpers/spread.js");
|
|
|
|
// Expose isAxiosError
|
|
axios.isAxiosError = __webpack_require__(/*! ./helpers/isAxiosError */ "./node_modules/axios/lib/helpers/isAxiosError.js");
|
|
|
|
module.exports = axios;
|
|
|
|
// Allow use of default import syntax in TypeScript
|
|
module.exports.default = axios;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/cancel/Cancel.js":
|
|
/*!*************************************************!*\
|
|
!*** ./node_modules/axios/lib/cancel/Cancel.js ***!
|
|
\*************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
/**
|
|
* A `Cancel` is an object that is thrown when an operation is canceled.
|
|
*
|
|
* @class
|
|
* @param {string=} message The message.
|
|
*/
|
|
function Cancel(message) {
|
|
this.message = message;
|
|
}
|
|
|
|
Cancel.prototype.toString = function toString() {
|
|
return 'Cancel' + (this.message ? ': ' + this.message : '');
|
|
};
|
|
|
|
Cancel.prototype.__CANCEL__ = true;
|
|
|
|
module.exports = Cancel;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/cancel/CancelToken.js":
|
|
/*!******************************************************!*\
|
|
!*** ./node_modules/axios/lib/cancel/CancelToken.js ***!
|
|
\******************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var Cancel = __webpack_require__(/*! ./Cancel */ "./node_modules/axios/lib/cancel/Cancel.js");
|
|
|
|
/**
|
|
* A `CancelToken` is an object that can be used to request cancellation of an operation.
|
|
*
|
|
* @class
|
|
* @param {Function} executor The executor function.
|
|
*/
|
|
function CancelToken(executor) {
|
|
if (typeof executor !== 'function') {
|
|
throw new TypeError('executor must be a function.');
|
|
}
|
|
|
|
var resolvePromise;
|
|
this.promise = new Promise(function promiseExecutor(resolve) {
|
|
resolvePromise = resolve;
|
|
});
|
|
|
|
var token = this;
|
|
executor(function cancel(message) {
|
|
if (token.reason) {
|
|
// Cancellation has already been requested
|
|
return;
|
|
}
|
|
|
|
token.reason = new Cancel(message);
|
|
resolvePromise(token.reason);
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Throws a `Cancel` if cancellation has been requested.
|
|
*/
|
|
CancelToken.prototype.throwIfRequested = function throwIfRequested() {
|
|
if (this.reason) {
|
|
throw this.reason;
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Returns an object that contains a new `CancelToken` and a function that, when called,
|
|
* cancels the `CancelToken`.
|
|
*/
|
|
CancelToken.source = function source() {
|
|
var cancel;
|
|
var token = new CancelToken(function executor(c) {
|
|
cancel = c;
|
|
});
|
|
return {
|
|
token: token,
|
|
cancel: cancel
|
|
};
|
|
};
|
|
|
|
module.exports = CancelToken;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/cancel/isCancel.js":
|
|
/*!***************************************************!*\
|
|
!*** ./node_modules/axios/lib/cancel/isCancel.js ***!
|
|
\***************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
module.exports = function isCancel(value) {
|
|
return !!(value && value.__CANCEL__);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/core/Axios.js":
|
|
/*!**********************************************!*\
|
|
!*** ./node_modules/axios/lib/core/Axios.js ***!
|
|
\**********************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
|
|
var buildURL = __webpack_require__(/*! ../helpers/buildURL */ "./node_modules/axios/lib/helpers/buildURL.js");
|
|
var InterceptorManager = __webpack_require__(/*! ./InterceptorManager */ "./node_modules/axios/lib/core/InterceptorManager.js");
|
|
var dispatchRequest = __webpack_require__(/*! ./dispatchRequest */ "./node_modules/axios/lib/core/dispatchRequest.js");
|
|
var mergeConfig = __webpack_require__(/*! ./mergeConfig */ "./node_modules/axios/lib/core/mergeConfig.js");
|
|
|
|
/**
|
|
* Create a new instance of Axios
|
|
*
|
|
* @param {Object} instanceConfig The default config for the instance
|
|
*/
|
|
function Axios(instanceConfig) {
|
|
this.defaults = instanceConfig;
|
|
this.interceptors = {
|
|
request: new InterceptorManager(),
|
|
response: new InterceptorManager()
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Dispatch a request
|
|
*
|
|
* @param {Object} config The config specific for this request (merged with this.defaults)
|
|
*/
|
|
Axios.prototype.request = function request(config) {
|
|
/*eslint no-param-reassign:0*/
|
|
// Allow for axios('example/url'[, config]) a la fetch API
|
|
if (typeof config === 'string') {
|
|
config = arguments[1] || {};
|
|
config.url = arguments[0];
|
|
} else {
|
|
config = config || {};
|
|
}
|
|
|
|
config = mergeConfig(this.defaults, config);
|
|
|
|
// Set config.method
|
|
if (config.method) {
|
|
config.method = config.method.toLowerCase();
|
|
} else if (this.defaults.method) {
|
|
config.method = this.defaults.method.toLowerCase();
|
|
} else {
|
|
config.method = 'get';
|
|
}
|
|
|
|
// Hook up interceptors middleware
|
|
var chain = [dispatchRequest, undefined];
|
|
var promise = Promise.resolve(config);
|
|
|
|
this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {
|
|
chain.unshift(interceptor.fulfilled, interceptor.rejected);
|
|
});
|
|
|
|
this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {
|
|
chain.push(interceptor.fulfilled, interceptor.rejected);
|
|
});
|
|
|
|
while (chain.length) {
|
|
promise = promise.then(chain.shift(), chain.shift());
|
|
}
|
|
|
|
return promise;
|
|
};
|
|
|
|
Axios.prototype.getUri = function getUri(config) {
|
|
config = mergeConfig(this.defaults, config);
|
|
return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\?/, '');
|
|
};
|
|
|
|
// Provide aliases for supported request methods
|
|
utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {
|
|
/*eslint func-names:0*/
|
|
Axios.prototype[method] = function(url, config) {
|
|
return this.request(mergeConfig(config || {}, {
|
|
method: method,
|
|
url: url,
|
|
data: (config || {}).data
|
|
}));
|
|
};
|
|
});
|
|
|
|
utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {
|
|
/*eslint func-names:0*/
|
|
Axios.prototype[method] = function(url, data, config) {
|
|
return this.request(mergeConfig(config || {}, {
|
|
method: method,
|
|
url: url,
|
|
data: data
|
|
}));
|
|
};
|
|
});
|
|
|
|
module.exports = Axios;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/core/InterceptorManager.js":
|
|
/*!***********************************************************!*\
|
|
!*** ./node_modules/axios/lib/core/InterceptorManager.js ***!
|
|
\***********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
|
|
|
|
function InterceptorManager() {
|
|
this.handlers = [];
|
|
}
|
|
|
|
/**
|
|
* Add a new interceptor to the stack
|
|
*
|
|
* @param {Function} fulfilled The function to handle `then` for a `Promise`
|
|
* @param {Function} rejected The function to handle `reject` for a `Promise`
|
|
*
|
|
* @return {Number} An ID used to remove interceptor later
|
|
*/
|
|
InterceptorManager.prototype.use = function use(fulfilled, rejected) {
|
|
this.handlers.push({
|
|
fulfilled: fulfilled,
|
|
rejected: rejected
|
|
});
|
|
return this.handlers.length - 1;
|
|
};
|
|
|
|
/**
|
|
* Remove an interceptor from the stack
|
|
*
|
|
* @param {Number} id The ID that was returned by `use`
|
|
*/
|
|
InterceptorManager.prototype.eject = function eject(id) {
|
|
if (this.handlers[id]) {
|
|
this.handlers[id] = null;
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Iterate over all the registered interceptors
|
|
*
|
|
* This method is particularly useful for skipping over any
|
|
* interceptors that may have become `null` calling `eject`.
|
|
*
|
|
* @param {Function} fn The function to call for each interceptor
|
|
*/
|
|
InterceptorManager.prototype.forEach = function forEach(fn) {
|
|
utils.forEach(this.handlers, function forEachHandler(h) {
|
|
if (h !== null) {
|
|
fn(h);
|
|
}
|
|
});
|
|
};
|
|
|
|
module.exports = InterceptorManager;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/core/buildFullPath.js":
|
|
/*!******************************************************!*\
|
|
!*** ./node_modules/axios/lib/core/buildFullPath.js ***!
|
|
\******************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var isAbsoluteURL = __webpack_require__(/*! ../helpers/isAbsoluteURL */ "./node_modules/axios/lib/helpers/isAbsoluteURL.js");
|
|
var combineURLs = __webpack_require__(/*! ../helpers/combineURLs */ "./node_modules/axios/lib/helpers/combineURLs.js");
|
|
|
|
/**
|
|
* Creates a new URL by combining the baseURL with the requestedURL,
|
|
* only when the requestedURL is not already an absolute URL.
|
|
* If the requestURL is absolute, this function returns the requestedURL untouched.
|
|
*
|
|
* @param {string} baseURL The base URL
|
|
* @param {string} requestedURL Absolute or relative URL to combine
|
|
* @returns {string} The combined full path
|
|
*/
|
|
module.exports = function buildFullPath(baseURL, requestedURL) {
|
|
if (baseURL && !isAbsoluteURL(requestedURL)) {
|
|
return combineURLs(baseURL, requestedURL);
|
|
}
|
|
return requestedURL;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/core/createError.js":
|
|
/*!****************************************************!*\
|
|
!*** ./node_modules/axios/lib/core/createError.js ***!
|
|
\****************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var enhanceError = __webpack_require__(/*! ./enhanceError */ "./node_modules/axios/lib/core/enhanceError.js");
|
|
|
|
/**
|
|
* Create an Error with the specified message, config, error code, request and response.
|
|
*
|
|
* @param {string} message The error message.
|
|
* @param {Object} config The config.
|
|
* @param {string} [code] The error code (for example, 'ECONNABORTED').
|
|
* @param {Object} [request] The request.
|
|
* @param {Object} [response] The response.
|
|
* @returns {Error} The created error.
|
|
*/
|
|
module.exports = function createError(message, config, code, request, response) {
|
|
var error = new Error(message);
|
|
return enhanceError(error, config, code, request, response);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/core/dispatchRequest.js":
|
|
/*!********************************************************!*\
|
|
!*** ./node_modules/axios/lib/core/dispatchRequest.js ***!
|
|
\********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
|
|
var transformData = __webpack_require__(/*! ./transformData */ "./node_modules/axios/lib/core/transformData.js");
|
|
var isCancel = __webpack_require__(/*! ../cancel/isCancel */ "./node_modules/axios/lib/cancel/isCancel.js");
|
|
var defaults = __webpack_require__(/*! ../defaults */ "./node_modules/axios/lib/defaults.js");
|
|
|
|
/**
|
|
* Throws a `Cancel` if cancellation has been requested.
|
|
*/
|
|
function throwIfCancellationRequested(config) {
|
|
if (config.cancelToken) {
|
|
config.cancelToken.throwIfRequested();
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Dispatch a request to the server using the configured adapter.
|
|
*
|
|
* @param {object} config The config that is to be used for the request
|
|
* @returns {Promise} The Promise to be fulfilled
|
|
*/
|
|
module.exports = function dispatchRequest(config) {
|
|
throwIfCancellationRequested(config);
|
|
|
|
// Ensure headers exist
|
|
config.headers = config.headers || {};
|
|
|
|
// Transform request data
|
|
config.data = transformData(
|
|
config.data,
|
|
config.headers,
|
|
config.transformRequest
|
|
);
|
|
|
|
// Flatten headers
|
|
config.headers = utils.merge(
|
|
config.headers.common || {},
|
|
config.headers[config.method] || {},
|
|
config.headers
|
|
);
|
|
|
|
utils.forEach(
|
|
['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],
|
|
function cleanHeaderConfig(method) {
|
|
delete config.headers[method];
|
|
}
|
|
);
|
|
|
|
var adapter = config.adapter || defaults.adapter;
|
|
|
|
return adapter(config).then(function onAdapterResolution(response) {
|
|
throwIfCancellationRequested(config);
|
|
|
|
// Transform response data
|
|
response.data = transformData(
|
|
response.data,
|
|
response.headers,
|
|
config.transformResponse
|
|
);
|
|
|
|
return response;
|
|
}, function onAdapterRejection(reason) {
|
|
if (!isCancel(reason)) {
|
|
throwIfCancellationRequested(config);
|
|
|
|
// Transform response data
|
|
if (reason && reason.response) {
|
|
reason.response.data = transformData(
|
|
reason.response.data,
|
|
reason.response.headers,
|
|
config.transformResponse
|
|
);
|
|
}
|
|
}
|
|
|
|
return Promise.reject(reason);
|
|
});
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/core/enhanceError.js":
|
|
/*!*****************************************************!*\
|
|
!*** ./node_modules/axios/lib/core/enhanceError.js ***!
|
|
\*****************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
/**
|
|
* Update an Error with the specified config, error code, and response.
|
|
*
|
|
* @param {Error} error The error to update.
|
|
* @param {Object} config The config.
|
|
* @param {string} [code] The error code (for example, 'ECONNABORTED').
|
|
* @param {Object} [request] The request.
|
|
* @param {Object} [response] The response.
|
|
* @returns {Error} The error.
|
|
*/
|
|
module.exports = function enhanceError(error, config, code, request, response) {
|
|
error.config = config;
|
|
if (code) {
|
|
error.code = code;
|
|
}
|
|
|
|
error.request = request;
|
|
error.response = response;
|
|
error.isAxiosError = true;
|
|
|
|
error.toJSON = function toJSON() {
|
|
return {
|
|
// Standard
|
|
message: this.message,
|
|
name: this.name,
|
|
// Microsoft
|
|
description: this.description,
|
|
number: this.number,
|
|
// Mozilla
|
|
fileName: this.fileName,
|
|
lineNumber: this.lineNumber,
|
|
columnNumber: this.columnNumber,
|
|
stack: this.stack,
|
|
// Axios
|
|
config: this.config,
|
|
code: this.code
|
|
};
|
|
};
|
|
return error;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/core/mergeConfig.js":
|
|
/*!****************************************************!*\
|
|
!*** ./node_modules/axios/lib/core/mergeConfig.js ***!
|
|
\****************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var utils = __webpack_require__(/*! ../utils */ "./node_modules/axios/lib/utils.js");
|
|
|
|
/**
|
|
* Config-specific merge-function which creates a new config-object
|
|
* by merging two configuration objects together.
|
|
*
|
|
* @param {Object} config1
|
|
* @param {Object} config2
|
|
* @returns {Object} New object resulting from merging config2 to config1
|
|
*/
|
|
module.exports = function mergeConfig(config1, config2) {
|
|
// eslint-disable-next-line no-param-reassign
|
|
config2 = config2 || {};
|
|
var config = {};
|
|
|
|
var valueFromConfig2Keys = ['url', 'method', 'data'];
|
|
var mergeDeepPropertiesKeys = ['headers', 'auth', 'proxy', 'params'];
|
|
var defaultToConfig2Keys = [
|
|
'baseURL', 'transformRequest', 'transformResponse', 'paramsSerializer',
|
|
'timeout', 'timeoutMessage', 'withCredentials', 'adapter', 'responseType', 'xsrfCookieName',
|
|
'xsrfHeaderName', 'onUploadProgress', 'onDownloadProgress', 'decompress',
|
|
'maxContentLength', 'maxBodyLength', 'maxRedirects', 'transport', 'httpAgent',
|
|
'httpsAgent', 'cancelToken', 'socketPath', 'responseEncoding'
|
|
];
|
|
var directMergeKeys = ['validateStatus'];
|
|
|
|
function getMergedValue(target, source) {
|
|
if (utils.isPlainObject(target) && utils.isPlainObject(source)) {
|
|
return utils.merge(target, source);
|
|
} else if (utils.isPlainObject(source)) {
|
|
return utils.merge({}, source);
|
|
} else if (utils.isArray(source)) {
|
|
return source.slice();
|
|
}
|
|
return source;
|
|
}
|
|
|
|
function mergeDeepProperties(prop) {
|
|
if (!utils.isUndefined(config2[prop])) {
|
|
config[prop] = getMergedValue(config1[prop], config2[prop]);
|
|
} else if (!utils.isUndefined(config1[prop])) {
|
|
config[prop] = getMergedValue(undefined, config1[prop]);
|
|
}
|
|
}
|
|
|
|
utils.forEach(valueFromConfig2Keys, function valueFromConfig2(prop) {
|
|
if (!utils.isUndefined(config2[prop])) {
|
|
config[prop] = getMergedValue(undefined, config2[prop]);
|
|
}
|
|
});
|
|
|
|
utils.forEach(mergeDeepPropertiesKeys, mergeDeepProperties);
|
|
|
|
utils.forEach(defaultToConfig2Keys, function defaultToConfig2(prop) {
|
|
if (!utils.isUndefined(config2[prop])) {
|
|
config[prop] = getMergedValue(undefined, config2[prop]);
|
|
} else if (!utils.isUndefined(config1[prop])) {
|
|
config[prop] = getMergedValue(undefined, config1[prop]);
|
|
}
|
|
});
|
|
|
|
utils.forEach(directMergeKeys, function merge(prop) {
|
|
if (prop in config2) {
|
|
config[prop] = getMergedValue(config1[prop], config2[prop]);
|
|
} else if (prop in config1) {
|
|
config[prop] = getMergedValue(undefined, config1[prop]);
|
|
}
|
|
});
|
|
|
|
var axiosKeys = valueFromConfig2Keys
|
|
.concat(mergeDeepPropertiesKeys)
|
|
.concat(defaultToConfig2Keys)
|
|
.concat(directMergeKeys);
|
|
|
|
var otherKeys = Object
|
|
.keys(config1)
|
|
.concat(Object.keys(config2))
|
|
.filter(function filterAxiosKeys(key) {
|
|
return axiosKeys.indexOf(key) === -1;
|
|
});
|
|
|
|
utils.forEach(otherKeys, mergeDeepProperties);
|
|
|
|
return config;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/core/settle.js":
|
|
/*!***********************************************!*\
|
|
!*** ./node_modules/axios/lib/core/settle.js ***!
|
|
\***********************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var createError = __webpack_require__(/*! ./createError */ "./node_modules/axios/lib/core/createError.js");
|
|
|
|
/**
|
|
* Resolve or reject a Promise based on response status.
|
|
*
|
|
* @param {Function} resolve A function that resolves the promise.
|
|
* @param {Function} reject A function that rejects the promise.
|
|
* @param {object} response The response.
|
|
*/
|
|
module.exports = function settle(resolve, reject, response) {
|
|
var validateStatus = response.config.validateStatus;
|
|
if (!response.status || !validateStatus || validateStatus(response.status)) {
|
|
resolve(response);
|
|
} else {
|
|
reject(createError(
|
|
'Request failed with status code ' + response.status,
|
|
response.config,
|
|
null,
|
|
response.request,
|
|
response
|
|
));
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/core/transformData.js":
|
|
/*!******************************************************!*\
|
|
!*** ./node_modules/axios/lib/core/transformData.js ***!
|
|
\******************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
|
|
|
|
/**
|
|
* Transform the data for a request or a response
|
|
*
|
|
* @param {Object|String} data The data to be transformed
|
|
* @param {Array} headers The headers for the request or response
|
|
* @param {Array|Function} fns A single function or Array of functions
|
|
* @returns {*} The resulting transformed data
|
|
*/
|
|
module.exports = function transformData(data, headers, fns) {
|
|
/*eslint no-param-reassign:0*/
|
|
utils.forEach(fns, function transform(fn) {
|
|
data = fn(data, headers);
|
|
});
|
|
|
|
return data;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/defaults.js":
|
|
/*!********************************************!*\
|
|
!*** ./node_modules/axios/lib/defaults.js ***!
|
|
\********************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var process = __webpack_require__(/*! process/browser */ "./node_modules/process/browser.js");
|
|
|
|
|
|
var utils = __webpack_require__(/*! ./utils */ "./node_modules/axios/lib/utils.js");
|
|
var normalizeHeaderName = __webpack_require__(/*! ./helpers/normalizeHeaderName */ "./node_modules/axios/lib/helpers/normalizeHeaderName.js");
|
|
|
|
var DEFAULT_CONTENT_TYPE = {
|
|
'Content-Type': 'application/x-www-form-urlencoded'
|
|
};
|
|
|
|
function setContentTypeIfUnset(headers, value) {
|
|
if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {
|
|
headers['Content-Type'] = value;
|
|
}
|
|
}
|
|
|
|
function getDefaultAdapter() {
|
|
var adapter;
|
|
if (typeof XMLHttpRequest !== 'undefined') {
|
|
// For browsers use XHR adapter
|
|
adapter = __webpack_require__(/*! ./adapters/xhr */ "./node_modules/axios/lib/adapters/xhr.js");
|
|
} else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') {
|
|
// For node use HTTP adapter
|
|
adapter = __webpack_require__(/*! ./adapters/http */ "./node_modules/axios/lib/adapters/xhr.js");
|
|
}
|
|
return adapter;
|
|
}
|
|
|
|
var defaults = {
|
|
adapter: getDefaultAdapter(),
|
|
|
|
transformRequest: [function transformRequest(data, headers) {
|
|
normalizeHeaderName(headers, 'Accept');
|
|
normalizeHeaderName(headers, 'Content-Type');
|
|
if (utils.isFormData(data) ||
|
|
utils.isArrayBuffer(data) ||
|
|
utils.isBuffer(data) ||
|
|
utils.isStream(data) ||
|
|
utils.isFile(data) ||
|
|
utils.isBlob(data)
|
|
) {
|
|
return data;
|
|
}
|
|
if (utils.isArrayBufferView(data)) {
|
|
return data.buffer;
|
|
}
|
|
if (utils.isURLSearchParams(data)) {
|
|
setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');
|
|
return data.toString();
|
|
}
|
|
if (utils.isObject(data)) {
|
|
setContentTypeIfUnset(headers, 'application/json;charset=utf-8');
|
|
return JSON.stringify(data);
|
|
}
|
|
return data;
|
|
}],
|
|
|
|
transformResponse: [function transformResponse(data) {
|
|
/*eslint no-param-reassign:0*/
|
|
if (typeof data === 'string') {
|
|
try {
|
|
data = JSON.parse(data);
|
|
} catch (e) { /* Ignore */ }
|
|
}
|
|
return data;
|
|
}],
|
|
|
|
/**
|
|
* A timeout in milliseconds to abort a request. If set to 0 (default) a
|
|
* timeout is not created.
|
|
*/
|
|
timeout: 0,
|
|
|
|
xsrfCookieName: 'XSRF-TOKEN',
|
|
xsrfHeaderName: 'X-XSRF-TOKEN',
|
|
|
|
maxContentLength: -1,
|
|
maxBodyLength: -1,
|
|
|
|
validateStatus: function validateStatus(status) {
|
|
return status >= 200 && status < 300;
|
|
}
|
|
};
|
|
|
|
defaults.headers = {
|
|
common: {
|
|
'Accept': 'application/json, text/plain, */*'
|
|
}
|
|
};
|
|
|
|
utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {
|
|
defaults.headers[method] = {};
|
|
});
|
|
|
|
utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {
|
|
defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);
|
|
});
|
|
|
|
module.exports = defaults;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/helpers/bind.js":
|
|
/*!************************************************!*\
|
|
!*** ./node_modules/axios/lib/helpers/bind.js ***!
|
|
\************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
module.exports = function bind(fn, thisArg) {
|
|
return function wrap() {
|
|
var args = new Array(arguments.length);
|
|
for (var i = 0; i < args.length; i++) {
|
|
args[i] = arguments[i];
|
|
}
|
|
return fn.apply(thisArg, args);
|
|
};
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/helpers/buildURL.js":
|
|
/*!****************************************************!*\
|
|
!*** ./node_modules/axios/lib/helpers/buildURL.js ***!
|
|
\****************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
|
|
|
|
function encode(val) {
|
|
return encodeURIComponent(val).
|
|
replace(/%3A/gi, ':').
|
|
replace(/%24/g, '$').
|
|
replace(/%2C/gi, ',').
|
|
replace(/%20/g, '+').
|
|
replace(/%5B/gi, '[').
|
|
replace(/%5D/gi, ']');
|
|
}
|
|
|
|
/**
|
|
* Build a URL by appending params to the end
|
|
*
|
|
* @param {string} url The base of the url (e.g., http://www.google.com)
|
|
* @param {object} [params] The params to be appended
|
|
* @returns {string} The formatted url
|
|
*/
|
|
module.exports = function buildURL(url, params, paramsSerializer) {
|
|
/*eslint no-param-reassign:0*/
|
|
if (!params) {
|
|
return url;
|
|
}
|
|
|
|
var serializedParams;
|
|
if (paramsSerializer) {
|
|
serializedParams = paramsSerializer(params);
|
|
} else if (utils.isURLSearchParams(params)) {
|
|
serializedParams = params.toString();
|
|
} else {
|
|
var parts = [];
|
|
|
|
utils.forEach(params, function serialize(val, key) {
|
|
if (val === null || typeof val === 'undefined') {
|
|
return;
|
|
}
|
|
|
|
if (utils.isArray(val)) {
|
|
key = key + '[]';
|
|
} else {
|
|
val = [val];
|
|
}
|
|
|
|
utils.forEach(val, function parseValue(v) {
|
|
if (utils.isDate(v)) {
|
|
v = v.toISOString();
|
|
} else if (utils.isObject(v)) {
|
|
v = JSON.stringify(v);
|
|
}
|
|
parts.push(encode(key) + '=' + encode(v));
|
|
});
|
|
});
|
|
|
|
serializedParams = parts.join('&');
|
|
}
|
|
|
|
if (serializedParams) {
|
|
var hashmarkIndex = url.indexOf('#');
|
|
if (hashmarkIndex !== -1) {
|
|
url = url.slice(0, hashmarkIndex);
|
|
}
|
|
|
|
url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;
|
|
}
|
|
|
|
return url;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/helpers/combineURLs.js":
|
|
/*!*******************************************************!*\
|
|
!*** ./node_modules/axios/lib/helpers/combineURLs.js ***!
|
|
\*******************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
/**
|
|
* Creates a new URL by combining the specified URLs
|
|
*
|
|
* @param {string} baseURL The base URL
|
|
* @param {string} relativeURL The relative URL
|
|
* @returns {string} The combined URL
|
|
*/
|
|
module.exports = function combineURLs(baseURL, relativeURL) {
|
|
return relativeURL
|
|
? baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '')
|
|
: baseURL;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/helpers/cookies.js":
|
|
/*!***************************************************!*\
|
|
!*** ./node_modules/axios/lib/helpers/cookies.js ***!
|
|
\***************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
|
|
|
|
module.exports = (
|
|
utils.isStandardBrowserEnv() ?
|
|
|
|
// Standard browser envs support document.cookie
|
|
(function standardBrowserEnv() {
|
|
return {
|
|
write: function write(name, value, expires, path, domain, secure) {
|
|
var cookie = [];
|
|
cookie.push(name + '=' + encodeURIComponent(value));
|
|
|
|
if (utils.isNumber(expires)) {
|
|
cookie.push('expires=' + new Date(expires).toGMTString());
|
|
}
|
|
|
|
if (utils.isString(path)) {
|
|
cookie.push('path=' + path);
|
|
}
|
|
|
|
if (utils.isString(domain)) {
|
|
cookie.push('domain=' + domain);
|
|
}
|
|
|
|
if (secure === true) {
|
|
cookie.push('secure');
|
|
}
|
|
|
|
document.cookie = cookie.join('; ');
|
|
},
|
|
|
|
read: function read(name) {
|
|
var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)'));
|
|
return (match ? decodeURIComponent(match[3]) : null);
|
|
},
|
|
|
|
remove: function remove(name) {
|
|
this.write(name, '', Date.now() - 86400000);
|
|
}
|
|
};
|
|
})() :
|
|
|
|
// Non standard browser env (web workers, react-native) lack needed support.
|
|
(function nonStandardBrowserEnv() {
|
|
return {
|
|
write: function write() {},
|
|
read: function read() { return null; },
|
|
remove: function remove() {}
|
|
};
|
|
})()
|
|
);
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/helpers/isAbsoluteURL.js":
|
|
/*!*********************************************************!*\
|
|
!*** ./node_modules/axios/lib/helpers/isAbsoluteURL.js ***!
|
|
\*********************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
/**
|
|
* Determines whether the specified URL is absolute
|
|
*
|
|
* @param {string} url The URL to test
|
|
* @returns {boolean} True if the specified URL is absolute, otherwise false
|
|
*/
|
|
module.exports = function isAbsoluteURL(url) {
|
|
// A URL is considered absolute if it begins with "<scheme>://" or "//" (protocol-relative URL).
|
|
// RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed
|
|
// by any combination of letters, digits, plus, period, or hyphen.
|
|
return /^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(url);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/helpers/isAxiosError.js":
|
|
/*!********************************************************!*\
|
|
!*** ./node_modules/axios/lib/helpers/isAxiosError.js ***!
|
|
\********************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
/**
|
|
* Determines whether the payload is an error thrown by Axios
|
|
*
|
|
* @param {*} payload The value to test
|
|
* @returns {boolean} True if the payload is an error thrown by Axios, otherwise false
|
|
*/
|
|
module.exports = function isAxiosError(payload) {
|
|
return (typeof payload === 'object') && (payload.isAxiosError === true);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/helpers/isURLSameOrigin.js":
|
|
/*!***********************************************************!*\
|
|
!*** ./node_modules/axios/lib/helpers/isURLSameOrigin.js ***!
|
|
\***********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
|
|
|
|
module.exports = (
|
|
utils.isStandardBrowserEnv() ?
|
|
|
|
// Standard browser envs have full support of the APIs needed to test
|
|
// whether the request URL is of the same origin as current location.
|
|
(function standardBrowserEnv() {
|
|
var msie = /(msie|trident)/i.test(navigator.userAgent);
|
|
var urlParsingNode = document.createElement('a');
|
|
var originURL;
|
|
|
|
/**
|
|
* Parse a URL to discover it's components
|
|
*
|
|
* @param {String} url The URL to be parsed
|
|
* @returns {Object}
|
|
*/
|
|
function resolveURL(url) {
|
|
var href = url;
|
|
|
|
if (msie) {
|
|
// IE needs attribute set twice to normalize properties
|
|
urlParsingNode.setAttribute('href', href);
|
|
href = urlParsingNode.href;
|
|
}
|
|
|
|
urlParsingNode.setAttribute('href', href);
|
|
|
|
// urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils
|
|
return {
|
|
href: urlParsingNode.href,
|
|
protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',
|
|
host: urlParsingNode.host,
|
|
search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '',
|
|
hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',
|
|
hostname: urlParsingNode.hostname,
|
|
port: urlParsingNode.port,
|
|
pathname: (urlParsingNode.pathname.charAt(0) === '/') ?
|
|
urlParsingNode.pathname :
|
|
'/' + urlParsingNode.pathname
|
|
};
|
|
}
|
|
|
|
originURL = resolveURL(window.location.href);
|
|
|
|
/**
|
|
* Determine if a URL shares the same origin as the current location
|
|
*
|
|
* @param {String} requestURL The URL to test
|
|
* @returns {boolean} True if URL shares the same origin, otherwise false
|
|
*/
|
|
return function isURLSameOrigin(requestURL) {
|
|
var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;
|
|
return (parsed.protocol === originURL.protocol &&
|
|
parsed.host === originURL.host);
|
|
};
|
|
})() :
|
|
|
|
// Non standard browser envs (web workers, react-native) lack needed support.
|
|
(function nonStandardBrowserEnv() {
|
|
return function isURLSameOrigin() {
|
|
return true;
|
|
};
|
|
})()
|
|
);
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/helpers/normalizeHeaderName.js":
|
|
/*!***************************************************************!*\
|
|
!*** ./node_modules/axios/lib/helpers/normalizeHeaderName.js ***!
|
|
\***************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var utils = __webpack_require__(/*! ../utils */ "./node_modules/axios/lib/utils.js");
|
|
|
|
module.exports = function normalizeHeaderName(headers, normalizedName) {
|
|
utils.forEach(headers, function processHeader(value, name) {
|
|
if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {
|
|
headers[normalizedName] = value;
|
|
delete headers[name];
|
|
}
|
|
});
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/helpers/parseHeaders.js":
|
|
/*!********************************************************!*\
|
|
!*** ./node_modules/axios/lib/helpers/parseHeaders.js ***!
|
|
\********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
|
|
|
|
// Headers whose duplicates are ignored by node
|
|
// c.f. https://nodejs.org/api/http.html#http_message_headers
|
|
var ignoreDuplicateOf = [
|
|
'age', 'authorization', 'content-length', 'content-type', 'etag',
|
|
'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',
|
|
'last-modified', 'location', 'max-forwards', 'proxy-authorization',
|
|
'referer', 'retry-after', 'user-agent'
|
|
];
|
|
|
|
/**
|
|
* Parse headers into an object
|
|
*
|
|
* ```
|
|
* Date: Wed, 27 Aug 2014 08:58:49 GMT
|
|
* Content-Type: application/json
|
|
* Connection: keep-alive
|
|
* Transfer-Encoding: chunked
|
|
* ```
|
|
*
|
|
* @param {String} headers Headers needing to be parsed
|
|
* @returns {Object} Headers parsed into an object
|
|
*/
|
|
module.exports = function parseHeaders(headers) {
|
|
var parsed = {};
|
|
var key;
|
|
var val;
|
|
var i;
|
|
|
|
if (!headers) { return parsed; }
|
|
|
|
utils.forEach(headers.split('\n'), function parser(line) {
|
|
i = line.indexOf(':');
|
|
key = utils.trim(line.substr(0, i)).toLowerCase();
|
|
val = utils.trim(line.substr(i + 1));
|
|
|
|
if (key) {
|
|
if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {
|
|
return;
|
|
}
|
|
if (key === 'set-cookie') {
|
|
parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);
|
|
} else {
|
|
parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;
|
|
}
|
|
}
|
|
});
|
|
|
|
return parsed;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/helpers/spread.js":
|
|
/*!**************************************************!*\
|
|
!*** ./node_modules/axios/lib/helpers/spread.js ***!
|
|
\**************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
/**
|
|
* Syntactic sugar for invoking a function and expanding an array for arguments.
|
|
*
|
|
* Common use case would be to use `Function.prototype.apply`.
|
|
*
|
|
* ```js
|
|
* function f(x, y, z) {}
|
|
* var args = [1, 2, 3];
|
|
* f.apply(null, args);
|
|
* ```
|
|
*
|
|
* With `spread` this example can be re-written.
|
|
*
|
|
* ```js
|
|
* spread(function(x, y, z) {})([1, 2, 3]);
|
|
* ```
|
|
*
|
|
* @param {Function} callback
|
|
* @returns {Function}
|
|
*/
|
|
module.exports = function spread(callback) {
|
|
return function wrap(arr) {
|
|
return callback.apply(null, arr);
|
|
};
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/axios/lib/utils.js":
|
|
/*!*****************************************!*\
|
|
!*** ./node_modules/axios/lib/utils.js ***!
|
|
\*****************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var bind = __webpack_require__(/*! ./helpers/bind */ "./node_modules/axios/lib/helpers/bind.js");
|
|
|
|
/*global toString:true*/
|
|
|
|
// utils is a library of generic helper functions non-specific to axios
|
|
|
|
var toString = Object.prototype.toString;
|
|
|
|
/**
|
|
* Determine if a value is an Array
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is an Array, otherwise false
|
|
*/
|
|
function isArray(val) {
|
|
return toString.call(val) === '[object Array]';
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is undefined
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if the value is undefined, otherwise false
|
|
*/
|
|
function isUndefined(val) {
|
|
return typeof val === 'undefined';
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is a Buffer
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is a Buffer, otherwise false
|
|
*/
|
|
function isBuffer(val) {
|
|
return val !== null && !isUndefined(val) && val.constructor !== null && !isUndefined(val.constructor)
|
|
&& typeof val.constructor.isBuffer === 'function' && val.constructor.isBuffer(val);
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is an ArrayBuffer
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is an ArrayBuffer, otherwise false
|
|
*/
|
|
function isArrayBuffer(val) {
|
|
return toString.call(val) === '[object ArrayBuffer]';
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is a FormData
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is an FormData, otherwise false
|
|
*/
|
|
function isFormData(val) {
|
|
return (typeof FormData !== 'undefined') && (val instanceof FormData);
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is a view on an ArrayBuffer
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false
|
|
*/
|
|
function isArrayBufferView(val) {
|
|
var result;
|
|
if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {
|
|
result = ArrayBuffer.isView(val);
|
|
} else {
|
|
result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is a String
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is a String, otherwise false
|
|
*/
|
|
function isString(val) {
|
|
return typeof val === 'string';
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is a Number
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is a Number, otherwise false
|
|
*/
|
|
function isNumber(val) {
|
|
return typeof val === 'number';
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is an Object
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is an Object, otherwise false
|
|
*/
|
|
function isObject(val) {
|
|
return val !== null && typeof val === 'object';
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is a plain Object
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @return {boolean} True if value is a plain Object, otherwise false
|
|
*/
|
|
function isPlainObject(val) {
|
|
if (toString.call(val) !== '[object Object]') {
|
|
return false;
|
|
}
|
|
|
|
var prototype = Object.getPrototypeOf(val);
|
|
return prototype === null || prototype === Object.prototype;
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is a Date
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is a Date, otherwise false
|
|
*/
|
|
function isDate(val) {
|
|
return toString.call(val) === '[object Date]';
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is a File
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is a File, otherwise false
|
|
*/
|
|
function isFile(val) {
|
|
return toString.call(val) === '[object File]';
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is a Blob
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is a Blob, otherwise false
|
|
*/
|
|
function isBlob(val) {
|
|
return toString.call(val) === '[object Blob]';
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is a Function
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is a Function, otherwise false
|
|
*/
|
|
function isFunction(val) {
|
|
return toString.call(val) === '[object Function]';
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is a Stream
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is a Stream, otherwise false
|
|
*/
|
|
function isStream(val) {
|
|
return isObject(val) && isFunction(val.pipe);
|
|
}
|
|
|
|
/**
|
|
* Determine if a value is a URLSearchParams object
|
|
*
|
|
* @param {Object} val The value to test
|
|
* @returns {boolean} True if value is a URLSearchParams object, otherwise false
|
|
*/
|
|
function isURLSearchParams(val) {
|
|
return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;
|
|
}
|
|
|
|
/**
|
|
* Trim excess whitespace off the beginning and end of a string
|
|
*
|
|
* @param {String} str The String to trim
|
|
* @returns {String} The String freed of excess whitespace
|
|
*/
|
|
function trim(str) {
|
|
return str.replace(/^\s*/, '').replace(/\s*$/, '');
|
|
}
|
|
|
|
/**
|
|
* Determine if we're running in a standard browser environment
|
|
*
|
|
* This allows axios to run in a web worker, and react-native.
|
|
* Both environments support XMLHttpRequest, but not fully standard globals.
|
|
*
|
|
* web workers:
|
|
* typeof window -> undefined
|
|
* typeof document -> undefined
|
|
*
|
|
* react-native:
|
|
* navigator.product -> 'ReactNative'
|
|
* nativescript
|
|
* navigator.product -> 'NativeScript' or 'NS'
|
|
*/
|
|
function isStandardBrowserEnv() {
|
|
if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' ||
|
|
navigator.product === 'NativeScript' ||
|
|
navigator.product === 'NS')) {
|
|
return false;
|
|
}
|
|
return (
|
|
typeof window !== 'undefined' &&
|
|
typeof document !== 'undefined'
|
|
);
|
|
}
|
|
|
|
/**
|
|
* Iterate over an Array or an Object invoking a function for each item.
|
|
*
|
|
* If `obj` is an Array callback will be called passing
|
|
* the value, index, and complete array for each item.
|
|
*
|
|
* If 'obj' is an Object callback will be called passing
|
|
* the value, key, and complete object for each property.
|
|
*
|
|
* @param {Object|Array} obj The object to iterate
|
|
* @param {Function} fn The callback to invoke for each item
|
|
*/
|
|
function forEach(obj, fn) {
|
|
// Don't bother if no value provided
|
|
if (obj === null || typeof obj === 'undefined') {
|
|
return;
|
|
}
|
|
|
|
// Force an array if not already something iterable
|
|
if (typeof obj !== 'object') {
|
|
/*eslint no-param-reassign:0*/
|
|
obj = [obj];
|
|
}
|
|
|
|
if (isArray(obj)) {
|
|
// Iterate over array values
|
|
for (var i = 0, l = obj.length; i < l; i++) {
|
|
fn.call(null, obj[i], i, obj);
|
|
}
|
|
} else {
|
|
// Iterate over object keys
|
|
for (var key in obj) {
|
|
if (Object.prototype.hasOwnProperty.call(obj, key)) {
|
|
fn.call(null, obj[key], key, obj);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Accepts varargs expecting each argument to be an object, then
|
|
* immutably merges the properties of each object and returns result.
|
|
*
|
|
* When multiple objects contain the same key the later object in
|
|
* the arguments list will take precedence.
|
|
*
|
|
* Example:
|
|
*
|
|
* ```js
|
|
* var result = merge({foo: 123}, {foo: 456});
|
|
* console.log(result.foo); // outputs 456
|
|
* ```
|
|
*
|
|
* @param {Object} obj1 Object to merge
|
|
* @returns {Object} Result of all merge properties
|
|
*/
|
|
function merge(/* obj1, obj2, obj3, ... */) {
|
|
var result = {};
|
|
function assignValue(val, key) {
|
|
if (isPlainObject(result[key]) && isPlainObject(val)) {
|
|
result[key] = merge(result[key], val);
|
|
} else if (isPlainObject(val)) {
|
|
result[key] = merge({}, val);
|
|
} else if (isArray(val)) {
|
|
result[key] = val.slice();
|
|
} else {
|
|
result[key] = val;
|
|
}
|
|
}
|
|
|
|
for (var i = 0, l = arguments.length; i < l; i++) {
|
|
forEach(arguments[i], assignValue);
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Extends object a by mutably adding to it the properties of object b.
|
|
*
|
|
* @param {Object} a The object to be extended
|
|
* @param {Object} b The object to copy properties from
|
|
* @param {Object} thisArg The object to bind function to
|
|
* @return {Object} The resulting value of object a
|
|
*/
|
|
function extend(a, b, thisArg) {
|
|
forEach(b, function assignValue(val, key) {
|
|
if (thisArg && typeof val === 'function') {
|
|
a[key] = bind(val, thisArg);
|
|
} else {
|
|
a[key] = val;
|
|
}
|
|
});
|
|
return a;
|
|
}
|
|
|
|
/**
|
|
* Remove byte order marker. This catches EF BB BF (the UTF-8 BOM)
|
|
*
|
|
* @param {string} content with BOM
|
|
* @return {string} content value without BOM
|
|
*/
|
|
function stripBOM(content) {
|
|
if (content.charCodeAt(0) === 0xFEFF) {
|
|
content = content.slice(1);
|
|
}
|
|
return content;
|
|
}
|
|
|
|
module.exports = {
|
|
isArray: isArray,
|
|
isArrayBuffer: isArrayBuffer,
|
|
isBuffer: isBuffer,
|
|
isFormData: isFormData,
|
|
isArrayBufferView: isArrayBufferView,
|
|
isString: isString,
|
|
isNumber: isNumber,
|
|
isObject: isObject,
|
|
isPlainObject: isPlainObject,
|
|
isUndefined: isUndefined,
|
|
isDate: isDate,
|
|
isFile: isFile,
|
|
isBlob: isBlob,
|
|
isFunction: isFunction,
|
|
isStream: isStream,
|
|
isURLSearchParams: isURLSearchParams,
|
|
isStandardBrowserEnv: isStandardBrowserEnv,
|
|
forEach: forEach,
|
|
merge: merge,
|
|
extend: extend,
|
|
trim: trim,
|
|
stripBOM: stripBOM
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/PageHeader.vue?vue&type=script&lang=js":
|
|
/*!****************************************************************************************************************************************************************************************************!*\
|
|
!*** ./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/PageHeader.vue?vue&type=script&lang=js ***!
|
|
\****************************************************************************************************************************************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _SiteNav_vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./SiteNav.vue */ "./resources/js/components/SiteNav.vue");
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = ({
|
|
components: {
|
|
SiteNav: _SiteNav_vue__WEBPACK_IMPORTED_MODULE_0__.default
|
|
}
|
|
});
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/views/Home.vue?vue&type=script&lang=js":
|
|
/*!*****************************************************************************************************************************************************************************************!*\
|
|
!*** ./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/views/Home.vue?vue&type=script&lang=js ***!
|
|
\*****************************************************************************************************************************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _components_PageHeader_vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ../components/PageHeader.vue */ "./resources/js/components/PageHeader.vue");
|
|
/* harmony import */ var _components_Container_vue__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! ../components/Container.vue */ "./resources/js/components/Container.vue");
|
|
/* harmony import */ var _components_SplitContent_vue__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! ../components/SplitContent.vue */ "./resources/js/components/SplitContent.vue");
|
|
/* harmony import */ var _components_BlogRecent_vue__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! ../components/BlogRecent.vue */ "./resources/js/components/BlogRecent.vue");
|
|
/* harmony import */ var _components_BlogPopular_vue__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! ../components/BlogPopular.vue */ "./resources/js/components/BlogPopular.vue");
|
|
/* harmony import */ var _components_PageFooter_vue__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! ../components/PageFooter.vue */ "./resources/js/components/PageFooter.vue");
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = ({
|
|
components: {
|
|
PageHeader: _components_PageHeader_vue__WEBPACK_IMPORTED_MODULE_0__.default,
|
|
Container: _components_Container_vue__WEBPACK_IMPORTED_MODULE_1__.default,
|
|
SplitContent: _components_SplitContent_vue__WEBPACK_IMPORTED_MODULE_2__.default,
|
|
BlogRecent: _components_BlogRecent_vue__WEBPACK_IMPORTED_MODULE_3__.default,
|
|
BlogPopular: _components_BlogPopular_vue__WEBPACK_IMPORTED_MODULE_4__.default,
|
|
PageFooter: _components_PageFooter_vue__WEBPACK_IMPORTED_MODULE_5__.default
|
|
}
|
|
});
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/apps/App.vue?vue&type=template&id=2dea4962":
|
|
/*!*******************************************************************************************************************************************************************************************************************************************************************!*\
|
|
!*** ./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/apps/App.vue?vue&type=template&id=2dea4962 ***!
|
|
\*******************************************************************************************************************************************************************************************************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* binding */ render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! vue */ "./node_modules/vue/dist/vue.esm-bundler.js");
|
|
|
|
function render(_ctx, _cache) {
|
|
var _component_router_view = (0,vue__WEBPACK_IMPORTED_MODULE_0__.resolveComponent)("router-view");
|
|
|
|
return (0,vue__WEBPACK_IMPORTED_MODULE_0__.openBlock)(), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createBlock)(_component_router_view);
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/BlogPopular.vue?vue&type=template&id=3498cf88":
|
|
/*!*********************************************************************************************************************************************************************************************************************************************************************************!*\
|
|
!*** ./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/BlogPopular.vue?vue&type=template&id=3498cf88 ***!
|
|
\*********************************************************************************************************************************************************************************************************************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* binding */ render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! vue */ "./node_modules/vue/dist/vue.esm-bundler.js");
|
|
|
|
var _hoisted_1 = {
|
|
"class": "blog-popular"
|
|
};
|
|
|
|
var _hoisted_2 = /*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createStaticVNode)("<h3>Popular content</h3><ul class=\"popular-items\"><li><span class=\"arrow\"><svg xmlns=\"http://www.w3.org/2000/svg\" width=\"20\" height=\"20\" viewBox=\"0 0 24 24\" fill=\"none\" stroke=\"currentColor\" stroke-width=\"2\" stroke-linecap=\"round\" stroke-linejoin=\"round\"><line x1=\"5\" y1=\"12\" x2=\"19\" y2=\"12\"></line><polyline points=\"12 5 19 12 12 19\"></polyline></svg></span><a class=\"link\" href=\"#\">Lorem ipsum dolor sit, amet consectetur adipisicing.</a></li><li><span class=\"arrow\"><svg xmlns=\"http://www.w3.org/2000/svg\" width=\"20\" height=\"20\" viewBox=\"0 0 24 24\" fill=\"none\" stroke=\"currentColor\" stroke-width=\"2\" stroke-linecap=\"round\" stroke-linejoin=\"round\"><line x1=\"5\" y1=\"12\" x2=\"19\" y2=\"12\"></line><polyline points=\"12 5 19 12 12 19\"></polyline></svg></span><a class=\"link\" href=\"#\">Lorem ipsum dolor sit.</a></li><li><span class=\"arrow\"><svg xmlns=\"http://www.w3.org/2000/svg\" width=\"20\" height=\"20\" viewBox=\"0 0 24 24\" fill=\"none\" stroke=\"currentColor\" stroke-width=\"2\" stroke-linecap=\"round\" stroke-linejoin=\"round\"><line x1=\"5\" y1=\"12\" x2=\"19\" y2=\"12\"></line><polyline points=\"12 5 19 12 12 19\"></polyline></svg></span><a class=\"link\" href=\"#\">Lorem ipsum dolor sit, amet consectetur adipisicing.</a></li><li><span class=\"arrow\"><svg xmlns=\"http://www.w3.org/2000/svg\" width=\"20\" height=\"20\" viewBox=\"0 0 24 24\" fill=\"none\" stroke=\"currentColor\" stroke-width=\"2\" stroke-linecap=\"round\" stroke-linejoin=\"round\"><line x1=\"5\" y1=\"12\" x2=\"19\" y2=\"12\"></line><polyline points=\"12 5 19 12 12 19\"></polyline></svg></span><a class=\"link\" href=\"#\">Lorem ipsum dolor sit, amet consectetur adipisicing.</a></li><li><span class=\"arrow\"><svg xmlns=\"http://www.w3.org/2000/svg\" width=\"20\" height=\"20\" viewBox=\"0 0 24 24\" fill=\"none\" stroke=\"currentColor\" stroke-width=\"2\" stroke-linecap=\"round\" stroke-linejoin=\"round\"><line x1=\"5\" y1=\"12\" x2=\"19\" y2=\"12\"></line><polyline points=\"12 5 19 12 12 19\"></polyline></svg></span><a class=\"link\" href=\"#\">Lorem ipsum dolor sit, amet consectetur adipisicing.</a></li></ul>", 2);
|
|
|
|
var _hoisted_4 = [_hoisted_2];
|
|
function render(_ctx, _cache) {
|
|
return (0,vue__WEBPACK_IMPORTED_MODULE_0__.openBlock)(), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementBlock)("section", _hoisted_1, _hoisted_4);
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/BlogRecent.vue?vue&type=template&id=6b89b6c8":
|
|
/*!********************************************************************************************************************************************************************************************************************************************************************************!*\
|
|
!*** ./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/BlogRecent.vue?vue&type=template&id=6b89b6c8 ***!
|
|
\********************************************************************************************************************************************************************************************************************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* binding */ render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! vue */ "./node_modules/vue/dist/vue.esm-bundler.js");
|
|
|
|
var _hoisted_1 = {
|
|
"class": "blog-recent"
|
|
};
|
|
|
|
var _hoisted_2 = /*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createStaticVNode)("<div class=\"header\"><h3>Latest Articles</h3><div class=\"all-articles\"><a href=\"javascript:void(0)\">All articles</a></div></div><div class=\"list\"><ul class=\"blog-items\"><li class=\"blog-item\"><img class=\"article-image\" src=\"//via.placeholder.com/128\" alt=\"Article Topic\"><div class=\"article-text\"><h4 class=\"article-title\"> Lorem ipsum dolor sit amet, consectetur adipisicing. </h4><span class=\"article-date\">March 8, 2021</span></div></li><li class=\"blog-item\"><img class=\"article-image\" src=\"//via.placeholder.com/128\" alt=\"Article Topic\"><div class=\"article-text\"><h4 class=\"article-title\"> Lorem ipsum dolor sit amet, consectetur adipisicing. </h4><span class=\"article-date\">March 8, 2021</span></div></li><li class=\"blog-item\"><img class=\"article-image\" src=\"//via.placeholder.com/128\" alt=\"Article Topic\"><div class=\"article-text\"><h4 class=\"article-title\"> Lorem ipsum dolor sit amet, consectetur adipisicing. </h4><span class=\"article-date\">March 8, 2021</span></div></li><li class=\"blog-item\"><img class=\"article-image\" src=\"//via.placeholder.com/128\" alt=\"Article Topic\"><div class=\"article-text\"><h4 class=\"article-title\"> Lorem ipsum dolor sit amet, consectetur adipisicing. </h4><span class=\"article-date\">March 8, 2021</span></div></li><li class=\"blog-item\"><img class=\"article-image\" src=\"//via.placeholder.com/128\" alt=\"Article Topic\"><div class=\"article-text\"><h4 class=\"article-title\"> Lorem ipsum dolor sit amet, consectetur adipisicing. </h4><span class=\"article-date\">March 8, 2021</span></div></li><li class=\"blog-item\"><img class=\"article-image\" src=\"//via.placeholder.com/128\" alt=\"Article Topic\"><div class=\"article-text\"><h4 class=\"article-title\"> Lorem ipsum dolor sit amet, consectetur adipisicing. </h4><span class=\"article-date\">March 8, 2021</span></div></li><li class=\"blog-item\"><img class=\"article-image\" src=\"//via.placeholder.com/128\" alt=\"Article Topic\"><div class=\"article-text\"><h4 class=\"article-title\"> Lorem ipsum dolor sit amet, consectetur adipisicing. </h4><span class=\"article-date\">March 8, 2021</span></div></li><li class=\"blog-item\"><img class=\"article-image\" src=\"//via.placeholder.com/128\" alt=\"Article Topic\"><div class=\"article-text\"><h4 class=\"article-title\"> Lorem ipsum dolor sit amet, consectetur adipisicing. </h4><span class=\"article-date\">March 8, 2021</span></div></li><li class=\"blog-item\"><img class=\"article-image\" src=\"//via.placeholder.com/128\" alt=\"Article Topic\"><div class=\"article-text\"><h4 class=\"article-title\"> Lorem ipsum dolor sit amet, consectetur adipisicing. </h4><span class=\"article-date\">March 8, 2021</span></div></li><li class=\"blog-item\"><img class=\"article-image\" src=\"//via.placeholder.com/128\" alt=\"Article Topic\"><div class=\"article-text\"><h4 class=\"article-title\"> Lorem ipsum dolor sit amet, consectetur adipisicing. </h4><span class=\"article-date\">March 8, 2021</span></div></li></ul></div>", 2);
|
|
|
|
var _hoisted_4 = [_hoisted_2];
|
|
function render(_ctx, _cache) {
|
|
return (0,vue__WEBPACK_IMPORTED_MODULE_0__.openBlock)(), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementBlock)("section", _hoisted_1, _hoisted_4);
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/Container.vue?vue&type=template&id=ba1063b4":
|
|
/*!*******************************************************************************************************************************************************************************************************************************************************************************!*\
|
|
!*** ./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/Container.vue?vue&type=template&id=ba1063b4 ***!
|
|
\*******************************************************************************************************************************************************************************************************************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* binding */ render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! vue */ "./node_modules/vue/dist/vue.esm-bundler.js");
|
|
|
|
var _hoisted_1 = {
|
|
"class": "container"
|
|
};
|
|
function render(_ctx, _cache) {
|
|
return (0,vue__WEBPACK_IMPORTED_MODULE_0__.openBlock)(), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementBlock)("div", _hoisted_1, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.renderSlot)(_ctx.$slots, "default")]);
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/PageFooter.vue?vue&type=template&id=5e81b4b5":
|
|
/*!********************************************************************************************************************************************************************************************************************************************************************************!*\
|
|
!*** ./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/PageFooter.vue?vue&type=template&id=5e81b4b5 ***!
|
|
\********************************************************************************************************************************************************************************************************************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* binding */ render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! vue */ "./node_modules/vue/dist/vue.esm-bundler.js");
|
|
|
|
|
|
var _hoisted_1 = /*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createStaticVNode)("<div class=\"credits\"><p>Designed and developed by Daniel de Cloet.</p><p> Built with <a href=\"https://vuejs.org/\">Vue.js</a>. Iconset provided by <a href=\"https://fontawesome.com/\">Font Awesome</a>. </p></div><div class=\"social-links\"><ul><li><a href=\"javascript:void(0)\"><i class=\"fab fa-github\"></i></a></li><li><a href=\"javascript:void(0)\"><i class=\"fab fa-gitlab\"></i></a></li><li><a href=\"javascript:void(0)\"><i class=\"fab fa-linkedin\"></i></a></li></ul></div>", 2);
|
|
|
|
var _hoisted_3 = [_hoisted_1];
|
|
function render(_ctx, _cache) {
|
|
return (0,vue__WEBPACK_IMPORTED_MODULE_0__.openBlock)(), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementBlock)("footer", null, _hoisted_3);
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/PageHeader.vue?vue&type=template&id=7fb418a7":
|
|
/*!********************************************************************************************************************************************************************************************************************************************************************************!*\
|
|
!*** ./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/PageHeader.vue?vue&type=template&id=7fb418a7 ***!
|
|
\********************************************************************************************************************************************************************************************************************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* binding */ render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! vue */ "./node_modules/vue/dist/vue.esm-bundler.js");
|
|
|
|
var _hoisted_1 = {
|
|
"class": "home-header"
|
|
};
|
|
var _hoisted_2 = {
|
|
"class": "container"
|
|
};
|
|
|
|
var _hoisted_3 = /*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("a", {
|
|
"class": "brand",
|
|
href: "/"
|
|
}, [/*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("img", {
|
|
"class": "brand-logo",
|
|
src: "//via.placeholder.com/256",
|
|
alt: "Brand Logo"
|
|
}), /*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("span", {
|
|
"class": "brand-name"
|
|
}, "Daniel de Cloet")], -1
|
|
/* HOISTED */
|
|
);
|
|
|
|
var _hoisted_4 = {
|
|
"class": "site-nav"
|
|
};
|
|
|
|
var _hoisted_5 = /*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("section", {
|
|
"class": "hero"
|
|
}, [/*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("h1", null, "I'm Daniel, junior software engineer"), /*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("p", null, " Lorem ipsum dolor sit amet consectetur, adipisicing elit. Deleniti iure earum odio architecto? Tenetur in ea, animi illo non voluptatibus distinctio consequuntur ipsam adipisci officiis quod, recusandae facilis? Ut, aliquid. ")], -1
|
|
/* HOISTED */
|
|
);
|
|
|
|
var _hoisted_6 = /*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("div", {
|
|
"class": "wave"
|
|
}, [/*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("svg", {
|
|
preserveAspectRatio: "none",
|
|
width: "1440",
|
|
height: "74",
|
|
viewBox: "0 0 1440 74"
|
|
}, [/*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("path", {
|
|
d: "M456.464 0.0433865C277.158 -1.70575 0 50.0141 0 50.0141V74H1440V50.0141C1440 50.0141 1320.4 31.1925 1243.09 27.0276C1099.33 19.2816 1019.08 53.1981 875.138 50.0141C710.527 46.3727 621.108 1.64949 456.464 0.0433865Z"
|
|
})])], -1
|
|
/* HOISTED */
|
|
);
|
|
|
|
function render(_ctx, _cache, $props, $setup, $data, $options) {
|
|
var _component_site_nav = (0,vue__WEBPACK_IMPORTED_MODULE_0__.resolveComponent)("site-nav");
|
|
|
|
return (0,vue__WEBPACK_IMPORTED_MODULE_0__.openBlock)(), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementBlock)("div", _hoisted_1, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("div", _hoisted_2, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("header", null, [_hoisted_3, (0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("nav", _hoisted_4, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createVNode)(_component_site_nav)])]), _hoisted_5]), _hoisted_6]);
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/SiteNav.vue?vue&type=template&id=3cf6587e":
|
|
/*!*****************************************************************************************************************************************************************************************************************************************************************************!*\
|
|
!*** ./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/SiteNav.vue?vue&type=template&id=3cf6587e ***!
|
|
\*****************************************************************************************************************************************************************************************************************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* binding */ render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! vue */ "./node_modules/vue/dist/vue.esm-bundler.js");
|
|
|
|
var _hoisted_1 = {
|
|
"class": "nav-items"
|
|
};
|
|
var _hoisted_2 = {
|
|
"class": "nav-item"
|
|
};
|
|
|
|
var _hoisted_3 = /*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createTextVNode)("Blog");
|
|
|
|
var _hoisted_4 = {
|
|
"class": "nav-item"
|
|
};
|
|
|
|
var _hoisted_5 = /*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createTextVNode)("Snippets");
|
|
|
|
var _hoisted_6 = {
|
|
"class": "nav-item"
|
|
};
|
|
|
|
var _hoisted_7 = /*#__PURE__*/(0,vue__WEBPACK_IMPORTED_MODULE_0__.createTextVNode)("Contact");
|
|
|
|
function render(_ctx, _cache) {
|
|
var _component_router_link = (0,vue__WEBPACK_IMPORTED_MODULE_0__.resolveComponent)("router-link");
|
|
|
|
return (0,vue__WEBPACK_IMPORTED_MODULE_0__.openBlock)(), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementBlock)("ul", _hoisted_1, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("li", _hoisted_2, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createVNode)(_component_router_link, {
|
|
to: {
|
|
name: 'blog'
|
|
}
|
|
}, {
|
|
"default": (0,vue__WEBPACK_IMPORTED_MODULE_0__.withCtx)(function () {
|
|
return [_hoisted_3];
|
|
}),
|
|
_: 1
|
|
/* STABLE */
|
|
|
|
})]), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("li", _hoisted_4, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createVNode)(_component_router_link, {
|
|
to: {
|
|
name: 'snippets'
|
|
}
|
|
}, {
|
|
"default": (0,vue__WEBPACK_IMPORTED_MODULE_0__.withCtx)(function () {
|
|
return [_hoisted_5];
|
|
}),
|
|
_: 1
|
|
/* STABLE */
|
|
|
|
})]), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("li", _hoisted_6, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createVNode)(_component_router_link, {
|
|
to: {
|
|
name: 'contact'
|
|
}
|
|
}, {
|
|
"default": (0,vue__WEBPACK_IMPORTED_MODULE_0__.withCtx)(function () {
|
|
return [_hoisted_7];
|
|
}),
|
|
_: 1
|
|
/* STABLE */
|
|
|
|
})])]);
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/SplitContent.vue?vue&type=template&id=1553872c":
|
|
/*!**********************************************************************************************************************************************************************************************************************************************************************************!*\
|
|
!*** ./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/SplitContent.vue?vue&type=template&id=1553872c ***!
|
|
\**********************************************************************************************************************************************************************************************************************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* binding */ render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! vue */ "./node_modules/vue/dist/vue.esm-bundler.js");
|
|
|
|
var _hoisted_1 = {
|
|
"class": "container"
|
|
};
|
|
var _hoisted_2 = {
|
|
"class": "split-content"
|
|
};
|
|
function render(_ctx, _cache) {
|
|
return (0,vue__WEBPACK_IMPORTED_MODULE_0__.openBlock)(), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementBlock)("div", _hoisted_1, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("div", _hoisted_2, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("main", null, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.renderSlot)(_ctx.$slots, "main")]), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementVNode)("aside", null, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.renderSlot)(_ctx.$slots, "aside")])])]);
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/views/Home.vue?vue&type=template&id=63cd6604":
|
|
/*!*********************************************************************************************************************************************************************************************************************************************************************!*\
|
|
!*** ./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/views/Home.vue?vue&type=template&id=63cd6604 ***!
|
|
\*********************************************************************************************************************************************************************************************************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* binding */ render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! vue */ "./node_modules/vue/dist/vue.esm-bundler.js");
|
|
|
|
function render(_ctx, _cache, $props, $setup, $data, $options) {
|
|
var _component_page_header = (0,vue__WEBPACK_IMPORTED_MODULE_0__.resolveComponent)("page-header");
|
|
|
|
var _component_blog_recent = (0,vue__WEBPACK_IMPORTED_MODULE_0__.resolveComponent)("blog-recent");
|
|
|
|
var _component_blog_popular = (0,vue__WEBPACK_IMPORTED_MODULE_0__.resolveComponent)("blog-popular");
|
|
|
|
var _component_split_content = (0,vue__WEBPACK_IMPORTED_MODULE_0__.resolveComponent)("split-content");
|
|
|
|
var _component_page_footer = (0,vue__WEBPACK_IMPORTED_MODULE_0__.resolveComponent)("page-footer");
|
|
|
|
var _component_container = (0,vue__WEBPACK_IMPORTED_MODULE_0__.resolveComponent)("container");
|
|
|
|
return (0,vue__WEBPACK_IMPORTED_MODULE_0__.openBlock)(), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createElementBlock)(vue__WEBPACK_IMPORTED_MODULE_0__.Fragment, null, [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createVNode)(_component_page_header), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createVNode)(_component_container, null, {
|
|
"default": (0,vue__WEBPACK_IMPORTED_MODULE_0__.withCtx)(function () {
|
|
return [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createVNode)(_component_split_content, null, {
|
|
main: (0,vue__WEBPACK_IMPORTED_MODULE_0__.withCtx)(function () {
|
|
return [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createVNode)(_component_blog_recent)];
|
|
}),
|
|
aside: (0,vue__WEBPACK_IMPORTED_MODULE_0__.withCtx)(function () {
|
|
return [(0,vue__WEBPACK_IMPORTED_MODULE_0__.createVNode)(_component_blog_popular)];
|
|
}),
|
|
_: 1
|
|
/* STABLE */
|
|
|
|
}), (0,vue__WEBPACK_IMPORTED_MODULE_0__.createVNode)(_component_page_footer)];
|
|
}),
|
|
_: 1
|
|
/* STABLE */
|
|
|
|
})], 64
|
|
/* STABLE_FRAGMENT */
|
|
);
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/app.js":
|
|
/*!*****************************!*\
|
|
!*** ./resources/js/app.js ***!
|
|
\*****************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony import */ var _router_app__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./router-app */ "./resources/js/router-app.js");
|
|
/* harmony import */ var _apps_App_vue__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! ./apps/App.vue */ "./resources/js/apps/App.vue");
|
|
__webpack_require__(/*! ./bootstrap */ "./resources/js/bootstrap.js"); // Import Vue.js
|
|
|
|
|
|
window.Vue = __webpack_require__(/*! vue */ "./node_modules/vue/dist/vue.esm-bundler.js");
|
|
|
|
// Create the Vue.js application
|
|
|
|
var app = Vue.createApp(_apps_App_vue__WEBPACK_IMPORTED_MODULE_1__.default); // Register plugins
|
|
|
|
app.use(_router_app__WEBPACK_IMPORTED_MODULE_0__.default); // Mount and start using Vue.js
|
|
|
|
app.mount('#app');
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/bootstrap.js":
|
|
/*!***********************************!*\
|
|
!*** ./resources/js/bootstrap.js ***!
|
|
\***********************************/
|
|
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
window._ = __webpack_require__(/*! lodash */ "./node_modules/lodash/lodash.js");
|
|
/**
|
|
* We'll load the axios HTTP library which allows us to easily issue requests
|
|
* to our Laravel back-end. This library automatically handles sending the
|
|
* CSRF token as a header based on the value of the "XSRF" token cookie.
|
|
*/
|
|
|
|
window.axios = __webpack_require__(/*! axios */ "./node_modules/axios/index.js");
|
|
window.axios.defaults.headers.common['X-Requested-With'] = 'XMLHttpRequest';
|
|
/**
|
|
* Echo exposes an expressive API for subscribing to channels and listening
|
|
* for events that are broadcast by Laravel. Echo and event broadcasting
|
|
* allows your team to easily build robust real-time web applications.
|
|
*/
|
|
// import Echo from 'laravel-echo';
|
|
// window.Pusher = require('pusher-js');
|
|
// window.Echo = new Echo({
|
|
// broadcaster: 'pusher',
|
|
// key: process.env.MIX_PUSHER_APP_KEY,
|
|
// cluster: process.env.MIX_PUSHER_APP_CLUSTER,
|
|
// forceTLS: true
|
|
// });
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/router-app.js":
|
|
/*!************************************!*\
|
|
!*** ./resources/js/router-app.js ***!
|
|
\************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _views_Home_vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./views/Home.vue */ "./resources/js/views/Home.vue");
|
|
/* harmony import */ var _views_Blog_vue__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! ./views/Blog.vue */ "./resources/js/views/Blog.vue");
|
|
/* harmony import */ var _views_Snippets_vue__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! ./views/Snippets.vue */ "./resources/js/views/Snippets.vue");
|
|
/* harmony import */ var _views_Contact_vue__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! ./views/Contact.vue */ "./resources/js/views/Contact.vue");
|
|
var VueRouter = __webpack_require__(/*! vue-router */ "./node_modules/vue-router/dist/vue-router.esm-bundler.js");
|
|
|
|
|
|
|
|
|
|
|
|
var routes = [{
|
|
path: '/',
|
|
name: 'index',
|
|
component: _views_Home_vue__WEBPACK_IMPORTED_MODULE_0__.default
|
|
}, {
|
|
path: '/blog',
|
|
name: 'blog',
|
|
component: _views_Blog_vue__WEBPACK_IMPORTED_MODULE_1__.default
|
|
}, {
|
|
path: '/snippets',
|
|
name: 'snippets',
|
|
component: _views_Snippets_vue__WEBPACK_IMPORTED_MODULE_2__.default
|
|
}, {
|
|
path: '/contact',
|
|
name: 'contact',
|
|
component: _views_Contact_vue__WEBPACK_IMPORTED_MODULE_3__.default
|
|
}];
|
|
var router = VueRouter.createRouter({
|
|
history: VueRouter.createWebHistory(),
|
|
routes: routes
|
|
});
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (router);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/lodash/lodash.js":
|
|
/*!***************************************!*\
|
|
!*** ./node_modules/lodash/lodash.js ***!
|
|
\***************************************/
|
|
/***/ (function(module, exports, __webpack_require__) {
|
|
|
|
/* module decorator */ module = __webpack_require__.nmd(module);
|
|
var __WEBPACK_AMD_DEFINE_RESULT__;/**
|
|
* @license
|
|
* Lodash <https://lodash.com/>
|
|
* Copyright OpenJS Foundation and other contributors <https://openjsf.org/>
|
|
* Released under MIT license <https://lodash.com/license>
|
|
* Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
|
|
* Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
|
|
*/
|
|
;(function() {
|
|
|
|
/** Used as a safe reference for `undefined` in pre-ES5 environments. */
|
|
var undefined;
|
|
|
|
/** Used as the semantic version number. */
|
|
var VERSION = '4.17.21';
|
|
|
|
/** Used as the size to enable large array optimizations. */
|
|
var LARGE_ARRAY_SIZE = 200;
|
|
|
|
/** Error message constants. */
|
|
var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.',
|
|
FUNC_ERROR_TEXT = 'Expected a function',
|
|
INVALID_TEMPL_VAR_ERROR_TEXT = 'Invalid `variable` option passed into `_.template`';
|
|
|
|
/** Used to stand-in for `undefined` hash values. */
|
|
var HASH_UNDEFINED = '__lodash_hash_undefined__';
|
|
|
|
/** Used as the maximum memoize cache size. */
|
|
var MAX_MEMOIZE_SIZE = 500;
|
|
|
|
/** Used as the internal argument placeholder. */
|
|
var PLACEHOLDER = '__lodash_placeholder__';
|
|
|
|
/** Used to compose bitmasks for cloning. */
|
|
var CLONE_DEEP_FLAG = 1,
|
|
CLONE_FLAT_FLAG = 2,
|
|
CLONE_SYMBOLS_FLAG = 4;
|
|
|
|
/** Used to compose bitmasks for value comparisons. */
|
|
var COMPARE_PARTIAL_FLAG = 1,
|
|
COMPARE_UNORDERED_FLAG = 2;
|
|
|
|
/** Used to compose bitmasks for function metadata. */
|
|
var WRAP_BIND_FLAG = 1,
|
|
WRAP_BIND_KEY_FLAG = 2,
|
|
WRAP_CURRY_BOUND_FLAG = 4,
|
|
WRAP_CURRY_FLAG = 8,
|
|
WRAP_CURRY_RIGHT_FLAG = 16,
|
|
WRAP_PARTIAL_FLAG = 32,
|
|
WRAP_PARTIAL_RIGHT_FLAG = 64,
|
|
WRAP_ARY_FLAG = 128,
|
|
WRAP_REARG_FLAG = 256,
|
|
WRAP_FLIP_FLAG = 512;
|
|
|
|
/** Used as default options for `_.truncate`. */
|
|
var DEFAULT_TRUNC_LENGTH = 30,
|
|
DEFAULT_TRUNC_OMISSION = '...';
|
|
|
|
/** Used to detect hot functions by number of calls within a span of milliseconds. */
|
|
var HOT_COUNT = 800,
|
|
HOT_SPAN = 16;
|
|
|
|
/** Used to indicate the type of lazy iteratees. */
|
|
var LAZY_FILTER_FLAG = 1,
|
|
LAZY_MAP_FLAG = 2,
|
|
LAZY_WHILE_FLAG = 3;
|
|
|
|
/** Used as references for various `Number` constants. */
|
|
var INFINITY = 1 / 0,
|
|
MAX_SAFE_INTEGER = 9007199254740991,
|
|
MAX_INTEGER = 1.7976931348623157e+308,
|
|
NAN = 0 / 0;
|
|
|
|
/** Used as references for the maximum length and index of an array. */
|
|
var MAX_ARRAY_LENGTH = 4294967295,
|
|
MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1,
|
|
HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1;
|
|
|
|
/** Used to associate wrap methods with their bit flags. */
|
|
var wrapFlags = [
|
|
['ary', WRAP_ARY_FLAG],
|
|
['bind', WRAP_BIND_FLAG],
|
|
['bindKey', WRAP_BIND_KEY_FLAG],
|
|
['curry', WRAP_CURRY_FLAG],
|
|
['curryRight', WRAP_CURRY_RIGHT_FLAG],
|
|
['flip', WRAP_FLIP_FLAG],
|
|
['partial', WRAP_PARTIAL_FLAG],
|
|
['partialRight', WRAP_PARTIAL_RIGHT_FLAG],
|
|
['rearg', WRAP_REARG_FLAG]
|
|
];
|
|
|
|
/** `Object#toString` result references. */
|
|
var argsTag = '[object Arguments]',
|
|
arrayTag = '[object Array]',
|
|
asyncTag = '[object AsyncFunction]',
|
|
boolTag = '[object Boolean]',
|
|
dateTag = '[object Date]',
|
|
domExcTag = '[object DOMException]',
|
|
errorTag = '[object Error]',
|
|
funcTag = '[object Function]',
|
|
genTag = '[object GeneratorFunction]',
|
|
mapTag = '[object Map]',
|
|
numberTag = '[object Number]',
|
|
nullTag = '[object Null]',
|
|
objectTag = '[object Object]',
|
|
promiseTag = '[object Promise]',
|
|
proxyTag = '[object Proxy]',
|
|
regexpTag = '[object RegExp]',
|
|
setTag = '[object Set]',
|
|
stringTag = '[object String]',
|
|
symbolTag = '[object Symbol]',
|
|
undefinedTag = '[object Undefined]',
|
|
weakMapTag = '[object WeakMap]',
|
|
weakSetTag = '[object WeakSet]';
|
|
|
|
var arrayBufferTag = '[object ArrayBuffer]',
|
|
dataViewTag = '[object DataView]',
|
|
float32Tag = '[object Float32Array]',
|
|
float64Tag = '[object Float64Array]',
|
|
int8Tag = '[object Int8Array]',
|
|
int16Tag = '[object Int16Array]',
|
|
int32Tag = '[object Int32Array]',
|
|
uint8Tag = '[object Uint8Array]',
|
|
uint8ClampedTag = '[object Uint8ClampedArray]',
|
|
uint16Tag = '[object Uint16Array]',
|
|
uint32Tag = '[object Uint32Array]';
|
|
|
|
/** Used to match empty string literals in compiled template source. */
|
|
var reEmptyStringLeading = /\b__p \+= '';/g,
|
|
reEmptyStringMiddle = /\b(__p \+=) '' \+/g,
|
|
reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g;
|
|
|
|
/** Used to match HTML entities and HTML characters. */
|
|
var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g,
|
|
reUnescapedHtml = /[&<>"']/g,
|
|
reHasEscapedHtml = RegExp(reEscapedHtml.source),
|
|
reHasUnescapedHtml = RegExp(reUnescapedHtml.source);
|
|
|
|
/** Used to match template delimiters. */
|
|
var reEscape = /<%-([\s\S]+?)%>/g,
|
|
reEvaluate = /<%([\s\S]+?)%>/g,
|
|
reInterpolate = /<%=([\s\S]+?)%>/g;
|
|
|
|
/** Used to match property names within property paths. */
|
|
var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/,
|
|
reIsPlainProp = /^\w*$/,
|
|
rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
|
|
|
|
/**
|
|
* Used to match `RegExp`
|
|
* [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).
|
|
*/
|
|
var reRegExpChar = /[\\^$.*+?()[\]{}|]/g,
|
|
reHasRegExpChar = RegExp(reRegExpChar.source);
|
|
|
|
/** Used to match leading whitespace. */
|
|
var reTrimStart = /^\s+/;
|
|
|
|
/** Used to match a single whitespace character. */
|
|
var reWhitespace = /\s/;
|
|
|
|
/** Used to match wrap detail comments. */
|
|
var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/,
|
|
reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/,
|
|
reSplitDetails = /,? & /;
|
|
|
|
/** Used to match words composed of alphanumeric characters. */
|
|
var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g;
|
|
|
|
/**
|
|
* Used to validate the `validate` option in `_.template` variable.
|
|
*
|
|
* Forbids characters which could potentially change the meaning of the function argument definition:
|
|
* - "()," (modification of function parameters)
|
|
* - "=" (default value)
|
|
* - "[]{}" (destructuring of function parameters)
|
|
* - "/" (beginning of a comment)
|
|
* - whitespace
|
|
*/
|
|
var reForbiddenIdentifierChars = /[()=,{}\[\]\/\s]/;
|
|
|
|
/** Used to match backslashes in property paths. */
|
|
var reEscapeChar = /\\(\\)?/g;
|
|
|
|
/**
|
|
* Used to match
|
|
* [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components).
|
|
*/
|
|
var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g;
|
|
|
|
/** Used to match `RegExp` flags from their coerced string values. */
|
|
var reFlags = /\w*$/;
|
|
|
|
/** Used to detect bad signed hexadecimal string values. */
|
|
var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;
|
|
|
|
/** Used to detect binary string values. */
|
|
var reIsBinary = /^0b[01]+$/i;
|
|
|
|
/** Used to detect host constructors (Safari). */
|
|
var reIsHostCtor = /^\[object .+?Constructor\]$/;
|
|
|
|
/** Used to detect octal string values. */
|
|
var reIsOctal = /^0o[0-7]+$/i;
|
|
|
|
/** Used to detect unsigned integer values. */
|
|
var reIsUint = /^(?:0|[1-9]\d*)$/;
|
|
|
|
/** Used to match Latin Unicode letters (excluding mathematical operators). */
|
|
var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g;
|
|
|
|
/** Used to ensure capturing order of template delimiters. */
|
|
var reNoMatch = /($^)/;
|
|
|
|
/** Used to match unescaped characters in compiled string literals. */
|
|
var reUnescapedString = /['\n\r\u2028\u2029\\]/g;
|
|
|
|
/** Used to compose unicode character classes. */
|
|
var rsAstralRange = '\\ud800-\\udfff',
|
|
rsComboMarksRange = '\\u0300-\\u036f',
|
|
reComboHalfMarksRange = '\\ufe20-\\ufe2f',
|
|
rsComboSymbolsRange = '\\u20d0-\\u20ff',
|
|
rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange,
|
|
rsDingbatRange = '\\u2700-\\u27bf',
|
|
rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff',
|
|
rsMathOpRange = '\\xac\\xb1\\xd7\\xf7',
|
|
rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf',
|
|
rsPunctuationRange = '\\u2000-\\u206f',
|
|
rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000',
|
|
rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde',
|
|
rsVarRange = '\\ufe0e\\ufe0f',
|
|
rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange;
|
|
|
|
/** Used to compose unicode capture groups. */
|
|
var rsApos = "['\u2019]",
|
|
rsAstral = '[' + rsAstralRange + ']',
|
|
rsBreak = '[' + rsBreakRange + ']',
|
|
rsCombo = '[' + rsComboRange + ']',
|
|
rsDigits = '\\d+',
|
|
rsDingbat = '[' + rsDingbatRange + ']',
|
|
rsLower = '[' + rsLowerRange + ']',
|
|
rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']',
|
|
rsFitz = '\\ud83c[\\udffb-\\udfff]',
|
|
rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')',
|
|
rsNonAstral = '[^' + rsAstralRange + ']',
|
|
rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}',
|
|
rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]',
|
|
rsUpper = '[' + rsUpperRange + ']',
|
|
rsZWJ = '\\u200d';
|
|
|
|
/** Used to compose unicode regexes. */
|
|
var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')',
|
|
rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')',
|
|
rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?',
|
|
rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?',
|
|
reOptMod = rsModifier + '?',
|
|
rsOptVar = '[' + rsVarRange + ']?',
|
|
rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*',
|
|
rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])',
|
|
rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])',
|
|
rsSeq = rsOptVar + reOptMod + rsOptJoin,
|
|
rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq,
|
|
rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')';
|
|
|
|
/** Used to match apostrophes. */
|
|
var reApos = RegExp(rsApos, 'g');
|
|
|
|
/**
|
|
* Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and
|
|
* [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols).
|
|
*/
|
|
var reComboMark = RegExp(rsCombo, 'g');
|
|
|
|
/** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */
|
|
var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g');
|
|
|
|
/** Used to match complex or compound words. */
|
|
var reUnicodeWord = RegExp([
|
|
rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')',
|
|
rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')',
|
|
rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower,
|
|
rsUpper + '+' + rsOptContrUpper,
|
|
rsOrdUpper,
|
|
rsOrdLower,
|
|
rsDigits,
|
|
rsEmoji
|
|
].join('|'), 'g');
|
|
|
|
/** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */
|
|
var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']');
|
|
|
|
/** Used to detect strings that need a more robust regexp to match words. */
|
|
var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/;
|
|
|
|
/** Used to assign default `context` object properties. */
|
|
var contextProps = [
|
|
'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array',
|
|
'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object',
|
|
'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array',
|
|
'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap',
|
|
'_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout'
|
|
];
|
|
|
|
/** Used to make template sourceURLs easier to identify. */
|
|
var templateCounter = -1;
|
|
|
|
/** Used to identify `toStringTag` values of typed arrays. */
|
|
var typedArrayTags = {};
|
|
typedArrayTags[float32Tag] = typedArrayTags[float64Tag] =
|
|
typedArrayTags[int8Tag] = typedArrayTags[int16Tag] =
|
|
typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =
|
|
typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =
|
|
typedArrayTags[uint32Tag] = true;
|
|
typedArrayTags[argsTag] = typedArrayTags[arrayTag] =
|
|
typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =
|
|
typedArrayTags[dataViewTag] = typedArrayTags[dateTag] =
|
|
typedArrayTags[errorTag] = typedArrayTags[funcTag] =
|
|
typedArrayTags[mapTag] = typedArrayTags[numberTag] =
|
|
typedArrayTags[objectTag] = typedArrayTags[regexpTag] =
|
|
typedArrayTags[setTag] = typedArrayTags[stringTag] =
|
|
typedArrayTags[weakMapTag] = false;
|
|
|
|
/** Used to identify `toStringTag` values supported by `_.clone`. */
|
|
var cloneableTags = {};
|
|
cloneableTags[argsTag] = cloneableTags[arrayTag] =
|
|
cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] =
|
|
cloneableTags[boolTag] = cloneableTags[dateTag] =
|
|
cloneableTags[float32Tag] = cloneableTags[float64Tag] =
|
|
cloneableTags[int8Tag] = cloneableTags[int16Tag] =
|
|
cloneableTags[int32Tag] = cloneableTags[mapTag] =
|
|
cloneableTags[numberTag] = cloneableTags[objectTag] =
|
|
cloneableTags[regexpTag] = cloneableTags[setTag] =
|
|
cloneableTags[stringTag] = cloneableTags[symbolTag] =
|
|
cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] =
|
|
cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;
|
|
cloneableTags[errorTag] = cloneableTags[funcTag] =
|
|
cloneableTags[weakMapTag] = false;
|
|
|
|
/** Used to map Latin Unicode letters to basic Latin letters. */
|
|
var deburredLetters = {
|
|
// Latin-1 Supplement block.
|
|
'\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A',
|
|
'\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a',
|
|
'\xc7': 'C', '\xe7': 'c',
|
|
'\xd0': 'D', '\xf0': 'd',
|
|
'\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E',
|
|
'\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e',
|
|
'\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I',
|
|
'\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i',
|
|
'\xd1': 'N', '\xf1': 'n',
|
|
'\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O',
|
|
'\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o',
|
|
'\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U',
|
|
'\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u',
|
|
'\xdd': 'Y', '\xfd': 'y', '\xff': 'y',
|
|
'\xc6': 'Ae', '\xe6': 'ae',
|
|
'\xde': 'Th', '\xfe': 'th',
|
|
'\xdf': 'ss',
|
|
// Latin Extended-A block.
|
|
'\u0100': 'A', '\u0102': 'A', '\u0104': 'A',
|
|
'\u0101': 'a', '\u0103': 'a', '\u0105': 'a',
|
|
'\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C',
|
|
'\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c',
|
|
'\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd',
|
|
'\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E',
|
|
'\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e',
|
|
'\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G',
|
|
'\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g',
|
|
'\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h',
|
|
'\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I',
|
|
'\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i',
|
|
'\u0134': 'J', '\u0135': 'j',
|
|
'\u0136': 'K', '\u0137': 'k', '\u0138': 'k',
|
|
'\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L',
|
|
'\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l',
|
|
'\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N',
|
|
'\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n',
|
|
'\u014c': 'O', '\u014e': 'O', '\u0150': 'O',
|
|
'\u014d': 'o', '\u014f': 'o', '\u0151': 'o',
|
|
'\u0154': 'R', '\u0156': 'R', '\u0158': 'R',
|
|
'\u0155': 'r', '\u0157': 'r', '\u0159': 'r',
|
|
'\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S',
|
|
'\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's',
|
|
'\u0162': 'T', '\u0164': 'T', '\u0166': 'T',
|
|
'\u0163': 't', '\u0165': 't', '\u0167': 't',
|
|
'\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U',
|
|
'\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u',
|
|
'\u0174': 'W', '\u0175': 'w',
|
|
'\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y',
|
|
'\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z',
|
|
'\u017a': 'z', '\u017c': 'z', '\u017e': 'z',
|
|
'\u0132': 'IJ', '\u0133': 'ij',
|
|
'\u0152': 'Oe', '\u0153': 'oe',
|
|
'\u0149': "'n", '\u017f': 's'
|
|
};
|
|
|
|
/** Used to map characters to HTML entities. */
|
|
var htmlEscapes = {
|
|
'&': '&',
|
|
'<': '<',
|
|
'>': '>',
|
|
'"': '"',
|
|
"'": '''
|
|
};
|
|
|
|
/** Used to map HTML entities to characters. */
|
|
var htmlUnescapes = {
|
|
'&': '&',
|
|
'<': '<',
|
|
'>': '>',
|
|
'"': '"',
|
|
''': "'"
|
|
};
|
|
|
|
/** Used to escape characters for inclusion in compiled string literals. */
|
|
var stringEscapes = {
|
|
'\\': '\\',
|
|
"'": "'",
|
|
'\n': 'n',
|
|
'\r': 'r',
|
|
'\u2028': 'u2028',
|
|
'\u2029': 'u2029'
|
|
};
|
|
|
|
/** Built-in method references without a dependency on `root`. */
|
|
var freeParseFloat = parseFloat,
|
|
freeParseInt = parseInt;
|
|
|
|
/** Detect free variable `global` from Node.js. */
|
|
var freeGlobal = typeof __webpack_require__.g == 'object' && __webpack_require__.g && __webpack_require__.g.Object === Object && __webpack_require__.g;
|
|
|
|
/** Detect free variable `self`. */
|
|
var freeSelf = typeof self == 'object' && self && self.Object === Object && self;
|
|
|
|
/** Used as a reference to the global object. */
|
|
var root = freeGlobal || freeSelf || Function('return this')();
|
|
|
|
/** Detect free variable `exports`. */
|
|
var freeExports = true && exports && !exports.nodeType && exports;
|
|
|
|
/** Detect free variable `module`. */
|
|
var freeModule = freeExports && "object" == 'object' && module && !module.nodeType && module;
|
|
|
|
/** Detect the popular CommonJS extension `module.exports`. */
|
|
var moduleExports = freeModule && freeModule.exports === freeExports;
|
|
|
|
/** Detect free variable `process` from Node.js. */
|
|
var freeProcess = moduleExports && freeGlobal.process;
|
|
|
|
/** Used to access faster Node.js helpers. */
|
|
var nodeUtil = (function() {
|
|
try {
|
|
// Use `util.types` for Node.js 10+.
|
|
var types = freeModule && freeModule.require && freeModule.require('util').types;
|
|
|
|
if (types) {
|
|
return types;
|
|
}
|
|
|
|
// Legacy `process.binding('util')` for Node.js < 10.
|
|
return freeProcess && freeProcess.binding && freeProcess.binding('util');
|
|
} catch (e) {}
|
|
}());
|
|
|
|
/* Node.js helper references. */
|
|
var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer,
|
|
nodeIsDate = nodeUtil && nodeUtil.isDate,
|
|
nodeIsMap = nodeUtil && nodeUtil.isMap,
|
|
nodeIsRegExp = nodeUtil && nodeUtil.isRegExp,
|
|
nodeIsSet = nodeUtil && nodeUtil.isSet,
|
|
nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;
|
|
|
|
/*--------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* A faster alternative to `Function#apply`, this function invokes `func`
|
|
* with the `this` binding of `thisArg` and the arguments of `args`.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to invoke.
|
|
* @param {*} thisArg The `this` binding of `func`.
|
|
* @param {Array} args The arguments to invoke `func` with.
|
|
* @returns {*} Returns the result of `func`.
|
|
*/
|
|
function apply(func, thisArg, args) {
|
|
switch (args.length) {
|
|
case 0: return func.call(thisArg);
|
|
case 1: return func.call(thisArg, args[0]);
|
|
case 2: return func.call(thisArg, args[0], args[1]);
|
|
case 3: return func.call(thisArg, args[0], args[1], args[2]);
|
|
}
|
|
return func.apply(thisArg, args);
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `baseAggregator` for arrays.
|
|
*
|
|
* @private
|
|
* @param {Array} [array] The array to iterate over.
|
|
* @param {Function} setter The function to set `accumulator` values.
|
|
* @param {Function} iteratee The iteratee to transform keys.
|
|
* @param {Object} accumulator The initial aggregated object.
|
|
* @returns {Function} Returns `accumulator`.
|
|
*/
|
|
function arrayAggregator(array, setter, iteratee, accumulator) {
|
|
var index = -1,
|
|
length = array == null ? 0 : array.length;
|
|
|
|
while (++index < length) {
|
|
var value = array[index];
|
|
setter(accumulator, value, iteratee(value), array);
|
|
}
|
|
return accumulator;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.forEach` for arrays without support for
|
|
* iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} [array] The array to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @returns {Array} Returns `array`.
|
|
*/
|
|
function arrayEach(array, iteratee) {
|
|
var index = -1,
|
|
length = array == null ? 0 : array.length;
|
|
|
|
while (++index < length) {
|
|
if (iteratee(array[index], index, array) === false) {
|
|
break;
|
|
}
|
|
}
|
|
return array;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.forEachRight` for arrays without support for
|
|
* iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} [array] The array to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @returns {Array} Returns `array`.
|
|
*/
|
|
function arrayEachRight(array, iteratee) {
|
|
var length = array == null ? 0 : array.length;
|
|
|
|
while (length--) {
|
|
if (iteratee(array[length], length, array) === false) {
|
|
break;
|
|
}
|
|
}
|
|
return array;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.every` for arrays without support for
|
|
* iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} [array] The array to iterate over.
|
|
* @param {Function} predicate The function invoked per iteration.
|
|
* @returns {boolean} Returns `true` if all elements pass the predicate check,
|
|
* else `false`.
|
|
*/
|
|
function arrayEvery(array, predicate) {
|
|
var index = -1,
|
|
length = array == null ? 0 : array.length;
|
|
|
|
while (++index < length) {
|
|
if (!predicate(array[index], index, array)) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.filter` for arrays without support for
|
|
* iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} [array] The array to iterate over.
|
|
* @param {Function} predicate The function invoked per iteration.
|
|
* @returns {Array} Returns the new filtered array.
|
|
*/
|
|
function arrayFilter(array, predicate) {
|
|
var index = -1,
|
|
length = array == null ? 0 : array.length,
|
|
resIndex = 0,
|
|
result = [];
|
|
|
|
while (++index < length) {
|
|
var value = array[index];
|
|
if (predicate(value, index, array)) {
|
|
result[resIndex++] = value;
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.includes` for arrays without support for
|
|
* specifying an index to search from.
|
|
*
|
|
* @private
|
|
* @param {Array} [array] The array to inspect.
|
|
* @param {*} target The value to search for.
|
|
* @returns {boolean} Returns `true` if `target` is found, else `false`.
|
|
*/
|
|
function arrayIncludes(array, value) {
|
|
var length = array == null ? 0 : array.length;
|
|
return !!length && baseIndexOf(array, value, 0) > -1;
|
|
}
|
|
|
|
/**
|
|
* This function is like `arrayIncludes` except that it accepts a comparator.
|
|
*
|
|
* @private
|
|
* @param {Array} [array] The array to inspect.
|
|
* @param {*} target The value to search for.
|
|
* @param {Function} comparator The comparator invoked per element.
|
|
* @returns {boolean} Returns `true` if `target` is found, else `false`.
|
|
*/
|
|
function arrayIncludesWith(array, value, comparator) {
|
|
var index = -1,
|
|
length = array == null ? 0 : array.length;
|
|
|
|
while (++index < length) {
|
|
if (comparator(value, array[index])) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.map` for arrays without support for iteratee
|
|
* shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} [array] The array to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @returns {Array} Returns the new mapped array.
|
|
*/
|
|
function arrayMap(array, iteratee) {
|
|
var index = -1,
|
|
length = array == null ? 0 : array.length,
|
|
result = Array(length);
|
|
|
|
while (++index < length) {
|
|
result[index] = iteratee(array[index], index, array);
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Appends the elements of `values` to `array`.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to modify.
|
|
* @param {Array} values The values to append.
|
|
* @returns {Array} Returns `array`.
|
|
*/
|
|
function arrayPush(array, values) {
|
|
var index = -1,
|
|
length = values.length,
|
|
offset = array.length;
|
|
|
|
while (++index < length) {
|
|
array[offset + index] = values[index];
|
|
}
|
|
return array;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.reduce` for arrays without support for
|
|
* iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} [array] The array to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @param {*} [accumulator] The initial value.
|
|
* @param {boolean} [initAccum] Specify using the first element of `array` as
|
|
* the initial value.
|
|
* @returns {*} Returns the accumulated value.
|
|
*/
|
|
function arrayReduce(array, iteratee, accumulator, initAccum) {
|
|
var index = -1,
|
|
length = array == null ? 0 : array.length;
|
|
|
|
if (initAccum && length) {
|
|
accumulator = array[++index];
|
|
}
|
|
while (++index < length) {
|
|
accumulator = iteratee(accumulator, array[index], index, array);
|
|
}
|
|
return accumulator;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.reduceRight` for arrays without support for
|
|
* iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} [array] The array to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @param {*} [accumulator] The initial value.
|
|
* @param {boolean} [initAccum] Specify using the last element of `array` as
|
|
* the initial value.
|
|
* @returns {*} Returns the accumulated value.
|
|
*/
|
|
function arrayReduceRight(array, iteratee, accumulator, initAccum) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (initAccum && length) {
|
|
accumulator = array[--length];
|
|
}
|
|
while (length--) {
|
|
accumulator = iteratee(accumulator, array[length], length, array);
|
|
}
|
|
return accumulator;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.some` for arrays without support for iteratee
|
|
* shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} [array] The array to iterate over.
|
|
* @param {Function} predicate The function invoked per iteration.
|
|
* @returns {boolean} Returns `true` if any element passes the predicate check,
|
|
* else `false`.
|
|
*/
|
|
function arraySome(array, predicate) {
|
|
var index = -1,
|
|
length = array == null ? 0 : array.length;
|
|
|
|
while (++index < length) {
|
|
if (predicate(array[index], index, array)) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
|
|
/**
|
|
* Gets the size of an ASCII `string`.
|
|
*
|
|
* @private
|
|
* @param {string} string The string inspect.
|
|
* @returns {number} Returns the string size.
|
|
*/
|
|
var asciiSize = baseProperty('length');
|
|
|
|
/**
|
|
* Converts an ASCII `string` to an array.
|
|
*
|
|
* @private
|
|
* @param {string} string The string to convert.
|
|
* @returns {Array} Returns the converted array.
|
|
*/
|
|
function asciiToArray(string) {
|
|
return string.split('');
|
|
}
|
|
|
|
/**
|
|
* Splits an ASCII `string` into an array of its words.
|
|
*
|
|
* @private
|
|
* @param {string} The string to inspect.
|
|
* @returns {Array} Returns the words of `string`.
|
|
*/
|
|
function asciiWords(string) {
|
|
return string.match(reAsciiWord) || [];
|
|
}
|
|
|
|
/**
|
|
* The base implementation of methods like `_.findKey` and `_.findLastKey`,
|
|
* without support for iteratee shorthands, which iterates over `collection`
|
|
* using `eachFunc`.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to inspect.
|
|
* @param {Function} predicate The function invoked per iteration.
|
|
* @param {Function} eachFunc The function to iterate over `collection`.
|
|
* @returns {*} Returns the found element or its key, else `undefined`.
|
|
*/
|
|
function baseFindKey(collection, predicate, eachFunc) {
|
|
var result;
|
|
eachFunc(collection, function(value, key, collection) {
|
|
if (predicate(value, key, collection)) {
|
|
result = key;
|
|
return false;
|
|
}
|
|
});
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.findIndex` and `_.findLastIndex` without
|
|
* support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to inspect.
|
|
* @param {Function} predicate The function invoked per iteration.
|
|
* @param {number} fromIndex The index to search from.
|
|
* @param {boolean} [fromRight] Specify iterating from right to left.
|
|
* @returns {number} Returns the index of the matched value, else `-1`.
|
|
*/
|
|
function baseFindIndex(array, predicate, fromIndex, fromRight) {
|
|
var length = array.length,
|
|
index = fromIndex + (fromRight ? 1 : -1);
|
|
|
|
while ((fromRight ? index-- : ++index < length)) {
|
|
if (predicate(array[index], index, array)) {
|
|
return index;
|
|
}
|
|
}
|
|
return -1;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.indexOf` without `fromIndex` bounds checks.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to inspect.
|
|
* @param {*} value The value to search for.
|
|
* @param {number} fromIndex The index to search from.
|
|
* @returns {number} Returns the index of the matched value, else `-1`.
|
|
*/
|
|
function baseIndexOf(array, value, fromIndex) {
|
|
return value === value
|
|
? strictIndexOf(array, value, fromIndex)
|
|
: baseFindIndex(array, baseIsNaN, fromIndex);
|
|
}
|
|
|
|
/**
|
|
* This function is like `baseIndexOf` except that it accepts a comparator.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to inspect.
|
|
* @param {*} value The value to search for.
|
|
* @param {number} fromIndex The index to search from.
|
|
* @param {Function} comparator The comparator invoked per element.
|
|
* @returns {number} Returns the index of the matched value, else `-1`.
|
|
*/
|
|
function baseIndexOfWith(array, value, fromIndex, comparator) {
|
|
var index = fromIndex - 1,
|
|
length = array.length;
|
|
|
|
while (++index < length) {
|
|
if (comparator(array[index], value)) {
|
|
return index;
|
|
}
|
|
}
|
|
return -1;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.isNaN` without support for number objects.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
|
|
*/
|
|
function baseIsNaN(value) {
|
|
return value !== value;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.mean` and `_.meanBy` without support for
|
|
* iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @returns {number} Returns the mean.
|
|
*/
|
|
function baseMean(array, iteratee) {
|
|
var length = array == null ? 0 : array.length;
|
|
return length ? (baseSum(array, iteratee) / length) : NAN;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.property` without support for deep paths.
|
|
*
|
|
* @private
|
|
* @param {string} key The key of the property to get.
|
|
* @returns {Function} Returns the new accessor function.
|
|
*/
|
|
function baseProperty(key) {
|
|
return function(object) {
|
|
return object == null ? undefined : object[key];
|
|
};
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.propertyOf` without support for deep paths.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @returns {Function} Returns the new accessor function.
|
|
*/
|
|
function basePropertyOf(object) {
|
|
return function(key) {
|
|
return object == null ? undefined : object[key];
|
|
};
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.reduce` and `_.reduceRight`, without support
|
|
* for iteratee shorthands, which iterates over `collection` using `eachFunc`.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @param {*} accumulator The initial value.
|
|
* @param {boolean} initAccum Specify using the first or last element of
|
|
* `collection` as the initial value.
|
|
* @param {Function} eachFunc The function to iterate over `collection`.
|
|
* @returns {*} Returns the accumulated value.
|
|
*/
|
|
function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) {
|
|
eachFunc(collection, function(value, index, collection) {
|
|
accumulator = initAccum
|
|
? (initAccum = false, value)
|
|
: iteratee(accumulator, value, index, collection);
|
|
});
|
|
return accumulator;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.sortBy` which uses `comparer` to define the
|
|
* sort order of `array` and replaces criteria objects with their corresponding
|
|
* values.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to sort.
|
|
* @param {Function} comparer The function to define sort order.
|
|
* @returns {Array} Returns `array`.
|
|
*/
|
|
function baseSortBy(array, comparer) {
|
|
var length = array.length;
|
|
|
|
array.sort(comparer);
|
|
while (length--) {
|
|
array[length] = array[length].value;
|
|
}
|
|
return array;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.sum` and `_.sumBy` without support for
|
|
* iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @returns {number} Returns the sum.
|
|
*/
|
|
function baseSum(array, iteratee) {
|
|
var result,
|
|
index = -1,
|
|
length = array.length;
|
|
|
|
while (++index < length) {
|
|
var current = iteratee(array[index]);
|
|
if (current !== undefined) {
|
|
result = result === undefined ? current : (result + current);
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.times` without support for iteratee shorthands
|
|
* or max array length checks.
|
|
*
|
|
* @private
|
|
* @param {number} n The number of times to invoke `iteratee`.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @returns {Array} Returns the array of results.
|
|
*/
|
|
function baseTimes(n, iteratee) {
|
|
var index = -1,
|
|
result = Array(n);
|
|
|
|
while (++index < n) {
|
|
result[index] = iteratee(index);
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array
|
|
* of key-value pairs for `object` corresponding to the property names of `props`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @param {Array} props The property names to get values for.
|
|
* @returns {Object} Returns the key-value pairs.
|
|
*/
|
|
function baseToPairs(object, props) {
|
|
return arrayMap(props, function(key) {
|
|
return [key, object[key]];
|
|
});
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.trim`.
|
|
*
|
|
* @private
|
|
* @param {string} string The string to trim.
|
|
* @returns {string} Returns the trimmed string.
|
|
*/
|
|
function baseTrim(string) {
|
|
return string
|
|
? string.slice(0, trimmedEndIndex(string) + 1).replace(reTrimStart, '')
|
|
: string;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.unary` without support for storing metadata.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to cap arguments for.
|
|
* @returns {Function} Returns the new capped function.
|
|
*/
|
|
function baseUnary(func) {
|
|
return function(value) {
|
|
return func(value);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.values` and `_.valuesIn` which creates an
|
|
* array of `object` property values corresponding to the property names
|
|
* of `props`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @param {Array} props The property names to get values for.
|
|
* @returns {Object} Returns the array of property values.
|
|
*/
|
|
function baseValues(object, props) {
|
|
return arrayMap(props, function(key) {
|
|
return object[key];
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Checks if a `cache` value for `key` exists.
|
|
*
|
|
* @private
|
|
* @param {Object} cache The cache to query.
|
|
* @param {string} key The key of the entry to check.
|
|
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
|
|
*/
|
|
function cacheHas(cache, key) {
|
|
return cache.has(key);
|
|
}
|
|
|
|
/**
|
|
* Used by `_.trim` and `_.trimStart` to get the index of the first string symbol
|
|
* that is not found in the character symbols.
|
|
*
|
|
* @private
|
|
* @param {Array} strSymbols The string symbols to inspect.
|
|
* @param {Array} chrSymbols The character symbols to find.
|
|
* @returns {number} Returns the index of the first unmatched string symbol.
|
|
*/
|
|
function charsStartIndex(strSymbols, chrSymbols) {
|
|
var index = -1,
|
|
length = strSymbols.length;
|
|
|
|
while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}
|
|
return index;
|
|
}
|
|
|
|
/**
|
|
* Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol
|
|
* that is not found in the character symbols.
|
|
*
|
|
* @private
|
|
* @param {Array} strSymbols The string symbols to inspect.
|
|
* @param {Array} chrSymbols The character symbols to find.
|
|
* @returns {number} Returns the index of the last unmatched string symbol.
|
|
*/
|
|
function charsEndIndex(strSymbols, chrSymbols) {
|
|
var index = strSymbols.length;
|
|
|
|
while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}
|
|
return index;
|
|
}
|
|
|
|
/**
|
|
* Gets the number of `placeholder` occurrences in `array`.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to inspect.
|
|
* @param {*} placeholder The placeholder to search for.
|
|
* @returns {number} Returns the placeholder count.
|
|
*/
|
|
function countHolders(array, placeholder) {
|
|
var length = array.length,
|
|
result = 0;
|
|
|
|
while (length--) {
|
|
if (array[length] === placeholder) {
|
|
++result;
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A
|
|
* letters to basic Latin letters.
|
|
*
|
|
* @private
|
|
* @param {string} letter The matched letter to deburr.
|
|
* @returns {string} Returns the deburred letter.
|
|
*/
|
|
var deburrLetter = basePropertyOf(deburredLetters);
|
|
|
|
/**
|
|
* Used by `_.escape` to convert characters to HTML entities.
|
|
*
|
|
* @private
|
|
* @param {string} chr The matched character to escape.
|
|
* @returns {string} Returns the escaped character.
|
|
*/
|
|
var escapeHtmlChar = basePropertyOf(htmlEscapes);
|
|
|
|
/**
|
|
* Used by `_.template` to escape characters for inclusion in compiled string literals.
|
|
*
|
|
* @private
|
|
* @param {string} chr The matched character to escape.
|
|
* @returns {string} Returns the escaped character.
|
|
*/
|
|
function escapeStringChar(chr) {
|
|
return '\\' + stringEscapes[chr];
|
|
}
|
|
|
|
/**
|
|
* Gets the value at `key` of `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} [object] The object to query.
|
|
* @param {string} key The key of the property to get.
|
|
* @returns {*} Returns the property value.
|
|
*/
|
|
function getValue(object, key) {
|
|
return object == null ? undefined : object[key];
|
|
}
|
|
|
|
/**
|
|
* Checks if `string` contains Unicode symbols.
|
|
*
|
|
* @private
|
|
* @param {string} string The string to inspect.
|
|
* @returns {boolean} Returns `true` if a symbol is found, else `false`.
|
|
*/
|
|
function hasUnicode(string) {
|
|
return reHasUnicode.test(string);
|
|
}
|
|
|
|
/**
|
|
* Checks if `string` contains a word composed of Unicode symbols.
|
|
*
|
|
* @private
|
|
* @param {string} string The string to inspect.
|
|
* @returns {boolean} Returns `true` if a word is found, else `false`.
|
|
*/
|
|
function hasUnicodeWord(string) {
|
|
return reHasUnicodeWord.test(string);
|
|
}
|
|
|
|
/**
|
|
* Converts `iterator` to an array.
|
|
*
|
|
* @private
|
|
* @param {Object} iterator The iterator to convert.
|
|
* @returns {Array} Returns the converted array.
|
|
*/
|
|
function iteratorToArray(iterator) {
|
|
var data,
|
|
result = [];
|
|
|
|
while (!(data = iterator.next()).done) {
|
|
result.push(data.value);
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Converts `map` to its key-value pairs.
|
|
*
|
|
* @private
|
|
* @param {Object} map The map to convert.
|
|
* @returns {Array} Returns the key-value pairs.
|
|
*/
|
|
function mapToArray(map) {
|
|
var index = -1,
|
|
result = Array(map.size);
|
|
|
|
map.forEach(function(value, key) {
|
|
result[++index] = [key, value];
|
|
});
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Creates a unary function that invokes `func` with its argument transformed.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to wrap.
|
|
* @param {Function} transform The argument transform.
|
|
* @returns {Function} Returns the new function.
|
|
*/
|
|
function overArg(func, transform) {
|
|
return function(arg) {
|
|
return func(transform(arg));
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Replaces all `placeholder` elements in `array` with an internal placeholder
|
|
* and returns an array of their indexes.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to modify.
|
|
* @param {*} placeholder The placeholder to replace.
|
|
* @returns {Array} Returns the new array of placeholder indexes.
|
|
*/
|
|
function replaceHolders(array, placeholder) {
|
|
var index = -1,
|
|
length = array.length,
|
|
resIndex = 0,
|
|
result = [];
|
|
|
|
while (++index < length) {
|
|
var value = array[index];
|
|
if (value === placeholder || value === PLACEHOLDER) {
|
|
array[index] = PLACEHOLDER;
|
|
result[resIndex++] = index;
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Converts `set` to an array of its values.
|
|
*
|
|
* @private
|
|
* @param {Object} set The set to convert.
|
|
* @returns {Array} Returns the values.
|
|
*/
|
|
function setToArray(set) {
|
|
var index = -1,
|
|
result = Array(set.size);
|
|
|
|
set.forEach(function(value) {
|
|
result[++index] = value;
|
|
});
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Converts `set` to its value-value pairs.
|
|
*
|
|
* @private
|
|
* @param {Object} set The set to convert.
|
|
* @returns {Array} Returns the value-value pairs.
|
|
*/
|
|
function setToPairs(set) {
|
|
var index = -1,
|
|
result = Array(set.size);
|
|
|
|
set.forEach(function(value) {
|
|
result[++index] = [value, value];
|
|
});
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.indexOf` which performs strict equality
|
|
* comparisons of values, i.e. `===`.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to inspect.
|
|
* @param {*} value The value to search for.
|
|
* @param {number} fromIndex The index to search from.
|
|
* @returns {number} Returns the index of the matched value, else `-1`.
|
|
*/
|
|
function strictIndexOf(array, value, fromIndex) {
|
|
var index = fromIndex - 1,
|
|
length = array.length;
|
|
|
|
while (++index < length) {
|
|
if (array[index] === value) {
|
|
return index;
|
|
}
|
|
}
|
|
return -1;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.lastIndexOf` which performs strict equality
|
|
* comparisons of values, i.e. `===`.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to inspect.
|
|
* @param {*} value The value to search for.
|
|
* @param {number} fromIndex The index to search from.
|
|
* @returns {number} Returns the index of the matched value, else `-1`.
|
|
*/
|
|
function strictLastIndexOf(array, value, fromIndex) {
|
|
var index = fromIndex + 1;
|
|
while (index--) {
|
|
if (array[index] === value) {
|
|
return index;
|
|
}
|
|
}
|
|
return index;
|
|
}
|
|
|
|
/**
|
|
* Gets the number of symbols in `string`.
|
|
*
|
|
* @private
|
|
* @param {string} string The string to inspect.
|
|
* @returns {number} Returns the string size.
|
|
*/
|
|
function stringSize(string) {
|
|
return hasUnicode(string)
|
|
? unicodeSize(string)
|
|
: asciiSize(string);
|
|
}
|
|
|
|
/**
|
|
* Converts `string` to an array.
|
|
*
|
|
* @private
|
|
* @param {string} string The string to convert.
|
|
* @returns {Array} Returns the converted array.
|
|
*/
|
|
function stringToArray(string) {
|
|
return hasUnicode(string)
|
|
? unicodeToArray(string)
|
|
: asciiToArray(string);
|
|
}
|
|
|
|
/**
|
|
* Used by `_.trim` and `_.trimEnd` to get the index of the last non-whitespace
|
|
* character of `string`.
|
|
*
|
|
* @private
|
|
* @param {string} string The string to inspect.
|
|
* @returns {number} Returns the index of the last non-whitespace character.
|
|
*/
|
|
function trimmedEndIndex(string) {
|
|
var index = string.length;
|
|
|
|
while (index-- && reWhitespace.test(string.charAt(index))) {}
|
|
return index;
|
|
}
|
|
|
|
/**
|
|
* Used by `_.unescape` to convert HTML entities to characters.
|
|
*
|
|
* @private
|
|
* @param {string} chr The matched character to unescape.
|
|
* @returns {string} Returns the unescaped character.
|
|
*/
|
|
var unescapeHtmlChar = basePropertyOf(htmlUnescapes);
|
|
|
|
/**
|
|
* Gets the size of a Unicode `string`.
|
|
*
|
|
* @private
|
|
* @param {string} string The string inspect.
|
|
* @returns {number} Returns the string size.
|
|
*/
|
|
function unicodeSize(string) {
|
|
var result = reUnicode.lastIndex = 0;
|
|
while (reUnicode.test(string)) {
|
|
++result;
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Converts a Unicode `string` to an array.
|
|
*
|
|
* @private
|
|
* @param {string} string The string to convert.
|
|
* @returns {Array} Returns the converted array.
|
|
*/
|
|
function unicodeToArray(string) {
|
|
return string.match(reUnicode) || [];
|
|
}
|
|
|
|
/**
|
|
* Splits a Unicode `string` into an array of its words.
|
|
*
|
|
* @private
|
|
* @param {string} The string to inspect.
|
|
* @returns {Array} Returns the words of `string`.
|
|
*/
|
|
function unicodeWords(string) {
|
|
return string.match(reUnicodeWord) || [];
|
|
}
|
|
|
|
/*--------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Create a new pristine `lodash` function using the `context` object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 1.1.0
|
|
* @category Util
|
|
* @param {Object} [context=root] The context object.
|
|
* @returns {Function} Returns a new `lodash` function.
|
|
* @example
|
|
*
|
|
* _.mixin({ 'foo': _.constant('foo') });
|
|
*
|
|
* var lodash = _.runInContext();
|
|
* lodash.mixin({ 'bar': lodash.constant('bar') });
|
|
*
|
|
* _.isFunction(_.foo);
|
|
* // => true
|
|
* _.isFunction(_.bar);
|
|
* // => false
|
|
*
|
|
* lodash.isFunction(lodash.foo);
|
|
* // => false
|
|
* lodash.isFunction(lodash.bar);
|
|
* // => true
|
|
*
|
|
* // Create a suped-up `defer` in Node.js.
|
|
* var defer = _.runInContext({ 'setTimeout': setImmediate }).defer;
|
|
*/
|
|
var runInContext = (function runInContext(context) {
|
|
context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps));
|
|
|
|
/** Built-in constructor references. */
|
|
var Array = context.Array,
|
|
Date = context.Date,
|
|
Error = context.Error,
|
|
Function = context.Function,
|
|
Math = context.Math,
|
|
Object = context.Object,
|
|
RegExp = context.RegExp,
|
|
String = context.String,
|
|
TypeError = context.TypeError;
|
|
|
|
/** Used for built-in method references. */
|
|
var arrayProto = Array.prototype,
|
|
funcProto = Function.prototype,
|
|
objectProto = Object.prototype;
|
|
|
|
/** Used to detect overreaching core-js shims. */
|
|
var coreJsData = context['__core-js_shared__'];
|
|
|
|
/** Used to resolve the decompiled source of functions. */
|
|
var funcToString = funcProto.toString;
|
|
|
|
/** Used to check objects for own properties. */
|
|
var hasOwnProperty = objectProto.hasOwnProperty;
|
|
|
|
/** Used to generate unique IDs. */
|
|
var idCounter = 0;
|
|
|
|
/** Used to detect methods masquerading as native. */
|
|
var maskSrcKey = (function() {
|
|
var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');
|
|
return uid ? ('Symbol(src)_1.' + uid) : '';
|
|
}());
|
|
|
|
/**
|
|
* Used to resolve the
|
|
* [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)
|
|
* of values.
|
|
*/
|
|
var nativeObjectToString = objectProto.toString;
|
|
|
|
/** Used to infer the `Object` constructor. */
|
|
var objectCtorString = funcToString.call(Object);
|
|
|
|
/** Used to restore the original `_` reference in `_.noConflict`. */
|
|
var oldDash = root._;
|
|
|
|
/** Used to detect if a method is native. */
|
|
var reIsNative = RegExp('^' +
|
|
funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&')
|
|
.replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$'
|
|
);
|
|
|
|
/** Built-in value references. */
|
|
var Buffer = moduleExports ? context.Buffer : undefined,
|
|
Symbol = context.Symbol,
|
|
Uint8Array = context.Uint8Array,
|
|
allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined,
|
|
getPrototype = overArg(Object.getPrototypeOf, Object),
|
|
objectCreate = Object.create,
|
|
propertyIsEnumerable = objectProto.propertyIsEnumerable,
|
|
splice = arrayProto.splice,
|
|
spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined,
|
|
symIterator = Symbol ? Symbol.iterator : undefined,
|
|
symToStringTag = Symbol ? Symbol.toStringTag : undefined;
|
|
|
|
var defineProperty = (function() {
|
|
try {
|
|
var func = getNative(Object, 'defineProperty');
|
|
func({}, '', {});
|
|
return func;
|
|
} catch (e) {}
|
|
}());
|
|
|
|
/** Mocked built-ins. */
|
|
var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout,
|
|
ctxNow = Date && Date.now !== root.Date.now && Date.now,
|
|
ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout;
|
|
|
|
/* Built-in method references for those with the same name as other `lodash` methods. */
|
|
var nativeCeil = Math.ceil,
|
|
nativeFloor = Math.floor,
|
|
nativeGetSymbols = Object.getOwnPropertySymbols,
|
|
nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,
|
|
nativeIsFinite = context.isFinite,
|
|
nativeJoin = arrayProto.join,
|
|
nativeKeys = overArg(Object.keys, Object),
|
|
nativeMax = Math.max,
|
|
nativeMin = Math.min,
|
|
nativeNow = Date.now,
|
|
nativeParseInt = context.parseInt,
|
|
nativeRandom = Math.random,
|
|
nativeReverse = arrayProto.reverse;
|
|
|
|
/* Built-in method references that are verified to be native. */
|
|
var DataView = getNative(context, 'DataView'),
|
|
Map = getNative(context, 'Map'),
|
|
Promise = getNative(context, 'Promise'),
|
|
Set = getNative(context, 'Set'),
|
|
WeakMap = getNative(context, 'WeakMap'),
|
|
nativeCreate = getNative(Object, 'create');
|
|
|
|
/** Used to store function metadata. */
|
|
var metaMap = WeakMap && new WeakMap;
|
|
|
|
/** Used to lookup unminified function names. */
|
|
var realNames = {};
|
|
|
|
/** Used to detect maps, sets, and weakmaps. */
|
|
var dataViewCtorString = toSource(DataView),
|
|
mapCtorString = toSource(Map),
|
|
promiseCtorString = toSource(Promise),
|
|
setCtorString = toSource(Set),
|
|
weakMapCtorString = toSource(WeakMap);
|
|
|
|
/** Used to convert symbols to primitives and strings. */
|
|
var symbolProto = Symbol ? Symbol.prototype : undefined,
|
|
symbolValueOf = symbolProto ? symbolProto.valueOf : undefined,
|
|
symbolToString = symbolProto ? symbolProto.toString : undefined;
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Creates a `lodash` object which wraps `value` to enable implicit method
|
|
* chain sequences. Methods that operate on and return arrays, collections,
|
|
* and functions can be chained together. Methods that retrieve a single value
|
|
* or may return a primitive value will automatically end the chain sequence
|
|
* and return the unwrapped value. Otherwise, the value must be unwrapped
|
|
* with `_#value`.
|
|
*
|
|
* Explicit chain sequences, which must be unwrapped with `_#value`, may be
|
|
* enabled using `_.chain`.
|
|
*
|
|
* The execution of chained methods is lazy, that is, it's deferred until
|
|
* `_#value` is implicitly or explicitly called.
|
|
*
|
|
* Lazy evaluation allows several methods to support shortcut fusion.
|
|
* Shortcut fusion is an optimization to merge iteratee calls; this avoids
|
|
* the creation of intermediate arrays and can greatly reduce the number of
|
|
* iteratee executions. Sections of a chain sequence qualify for shortcut
|
|
* fusion if the section is applied to an array and iteratees accept only
|
|
* one argument. The heuristic for whether a section qualifies for shortcut
|
|
* fusion is subject to change.
|
|
*
|
|
* Chaining is supported in custom builds as long as the `_#value` method is
|
|
* directly or indirectly included in the build.
|
|
*
|
|
* In addition to lodash methods, wrappers have `Array` and `String` methods.
|
|
*
|
|
* The wrapper `Array` methods are:
|
|
* `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift`
|
|
*
|
|
* The wrapper `String` methods are:
|
|
* `replace` and `split`
|
|
*
|
|
* The wrapper methods that support shortcut fusion are:
|
|
* `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`,
|
|
* `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`,
|
|
* `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray`
|
|
*
|
|
* The chainable wrapper methods are:
|
|
* `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`,
|
|
* `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`,
|
|
* `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`,
|
|
* `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`,
|
|
* `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`,
|
|
* `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`,
|
|
* `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`,
|
|
* `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`,
|
|
* `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`,
|
|
* `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`,
|
|
* `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`,
|
|
* `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`,
|
|
* `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`,
|
|
* `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`,
|
|
* `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`,
|
|
* `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`,
|
|
* `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`,
|
|
* `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`,
|
|
* `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`,
|
|
* `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`,
|
|
* `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`,
|
|
* `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`,
|
|
* `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`,
|
|
* `zipObject`, `zipObjectDeep`, and `zipWith`
|
|
*
|
|
* The wrapper methods that are **not** chainable by default are:
|
|
* `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`,
|
|
* `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`,
|
|
* `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`,
|
|
* `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`,
|
|
* `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`,
|
|
* `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`,
|
|
* `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`,
|
|
* `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`,
|
|
* `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`,
|
|
* `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`,
|
|
* `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`,
|
|
* `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`,
|
|
* `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`,
|
|
* `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`,
|
|
* `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`,
|
|
* `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`,
|
|
* `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`,
|
|
* `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`,
|
|
* `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`,
|
|
* `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`,
|
|
* `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`,
|
|
* `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`,
|
|
* `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`,
|
|
* `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`,
|
|
* `upperFirst`, `value`, and `words`
|
|
*
|
|
* @name _
|
|
* @constructor
|
|
* @category Seq
|
|
* @param {*} value The value to wrap in a `lodash` instance.
|
|
* @returns {Object} Returns the new `lodash` wrapper instance.
|
|
* @example
|
|
*
|
|
* function square(n) {
|
|
* return n * n;
|
|
* }
|
|
*
|
|
* var wrapped = _([1, 2, 3]);
|
|
*
|
|
* // Returns an unwrapped value.
|
|
* wrapped.reduce(_.add);
|
|
* // => 6
|
|
*
|
|
* // Returns a wrapped value.
|
|
* var squares = wrapped.map(square);
|
|
*
|
|
* _.isArray(squares);
|
|
* // => false
|
|
*
|
|
* _.isArray(squares.value());
|
|
* // => true
|
|
*/
|
|
function lodash(value) {
|
|
if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) {
|
|
if (value instanceof LodashWrapper) {
|
|
return value;
|
|
}
|
|
if (hasOwnProperty.call(value, '__wrapped__')) {
|
|
return wrapperClone(value);
|
|
}
|
|
}
|
|
return new LodashWrapper(value);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.create` without support for assigning
|
|
* properties to the created object.
|
|
*
|
|
* @private
|
|
* @param {Object} proto The object to inherit from.
|
|
* @returns {Object} Returns the new object.
|
|
*/
|
|
var baseCreate = (function() {
|
|
function object() {}
|
|
return function(proto) {
|
|
if (!isObject(proto)) {
|
|
return {};
|
|
}
|
|
if (objectCreate) {
|
|
return objectCreate(proto);
|
|
}
|
|
object.prototype = proto;
|
|
var result = new object;
|
|
object.prototype = undefined;
|
|
return result;
|
|
};
|
|
}());
|
|
|
|
/**
|
|
* The function whose prototype chain sequence wrappers inherit from.
|
|
*
|
|
* @private
|
|
*/
|
|
function baseLodash() {
|
|
// No operation performed.
|
|
}
|
|
|
|
/**
|
|
* The base constructor for creating `lodash` wrapper objects.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to wrap.
|
|
* @param {boolean} [chainAll] Enable explicit method chain sequences.
|
|
*/
|
|
function LodashWrapper(value, chainAll) {
|
|
this.__wrapped__ = value;
|
|
this.__actions__ = [];
|
|
this.__chain__ = !!chainAll;
|
|
this.__index__ = 0;
|
|
this.__values__ = undefined;
|
|
}
|
|
|
|
/**
|
|
* By default, the template delimiters used by lodash are like those in
|
|
* embedded Ruby (ERB) as well as ES2015 template strings. Change the
|
|
* following template settings to use alternative delimiters.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @type {Object}
|
|
*/
|
|
lodash.templateSettings = {
|
|
|
|
/**
|
|
* Used to detect `data` property values to be HTML-escaped.
|
|
*
|
|
* @memberOf _.templateSettings
|
|
* @type {RegExp}
|
|
*/
|
|
'escape': reEscape,
|
|
|
|
/**
|
|
* Used to detect code to be evaluated.
|
|
*
|
|
* @memberOf _.templateSettings
|
|
* @type {RegExp}
|
|
*/
|
|
'evaluate': reEvaluate,
|
|
|
|
/**
|
|
* Used to detect `data` property values to inject.
|
|
*
|
|
* @memberOf _.templateSettings
|
|
* @type {RegExp}
|
|
*/
|
|
'interpolate': reInterpolate,
|
|
|
|
/**
|
|
* Used to reference the data object in the template text.
|
|
*
|
|
* @memberOf _.templateSettings
|
|
* @type {string}
|
|
*/
|
|
'variable': '',
|
|
|
|
/**
|
|
* Used to import variables into the compiled template.
|
|
*
|
|
* @memberOf _.templateSettings
|
|
* @type {Object}
|
|
*/
|
|
'imports': {
|
|
|
|
/**
|
|
* A reference to the `lodash` function.
|
|
*
|
|
* @memberOf _.templateSettings.imports
|
|
* @type {Function}
|
|
*/
|
|
'_': lodash
|
|
}
|
|
};
|
|
|
|
// Ensure wrappers are instances of `baseLodash`.
|
|
lodash.prototype = baseLodash.prototype;
|
|
lodash.prototype.constructor = lodash;
|
|
|
|
LodashWrapper.prototype = baseCreate(baseLodash.prototype);
|
|
LodashWrapper.prototype.constructor = LodashWrapper;
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Creates a lazy wrapper object which wraps `value` to enable lazy evaluation.
|
|
*
|
|
* @private
|
|
* @constructor
|
|
* @param {*} value The value to wrap.
|
|
*/
|
|
function LazyWrapper(value) {
|
|
this.__wrapped__ = value;
|
|
this.__actions__ = [];
|
|
this.__dir__ = 1;
|
|
this.__filtered__ = false;
|
|
this.__iteratees__ = [];
|
|
this.__takeCount__ = MAX_ARRAY_LENGTH;
|
|
this.__views__ = [];
|
|
}
|
|
|
|
/**
|
|
* Creates a clone of the lazy wrapper object.
|
|
*
|
|
* @private
|
|
* @name clone
|
|
* @memberOf LazyWrapper
|
|
* @returns {Object} Returns the cloned `LazyWrapper` object.
|
|
*/
|
|
function lazyClone() {
|
|
var result = new LazyWrapper(this.__wrapped__);
|
|
result.__actions__ = copyArray(this.__actions__);
|
|
result.__dir__ = this.__dir__;
|
|
result.__filtered__ = this.__filtered__;
|
|
result.__iteratees__ = copyArray(this.__iteratees__);
|
|
result.__takeCount__ = this.__takeCount__;
|
|
result.__views__ = copyArray(this.__views__);
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Reverses the direction of lazy iteration.
|
|
*
|
|
* @private
|
|
* @name reverse
|
|
* @memberOf LazyWrapper
|
|
* @returns {Object} Returns the new reversed `LazyWrapper` object.
|
|
*/
|
|
function lazyReverse() {
|
|
if (this.__filtered__) {
|
|
var result = new LazyWrapper(this);
|
|
result.__dir__ = -1;
|
|
result.__filtered__ = true;
|
|
} else {
|
|
result = this.clone();
|
|
result.__dir__ *= -1;
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Extracts the unwrapped value from its lazy wrapper.
|
|
*
|
|
* @private
|
|
* @name value
|
|
* @memberOf LazyWrapper
|
|
* @returns {*} Returns the unwrapped value.
|
|
*/
|
|
function lazyValue() {
|
|
var array = this.__wrapped__.value(),
|
|
dir = this.__dir__,
|
|
isArr = isArray(array),
|
|
isRight = dir < 0,
|
|
arrLength = isArr ? array.length : 0,
|
|
view = getView(0, arrLength, this.__views__),
|
|
start = view.start,
|
|
end = view.end,
|
|
length = end - start,
|
|
index = isRight ? end : (start - 1),
|
|
iteratees = this.__iteratees__,
|
|
iterLength = iteratees.length,
|
|
resIndex = 0,
|
|
takeCount = nativeMin(length, this.__takeCount__);
|
|
|
|
if (!isArr || (!isRight && arrLength == length && takeCount == length)) {
|
|
return baseWrapperValue(array, this.__actions__);
|
|
}
|
|
var result = [];
|
|
|
|
outer:
|
|
while (length-- && resIndex < takeCount) {
|
|
index += dir;
|
|
|
|
var iterIndex = -1,
|
|
value = array[index];
|
|
|
|
while (++iterIndex < iterLength) {
|
|
var data = iteratees[iterIndex],
|
|
iteratee = data.iteratee,
|
|
type = data.type,
|
|
computed = iteratee(value);
|
|
|
|
if (type == LAZY_MAP_FLAG) {
|
|
value = computed;
|
|
} else if (!computed) {
|
|
if (type == LAZY_FILTER_FLAG) {
|
|
continue outer;
|
|
} else {
|
|
break outer;
|
|
}
|
|
}
|
|
}
|
|
result[resIndex++] = value;
|
|
}
|
|
return result;
|
|
}
|
|
|
|
// Ensure `LazyWrapper` is an instance of `baseLodash`.
|
|
LazyWrapper.prototype = baseCreate(baseLodash.prototype);
|
|
LazyWrapper.prototype.constructor = LazyWrapper;
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Creates a hash object.
|
|
*
|
|
* @private
|
|
* @constructor
|
|
* @param {Array} [entries] The key-value pairs to cache.
|
|
*/
|
|
function Hash(entries) {
|
|
var index = -1,
|
|
length = entries == null ? 0 : entries.length;
|
|
|
|
this.clear();
|
|
while (++index < length) {
|
|
var entry = entries[index];
|
|
this.set(entry[0], entry[1]);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Removes all key-value entries from the hash.
|
|
*
|
|
* @private
|
|
* @name clear
|
|
* @memberOf Hash
|
|
*/
|
|
function hashClear() {
|
|
this.__data__ = nativeCreate ? nativeCreate(null) : {};
|
|
this.size = 0;
|
|
}
|
|
|
|
/**
|
|
* Removes `key` and its value from the hash.
|
|
*
|
|
* @private
|
|
* @name delete
|
|
* @memberOf Hash
|
|
* @param {Object} hash The hash to modify.
|
|
* @param {string} key The key of the value to remove.
|
|
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
|
|
*/
|
|
function hashDelete(key) {
|
|
var result = this.has(key) && delete this.__data__[key];
|
|
this.size -= result ? 1 : 0;
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Gets the hash value for `key`.
|
|
*
|
|
* @private
|
|
* @name get
|
|
* @memberOf Hash
|
|
* @param {string} key The key of the value to get.
|
|
* @returns {*} Returns the entry value.
|
|
*/
|
|
function hashGet(key) {
|
|
var data = this.__data__;
|
|
if (nativeCreate) {
|
|
var result = data[key];
|
|
return result === HASH_UNDEFINED ? undefined : result;
|
|
}
|
|
return hasOwnProperty.call(data, key) ? data[key] : undefined;
|
|
}
|
|
|
|
/**
|
|
* Checks if a hash value for `key` exists.
|
|
*
|
|
* @private
|
|
* @name has
|
|
* @memberOf Hash
|
|
* @param {string} key The key of the entry to check.
|
|
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
|
|
*/
|
|
function hashHas(key) {
|
|
var data = this.__data__;
|
|
return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);
|
|
}
|
|
|
|
/**
|
|
* Sets the hash `key` to `value`.
|
|
*
|
|
* @private
|
|
* @name set
|
|
* @memberOf Hash
|
|
* @param {string} key The key of the value to set.
|
|
* @param {*} value The value to set.
|
|
* @returns {Object} Returns the hash instance.
|
|
*/
|
|
function hashSet(key, value) {
|
|
var data = this.__data__;
|
|
this.size += this.has(key) ? 0 : 1;
|
|
data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;
|
|
return this;
|
|
}
|
|
|
|
// Add methods to `Hash`.
|
|
Hash.prototype.clear = hashClear;
|
|
Hash.prototype['delete'] = hashDelete;
|
|
Hash.prototype.get = hashGet;
|
|
Hash.prototype.has = hashHas;
|
|
Hash.prototype.set = hashSet;
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Creates an list cache object.
|
|
*
|
|
* @private
|
|
* @constructor
|
|
* @param {Array} [entries] The key-value pairs to cache.
|
|
*/
|
|
function ListCache(entries) {
|
|
var index = -1,
|
|
length = entries == null ? 0 : entries.length;
|
|
|
|
this.clear();
|
|
while (++index < length) {
|
|
var entry = entries[index];
|
|
this.set(entry[0], entry[1]);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Removes all key-value entries from the list cache.
|
|
*
|
|
* @private
|
|
* @name clear
|
|
* @memberOf ListCache
|
|
*/
|
|
function listCacheClear() {
|
|
this.__data__ = [];
|
|
this.size = 0;
|
|
}
|
|
|
|
/**
|
|
* Removes `key` and its value from the list cache.
|
|
*
|
|
* @private
|
|
* @name delete
|
|
* @memberOf ListCache
|
|
* @param {string} key The key of the value to remove.
|
|
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
|
|
*/
|
|
function listCacheDelete(key) {
|
|
var data = this.__data__,
|
|
index = assocIndexOf(data, key);
|
|
|
|
if (index < 0) {
|
|
return false;
|
|
}
|
|
var lastIndex = data.length - 1;
|
|
if (index == lastIndex) {
|
|
data.pop();
|
|
} else {
|
|
splice.call(data, index, 1);
|
|
}
|
|
--this.size;
|
|
return true;
|
|
}
|
|
|
|
/**
|
|
* Gets the list cache value for `key`.
|
|
*
|
|
* @private
|
|
* @name get
|
|
* @memberOf ListCache
|
|
* @param {string} key The key of the value to get.
|
|
* @returns {*} Returns the entry value.
|
|
*/
|
|
function listCacheGet(key) {
|
|
var data = this.__data__,
|
|
index = assocIndexOf(data, key);
|
|
|
|
return index < 0 ? undefined : data[index][1];
|
|
}
|
|
|
|
/**
|
|
* Checks if a list cache value for `key` exists.
|
|
*
|
|
* @private
|
|
* @name has
|
|
* @memberOf ListCache
|
|
* @param {string} key The key of the entry to check.
|
|
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
|
|
*/
|
|
function listCacheHas(key) {
|
|
return assocIndexOf(this.__data__, key) > -1;
|
|
}
|
|
|
|
/**
|
|
* Sets the list cache `key` to `value`.
|
|
*
|
|
* @private
|
|
* @name set
|
|
* @memberOf ListCache
|
|
* @param {string} key The key of the value to set.
|
|
* @param {*} value The value to set.
|
|
* @returns {Object} Returns the list cache instance.
|
|
*/
|
|
function listCacheSet(key, value) {
|
|
var data = this.__data__,
|
|
index = assocIndexOf(data, key);
|
|
|
|
if (index < 0) {
|
|
++this.size;
|
|
data.push([key, value]);
|
|
} else {
|
|
data[index][1] = value;
|
|
}
|
|
return this;
|
|
}
|
|
|
|
// Add methods to `ListCache`.
|
|
ListCache.prototype.clear = listCacheClear;
|
|
ListCache.prototype['delete'] = listCacheDelete;
|
|
ListCache.prototype.get = listCacheGet;
|
|
ListCache.prototype.has = listCacheHas;
|
|
ListCache.prototype.set = listCacheSet;
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Creates a map cache object to store key-value pairs.
|
|
*
|
|
* @private
|
|
* @constructor
|
|
* @param {Array} [entries] The key-value pairs to cache.
|
|
*/
|
|
function MapCache(entries) {
|
|
var index = -1,
|
|
length = entries == null ? 0 : entries.length;
|
|
|
|
this.clear();
|
|
while (++index < length) {
|
|
var entry = entries[index];
|
|
this.set(entry[0], entry[1]);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Removes all key-value entries from the map.
|
|
*
|
|
* @private
|
|
* @name clear
|
|
* @memberOf MapCache
|
|
*/
|
|
function mapCacheClear() {
|
|
this.size = 0;
|
|
this.__data__ = {
|
|
'hash': new Hash,
|
|
'map': new (Map || ListCache),
|
|
'string': new Hash
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Removes `key` and its value from the map.
|
|
*
|
|
* @private
|
|
* @name delete
|
|
* @memberOf MapCache
|
|
* @param {string} key The key of the value to remove.
|
|
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
|
|
*/
|
|
function mapCacheDelete(key) {
|
|
var result = getMapData(this, key)['delete'](key);
|
|
this.size -= result ? 1 : 0;
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Gets the map value for `key`.
|
|
*
|
|
* @private
|
|
* @name get
|
|
* @memberOf MapCache
|
|
* @param {string} key The key of the value to get.
|
|
* @returns {*} Returns the entry value.
|
|
*/
|
|
function mapCacheGet(key) {
|
|
return getMapData(this, key).get(key);
|
|
}
|
|
|
|
/**
|
|
* Checks if a map value for `key` exists.
|
|
*
|
|
* @private
|
|
* @name has
|
|
* @memberOf MapCache
|
|
* @param {string} key The key of the entry to check.
|
|
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
|
|
*/
|
|
function mapCacheHas(key) {
|
|
return getMapData(this, key).has(key);
|
|
}
|
|
|
|
/**
|
|
* Sets the map `key` to `value`.
|
|
*
|
|
* @private
|
|
* @name set
|
|
* @memberOf MapCache
|
|
* @param {string} key The key of the value to set.
|
|
* @param {*} value The value to set.
|
|
* @returns {Object} Returns the map cache instance.
|
|
*/
|
|
function mapCacheSet(key, value) {
|
|
var data = getMapData(this, key),
|
|
size = data.size;
|
|
|
|
data.set(key, value);
|
|
this.size += data.size == size ? 0 : 1;
|
|
return this;
|
|
}
|
|
|
|
// Add methods to `MapCache`.
|
|
MapCache.prototype.clear = mapCacheClear;
|
|
MapCache.prototype['delete'] = mapCacheDelete;
|
|
MapCache.prototype.get = mapCacheGet;
|
|
MapCache.prototype.has = mapCacheHas;
|
|
MapCache.prototype.set = mapCacheSet;
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
*
|
|
* Creates an array cache object to store unique values.
|
|
*
|
|
* @private
|
|
* @constructor
|
|
* @param {Array} [values] The values to cache.
|
|
*/
|
|
function SetCache(values) {
|
|
var index = -1,
|
|
length = values == null ? 0 : values.length;
|
|
|
|
this.__data__ = new MapCache;
|
|
while (++index < length) {
|
|
this.add(values[index]);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Adds `value` to the array cache.
|
|
*
|
|
* @private
|
|
* @name add
|
|
* @memberOf SetCache
|
|
* @alias push
|
|
* @param {*} value The value to cache.
|
|
* @returns {Object} Returns the cache instance.
|
|
*/
|
|
function setCacheAdd(value) {
|
|
this.__data__.set(value, HASH_UNDEFINED);
|
|
return this;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is in the array cache.
|
|
*
|
|
* @private
|
|
* @name has
|
|
* @memberOf SetCache
|
|
* @param {*} value The value to search for.
|
|
* @returns {number} Returns `true` if `value` is found, else `false`.
|
|
*/
|
|
function setCacheHas(value) {
|
|
return this.__data__.has(value);
|
|
}
|
|
|
|
// Add methods to `SetCache`.
|
|
SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;
|
|
SetCache.prototype.has = setCacheHas;
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Creates a stack cache object to store key-value pairs.
|
|
*
|
|
* @private
|
|
* @constructor
|
|
* @param {Array} [entries] The key-value pairs to cache.
|
|
*/
|
|
function Stack(entries) {
|
|
var data = this.__data__ = new ListCache(entries);
|
|
this.size = data.size;
|
|
}
|
|
|
|
/**
|
|
* Removes all key-value entries from the stack.
|
|
*
|
|
* @private
|
|
* @name clear
|
|
* @memberOf Stack
|
|
*/
|
|
function stackClear() {
|
|
this.__data__ = new ListCache;
|
|
this.size = 0;
|
|
}
|
|
|
|
/**
|
|
* Removes `key` and its value from the stack.
|
|
*
|
|
* @private
|
|
* @name delete
|
|
* @memberOf Stack
|
|
* @param {string} key The key of the value to remove.
|
|
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
|
|
*/
|
|
function stackDelete(key) {
|
|
var data = this.__data__,
|
|
result = data['delete'](key);
|
|
|
|
this.size = data.size;
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Gets the stack value for `key`.
|
|
*
|
|
* @private
|
|
* @name get
|
|
* @memberOf Stack
|
|
* @param {string} key The key of the value to get.
|
|
* @returns {*} Returns the entry value.
|
|
*/
|
|
function stackGet(key) {
|
|
return this.__data__.get(key);
|
|
}
|
|
|
|
/**
|
|
* Checks if a stack value for `key` exists.
|
|
*
|
|
* @private
|
|
* @name has
|
|
* @memberOf Stack
|
|
* @param {string} key The key of the entry to check.
|
|
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
|
|
*/
|
|
function stackHas(key) {
|
|
return this.__data__.has(key);
|
|
}
|
|
|
|
/**
|
|
* Sets the stack `key` to `value`.
|
|
*
|
|
* @private
|
|
* @name set
|
|
* @memberOf Stack
|
|
* @param {string} key The key of the value to set.
|
|
* @param {*} value The value to set.
|
|
* @returns {Object} Returns the stack cache instance.
|
|
*/
|
|
function stackSet(key, value) {
|
|
var data = this.__data__;
|
|
if (data instanceof ListCache) {
|
|
var pairs = data.__data__;
|
|
if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {
|
|
pairs.push([key, value]);
|
|
this.size = ++data.size;
|
|
return this;
|
|
}
|
|
data = this.__data__ = new MapCache(pairs);
|
|
}
|
|
data.set(key, value);
|
|
this.size = data.size;
|
|
return this;
|
|
}
|
|
|
|
// Add methods to `Stack`.
|
|
Stack.prototype.clear = stackClear;
|
|
Stack.prototype['delete'] = stackDelete;
|
|
Stack.prototype.get = stackGet;
|
|
Stack.prototype.has = stackHas;
|
|
Stack.prototype.set = stackSet;
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Creates an array of the enumerable property names of the array-like `value`.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to query.
|
|
* @param {boolean} inherited Specify returning inherited property names.
|
|
* @returns {Array} Returns the array of property names.
|
|
*/
|
|
function arrayLikeKeys(value, inherited) {
|
|
var isArr = isArray(value),
|
|
isArg = !isArr && isArguments(value),
|
|
isBuff = !isArr && !isArg && isBuffer(value),
|
|
isType = !isArr && !isArg && !isBuff && isTypedArray(value),
|
|
skipIndexes = isArr || isArg || isBuff || isType,
|
|
result = skipIndexes ? baseTimes(value.length, String) : [],
|
|
length = result.length;
|
|
|
|
for (var key in value) {
|
|
if ((inherited || hasOwnProperty.call(value, key)) &&
|
|
!(skipIndexes && (
|
|
// Safari 9 has enumerable `arguments.length` in strict mode.
|
|
key == 'length' ||
|
|
// Node.js 0.10 has enumerable non-index properties on buffers.
|
|
(isBuff && (key == 'offset' || key == 'parent')) ||
|
|
// PhantomJS 2 has enumerable non-index properties on typed arrays.
|
|
(isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||
|
|
// Skip index properties.
|
|
isIndex(key, length)
|
|
))) {
|
|
result.push(key);
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.sample` for arrays.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to sample.
|
|
* @returns {*} Returns the random element.
|
|
*/
|
|
function arraySample(array) {
|
|
var length = array.length;
|
|
return length ? array[baseRandom(0, length - 1)] : undefined;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.sampleSize` for arrays.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to sample.
|
|
* @param {number} n The number of elements to sample.
|
|
* @returns {Array} Returns the random elements.
|
|
*/
|
|
function arraySampleSize(array, n) {
|
|
return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length));
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.shuffle` for arrays.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to shuffle.
|
|
* @returns {Array} Returns the new shuffled array.
|
|
*/
|
|
function arrayShuffle(array) {
|
|
return shuffleSelf(copyArray(array));
|
|
}
|
|
|
|
/**
|
|
* This function is like `assignValue` except that it doesn't assign
|
|
* `undefined` values.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to modify.
|
|
* @param {string} key The key of the property to assign.
|
|
* @param {*} value The value to assign.
|
|
*/
|
|
function assignMergeValue(object, key, value) {
|
|
if ((value !== undefined && !eq(object[key], value)) ||
|
|
(value === undefined && !(key in object))) {
|
|
baseAssignValue(object, key, value);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Assigns `value` to `key` of `object` if the existing value is not equivalent
|
|
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
|
|
* for equality comparisons.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to modify.
|
|
* @param {string} key The key of the property to assign.
|
|
* @param {*} value The value to assign.
|
|
*/
|
|
function assignValue(object, key, value) {
|
|
var objValue = object[key];
|
|
if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) ||
|
|
(value === undefined && !(key in object))) {
|
|
baseAssignValue(object, key, value);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Gets the index at which the `key` is found in `array` of key-value pairs.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to inspect.
|
|
* @param {*} key The key to search for.
|
|
* @returns {number} Returns the index of the matched value, else `-1`.
|
|
*/
|
|
function assocIndexOf(array, key) {
|
|
var length = array.length;
|
|
while (length--) {
|
|
if (eq(array[length][0], key)) {
|
|
return length;
|
|
}
|
|
}
|
|
return -1;
|
|
}
|
|
|
|
/**
|
|
* Aggregates elements of `collection` on `accumulator` with keys transformed
|
|
* by `iteratee` and values set by `setter`.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} setter The function to set `accumulator` values.
|
|
* @param {Function} iteratee The iteratee to transform keys.
|
|
* @param {Object} accumulator The initial aggregated object.
|
|
* @returns {Function} Returns `accumulator`.
|
|
*/
|
|
function baseAggregator(collection, setter, iteratee, accumulator) {
|
|
baseEach(collection, function(value, key, collection) {
|
|
setter(accumulator, value, iteratee(value), collection);
|
|
});
|
|
return accumulator;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.assign` without support for multiple sources
|
|
* or `customizer` functions.
|
|
*
|
|
* @private
|
|
* @param {Object} object The destination object.
|
|
* @param {Object} source The source object.
|
|
* @returns {Object} Returns `object`.
|
|
*/
|
|
function baseAssign(object, source) {
|
|
return object && copyObject(source, keys(source), object);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.assignIn` without support for multiple sources
|
|
* or `customizer` functions.
|
|
*
|
|
* @private
|
|
* @param {Object} object The destination object.
|
|
* @param {Object} source The source object.
|
|
* @returns {Object} Returns `object`.
|
|
*/
|
|
function baseAssignIn(object, source) {
|
|
return object && copyObject(source, keysIn(source), object);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `assignValue` and `assignMergeValue` without
|
|
* value checks.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to modify.
|
|
* @param {string} key The key of the property to assign.
|
|
* @param {*} value The value to assign.
|
|
*/
|
|
function baseAssignValue(object, key, value) {
|
|
if (key == '__proto__' && defineProperty) {
|
|
defineProperty(object, key, {
|
|
'configurable': true,
|
|
'enumerable': true,
|
|
'value': value,
|
|
'writable': true
|
|
});
|
|
} else {
|
|
object[key] = value;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.at` without support for individual paths.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {string[]} paths The property paths to pick.
|
|
* @returns {Array} Returns the picked elements.
|
|
*/
|
|
function baseAt(object, paths) {
|
|
var index = -1,
|
|
length = paths.length,
|
|
result = Array(length),
|
|
skip = object == null;
|
|
|
|
while (++index < length) {
|
|
result[index] = skip ? undefined : get(object, paths[index]);
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.clamp` which doesn't coerce arguments.
|
|
*
|
|
* @private
|
|
* @param {number} number The number to clamp.
|
|
* @param {number} [lower] The lower bound.
|
|
* @param {number} upper The upper bound.
|
|
* @returns {number} Returns the clamped number.
|
|
*/
|
|
function baseClamp(number, lower, upper) {
|
|
if (number === number) {
|
|
if (upper !== undefined) {
|
|
number = number <= upper ? number : upper;
|
|
}
|
|
if (lower !== undefined) {
|
|
number = number >= lower ? number : lower;
|
|
}
|
|
}
|
|
return number;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.clone` and `_.cloneDeep` which tracks
|
|
* traversed objects.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to clone.
|
|
* @param {boolean} bitmask The bitmask flags.
|
|
* 1 - Deep clone
|
|
* 2 - Flatten inherited properties
|
|
* 4 - Clone symbols
|
|
* @param {Function} [customizer] The function to customize cloning.
|
|
* @param {string} [key] The key of `value`.
|
|
* @param {Object} [object] The parent object of `value`.
|
|
* @param {Object} [stack] Tracks traversed objects and their clone counterparts.
|
|
* @returns {*} Returns the cloned value.
|
|
*/
|
|
function baseClone(value, bitmask, customizer, key, object, stack) {
|
|
var result,
|
|
isDeep = bitmask & CLONE_DEEP_FLAG,
|
|
isFlat = bitmask & CLONE_FLAT_FLAG,
|
|
isFull = bitmask & CLONE_SYMBOLS_FLAG;
|
|
|
|
if (customizer) {
|
|
result = object ? customizer(value, key, object, stack) : customizer(value);
|
|
}
|
|
if (result !== undefined) {
|
|
return result;
|
|
}
|
|
if (!isObject(value)) {
|
|
return value;
|
|
}
|
|
var isArr = isArray(value);
|
|
if (isArr) {
|
|
result = initCloneArray(value);
|
|
if (!isDeep) {
|
|
return copyArray(value, result);
|
|
}
|
|
} else {
|
|
var tag = getTag(value),
|
|
isFunc = tag == funcTag || tag == genTag;
|
|
|
|
if (isBuffer(value)) {
|
|
return cloneBuffer(value, isDeep);
|
|
}
|
|
if (tag == objectTag || tag == argsTag || (isFunc && !object)) {
|
|
result = (isFlat || isFunc) ? {} : initCloneObject(value);
|
|
if (!isDeep) {
|
|
return isFlat
|
|
? copySymbolsIn(value, baseAssignIn(result, value))
|
|
: copySymbols(value, baseAssign(result, value));
|
|
}
|
|
} else {
|
|
if (!cloneableTags[tag]) {
|
|
return object ? value : {};
|
|
}
|
|
result = initCloneByTag(value, tag, isDeep);
|
|
}
|
|
}
|
|
// Check for circular references and return its corresponding clone.
|
|
stack || (stack = new Stack);
|
|
var stacked = stack.get(value);
|
|
if (stacked) {
|
|
return stacked;
|
|
}
|
|
stack.set(value, result);
|
|
|
|
if (isSet(value)) {
|
|
value.forEach(function(subValue) {
|
|
result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack));
|
|
});
|
|
} else if (isMap(value)) {
|
|
value.forEach(function(subValue, key) {
|
|
result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack));
|
|
});
|
|
}
|
|
|
|
var keysFunc = isFull
|
|
? (isFlat ? getAllKeysIn : getAllKeys)
|
|
: (isFlat ? keysIn : keys);
|
|
|
|
var props = isArr ? undefined : keysFunc(value);
|
|
arrayEach(props || value, function(subValue, key) {
|
|
if (props) {
|
|
key = subValue;
|
|
subValue = value[key];
|
|
}
|
|
// Recursively populate clone (susceptible to call stack limits).
|
|
assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack));
|
|
});
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.conforms` which doesn't clone `source`.
|
|
*
|
|
* @private
|
|
* @param {Object} source The object of property predicates to conform to.
|
|
* @returns {Function} Returns the new spec function.
|
|
*/
|
|
function baseConforms(source) {
|
|
var props = keys(source);
|
|
return function(object) {
|
|
return baseConformsTo(object, source, props);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.conformsTo` which accepts `props` to check.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to inspect.
|
|
* @param {Object} source The object of property predicates to conform to.
|
|
* @returns {boolean} Returns `true` if `object` conforms, else `false`.
|
|
*/
|
|
function baseConformsTo(object, source, props) {
|
|
var length = props.length;
|
|
if (object == null) {
|
|
return !length;
|
|
}
|
|
object = Object(object);
|
|
while (length--) {
|
|
var key = props[length],
|
|
predicate = source[key],
|
|
value = object[key];
|
|
|
|
if ((value === undefined && !(key in object)) || !predicate(value)) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.delay` and `_.defer` which accepts `args`
|
|
* to provide to `func`.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to delay.
|
|
* @param {number} wait The number of milliseconds to delay invocation.
|
|
* @param {Array} args The arguments to provide to `func`.
|
|
* @returns {number|Object} Returns the timer id or timeout object.
|
|
*/
|
|
function baseDelay(func, wait, args) {
|
|
if (typeof func != 'function') {
|
|
throw new TypeError(FUNC_ERROR_TEXT);
|
|
}
|
|
return setTimeout(function() { func.apply(undefined, args); }, wait);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of methods like `_.difference` without support
|
|
* for excluding multiple arrays or iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to inspect.
|
|
* @param {Array} values The values to exclude.
|
|
* @param {Function} [iteratee] The iteratee invoked per element.
|
|
* @param {Function} [comparator] The comparator invoked per element.
|
|
* @returns {Array} Returns the new array of filtered values.
|
|
*/
|
|
function baseDifference(array, values, iteratee, comparator) {
|
|
var index = -1,
|
|
includes = arrayIncludes,
|
|
isCommon = true,
|
|
length = array.length,
|
|
result = [],
|
|
valuesLength = values.length;
|
|
|
|
if (!length) {
|
|
return result;
|
|
}
|
|
if (iteratee) {
|
|
values = arrayMap(values, baseUnary(iteratee));
|
|
}
|
|
if (comparator) {
|
|
includes = arrayIncludesWith;
|
|
isCommon = false;
|
|
}
|
|
else if (values.length >= LARGE_ARRAY_SIZE) {
|
|
includes = cacheHas;
|
|
isCommon = false;
|
|
values = new SetCache(values);
|
|
}
|
|
outer:
|
|
while (++index < length) {
|
|
var value = array[index],
|
|
computed = iteratee == null ? value : iteratee(value);
|
|
|
|
value = (comparator || value !== 0) ? value : 0;
|
|
if (isCommon && computed === computed) {
|
|
var valuesIndex = valuesLength;
|
|
while (valuesIndex--) {
|
|
if (values[valuesIndex] === computed) {
|
|
continue outer;
|
|
}
|
|
}
|
|
result.push(value);
|
|
}
|
|
else if (!includes(values, computed, comparator)) {
|
|
result.push(value);
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.forEach` without support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @returns {Array|Object} Returns `collection`.
|
|
*/
|
|
var baseEach = createBaseEach(baseForOwn);
|
|
|
|
/**
|
|
* The base implementation of `_.forEachRight` without support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @returns {Array|Object} Returns `collection`.
|
|
*/
|
|
var baseEachRight = createBaseEach(baseForOwnRight, true);
|
|
|
|
/**
|
|
* The base implementation of `_.every` without support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} predicate The function invoked per iteration.
|
|
* @returns {boolean} Returns `true` if all elements pass the predicate check,
|
|
* else `false`
|
|
*/
|
|
function baseEvery(collection, predicate) {
|
|
var result = true;
|
|
baseEach(collection, function(value, index, collection) {
|
|
result = !!predicate(value, index, collection);
|
|
return result;
|
|
});
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of methods like `_.max` and `_.min` which accepts a
|
|
* `comparator` to determine the extremum value.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to iterate over.
|
|
* @param {Function} iteratee The iteratee invoked per iteration.
|
|
* @param {Function} comparator The comparator used to compare values.
|
|
* @returns {*} Returns the extremum value.
|
|
*/
|
|
function baseExtremum(array, iteratee, comparator) {
|
|
var index = -1,
|
|
length = array.length;
|
|
|
|
while (++index < length) {
|
|
var value = array[index],
|
|
current = iteratee(value);
|
|
|
|
if (current != null && (computed === undefined
|
|
? (current === current && !isSymbol(current))
|
|
: comparator(current, computed)
|
|
)) {
|
|
var computed = current,
|
|
result = value;
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.fill` without an iteratee call guard.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to fill.
|
|
* @param {*} value The value to fill `array` with.
|
|
* @param {number} [start=0] The start position.
|
|
* @param {number} [end=array.length] The end position.
|
|
* @returns {Array} Returns `array`.
|
|
*/
|
|
function baseFill(array, value, start, end) {
|
|
var length = array.length;
|
|
|
|
start = toInteger(start);
|
|
if (start < 0) {
|
|
start = -start > length ? 0 : (length + start);
|
|
}
|
|
end = (end === undefined || end > length) ? length : toInteger(end);
|
|
if (end < 0) {
|
|
end += length;
|
|
}
|
|
end = start > end ? 0 : toLength(end);
|
|
while (start < end) {
|
|
array[start++] = value;
|
|
}
|
|
return array;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.filter` without support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} predicate The function invoked per iteration.
|
|
* @returns {Array} Returns the new filtered array.
|
|
*/
|
|
function baseFilter(collection, predicate) {
|
|
var result = [];
|
|
baseEach(collection, function(value, index, collection) {
|
|
if (predicate(value, index, collection)) {
|
|
result.push(value);
|
|
}
|
|
});
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.flatten` with support for restricting flattening.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to flatten.
|
|
* @param {number} depth The maximum recursion depth.
|
|
* @param {boolean} [predicate=isFlattenable] The function invoked per iteration.
|
|
* @param {boolean} [isStrict] Restrict to values that pass `predicate` checks.
|
|
* @param {Array} [result=[]] The initial result value.
|
|
* @returns {Array} Returns the new flattened array.
|
|
*/
|
|
function baseFlatten(array, depth, predicate, isStrict, result) {
|
|
var index = -1,
|
|
length = array.length;
|
|
|
|
predicate || (predicate = isFlattenable);
|
|
result || (result = []);
|
|
|
|
while (++index < length) {
|
|
var value = array[index];
|
|
if (depth > 0 && predicate(value)) {
|
|
if (depth > 1) {
|
|
// Recursively flatten arrays (susceptible to call stack limits).
|
|
baseFlatten(value, depth - 1, predicate, isStrict, result);
|
|
} else {
|
|
arrayPush(result, value);
|
|
}
|
|
} else if (!isStrict) {
|
|
result[result.length] = value;
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `baseForOwn` which iterates over `object`
|
|
* properties returned by `keysFunc` and invokes `iteratee` for each property.
|
|
* Iteratee functions may exit iteration early by explicitly returning `false`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @param {Function} keysFunc The function to get the keys of `object`.
|
|
* @returns {Object} Returns `object`.
|
|
*/
|
|
var baseFor = createBaseFor();
|
|
|
|
/**
|
|
* This function is like `baseFor` except that it iterates over properties
|
|
* in the opposite order.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @param {Function} keysFunc The function to get the keys of `object`.
|
|
* @returns {Object} Returns `object`.
|
|
*/
|
|
var baseForRight = createBaseFor(true);
|
|
|
|
/**
|
|
* The base implementation of `_.forOwn` without support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @returns {Object} Returns `object`.
|
|
*/
|
|
function baseForOwn(object, iteratee) {
|
|
return object && baseFor(object, iteratee, keys);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.forOwnRight` without support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @returns {Object} Returns `object`.
|
|
*/
|
|
function baseForOwnRight(object, iteratee) {
|
|
return object && baseForRight(object, iteratee, keys);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.functions` which creates an array of
|
|
* `object` function property names filtered from `props`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to inspect.
|
|
* @param {Array} props The property names to filter.
|
|
* @returns {Array} Returns the function names.
|
|
*/
|
|
function baseFunctions(object, props) {
|
|
return arrayFilter(props, function(key) {
|
|
return isFunction(object[key]);
|
|
});
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.get` without support for default values.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @param {Array|string} path The path of the property to get.
|
|
* @returns {*} Returns the resolved value.
|
|
*/
|
|
function baseGet(object, path) {
|
|
path = castPath(path, object);
|
|
|
|
var index = 0,
|
|
length = path.length;
|
|
|
|
while (object != null && index < length) {
|
|
object = object[toKey(path[index++])];
|
|
}
|
|
return (index && index == length) ? object : undefined;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `getAllKeys` and `getAllKeysIn` which uses
|
|
* `keysFunc` and `symbolsFunc` to get the enumerable property names and
|
|
* symbols of `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @param {Function} keysFunc The function to get the keys of `object`.
|
|
* @param {Function} symbolsFunc The function to get the symbols of `object`.
|
|
* @returns {Array} Returns the array of property names and symbols.
|
|
*/
|
|
function baseGetAllKeys(object, keysFunc, symbolsFunc) {
|
|
var result = keysFunc(object);
|
|
return isArray(object) ? result : arrayPush(result, symbolsFunc(object));
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `getTag` without fallbacks for buggy environments.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to query.
|
|
* @returns {string} Returns the `toStringTag`.
|
|
*/
|
|
function baseGetTag(value) {
|
|
if (value == null) {
|
|
return value === undefined ? undefinedTag : nullTag;
|
|
}
|
|
return (symToStringTag && symToStringTag in Object(value))
|
|
? getRawTag(value)
|
|
: objectToString(value);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.gt` which doesn't coerce arguments.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to compare.
|
|
* @param {*} other The other value to compare.
|
|
* @returns {boolean} Returns `true` if `value` is greater than `other`,
|
|
* else `false`.
|
|
*/
|
|
function baseGt(value, other) {
|
|
return value > other;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.has` without support for deep paths.
|
|
*
|
|
* @private
|
|
* @param {Object} [object] The object to query.
|
|
* @param {Array|string} key The key to check.
|
|
* @returns {boolean} Returns `true` if `key` exists, else `false`.
|
|
*/
|
|
function baseHas(object, key) {
|
|
return object != null && hasOwnProperty.call(object, key);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.hasIn` without support for deep paths.
|
|
*
|
|
* @private
|
|
* @param {Object} [object] The object to query.
|
|
* @param {Array|string} key The key to check.
|
|
* @returns {boolean} Returns `true` if `key` exists, else `false`.
|
|
*/
|
|
function baseHasIn(object, key) {
|
|
return object != null && key in Object(object);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.inRange` which doesn't coerce arguments.
|
|
*
|
|
* @private
|
|
* @param {number} number The number to check.
|
|
* @param {number} start The start of the range.
|
|
* @param {number} end The end of the range.
|
|
* @returns {boolean} Returns `true` if `number` is in the range, else `false`.
|
|
*/
|
|
function baseInRange(number, start, end) {
|
|
return number >= nativeMin(start, end) && number < nativeMax(start, end);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of methods like `_.intersection`, without support
|
|
* for iteratee shorthands, that accepts an array of arrays to inspect.
|
|
*
|
|
* @private
|
|
* @param {Array} arrays The arrays to inspect.
|
|
* @param {Function} [iteratee] The iteratee invoked per element.
|
|
* @param {Function} [comparator] The comparator invoked per element.
|
|
* @returns {Array} Returns the new array of shared values.
|
|
*/
|
|
function baseIntersection(arrays, iteratee, comparator) {
|
|
var includes = comparator ? arrayIncludesWith : arrayIncludes,
|
|
length = arrays[0].length,
|
|
othLength = arrays.length,
|
|
othIndex = othLength,
|
|
caches = Array(othLength),
|
|
maxLength = Infinity,
|
|
result = [];
|
|
|
|
while (othIndex--) {
|
|
var array = arrays[othIndex];
|
|
if (othIndex && iteratee) {
|
|
array = arrayMap(array, baseUnary(iteratee));
|
|
}
|
|
maxLength = nativeMin(array.length, maxLength);
|
|
caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120))
|
|
? new SetCache(othIndex && array)
|
|
: undefined;
|
|
}
|
|
array = arrays[0];
|
|
|
|
var index = -1,
|
|
seen = caches[0];
|
|
|
|
outer:
|
|
while (++index < length && result.length < maxLength) {
|
|
var value = array[index],
|
|
computed = iteratee ? iteratee(value) : value;
|
|
|
|
value = (comparator || value !== 0) ? value : 0;
|
|
if (!(seen
|
|
? cacheHas(seen, computed)
|
|
: includes(result, computed, comparator)
|
|
)) {
|
|
othIndex = othLength;
|
|
while (--othIndex) {
|
|
var cache = caches[othIndex];
|
|
if (!(cache
|
|
? cacheHas(cache, computed)
|
|
: includes(arrays[othIndex], computed, comparator))
|
|
) {
|
|
continue outer;
|
|
}
|
|
}
|
|
if (seen) {
|
|
seen.push(computed);
|
|
}
|
|
result.push(value);
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.invert` and `_.invertBy` which inverts
|
|
* `object` with values transformed by `iteratee` and set by `setter`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {Function} setter The function to set `accumulator` values.
|
|
* @param {Function} iteratee The iteratee to transform values.
|
|
* @param {Object} accumulator The initial inverted object.
|
|
* @returns {Function} Returns `accumulator`.
|
|
*/
|
|
function baseInverter(object, setter, iteratee, accumulator) {
|
|
baseForOwn(object, function(value, key, object) {
|
|
setter(accumulator, iteratee(value), key, object);
|
|
});
|
|
return accumulator;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.invoke` without support for individual
|
|
* method arguments.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @param {Array|string} path The path of the method to invoke.
|
|
* @param {Array} args The arguments to invoke the method with.
|
|
* @returns {*} Returns the result of the invoked method.
|
|
*/
|
|
function baseInvoke(object, path, args) {
|
|
path = castPath(path, object);
|
|
object = parent(object, path);
|
|
var func = object == null ? object : object[toKey(last(path))];
|
|
return func == null ? undefined : apply(func, object, args);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.isArguments`.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is an `arguments` object,
|
|
*/
|
|
function baseIsArguments(value) {
|
|
return isObjectLike(value) && baseGetTag(value) == argsTag;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.isArrayBuffer` without Node.js optimizations.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.
|
|
*/
|
|
function baseIsArrayBuffer(value) {
|
|
return isObjectLike(value) && baseGetTag(value) == arrayBufferTag;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.isDate` without Node.js optimizations.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a date object, else `false`.
|
|
*/
|
|
function baseIsDate(value) {
|
|
return isObjectLike(value) && baseGetTag(value) == dateTag;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.isEqual` which supports partial comparisons
|
|
* and tracks traversed objects.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to compare.
|
|
* @param {*} other The other value to compare.
|
|
* @param {boolean} bitmask The bitmask flags.
|
|
* 1 - Unordered comparison
|
|
* 2 - Partial comparison
|
|
* @param {Function} [customizer] The function to customize comparisons.
|
|
* @param {Object} [stack] Tracks traversed `value` and `other` objects.
|
|
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
|
|
*/
|
|
function baseIsEqual(value, other, bitmask, customizer, stack) {
|
|
if (value === other) {
|
|
return true;
|
|
}
|
|
if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {
|
|
return value !== value && other !== other;
|
|
}
|
|
return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `baseIsEqual` for arrays and objects which performs
|
|
* deep comparisons and tracks traversed objects enabling objects with circular
|
|
* references to be compared.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to compare.
|
|
* @param {Object} other The other object to compare.
|
|
* @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
|
|
* @param {Function} customizer The function to customize comparisons.
|
|
* @param {Function} equalFunc The function to determine equivalents of values.
|
|
* @param {Object} [stack] Tracks traversed `object` and `other` objects.
|
|
* @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
|
|
*/
|
|
function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {
|
|
var objIsArr = isArray(object),
|
|
othIsArr = isArray(other),
|
|
objTag = objIsArr ? arrayTag : getTag(object),
|
|
othTag = othIsArr ? arrayTag : getTag(other);
|
|
|
|
objTag = objTag == argsTag ? objectTag : objTag;
|
|
othTag = othTag == argsTag ? objectTag : othTag;
|
|
|
|
var objIsObj = objTag == objectTag,
|
|
othIsObj = othTag == objectTag,
|
|
isSameTag = objTag == othTag;
|
|
|
|
if (isSameTag && isBuffer(object)) {
|
|
if (!isBuffer(other)) {
|
|
return false;
|
|
}
|
|
objIsArr = true;
|
|
objIsObj = false;
|
|
}
|
|
if (isSameTag && !objIsObj) {
|
|
stack || (stack = new Stack);
|
|
return (objIsArr || isTypedArray(object))
|
|
? equalArrays(object, other, bitmask, customizer, equalFunc, stack)
|
|
: equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);
|
|
}
|
|
if (!(bitmask & COMPARE_PARTIAL_FLAG)) {
|
|
var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),
|
|
othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');
|
|
|
|
if (objIsWrapped || othIsWrapped) {
|
|
var objUnwrapped = objIsWrapped ? object.value() : object,
|
|
othUnwrapped = othIsWrapped ? other.value() : other;
|
|
|
|
stack || (stack = new Stack);
|
|
return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);
|
|
}
|
|
}
|
|
if (!isSameTag) {
|
|
return false;
|
|
}
|
|
stack || (stack = new Stack);
|
|
return equalObjects(object, other, bitmask, customizer, equalFunc, stack);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.isMap` without Node.js optimizations.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a map, else `false`.
|
|
*/
|
|
function baseIsMap(value) {
|
|
return isObjectLike(value) && getTag(value) == mapTag;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.isMatch` without support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to inspect.
|
|
* @param {Object} source The object of property values to match.
|
|
* @param {Array} matchData The property names, values, and compare flags to match.
|
|
* @param {Function} [customizer] The function to customize comparisons.
|
|
* @returns {boolean} Returns `true` if `object` is a match, else `false`.
|
|
*/
|
|
function baseIsMatch(object, source, matchData, customizer) {
|
|
var index = matchData.length,
|
|
length = index,
|
|
noCustomizer = !customizer;
|
|
|
|
if (object == null) {
|
|
return !length;
|
|
}
|
|
object = Object(object);
|
|
while (index--) {
|
|
var data = matchData[index];
|
|
if ((noCustomizer && data[2])
|
|
? data[1] !== object[data[0]]
|
|
: !(data[0] in object)
|
|
) {
|
|
return false;
|
|
}
|
|
}
|
|
while (++index < length) {
|
|
data = matchData[index];
|
|
var key = data[0],
|
|
objValue = object[key],
|
|
srcValue = data[1];
|
|
|
|
if (noCustomizer && data[2]) {
|
|
if (objValue === undefined && !(key in object)) {
|
|
return false;
|
|
}
|
|
} else {
|
|
var stack = new Stack;
|
|
if (customizer) {
|
|
var result = customizer(objValue, srcValue, key, object, source, stack);
|
|
}
|
|
if (!(result === undefined
|
|
? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack)
|
|
: result
|
|
)) {
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.isNative` without bad shim checks.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a native function,
|
|
* else `false`.
|
|
*/
|
|
function baseIsNative(value) {
|
|
if (!isObject(value) || isMasked(value)) {
|
|
return false;
|
|
}
|
|
var pattern = isFunction(value) ? reIsNative : reIsHostCtor;
|
|
return pattern.test(toSource(value));
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.isRegExp` without Node.js optimizations.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a regexp, else `false`.
|
|
*/
|
|
function baseIsRegExp(value) {
|
|
return isObjectLike(value) && baseGetTag(value) == regexpTag;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.isSet` without Node.js optimizations.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a set, else `false`.
|
|
*/
|
|
function baseIsSet(value) {
|
|
return isObjectLike(value) && getTag(value) == setTag;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.isTypedArray` without Node.js optimizations.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
|
|
*/
|
|
function baseIsTypedArray(value) {
|
|
return isObjectLike(value) &&
|
|
isLength(value.length) && !!typedArrayTags[baseGetTag(value)];
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.iteratee`.
|
|
*
|
|
* @private
|
|
* @param {*} [value=_.identity] The value to convert to an iteratee.
|
|
* @returns {Function} Returns the iteratee.
|
|
*/
|
|
function baseIteratee(value) {
|
|
// Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9.
|
|
// See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details.
|
|
if (typeof value == 'function') {
|
|
return value;
|
|
}
|
|
if (value == null) {
|
|
return identity;
|
|
}
|
|
if (typeof value == 'object') {
|
|
return isArray(value)
|
|
? baseMatchesProperty(value[0], value[1])
|
|
: baseMatches(value);
|
|
}
|
|
return property(value);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.keys` which doesn't treat sparse arrays as dense.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the array of property names.
|
|
*/
|
|
function baseKeys(object) {
|
|
if (!isPrototype(object)) {
|
|
return nativeKeys(object);
|
|
}
|
|
var result = [];
|
|
for (var key in Object(object)) {
|
|
if (hasOwnProperty.call(object, key) && key != 'constructor') {
|
|
result.push(key);
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the array of property names.
|
|
*/
|
|
function baseKeysIn(object) {
|
|
if (!isObject(object)) {
|
|
return nativeKeysIn(object);
|
|
}
|
|
var isProto = isPrototype(object),
|
|
result = [];
|
|
|
|
for (var key in object) {
|
|
if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {
|
|
result.push(key);
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.lt` which doesn't coerce arguments.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to compare.
|
|
* @param {*} other The other value to compare.
|
|
* @returns {boolean} Returns `true` if `value` is less than `other`,
|
|
* else `false`.
|
|
*/
|
|
function baseLt(value, other) {
|
|
return value < other;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.map` without support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} iteratee The function invoked per iteration.
|
|
* @returns {Array} Returns the new mapped array.
|
|
*/
|
|
function baseMap(collection, iteratee) {
|
|
var index = -1,
|
|
result = isArrayLike(collection) ? Array(collection.length) : [];
|
|
|
|
baseEach(collection, function(value, key, collection) {
|
|
result[++index] = iteratee(value, key, collection);
|
|
});
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.matches` which doesn't clone `source`.
|
|
*
|
|
* @private
|
|
* @param {Object} source The object of property values to match.
|
|
* @returns {Function} Returns the new spec function.
|
|
*/
|
|
function baseMatches(source) {
|
|
var matchData = getMatchData(source);
|
|
if (matchData.length == 1 && matchData[0][2]) {
|
|
return matchesStrictComparable(matchData[0][0], matchData[0][1]);
|
|
}
|
|
return function(object) {
|
|
return object === source || baseIsMatch(object, source, matchData);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.matchesProperty` which doesn't clone `srcValue`.
|
|
*
|
|
* @private
|
|
* @param {string} path The path of the property to get.
|
|
* @param {*} srcValue The value to match.
|
|
* @returns {Function} Returns the new spec function.
|
|
*/
|
|
function baseMatchesProperty(path, srcValue) {
|
|
if (isKey(path) && isStrictComparable(srcValue)) {
|
|
return matchesStrictComparable(toKey(path), srcValue);
|
|
}
|
|
return function(object) {
|
|
var objValue = get(object, path);
|
|
return (objValue === undefined && objValue === srcValue)
|
|
? hasIn(object, path)
|
|
: baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.merge` without support for multiple sources.
|
|
*
|
|
* @private
|
|
* @param {Object} object The destination object.
|
|
* @param {Object} source The source object.
|
|
* @param {number} srcIndex The index of `source`.
|
|
* @param {Function} [customizer] The function to customize merged values.
|
|
* @param {Object} [stack] Tracks traversed source values and their merged
|
|
* counterparts.
|
|
*/
|
|
function baseMerge(object, source, srcIndex, customizer, stack) {
|
|
if (object === source) {
|
|
return;
|
|
}
|
|
baseFor(source, function(srcValue, key) {
|
|
stack || (stack = new Stack);
|
|
if (isObject(srcValue)) {
|
|
baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack);
|
|
}
|
|
else {
|
|
var newValue = customizer
|
|
? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack)
|
|
: undefined;
|
|
|
|
if (newValue === undefined) {
|
|
newValue = srcValue;
|
|
}
|
|
assignMergeValue(object, key, newValue);
|
|
}
|
|
}, keysIn);
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `baseMerge` for arrays and objects which performs
|
|
* deep merges and tracks traversed objects enabling objects with circular
|
|
* references to be merged.
|
|
*
|
|
* @private
|
|
* @param {Object} object The destination object.
|
|
* @param {Object} source The source object.
|
|
* @param {string} key The key of the value to merge.
|
|
* @param {number} srcIndex The index of `source`.
|
|
* @param {Function} mergeFunc The function to merge values.
|
|
* @param {Function} [customizer] The function to customize assigned values.
|
|
* @param {Object} [stack] Tracks traversed source values and their merged
|
|
* counterparts.
|
|
*/
|
|
function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) {
|
|
var objValue = safeGet(object, key),
|
|
srcValue = safeGet(source, key),
|
|
stacked = stack.get(srcValue);
|
|
|
|
if (stacked) {
|
|
assignMergeValue(object, key, stacked);
|
|
return;
|
|
}
|
|
var newValue = customizer
|
|
? customizer(objValue, srcValue, (key + ''), object, source, stack)
|
|
: undefined;
|
|
|
|
var isCommon = newValue === undefined;
|
|
|
|
if (isCommon) {
|
|
var isArr = isArray(srcValue),
|
|
isBuff = !isArr && isBuffer(srcValue),
|
|
isTyped = !isArr && !isBuff && isTypedArray(srcValue);
|
|
|
|
newValue = srcValue;
|
|
if (isArr || isBuff || isTyped) {
|
|
if (isArray(objValue)) {
|
|
newValue = objValue;
|
|
}
|
|
else if (isArrayLikeObject(objValue)) {
|
|
newValue = copyArray(objValue);
|
|
}
|
|
else if (isBuff) {
|
|
isCommon = false;
|
|
newValue = cloneBuffer(srcValue, true);
|
|
}
|
|
else if (isTyped) {
|
|
isCommon = false;
|
|
newValue = cloneTypedArray(srcValue, true);
|
|
}
|
|
else {
|
|
newValue = [];
|
|
}
|
|
}
|
|
else if (isPlainObject(srcValue) || isArguments(srcValue)) {
|
|
newValue = objValue;
|
|
if (isArguments(objValue)) {
|
|
newValue = toPlainObject(objValue);
|
|
}
|
|
else if (!isObject(objValue) || isFunction(objValue)) {
|
|
newValue = initCloneObject(srcValue);
|
|
}
|
|
}
|
|
else {
|
|
isCommon = false;
|
|
}
|
|
}
|
|
if (isCommon) {
|
|
// Recursively merge objects and arrays (susceptible to call stack limits).
|
|
stack.set(srcValue, newValue);
|
|
mergeFunc(newValue, srcValue, srcIndex, customizer, stack);
|
|
stack['delete'](srcValue);
|
|
}
|
|
assignMergeValue(object, key, newValue);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.nth` which doesn't coerce arguments.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to query.
|
|
* @param {number} n The index of the element to return.
|
|
* @returns {*} Returns the nth element of `array`.
|
|
*/
|
|
function baseNth(array, n) {
|
|
var length = array.length;
|
|
if (!length) {
|
|
return;
|
|
}
|
|
n += n < 0 ? length : 0;
|
|
return isIndex(n, length) ? array[n] : undefined;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.orderBy` without param guards.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by.
|
|
* @param {string[]} orders The sort orders of `iteratees`.
|
|
* @returns {Array} Returns the new sorted array.
|
|
*/
|
|
function baseOrderBy(collection, iteratees, orders) {
|
|
if (iteratees.length) {
|
|
iteratees = arrayMap(iteratees, function(iteratee) {
|
|
if (isArray(iteratee)) {
|
|
return function(value) {
|
|
return baseGet(value, iteratee.length === 1 ? iteratee[0] : iteratee);
|
|
}
|
|
}
|
|
return iteratee;
|
|
});
|
|
} else {
|
|
iteratees = [identity];
|
|
}
|
|
|
|
var index = -1;
|
|
iteratees = arrayMap(iteratees, baseUnary(getIteratee()));
|
|
|
|
var result = baseMap(collection, function(value, key, collection) {
|
|
var criteria = arrayMap(iteratees, function(iteratee) {
|
|
return iteratee(value);
|
|
});
|
|
return { 'criteria': criteria, 'index': ++index, 'value': value };
|
|
});
|
|
|
|
return baseSortBy(result, function(object, other) {
|
|
return compareMultiple(object, other, orders);
|
|
});
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.pick` without support for individual
|
|
* property identifiers.
|
|
*
|
|
* @private
|
|
* @param {Object} object The source object.
|
|
* @param {string[]} paths The property paths to pick.
|
|
* @returns {Object} Returns the new object.
|
|
*/
|
|
function basePick(object, paths) {
|
|
return basePickBy(object, paths, function(value, path) {
|
|
return hasIn(object, path);
|
|
});
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.pickBy` without support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Object} object The source object.
|
|
* @param {string[]} paths The property paths to pick.
|
|
* @param {Function} predicate The function invoked per property.
|
|
* @returns {Object} Returns the new object.
|
|
*/
|
|
function basePickBy(object, paths, predicate) {
|
|
var index = -1,
|
|
length = paths.length,
|
|
result = {};
|
|
|
|
while (++index < length) {
|
|
var path = paths[index],
|
|
value = baseGet(object, path);
|
|
|
|
if (predicate(value, path)) {
|
|
baseSet(result, castPath(path, object), value);
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `baseProperty` which supports deep paths.
|
|
*
|
|
* @private
|
|
* @param {Array|string} path The path of the property to get.
|
|
* @returns {Function} Returns the new accessor function.
|
|
*/
|
|
function basePropertyDeep(path) {
|
|
return function(object) {
|
|
return baseGet(object, path);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.pullAllBy` without support for iteratee
|
|
* shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to modify.
|
|
* @param {Array} values The values to remove.
|
|
* @param {Function} [iteratee] The iteratee invoked per element.
|
|
* @param {Function} [comparator] The comparator invoked per element.
|
|
* @returns {Array} Returns `array`.
|
|
*/
|
|
function basePullAll(array, values, iteratee, comparator) {
|
|
var indexOf = comparator ? baseIndexOfWith : baseIndexOf,
|
|
index = -1,
|
|
length = values.length,
|
|
seen = array;
|
|
|
|
if (array === values) {
|
|
values = copyArray(values);
|
|
}
|
|
if (iteratee) {
|
|
seen = arrayMap(array, baseUnary(iteratee));
|
|
}
|
|
while (++index < length) {
|
|
var fromIndex = 0,
|
|
value = values[index],
|
|
computed = iteratee ? iteratee(value) : value;
|
|
|
|
while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) {
|
|
if (seen !== array) {
|
|
splice.call(seen, fromIndex, 1);
|
|
}
|
|
splice.call(array, fromIndex, 1);
|
|
}
|
|
}
|
|
return array;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.pullAt` without support for individual
|
|
* indexes or capturing the removed elements.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to modify.
|
|
* @param {number[]} indexes The indexes of elements to remove.
|
|
* @returns {Array} Returns `array`.
|
|
*/
|
|
function basePullAt(array, indexes) {
|
|
var length = array ? indexes.length : 0,
|
|
lastIndex = length - 1;
|
|
|
|
while (length--) {
|
|
var index = indexes[length];
|
|
if (length == lastIndex || index !== previous) {
|
|
var previous = index;
|
|
if (isIndex(index)) {
|
|
splice.call(array, index, 1);
|
|
} else {
|
|
baseUnset(array, index);
|
|
}
|
|
}
|
|
}
|
|
return array;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.random` without support for returning
|
|
* floating-point numbers.
|
|
*
|
|
* @private
|
|
* @param {number} lower The lower bound.
|
|
* @param {number} upper The upper bound.
|
|
* @returns {number} Returns the random number.
|
|
*/
|
|
function baseRandom(lower, upper) {
|
|
return lower + nativeFloor(nativeRandom() * (upper - lower + 1));
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.range` and `_.rangeRight` which doesn't
|
|
* coerce arguments.
|
|
*
|
|
* @private
|
|
* @param {number} start The start of the range.
|
|
* @param {number} end The end of the range.
|
|
* @param {number} step The value to increment or decrement by.
|
|
* @param {boolean} [fromRight] Specify iterating from right to left.
|
|
* @returns {Array} Returns the range of numbers.
|
|
*/
|
|
function baseRange(start, end, step, fromRight) {
|
|
var index = -1,
|
|
length = nativeMax(nativeCeil((end - start) / (step || 1)), 0),
|
|
result = Array(length);
|
|
|
|
while (length--) {
|
|
result[fromRight ? length : ++index] = start;
|
|
start += step;
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.repeat` which doesn't coerce arguments.
|
|
*
|
|
* @private
|
|
* @param {string} string The string to repeat.
|
|
* @param {number} n The number of times to repeat the string.
|
|
* @returns {string} Returns the repeated string.
|
|
*/
|
|
function baseRepeat(string, n) {
|
|
var result = '';
|
|
if (!string || n < 1 || n > MAX_SAFE_INTEGER) {
|
|
return result;
|
|
}
|
|
// Leverage the exponentiation by squaring algorithm for a faster repeat.
|
|
// See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details.
|
|
do {
|
|
if (n % 2) {
|
|
result += string;
|
|
}
|
|
n = nativeFloor(n / 2);
|
|
if (n) {
|
|
string += string;
|
|
}
|
|
} while (n);
|
|
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.rest` which doesn't validate or coerce arguments.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to apply a rest parameter to.
|
|
* @param {number} [start=func.length-1] The start position of the rest parameter.
|
|
* @returns {Function} Returns the new function.
|
|
*/
|
|
function baseRest(func, start) {
|
|
return setToString(overRest(func, start, identity), func + '');
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.sample`.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to sample.
|
|
* @returns {*} Returns the random element.
|
|
*/
|
|
function baseSample(collection) {
|
|
return arraySample(values(collection));
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.sampleSize` without param guards.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to sample.
|
|
* @param {number} n The number of elements to sample.
|
|
* @returns {Array} Returns the random elements.
|
|
*/
|
|
function baseSampleSize(collection, n) {
|
|
var array = values(collection);
|
|
return shuffleSelf(array, baseClamp(n, 0, array.length));
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.set`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to modify.
|
|
* @param {Array|string} path The path of the property to set.
|
|
* @param {*} value The value to set.
|
|
* @param {Function} [customizer] The function to customize path creation.
|
|
* @returns {Object} Returns `object`.
|
|
*/
|
|
function baseSet(object, path, value, customizer) {
|
|
if (!isObject(object)) {
|
|
return object;
|
|
}
|
|
path = castPath(path, object);
|
|
|
|
var index = -1,
|
|
length = path.length,
|
|
lastIndex = length - 1,
|
|
nested = object;
|
|
|
|
while (nested != null && ++index < length) {
|
|
var key = toKey(path[index]),
|
|
newValue = value;
|
|
|
|
if (key === '__proto__' || key === 'constructor' || key === 'prototype') {
|
|
return object;
|
|
}
|
|
|
|
if (index != lastIndex) {
|
|
var objValue = nested[key];
|
|
newValue = customizer ? customizer(objValue, key, nested) : undefined;
|
|
if (newValue === undefined) {
|
|
newValue = isObject(objValue)
|
|
? objValue
|
|
: (isIndex(path[index + 1]) ? [] : {});
|
|
}
|
|
}
|
|
assignValue(nested, key, newValue);
|
|
nested = nested[key];
|
|
}
|
|
return object;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `setData` without support for hot loop shorting.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to associate metadata with.
|
|
* @param {*} data The metadata.
|
|
* @returns {Function} Returns `func`.
|
|
*/
|
|
var baseSetData = !metaMap ? identity : function(func, data) {
|
|
metaMap.set(func, data);
|
|
return func;
|
|
};
|
|
|
|
/**
|
|
* The base implementation of `setToString` without support for hot loop shorting.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to modify.
|
|
* @param {Function} string The `toString` result.
|
|
* @returns {Function} Returns `func`.
|
|
*/
|
|
var baseSetToString = !defineProperty ? identity : function(func, string) {
|
|
return defineProperty(func, 'toString', {
|
|
'configurable': true,
|
|
'enumerable': false,
|
|
'value': constant(string),
|
|
'writable': true
|
|
});
|
|
};
|
|
|
|
/**
|
|
* The base implementation of `_.shuffle`.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to shuffle.
|
|
* @returns {Array} Returns the new shuffled array.
|
|
*/
|
|
function baseShuffle(collection) {
|
|
return shuffleSelf(values(collection));
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.slice` without an iteratee call guard.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to slice.
|
|
* @param {number} [start=0] The start position.
|
|
* @param {number} [end=array.length] The end position.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
*/
|
|
function baseSlice(array, start, end) {
|
|
var index = -1,
|
|
length = array.length;
|
|
|
|
if (start < 0) {
|
|
start = -start > length ? 0 : (length + start);
|
|
}
|
|
end = end > length ? length : end;
|
|
if (end < 0) {
|
|
end += length;
|
|
}
|
|
length = start > end ? 0 : ((end - start) >>> 0);
|
|
start >>>= 0;
|
|
|
|
var result = Array(length);
|
|
while (++index < length) {
|
|
result[index] = array[index + start];
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.some` without support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} predicate The function invoked per iteration.
|
|
* @returns {boolean} Returns `true` if any element passes the predicate check,
|
|
* else `false`.
|
|
*/
|
|
function baseSome(collection, predicate) {
|
|
var result;
|
|
|
|
baseEach(collection, function(value, index, collection) {
|
|
result = predicate(value, index, collection);
|
|
return !result;
|
|
});
|
|
return !!result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which
|
|
* performs a binary search of `array` to determine the index at which `value`
|
|
* should be inserted into `array` in order to maintain its sort order.
|
|
*
|
|
* @private
|
|
* @param {Array} array The sorted array to inspect.
|
|
* @param {*} value The value to evaluate.
|
|
* @param {boolean} [retHighest] Specify returning the highest qualified index.
|
|
* @returns {number} Returns the index at which `value` should be inserted
|
|
* into `array`.
|
|
*/
|
|
function baseSortedIndex(array, value, retHighest) {
|
|
var low = 0,
|
|
high = array == null ? low : array.length;
|
|
|
|
if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) {
|
|
while (low < high) {
|
|
var mid = (low + high) >>> 1,
|
|
computed = array[mid];
|
|
|
|
if (computed !== null && !isSymbol(computed) &&
|
|
(retHighest ? (computed <= value) : (computed < value))) {
|
|
low = mid + 1;
|
|
} else {
|
|
high = mid;
|
|
}
|
|
}
|
|
return high;
|
|
}
|
|
return baseSortedIndexBy(array, value, identity, retHighest);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy`
|
|
* which invokes `iteratee` for `value` and each element of `array` to compute
|
|
* their sort ranking. The iteratee is invoked with one argument; (value).
|
|
*
|
|
* @private
|
|
* @param {Array} array The sorted array to inspect.
|
|
* @param {*} value The value to evaluate.
|
|
* @param {Function} iteratee The iteratee invoked per element.
|
|
* @param {boolean} [retHighest] Specify returning the highest qualified index.
|
|
* @returns {number} Returns the index at which `value` should be inserted
|
|
* into `array`.
|
|
*/
|
|
function baseSortedIndexBy(array, value, iteratee, retHighest) {
|
|
var low = 0,
|
|
high = array == null ? 0 : array.length;
|
|
if (high === 0) {
|
|
return 0;
|
|
}
|
|
|
|
value = iteratee(value);
|
|
var valIsNaN = value !== value,
|
|
valIsNull = value === null,
|
|
valIsSymbol = isSymbol(value),
|
|
valIsUndefined = value === undefined;
|
|
|
|
while (low < high) {
|
|
var mid = nativeFloor((low + high) / 2),
|
|
computed = iteratee(array[mid]),
|
|
othIsDefined = computed !== undefined,
|
|
othIsNull = computed === null,
|
|
othIsReflexive = computed === computed,
|
|
othIsSymbol = isSymbol(computed);
|
|
|
|
if (valIsNaN) {
|
|
var setLow = retHighest || othIsReflexive;
|
|
} else if (valIsUndefined) {
|
|
setLow = othIsReflexive && (retHighest || othIsDefined);
|
|
} else if (valIsNull) {
|
|
setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull);
|
|
} else if (valIsSymbol) {
|
|
setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol);
|
|
} else if (othIsNull || othIsSymbol) {
|
|
setLow = false;
|
|
} else {
|
|
setLow = retHighest ? (computed <= value) : (computed < value);
|
|
}
|
|
if (setLow) {
|
|
low = mid + 1;
|
|
} else {
|
|
high = mid;
|
|
}
|
|
}
|
|
return nativeMin(high, MAX_ARRAY_INDEX);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without
|
|
* support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to inspect.
|
|
* @param {Function} [iteratee] The iteratee invoked per element.
|
|
* @returns {Array} Returns the new duplicate free array.
|
|
*/
|
|
function baseSortedUniq(array, iteratee) {
|
|
var index = -1,
|
|
length = array.length,
|
|
resIndex = 0,
|
|
result = [];
|
|
|
|
while (++index < length) {
|
|
var value = array[index],
|
|
computed = iteratee ? iteratee(value) : value;
|
|
|
|
if (!index || !eq(computed, seen)) {
|
|
var seen = computed;
|
|
result[resIndex++] = value === 0 ? 0 : value;
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.toNumber` which doesn't ensure correct
|
|
* conversions of binary, hexadecimal, or octal string values.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to process.
|
|
* @returns {number} Returns the number.
|
|
*/
|
|
function baseToNumber(value) {
|
|
if (typeof value == 'number') {
|
|
return value;
|
|
}
|
|
if (isSymbol(value)) {
|
|
return NAN;
|
|
}
|
|
return +value;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.toString` which doesn't convert nullish
|
|
* values to empty strings.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to process.
|
|
* @returns {string} Returns the string.
|
|
*/
|
|
function baseToString(value) {
|
|
// Exit early for strings to avoid a performance hit in some environments.
|
|
if (typeof value == 'string') {
|
|
return value;
|
|
}
|
|
if (isArray(value)) {
|
|
// Recursively convert values (susceptible to call stack limits).
|
|
return arrayMap(value, baseToString) + '';
|
|
}
|
|
if (isSymbol(value)) {
|
|
return symbolToString ? symbolToString.call(value) : '';
|
|
}
|
|
var result = (value + '');
|
|
return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.uniqBy` without support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to inspect.
|
|
* @param {Function} [iteratee] The iteratee invoked per element.
|
|
* @param {Function} [comparator] The comparator invoked per element.
|
|
* @returns {Array} Returns the new duplicate free array.
|
|
*/
|
|
function baseUniq(array, iteratee, comparator) {
|
|
var index = -1,
|
|
includes = arrayIncludes,
|
|
length = array.length,
|
|
isCommon = true,
|
|
result = [],
|
|
seen = result;
|
|
|
|
if (comparator) {
|
|
isCommon = false;
|
|
includes = arrayIncludesWith;
|
|
}
|
|
else if (length >= LARGE_ARRAY_SIZE) {
|
|
var set = iteratee ? null : createSet(array);
|
|
if (set) {
|
|
return setToArray(set);
|
|
}
|
|
isCommon = false;
|
|
includes = cacheHas;
|
|
seen = new SetCache;
|
|
}
|
|
else {
|
|
seen = iteratee ? [] : result;
|
|
}
|
|
outer:
|
|
while (++index < length) {
|
|
var value = array[index],
|
|
computed = iteratee ? iteratee(value) : value;
|
|
|
|
value = (comparator || value !== 0) ? value : 0;
|
|
if (isCommon && computed === computed) {
|
|
var seenIndex = seen.length;
|
|
while (seenIndex--) {
|
|
if (seen[seenIndex] === computed) {
|
|
continue outer;
|
|
}
|
|
}
|
|
if (iteratee) {
|
|
seen.push(computed);
|
|
}
|
|
result.push(value);
|
|
}
|
|
else if (!includes(seen, computed, comparator)) {
|
|
if (seen !== result) {
|
|
seen.push(computed);
|
|
}
|
|
result.push(value);
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.unset`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to modify.
|
|
* @param {Array|string} path The property path to unset.
|
|
* @returns {boolean} Returns `true` if the property is deleted, else `false`.
|
|
*/
|
|
function baseUnset(object, path) {
|
|
path = castPath(path, object);
|
|
object = parent(object, path);
|
|
return object == null || delete object[toKey(last(path))];
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `_.update`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to modify.
|
|
* @param {Array|string} path The path of the property to update.
|
|
* @param {Function} updater The function to produce the updated value.
|
|
* @param {Function} [customizer] The function to customize path creation.
|
|
* @returns {Object} Returns `object`.
|
|
*/
|
|
function baseUpdate(object, path, updater, customizer) {
|
|
return baseSet(object, path, updater(baseGet(object, path)), customizer);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of methods like `_.dropWhile` and `_.takeWhile`
|
|
* without support for iteratee shorthands.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to query.
|
|
* @param {Function} predicate The function invoked per iteration.
|
|
* @param {boolean} [isDrop] Specify dropping elements instead of taking them.
|
|
* @param {boolean} [fromRight] Specify iterating from right to left.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
*/
|
|
function baseWhile(array, predicate, isDrop, fromRight) {
|
|
var length = array.length,
|
|
index = fromRight ? length : -1;
|
|
|
|
while ((fromRight ? index-- : ++index < length) &&
|
|
predicate(array[index], index, array)) {}
|
|
|
|
return isDrop
|
|
? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length))
|
|
: baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index));
|
|
}
|
|
|
|
/**
|
|
* The base implementation of `wrapperValue` which returns the result of
|
|
* performing a sequence of actions on the unwrapped `value`, where each
|
|
* successive action is supplied the return value of the previous.
|
|
*
|
|
* @private
|
|
* @param {*} value The unwrapped value.
|
|
* @param {Array} actions Actions to perform to resolve the unwrapped value.
|
|
* @returns {*} Returns the resolved value.
|
|
*/
|
|
function baseWrapperValue(value, actions) {
|
|
var result = value;
|
|
if (result instanceof LazyWrapper) {
|
|
result = result.value();
|
|
}
|
|
return arrayReduce(actions, function(result, action) {
|
|
return action.func.apply(action.thisArg, arrayPush([result], action.args));
|
|
}, result);
|
|
}
|
|
|
|
/**
|
|
* The base implementation of methods like `_.xor`, without support for
|
|
* iteratee shorthands, that accepts an array of arrays to inspect.
|
|
*
|
|
* @private
|
|
* @param {Array} arrays The arrays to inspect.
|
|
* @param {Function} [iteratee] The iteratee invoked per element.
|
|
* @param {Function} [comparator] The comparator invoked per element.
|
|
* @returns {Array} Returns the new array of values.
|
|
*/
|
|
function baseXor(arrays, iteratee, comparator) {
|
|
var length = arrays.length;
|
|
if (length < 2) {
|
|
return length ? baseUniq(arrays[0]) : [];
|
|
}
|
|
var index = -1,
|
|
result = Array(length);
|
|
|
|
while (++index < length) {
|
|
var array = arrays[index],
|
|
othIndex = -1;
|
|
|
|
while (++othIndex < length) {
|
|
if (othIndex != index) {
|
|
result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator);
|
|
}
|
|
}
|
|
}
|
|
return baseUniq(baseFlatten(result, 1), iteratee, comparator);
|
|
}
|
|
|
|
/**
|
|
* This base implementation of `_.zipObject` which assigns values using `assignFunc`.
|
|
*
|
|
* @private
|
|
* @param {Array} props The property identifiers.
|
|
* @param {Array} values The property values.
|
|
* @param {Function} assignFunc The function to assign values.
|
|
* @returns {Object} Returns the new object.
|
|
*/
|
|
function baseZipObject(props, values, assignFunc) {
|
|
var index = -1,
|
|
length = props.length,
|
|
valsLength = values.length,
|
|
result = {};
|
|
|
|
while (++index < length) {
|
|
var value = index < valsLength ? values[index] : undefined;
|
|
assignFunc(result, props[index], value);
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Casts `value` to an empty array if it's not an array like object.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to inspect.
|
|
* @returns {Array|Object} Returns the cast array-like object.
|
|
*/
|
|
function castArrayLikeObject(value) {
|
|
return isArrayLikeObject(value) ? value : [];
|
|
}
|
|
|
|
/**
|
|
* Casts `value` to `identity` if it's not a function.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to inspect.
|
|
* @returns {Function} Returns cast function.
|
|
*/
|
|
function castFunction(value) {
|
|
return typeof value == 'function' ? value : identity;
|
|
}
|
|
|
|
/**
|
|
* Casts `value` to a path array if it's not one.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to inspect.
|
|
* @param {Object} [object] The object to query keys on.
|
|
* @returns {Array} Returns the cast property path array.
|
|
*/
|
|
function castPath(value, object) {
|
|
if (isArray(value)) {
|
|
return value;
|
|
}
|
|
return isKey(value, object) ? [value] : stringToPath(toString(value));
|
|
}
|
|
|
|
/**
|
|
* A `baseRest` alias which can be replaced with `identity` by module
|
|
* replacement plugins.
|
|
*
|
|
* @private
|
|
* @type {Function}
|
|
* @param {Function} func The function to apply a rest parameter to.
|
|
* @returns {Function} Returns the new function.
|
|
*/
|
|
var castRest = baseRest;
|
|
|
|
/**
|
|
* Casts `array` to a slice if it's needed.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to inspect.
|
|
* @param {number} start The start position.
|
|
* @param {number} [end=array.length] The end position.
|
|
* @returns {Array} Returns the cast slice.
|
|
*/
|
|
function castSlice(array, start, end) {
|
|
var length = array.length;
|
|
end = end === undefined ? length : end;
|
|
return (!start && end >= length) ? array : baseSlice(array, start, end);
|
|
}
|
|
|
|
/**
|
|
* A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout).
|
|
*
|
|
* @private
|
|
* @param {number|Object} id The timer id or timeout object of the timer to clear.
|
|
*/
|
|
var clearTimeout = ctxClearTimeout || function(id) {
|
|
return root.clearTimeout(id);
|
|
};
|
|
|
|
/**
|
|
* Creates a clone of `buffer`.
|
|
*
|
|
* @private
|
|
* @param {Buffer} buffer The buffer to clone.
|
|
* @param {boolean} [isDeep] Specify a deep clone.
|
|
* @returns {Buffer} Returns the cloned buffer.
|
|
*/
|
|
function cloneBuffer(buffer, isDeep) {
|
|
if (isDeep) {
|
|
return buffer.slice();
|
|
}
|
|
var length = buffer.length,
|
|
result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);
|
|
|
|
buffer.copy(result);
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Creates a clone of `arrayBuffer`.
|
|
*
|
|
* @private
|
|
* @param {ArrayBuffer} arrayBuffer The array buffer to clone.
|
|
* @returns {ArrayBuffer} Returns the cloned array buffer.
|
|
*/
|
|
function cloneArrayBuffer(arrayBuffer) {
|
|
var result = new arrayBuffer.constructor(arrayBuffer.byteLength);
|
|
new Uint8Array(result).set(new Uint8Array(arrayBuffer));
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Creates a clone of `dataView`.
|
|
*
|
|
* @private
|
|
* @param {Object} dataView The data view to clone.
|
|
* @param {boolean} [isDeep] Specify a deep clone.
|
|
* @returns {Object} Returns the cloned data view.
|
|
*/
|
|
function cloneDataView(dataView, isDeep) {
|
|
var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;
|
|
return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);
|
|
}
|
|
|
|
/**
|
|
* Creates a clone of `regexp`.
|
|
*
|
|
* @private
|
|
* @param {Object} regexp The regexp to clone.
|
|
* @returns {Object} Returns the cloned regexp.
|
|
*/
|
|
function cloneRegExp(regexp) {
|
|
var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));
|
|
result.lastIndex = regexp.lastIndex;
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Creates a clone of the `symbol` object.
|
|
*
|
|
* @private
|
|
* @param {Object} symbol The symbol object to clone.
|
|
* @returns {Object} Returns the cloned symbol object.
|
|
*/
|
|
function cloneSymbol(symbol) {
|
|
return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};
|
|
}
|
|
|
|
/**
|
|
* Creates a clone of `typedArray`.
|
|
*
|
|
* @private
|
|
* @param {Object} typedArray The typed array to clone.
|
|
* @param {boolean} [isDeep] Specify a deep clone.
|
|
* @returns {Object} Returns the cloned typed array.
|
|
*/
|
|
function cloneTypedArray(typedArray, isDeep) {
|
|
var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;
|
|
return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);
|
|
}
|
|
|
|
/**
|
|
* Compares values to sort them in ascending order.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to compare.
|
|
* @param {*} other The other value to compare.
|
|
* @returns {number} Returns the sort order indicator for `value`.
|
|
*/
|
|
function compareAscending(value, other) {
|
|
if (value !== other) {
|
|
var valIsDefined = value !== undefined,
|
|
valIsNull = value === null,
|
|
valIsReflexive = value === value,
|
|
valIsSymbol = isSymbol(value);
|
|
|
|
var othIsDefined = other !== undefined,
|
|
othIsNull = other === null,
|
|
othIsReflexive = other === other,
|
|
othIsSymbol = isSymbol(other);
|
|
|
|
if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) ||
|
|
(valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) ||
|
|
(valIsNull && othIsDefined && othIsReflexive) ||
|
|
(!valIsDefined && othIsReflexive) ||
|
|
!valIsReflexive) {
|
|
return 1;
|
|
}
|
|
if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) ||
|
|
(othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) ||
|
|
(othIsNull && valIsDefined && valIsReflexive) ||
|
|
(!othIsDefined && valIsReflexive) ||
|
|
!othIsReflexive) {
|
|
return -1;
|
|
}
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
/**
|
|
* Used by `_.orderBy` to compare multiple properties of a value to another
|
|
* and stable sort them.
|
|
*
|
|
* If `orders` is unspecified, all values are sorted in ascending order. Otherwise,
|
|
* specify an order of "desc" for descending or "asc" for ascending sort order
|
|
* of corresponding values.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to compare.
|
|
* @param {Object} other The other object to compare.
|
|
* @param {boolean[]|string[]} orders The order to sort by for each property.
|
|
* @returns {number} Returns the sort order indicator for `object`.
|
|
*/
|
|
function compareMultiple(object, other, orders) {
|
|
var index = -1,
|
|
objCriteria = object.criteria,
|
|
othCriteria = other.criteria,
|
|
length = objCriteria.length,
|
|
ordersLength = orders.length;
|
|
|
|
while (++index < length) {
|
|
var result = compareAscending(objCriteria[index], othCriteria[index]);
|
|
if (result) {
|
|
if (index >= ordersLength) {
|
|
return result;
|
|
}
|
|
var order = orders[index];
|
|
return result * (order == 'desc' ? -1 : 1);
|
|
}
|
|
}
|
|
// Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications
|
|
// that causes it, under certain circumstances, to provide the same value for
|
|
// `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247
|
|
// for more details.
|
|
//
|
|
// This also ensures a stable sort in V8 and other engines.
|
|
// See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details.
|
|
return object.index - other.index;
|
|
}
|
|
|
|
/**
|
|
* Creates an array that is the composition of partially applied arguments,
|
|
* placeholders, and provided arguments into a single array of arguments.
|
|
*
|
|
* @private
|
|
* @param {Array} args The provided arguments.
|
|
* @param {Array} partials The arguments to prepend to those provided.
|
|
* @param {Array} holders The `partials` placeholder indexes.
|
|
* @params {boolean} [isCurried] Specify composing for a curried function.
|
|
* @returns {Array} Returns the new array of composed arguments.
|
|
*/
|
|
function composeArgs(args, partials, holders, isCurried) {
|
|
var argsIndex = -1,
|
|
argsLength = args.length,
|
|
holdersLength = holders.length,
|
|
leftIndex = -1,
|
|
leftLength = partials.length,
|
|
rangeLength = nativeMax(argsLength - holdersLength, 0),
|
|
result = Array(leftLength + rangeLength),
|
|
isUncurried = !isCurried;
|
|
|
|
while (++leftIndex < leftLength) {
|
|
result[leftIndex] = partials[leftIndex];
|
|
}
|
|
while (++argsIndex < holdersLength) {
|
|
if (isUncurried || argsIndex < argsLength) {
|
|
result[holders[argsIndex]] = args[argsIndex];
|
|
}
|
|
}
|
|
while (rangeLength--) {
|
|
result[leftIndex++] = args[argsIndex++];
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* This function is like `composeArgs` except that the arguments composition
|
|
* is tailored for `_.partialRight`.
|
|
*
|
|
* @private
|
|
* @param {Array} args The provided arguments.
|
|
* @param {Array} partials The arguments to append to those provided.
|
|
* @param {Array} holders The `partials` placeholder indexes.
|
|
* @params {boolean} [isCurried] Specify composing for a curried function.
|
|
* @returns {Array} Returns the new array of composed arguments.
|
|
*/
|
|
function composeArgsRight(args, partials, holders, isCurried) {
|
|
var argsIndex = -1,
|
|
argsLength = args.length,
|
|
holdersIndex = -1,
|
|
holdersLength = holders.length,
|
|
rightIndex = -1,
|
|
rightLength = partials.length,
|
|
rangeLength = nativeMax(argsLength - holdersLength, 0),
|
|
result = Array(rangeLength + rightLength),
|
|
isUncurried = !isCurried;
|
|
|
|
while (++argsIndex < rangeLength) {
|
|
result[argsIndex] = args[argsIndex];
|
|
}
|
|
var offset = argsIndex;
|
|
while (++rightIndex < rightLength) {
|
|
result[offset + rightIndex] = partials[rightIndex];
|
|
}
|
|
while (++holdersIndex < holdersLength) {
|
|
if (isUncurried || argsIndex < argsLength) {
|
|
result[offset + holders[holdersIndex]] = args[argsIndex++];
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Copies the values of `source` to `array`.
|
|
*
|
|
* @private
|
|
* @param {Array} source The array to copy values from.
|
|
* @param {Array} [array=[]] The array to copy values to.
|
|
* @returns {Array} Returns `array`.
|
|
*/
|
|
function copyArray(source, array) {
|
|
var index = -1,
|
|
length = source.length;
|
|
|
|
array || (array = Array(length));
|
|
while (++index < length) {
|
|
array[index] = source[index];
|
|
}
|
|
return array;
|
|
}
|
|
|
|
/**
|
|
* Copies properties of `source` to `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} source The object to copy properties from.
|
|
* @param {Array} props The property identifiers to copy.
|
|
* @param {Object} [object={}] The object to copy properties to.
|
|
* @param {Function} [customizer] The function to customize copied values.
|
|
* @returns {Object} Returns `object`.
|
|
*/
|
|
function copyObject(source, props, object, customizer) {
|
|
var isNew = !object;
|
|
object || (object = {});
|
|
|
|
var index = -1,
|
|
length = props.length;
|
|
|
|
while (++index < length) {
|
|
var key = props[index];
|
|
|
|
var newValue = customizer
|
|
? customizer(object[key], source[key], key, object, source)
|
|
: undefined;
|
|
|
|
if (newValue === undefined) {
|
|
newValue = source[key];
|
|
}
|
|
if (isNew) {
|
|
baseAssignValue(object, key, newValue);
|
|
} else {
|
|
assignValue(object, key, newValue);
|
|
}
|
|
}
|
|
return object;
|
|
}
|
|
|
|
/**
|
|
* Copies own symbols of `source` to `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} source The object to copy symbols from.
|
|
* @param {Object} [object={}] The object to copy symbols to.
|
|
* @returns {Object} Returns `object`.
|
|
*/
|
|
function copySymbols(source, object) {
|
|
return copyObject(source, getSymbols(source), object);
|
|
}
|
|
|
|
/**
|
|
* Copies own and inherited symbols of `source` to `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} source The object to copy symbols from.
|
|
* @param {Object} [object={}] The object to copy symbols to.
|
|
* @returns {Object} Returns `object`.
|
|
*/
|
|
function copySymbolsIn(source, object) {
|
|
return copyObject(source, getSymbolsIn(source), object);
|
|
}
|
|
|
|
/**
|
|
* Creates a function like `_.groupBy`.
|
|
*
|
|
* @private
|
|
* @param {Function} setter The function to set accumulator values.
|
|
* @param {Function} [initializer] The accumulator object initializer.
|
|
* @returns {Function} Returns the new aggregator function.
|
|
*/
|
|
function createAggregator(setter, initializer) {
|
|
return function(collection, iteratee) {
|
|
var func = isArray(collection) ? arrayAggregator : baseAggregator,
|
|
accumulator = initializer ? initializer() : {};
|
|
|
|
return func(collection, setter, getIteratee(iteratee, 2), accumulator);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function like `_.assign`.
|
|
*
|
|
* @private
|
|
* @param {Function} assigner The function to assign values.
|
|
* @returns {Function} Returns the new assigner function.
|
|
*/
|
|
function createAssigner(assigner) {
|
|
return baseRest(function(object, sources) {
|
|
var index = -1,
|
|
length = sources.length,
|
|
customizer = length > 1 ? sources[length - 1] : undefined,
|
|
guard = length > 2 ? sources[2] : undefined;
|
|
|
|
customizer = (assigner.length > 3 && typeof customizer == 'function')
|
|
? (length--, customizer)
|
|
: undefined;
|
|
|
|
if (guard && isIterateeCall(sources[0], sources[1], guard)) {
|
|
customizer = length < 3 ? undefined : customizer;
|
|
length = 1;
|
|
}
|
|
object = Object(object);
|
|
while (++index < length) {
|
|
var source = sources[index];
|
|
if (source) {
|
|
assigner(object, source, index, customizer);
|
|
}
|
|
}
|
|
return object;
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Creates a `baseEach` or `baseEachRight` function.
|
|
*
|
|
* @private
|
|
* @param {Function} eachFunc The function to iterate over a collection.
|
|
* @param {boolean} [fromRight] Specify iterating from right to left.
|
|
* @returns {Function} Returns the new base function.
|
|
*/
|
|
function createBaseEach(eachFunc, fromRight) {
|
|
return function(collection, iteratee) {
|
|
if (collection == null) {
|
|
return collection;
|
|
}
|
|
if (!isArrayLike(collection)) {
|
|
return eachFunc(collection, iteratee);
|
|
}
|
|
var length = collection.length,
|
|
index = fromRight ? length : -1,
|
|
iterable = Object(collection);
|
|
|
|
while ((fromRight ? index-- : ++index < length)) {
|
|
if (iteratee(iterable[index], index, iterable) === false) {
|
|
break;
|
|
}
|
|
}
|
|
return collection;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a base function for methods like `_.forIn` and `_.forOwn`.
|
|
*
|
|
* @private
|
|
* @param {boolean} [fromRight] Specify iterating from right to left.
|
|
* @returns {Function} Returns the new base function.
|
|
*/
|
|
function createBaseFor(fromRight) {
|
|
return function(object, iteratee, keysFunc) {
|
|
var index = -1,
|
|
iterable = Object(object),
|
|
props = keysFunc(object),
|
|
length = props.length;
|
|
|
|
while (length--) {
|
|
var key = props[fromRight ? length : ++index];
|
|
if (iteratee(iterable[key], key, iterable) === false) {
|
|
break;
|
|
}
|
|
}
|
|
return object;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function that wraps `func` to invoke it with the optional `this`
|
|
* binding of `thisArg`.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to wrap.
|
|
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
|
|
* @param {*} [thisArg] The `this` binding of `func`.
|
|
* @returns {Function} Returns the new wrapped function.
|
|
*/
|
|
function createBind(func, bitmask, thisArg) {
|
|
var isBind = bitmask & WRAP_BIND_FLAG,
|
|
Ctor = createCtor(func);
|
|
|
|
function wrapper() {
|
|
var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
|
|
return fn.apply(isBind ? thisArg : this, arguments);
|
|
}
|
|
return wrapper;
|
|
}
|
|
|
|
/**
|
|
* Creates a function like `_.lowerFirst`.
|
|
*
|
|
* @private
|
|
* @param {string} methodName The name of the `String` case method to use.
|
|
* @returns {Function} Returns the new case function.
|
|
*/
|
|
function createCaseFirst(methodName) {
|
|
return function(string) {
|
|
string = toString(string);
|
|
|
|
var strSymbols = hasUnicode(string)
|
|
? stringToArray(string)
|
|
: undefined;
|
|
|
|
var chr = strSymbols
|
|
? strSymbols[0]
|
|
: string.charAt(0);
|
|
|
|
var trailing = strSymbols
|
|
? castSlice(strSymbols, 1).join('')
|
|
: string.slice(1);
|
|
|
|
return chr[methodName]() + trailing;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function like `_.camelCase`.
|
|
*
|
|
* @private
|
|
* @param {Function} callback The function to combine each word.
|
|
* @returns {Function} Returns the new compounder function.
|
|
*/
|
|
function createCompounder(callback) {
|
|
return function(string) {
|
|
return arrayReduce(words(deburr(string).replace(reApos, '')), callback, '');
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function that produces an instance of `Ctor` regardless of
|
|
* whether it was invoked as part of a `new` expression or by `call` or `apply`.
|
|
*
|
|
* @private
|
|
* @param {Function} Ctor The constructor to wrap.
|
|
* @returns {Function} Returns the new wrapped function.
|
|
*/
|
|
function createCtor(Ctor) {
|
|
return function() {
|
|
// Use a `switch` statement to work with class constructors. See
|
|
// http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist
|
|
// for more details.
|
|
var args = arguments;
|
|
switch (args.length) {
|
|
case 0: return new Ctor;
|
|
case 1: return new Ctor(args[0]);
|
|
case 2: return new Ctor(args[0], args[1]);
|
|
case 3: return new Ctor(args[0], args[1], args[2]);
|
|
case 4: return new Ctor(args[0], args[1], args[2], args[3]);
|
|
case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]);
|
|
case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]);
|
|
case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]);
|
|
}
|
|
var thisBinding = baseCreate(Ctor.prototype),
|
|
result = Ctor.apply(thisBinding, args);
|
|
|
|
// Mimic the constructor's `return` behavior.
|
|
// See https://es5.github.io/#x13.2.2 for more details.
|
|
return isObject(result) ? result : thisBinding;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function that wraps `func` to enable currying.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to wrap.
|
|
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
|
|
* @param {number} arity The arity of `func`.
|
|
* @returns {Function} Returns the new wrapped function.
|
|
*/
|
|
function createCurry(func, bitmask, arity) {
|
|
var Ctor = createCtor(func);
|
|
|
|
function wrapper() {
|
|
var length = arguments.length,
|
|
args = Array(length),
|
|
index = length,
|
|
placeholder = getHolder(wrapper);
|
|
|
|
while (index--) {
|
|
args[index] = arguments[index];
|
|
}
|
|
var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder)
|
|
? []
|
|
: replaceHolders(args, placeholder);
|
|
|
|
length -= holders.length;
|
|
if (length < arity) {
|
|
return createRecurry(
|
|
func, bitmask, createHybrid, wrapper.placeholder, undefined,
|
|
args, holders, undefined, undefined, arity - length);
|
|
}
|
|
var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
|
|
return apply(fn, this, args);
|
|
}
|
|
return wrapper;
|
|
}
|
|
|
|
/**
|
|
* Creates a `_.find` or `_.findLast` function.
|
|
*
|
|
* @private
|
|
* @param {Function} findIndexFunc The function to find the collection index.
|
|
* @returns {Function} Returns the new find function.
|
|
*/
|
|
function createFind(findIndexFunc) {
|
|
return function(collection, predicate, fromIndex) {
|
|
var iterable = Object(collection);
|
|
if (!isArrayLike(collection)) {
|
|
var iteratee = getIteratee(predicate, 3);
|
|
collection = keys(collection);
|
|
predicate = function(key) { return iteratee(iterable[key], key, iterable); };
|
|
}
|
|
var index = findIndexFunc(collection, predicate, fromIndex);
|
|
return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a `_.flow` or `_.flowRight` function.
|
|
*
|
|
* @private
|
|
* @param {boolean} [fromRight] Specify iterating from right to left.
|
|
* @returns {Function} Returns the new flow function.
|
|
*/
|
|
function createFlow(fromRight) {
|
|
return flatRest(function(funcs) {
|
|
var length = funcs.length,
|
|
index = length,
|
|
prereq = LodashWrapper.prototype.thru;
|
|
|
|
if (fromRight) {
|
|
funcs.reverse();
|
|
}
|
|
while (index--) {
|
|
var func = funcs[index];
|
|
if (typeof func != 'function') {
|
|
throw new TypeError(FUNC_ERROR_TEXT);
|
|
}
|
|
if (prereq && !wrapper && getFuncName(func) == 'wrapper') {
|
|
var wrapper = new LodashWrapper([], true);
|
|
}
|
|
}
|
|
index = wrapper ? index : length;
|
|
while (++index < length) {
|
|
func = funcs[index];
|
|
|
|
var funcName = getFuncName(func),
|
|
data = funcName == 'wrapper' ? getData(func) : undefined;
|
|
|
|
if (data && isLaziable(data[0]) &&
|
|
data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) &&
|
|
!data[4].length && data[9] == 1
|
|
) {
|
|
wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]);
|
|
} else {
|
|
wrapper = (func.length == 1 && isLaziable(func))
|
|
? wrapper[funcName]()
|
|
: wrapper.thru(func);
|
|
}
|
|
}
|
|
return function() {
|
|
var args = arguments,
|
|
value = args[0];
|
|
|
|
if (wrapper && args.length == 1 && isArray(value)) {
|
|
return wrapper.plant(value).value();
|
|
}
|
|
var index = 0,
|
|
result = length ? funcs[index].apply(this, args) : value;
|
|
|
|
while (++index < length) {
|
|
result = funcs[index].call(this, result);
|
|
}
|
|
return result;
|
|
};
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Creates a function that wraps `func` to invoke it with optional `this`
|
|
* binding of `thisArg`, partial application, and currying.
|
|
*
|
|
* @private
|
|
* @param {Function|string} func The function or method name to wrap.
|
|
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
|
|
* @param {*} [thisArg] The `this` binding of `func`.
|
|
* @param {Array} [partials] The arguments to prepend to those provided to
|
|
* the new function.
|
|
* @param {Array} [holders] The `partials` placeholder indexes.
|
|
* @param {Array} [partialsRight] The arguments to append to those provided
|
|
* to the new function.
|
|
* @param {Array} [holdersRight] The `partialsRight` placeholder indexes.
|
|
* @param {Array} [argPos] The argument positions of the new function.
|
|
* @param {number} [ary] The arity cap of `func`.
|
|
* @param {number} [arity] The arity of `func`.
|
|
* @returns {Function} Returns the new wrapped function.
|
|
*/
|
|
function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) {
|
|
var isAry = bitmask & WRAP_ARY_FLAG,
|
|
isBind = bitmask & WRAP_BIND_FLAG,
|
|
isBindKey = bitmask & WRAP_BIND_KEY_FLAG,
|
|
isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG),
|
|
isFlip = bitmask & WRAP_FLIP_FLAG,
|
|
Ctor = isBindKey ? undefined : createCtor(func);
|
|
|
|
function wrapper() {
|
|
var length = arguments.length,
|
|
args = Array(length),
|
|
index = length;
|
|
|
|
while (index--) {
|
|
args[index] = arguments[index];
|
|
}
|
|
if (isCurried) {
|
|
var placeholder = getHolder(wrapper),
|
|
holdersCount = countHolders(args, placeholder);
|
|
}
|
|
if (partials) {
|
|
args = composeArgs(args, partials, holders, isCurried);
|
|
}
|
|
if (partialsRight) {
|
|
args = composeArgsRight(args, partialsRight, holdersRight, isCurried);
|
|
}
|
|
length -= holdersCount;
|
|
if (isCurried && length < arity) {
|
|
var newHolders = replaceHolders(args, placeholder);
|
|
return createRecurry(
|
|
func, bitmask, createHybrid, wrapper.placeholder, thisArg,
|
|
args, newHolders, argPos, ary, arity - length
|
|
);
|
|
}
|
|
var thisBinding = isBind ? thisArg : this,
|
|
fn = isBindKey ? thisBinding[func] : func;
|
|
|
|
length = args.length;
|
|
if (argPos) {
|
|
args = reorder(args, argPos);
|
|
} else if (isFlip && length > 1) {
|
|
args.reverse();
|
|
}
|
|
if (isAry && ary < length) {
|
|
args.length = ary;
|
|
}
|
|
if (this && this !== root && this instanceof wrapper) {
|
|
fn = Ctor || createCtor(fn);
|
|
}
|
|
return fn.apply(thisBinding, args);
|
|
}
|
|
return wrapper;
|
|
}
|
|
|
|
/**
|
|
* Creates a function like `_.invertBy`.
|
|
*
|
|
* @private
|
|
* @param {Function} setter The function to set accumulator values.
|
|
* @param {Function} toIteratee The function to resolve iteratees.
|
|
* @returns {Function} Returns the new inverter function.
|
|
*/
|
|
function createInverter(setter, toIteratee) {
|
|
return function(object, iteratee) {
|
|
return baseInverter(object, setter, toIteratee(iteratee), {});
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function that performs a mathematical operation on two values.
|
|
*
|
|
* @private
|
|
* @param {Function} operator The function to perform the operation.
|
|
* @param {number} [defaultValue] The value used for `undefined` arguments.
|
|
* @returns {Function} Returns the new mathematical operation function.
|
|
*/
|
|
function createMathOperation(operator, defaultValue) {
|
|
return function(value, other) {
|
|
var result;
|
|
if (value === undefined && other === undefined) {
|
|
return defaultValue;
|
|
}
|
|
if (value !== undefined) {
|
|
result = value;
|
|
}
|
|
if (other !== undefined) {
|
|
if (result === undefined) {
|
|
return other;
|
|
}
|
|
if (typeof value == 'string' || typeof other == 'string') {
|
|
value = baseToString(value);
|
|
other = baseToString(other);
|
|
} else {
|
|
value = baseToNumber(value);
|
|
other = baseToNumber(other);
|
|
}
|
|
result = operator(value, other);
|
|
}
|
|
return result;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function like `_.over`.
|
|
*
|
|
* @private
|
|
* @param {Function} arrayFunc The function to iterate over iteratees.
|
|
* @returns {Function} Returns the new over function.
|
|
*/
|
|
function createOver(arrayFunc) {
|
|
return flatRest(function(iteratees) {
|
|
iteratees = arrayMap(iteratees, baseUnary(getIteratee()));
|
|
return baseRest(function(args) {
|
|
var thisArg = this;
|
|
return arrayFunc(iteratees, function(iteratee) {
|
|
return apply(iteratee, thisArg, args);
|
|
});
|
|
});
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Creates the padding for `string` based on `length`. The `chars` string
|
|
* is truncated if the number of characters exceeds `length`.
|
|
*
|
|
* @private
|
|
* @param {number} length The padding length.
|
|
* @param {string} [chars=' '] The string used as padding.
|
|
* @returns {string} Returns the padding for `string`.
|
|
*/
|
|
function createPadding(length, chars) {
|
|
chars = chars === undefined ? ' ' : baseToString(chars);
|
|
|
|
var charsLength = chars.length;
|
|
if (charsLength < 2) {
|
|
return charsLength ? baseRepeat(chars, length) : chars;
|
|
}
|
|
var result = baseRepeat(chars, nativeCeil(length / stringSize(chars)));
|
|
return hasUnicode(chars)
|
|
? castSlice(stringToArray(result), 0, length).join('')
|
|
: result.slice(0, length);
|
|
}
|
|
|
|
/**
|
|
* Creates a function that wraps `func` to invoke it with the `this` binding
|
|
* of `thisArg` and `partials` prepended to the arguments it receives.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to wrap.
|
|
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
|
|
* @param {*} thisArg The `this` binding of `func`.
|
|
* @param {Array} partials The arguments to prepend to those provided to
|
|
* the new function.
|
|
* @returns {Function} Returns the new wrapped function.
|
|
*/
|
|
function createPartial(func, bitmask, thisArg, partials) {
|
|
var isBind = bitmask & WRAP_BIND_FLAG,
|
|
Ctor = createCtor(func);
|
|
|
|
function wrapper() {
|
|
var argsIndex = -1,
|
|
argsLength = arguments.length,
|
|
leftIndex = -1,
|
|
leftLength = partials.length,
|
|
args = Array(leftLength + argsLength),
|
|
fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
|
|
|
|
while (++leftIndex < leftLength) {
|
|
args[leftIndex] = partials[leftIndex];
|
|
}
|
|
while (argsLength--) {
|
|
args[leftIndex++] = arguments[++argsIndex];
|
|
}
|
|
return apply(fn, isBind ? thisArg : this, args);
|
|
}
|
|
return wrapper;
|
|
}
|
|
|
|
/**
|
|
* Creates a `_.range` or `_.rangeRight` function.
|
|
*
|
|
* @private
|
|
* @param {boolean} [fromRight] Specify iterating from right to left.
|
|
* @returns {Function} Returns the new range function.
|
|
*/
|
|
function createRange(fromRight) {
|
|
return function(start, end, step) {
|
|
if (step && typeof step != 'number' && isIterateeCall(start, end, step)) {
|
|
end = step = undefined;
|
|
}
|
|
// Ensure the sign of `-0` is preserved.
|
|
start = toFinite(start);
|
|
if (end === undefined) {
|
|
end = start;
|
|
start = 0;
|
|
} else {
|
|
end = toFinite(end);
|
|
}
|
|
step = step === undefined ? (start < end ? 1 : -1) : toFinite(step);
|
|
return baseRange(start, end, step, fromRight);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function that performs a relational operation on two values.
|
|
*
|
|
* @private
|
|
* @param {Function} operator The function to perform the operation.
|
|
* @returns {Function} Returns the new relational operation function.
|
|
*/
|
|
function createRelationalOperation(operator) {
|
|
return function(value, other) {
|
|
if (!(typeof value == 'string' && typeof other == 'string')) {
|
|
value = toNumber(value);
|
|
other = toNumber(other);
|
|
}
|
|
return operator(value, other);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function that wraps `func` to continue currying.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to wrap.
|
|
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
|
|
* @param {Function} wrapFunc The function to create the `func` wrapper.
|
|
* @param {*} placeholder The placeholder value.
|
|
* @param {*} [thisArg] The `this` binding of `func`.
|
|
* @param {Array} [partials] The arguments to prepend to those provided to
|
|
* the new function.
|
|
* @param {Array} [holders] The `partials` placeholder indexes.
|
|
* @param {Array} [argPos] The argument positions of the new function.
|
|
* @param {number} [ary] The arity cap of `func`.
|
|
* @param {number} [arity] The arity of `func`.
|
|
* @returns {Function} Returns the new wrapped function.
|
|
*/
|
|
function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) {
|
|
var isCurry = bitmask & WRAP_CURRY_FLAG,
|
|
newHolders = isCurry ? holders : undefined,
|
|
newHoldersRight = isCurry ? undefined : holders,
|
|
newPartials = isCurry ? partials : undefined,
|
|
newPartialsRight = isCurry ? undefined : partials;
|
|
|
|
bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG);
|
|
bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG);
|
|
|
|
if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) {
|
|
bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG);
|
|
}
|
|
var newData = [
|
|
func, bitmask, thisArg, newPartials, newHolders, newPartialsRight,
|
|
newHoldersRight, argPos, ary, arity
|
|
];
|
|
|
|
var result = wrapFunc.apply(undefined, newData);
|
|
if (isLaziable(func)) {
|
|
setData(result, newData);
|
|
}
|
|
result.placeholder = placeholder;
|
|
return setWrapToString(result, func, bitmask);
|
|
}
|
|
|
|
/**
|
|
* Creates a function like `_.round`.
|
|
*
|
|
* @private
|
|
* @param {string} methodName The name of the `Math` method to use when rounding.
|
|
* @returns {Function} Returns the new round function.
|
|
*/
|
|
function createRound(methodName) {
|
|
var func = Math[methodName];
|
|
return function(number, precision) {
|
|
number = toNumber(number);
|
|
precision = precision == null ? 0 : nativeMin(toInteger(precision), 292);
|
|
if (precision && nativeIsFinite(number)) {
|
|
// Shift with exponential notation to avoid floating-point issues.
|
|
// See [MDN](https://mdn.io/round#Examples) for more details.
|
|
var pair = (toString(number) + 'e').split('e'),
|
|
value = func(pair[0] + 'e' + (+pair[1] + precision));
|
|
|
|
pair = (toString(value) + 'e').split('e');
|
|
return +(pair[0] + 'e' + (+pair[1] - precision));
|
|
}
|
|
return func(number);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a set object of `values`.
|
|
*
|
|
* @private
|
|
* @param {Array} values The values to add to the set.
|
|
* @returns {Object} Returns the new set.
|
|
*/
|
|
var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) {
|
|
return new Set(values);
|
|
};
|
|
|
|
/**
|
|
* Creates a `_.toPairs` or `_.toPairsIn` function.
|
|
*
|
|
* @private
|
|
* @param {Function} keysFunc The function to get the keys of a given object.
|
|
* @returns {Function} Returns the new pairs function.
|
|
*/
|
|
function createToPairs(keysFunc) {
|
|
return function(object) {
|
|
var tag = getTag(object);
|
|
if (tag == mapTag) {
|
|
return mapToArray(object);
|
|
}
|
|
if (tag == setTag) {
|
|
return setToPairs(object);
|
|
}
|
|
return baseToPairs(object, keysFunc(object));
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function that either curries or invokes `func` with optional
|
|
* `this` binding and partially applied arguments.
|
|
*
|
|
* @private
|
|
* @param {Function|string} func The function or method name to wrap.
|
|
* @param {number} bitmask The bitmask flags.
|
|
* 1 - `_.bind`
|
|
* 2 - `_.bindKey`
|
|
* 4 - `_.curry` or `_.curryRight` of a bound function
|
|
* 8 - `_.curry`
|
|
* 16 - `_.curryRight`
|
|
* 32 - `_.partial`
|
|
* 64 - `_.partialRight`
|
|
* 128 - `_.rearg`
|
|
* 256 - `_.ary`
|
|
* 512 - `_.flip`
|
|
* @param {*} [thisArg] The `this` binding of `func`.
|
|
* @param {Array} [partials] The arguments to be partially applied.
|
|
* @param {Array} [holders] The `partials` placeholder indexes.
|
|
* @param {Array} [argPos] The argument positions of the new function.
|
|
* @param {number} [ary] The arity cap of `func`.
|
|
* @param {number} [arity] The arity of `func`.
|
|
* @returns {Function} Returns the new wrapped function.
|
|
*/
|
|
function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) {
|
|
var isBindKey = bitmask & WRAP_BIND_KEY_FLAG;
|
|
if (!isBindKey && typeof func != 'function') {
|
|
throw new TypeError(FUNC_ERROR_TEXT);
|
|
}
|
|
var length = partials ? partials.length : 0;
|
|
if (!length) {
|
|
bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG);
|
|
partials = holders = undefined;
|
|
}
|
|
ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0);
|
|
arity = arity === undefined ? arity : toInteger(arity);
|
|
length -= holders ? holders.length : 0;
|
|
|
|
if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) {
|
|
var partialsRight = partials,
|
|
holdersRight = holders;
|
|
|
|
partials = holders = undefined;
|
|
}
|
|
var data = isBindKey ? undefined : getData(func);
|
|
|
|
var newData = [
|
|
func, bitmask, thisArg, partials, holders, partialsRight, holdersRight,
|
|
argPos, ary, arity
|
|
];
|
|
|
|
if (data) {
|
|
mergeData(newData, data);
|
|
}
|
|
func = newData[0];
|
|
bitmask = newData[1];
|
|
thisArg = newData[2];
|
|
partials = newData[3];
|
|
holders = newData[4];
|
|
arity = newData[9] = newData[9] === undefined
|
|
? (isBindKey ? 0 : func.length)
|
|
: nativeMax(newData[9] - length, 0);
|
|
|
|
if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) {
|
|
bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG);
|
|
}
|
|
if (!bitmask || bitmask == WRAP_BIND_FLAG) {
|
|
var result = createBind(func, bitmask, thisArg);
|
|
} else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) {
|
|
result = createCurry(func, bitmask, arity);
|
|
} else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) {
|
|
result = createPartial(func, bitmask, thisArg, partials);
|
|
} else {
|
|
result = createHybrid.apply(undefined, newData);
|
|
}
|
|
var setter = data ? baseSetData : setData;
|
|
return setWrapToString(setter(result, newData), func, bitmask);
|
|
}
|
|
|
|
/**
|
|
* Used by `_.defaults` to customize its `_.assignIn` use to assign properties
|
|
* of source objects to the destination object for all destination properties
|
|
* that resolve to `undefined`.
|
|
*
|
|
* @private
|
|
* @param {*} objValue The destination value.
|
|
* @param {*} srcValue The source value.
|
|
* @param {string} key The key of the property to assign.
|
|
* @param {Object} object The parent object of `objValue`.
|
|
* @returns {*} Returns the value to assign.
|
|
*/
|
|
function customDefaultsAssignIn(objValue, srcValue, key, object) {
|
|
if (objValue === undefined ||
|
|
(eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) {
|
|
return srcValue;
|
|
}
|
|
return objValue;
|
|
}
|
|
|
|
/**
|
|
* Used by `_.defaultsDeep` to customize its `_.merge` use to merge source
|
|
* objects into destination objects that are passed thru.
|
|
*
|
|
* @private
|
|
* @param {*} objValue The destination value.
|
|
* @param {*} srcValue The source value.
|
|
* @param {string} key The key of the property to merge.
|
|
* @param {Object} object The parent object of `objValue`.
|
|
* @param {Object} source The parent object of `srcValue`.
|
|
* @param {Object} [stack] Tracks traversed source values and their merged
|
|
* counterparts.
|
|
* @returns {*} Returns the value to assign.
|
|
*/
|
|
function customDefaultsMerge(objValue, srcValue, key, object, source, stack) {
|
|
if (isObject(objValue) && isObject(srcValue)) {
|
|
// Recursively merge objects and arrays (susceptible to call stack limits).
|
|
stack.set(srcValue, objValue);
|
|
baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack);
|
|
stack['delete'](srcValue);
|
|
}
|
|
return objValue;
|
|
}
|
|
|
|
/**
|
|
* Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain
|
|
* objects.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to inspect.
|
|
* @param {string} key The key of the property to inspect.
|
|
* @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`.
|
|
*/
|
|
function customOmitClone(value) {
|
|
return isPlainObject(value) ? undefined : value;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `baseIsEqualDeep` for arrays with support for
|
|
* partial deep comparisons.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to compare.
|
|
* @param {Array} other The other array to compare.
|
|
* @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
|
|
* @param {Function} customizer The function to customize comparisons.
|
|
* @param {Function} equalFunc The function to determine equivalents of values.
|
|
* @param {Object} stack Tracks traversed `array` and `other` objects.
|
|
* @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.
|
|
*/
|
|
function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {
|
|
var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
|
|
arrLength = array.length,
|
|
othLength = other.length;
|
|
|
|
if (arrLength != othLength && !(isPartial && othLength > arrLength)) {
|
|
return false;
|
|
}
|
|
// Check that cyclic values are equal.
|
|
var arrStacked = stack.get(array);
|
|
var othStacked = stack.get(other);
|
|
if (arrStacked && othStacked) {
|
|
return arrStacked == other && othStacked == array;
|
|
}
|
|
var index = -1,
|
|
result = true,
|
|
seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;
|
|
|
|
stack.set(array, other);
|
|
stack.set(other, array);
|
|
|
|
// Ignore non-index properties.
|
|
while (++index < arrLength) {
|
|
var arrValue = array[index],
|
|
othValue = other[index];
|
|
|
|
if (customizer) {
|
|
var compared = isPartial
|
|
? customizer(othValue, arrValue, index, other, array, stack)
|
|
: customizer(arrValue, othValue, index, array, other, stack);
|
|
}
|
|
if (compared !== undefined) {
|
|
if (compared) {
|
|
continue;
|
|
}
|
|
result = false;
|
|
break;
|
|
}
|
|
// Recursively compare arrays (susceptible to call stack limits).
|
|
if (seen) {
|
|
if (!arraySome(other, function(othValue, othIndex) {
|
|
if (!cacheHas(seen, othIndex) &&
|
|
(arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {
|
|
return seen.push(othIndex);
|
|
}
|
|
})) {
|
|
result = false;
|
|
break;
|
|
}
|
|
} else if (!(
|
|
arrValue === othValue ||
|
|
equalFunc(arrValue, othValue, bitmask, customizer, stack)
|
|
)) {
|
|
result = false;
|
|
break;
|
|
}
|
|
}
|
|
stack['delete'](array);
|
|
stack['delete'](other);
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `baseIsEqualDeep` for comparing objects of
|
|
* the same `toStringTag`.
|
|
*
|
|
* **Note:** This function only supports comparing values with tags of
|
|
* `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to compare.
|
|
* @param {Object} other The other object to compare.
|
|
* @param {string} tag The `toStringTag` of the objects to compare.
|
|
* @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
|
|
* @param {Function} customizer The function to customize comparisons.
|
|
* @param {Function} equalFunc The function to determine equivalents of values.
|
|
* @param {Object} stack Tracks traversed `object` and `other` objects.
|
|
* @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
|
|
*/
|
|
function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {
|
|
switch (tag) {
|
|
case dataViewTag:
|
|
if ((object.byteLength != other.byteLength) ||
|
|
(object.byteOffset != other.byteOffset)) {
|
|
return false;
|
|
}
|
|
object = object.buffer;
|
|
other = other.buffer;
|
|
|
|
case arrayBufferTag:
|
|
if ((object.byteLength != other.byteLength) ||
|
|
!equalFunc(new Uint8Array(object), new Uint8Array(other))) {
|
|
return false;
|
|
}
|
|
return true;
|
|
|
|
case boolTag:
|
|
case dateTag:
|
|
case numberTag:
|
|
// Coerce booleans to `1` or `0` and dates to milliseconds.
|
|
// Invalid dates are coerced to `NaN`.
|
|
return eq(+object, +other);
|
|
|
|
case errorTag:
|
|
return object.name == other.name && object.message == other.message;
|
|
|
|
case regexpTag:
|
|
case stringTag:
|
|
// Coerce regexes to strings and treat strings, primitives and objects,
|
|
// as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring
|
|
// for more details.
|
|
return object == (other + '');
|
|
|
|
case mapTag:
|
|
var convert = mapToArray;
|
|
|
|
case setTag:
|
|
var isPartial = bitmask & COMPARE_PARTIAL_FLAG;
|
|
convert || (convert = setToArray);
|
|
|
|
if (object.size != other.size && !isPartial) {
|
|
return false;
|
|
}
|
|
// Assume cyclic values are equal.
|
|
var stacked = stack.get(object);
|
|
if (stacked) {
|
|
return stacked == other;
|
|
}
|
|
bitmask |= COMPARE_UNORDERED_FLAG;
|
|
|
|
// Recursively compare objects (susceptible to call stack limits).
|
|
stack.set(object, other);
|
|
var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);
|
|
stack['delete'](object);
|
|
return result;
|
|
|
|
case symbolTag:
|
|
if (symbolValueOf) {
|
|
return symbolValueOf.call(object) == symbolValueOf.call(other);
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `baseIsEqualDeep` for objects with support for
|
|
* partial deep comparisons.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to compare.
|
|
* @param {Object} other The other object to compare.
|
|
* @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
|
|
* @param {Function} customizer The function to customize comparisons.
|
|
* @param {Function} equalFunc The function to determine equivalents of values.
|
|
* @param {Object} stack Tracks traversed `object` and `other` objects.
|
|
* @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
|
|
*/
|
|
function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {
|
|
var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
|
|
objProps = getAllKeys(object),
|
|
objLength = objProps.length,
|
|
othProps = getAllKeys(other),
|
|
othLength = othProps.length;
|
|
|
|
if (objLength != othLength && !isPartial) {
|
|
return false;
|
|
}
|
|
var index = objLength;
|
|
while (index--) {
|
|
var key = objProps[index];
|
|
if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {
|
|
return false;
|
|
}
|
|
}
|
|
// Check that cyclic values are equal.
|
|
var objStacked = stack.get(object);
|
|
var othStacked = stack.get(other);
|
|
if (objStacked && othStacked) {
|
|
return objStacked == other && othStacked == object;
|
|
}
|
|
var result = true;
|
|
stack.set(object, other);
|
|
stack.set(other, object);
|
|
|
|
var skipCtor = isPartial;
|
|
while (++index < objLength) {
|
|
key = objProps[index];
|
|
var objValue = object[key],
|
|
othValue = other[key];
|
|
|
|
if (customizer) {
|
|
var compared = isPartial
|
|
? customizer(othValue, objValue, key, other, object, stack)
|
|
: customizer(objValue, othValue, key, object, other, stack);
|
|
}
|
|
// Recursively compare objects (susceptible to call stack limits).
|
|
if (!(compared === undefined
|
|
? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))
|
|
: compared
|
|
)) {
|
|
result = false;
|
|
break;
|
|
}
|
|
skipCtor || (skipCtor = key == 'constructor');
|
|
}
|
|
if (result && !skipCtor) {
|
|
var objCtor = object.constructor,
|
|
othCtor = other.constructor;
|
|
|
|
// Non `Object` object instances with different constructors are not equal.
|
|
if (objCtor != othCtor &&
|
|
('constructor' in object && 'constructor' in other) &&
|
|
!(typeof objCtor == 'function' && objCtor instanceof objCtor &&
|
|
typeof othCtor == 'function' && othCtor instanceof othCtor)) {
|
|
result = false;
|
|
}
|
|
}
|
|
stack['delete'](object);
|
|
stack['delete'](other);
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `baseRest` which flattens the rest array.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to apply a rest parameter to.
|
|
* @returns {Function} Returns the new function.
|
|
*/
|
|
function flatRest(func) {
|
|
return setToString(overRest(func, undefined, flatten), func + '');
|
|
}
|
|
|
|
/**
|
|
* Creates an array of own enumerable property names and symbols of `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the array of property names and symbols.
|
|
*/
|
|
function getAllKeys(object) {
|
|
return baseGetAllKeys(object, keys, getSymbols);
|
|
}
|
|
|
|
/**
|
|
* Creates an array of own and inherited enumerable property names and
|
|
* symbols of `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the array of property names and symbols.
|
|
*/
|
|
function getAllKeysIn(object) {
|
|
return baseGetAllKeys(object, keysIn, getSymbolsIn);
|
|
}
|
|
|
|
/**
|
|
* Gets metadata for `func`.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to query.
|
|
* @returns {*} Returns the metadata for `func`.
|
|
*/
|
|
var getData = !metaMap ? noop : function(func) {
|
|
return metaMap.get(func);
|
|
};
|
|
|
|
/**
|
|
* Gets the name of `func`.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to query.
|
|
* @returns {string} Returns the function name.
|
|
*/
|
|
function getFuncName(func) {
|
|
var result = (func.name + ''),
|
|
array = realNames[result],
|
|
length = hasOwnProperty.call(realNames, result) ? array.length : 0;
|
|
|
|
while (length--) {
|
|
var data = array[length],
|
|
otherFunc = data.func;
|
|
if (otherFunc == null || otherFunc == func) {
|
|
return data.name;
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Gets the argument placeholder value for `func`.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to inspect.
|
|
* @returns {*} Returns the placeholder value.
|
|
*/
|
|
function getHolder(func) {
|
|
var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func;
|
|
return object.placeholder;
|
|
}
|
|
|
|
/**
|
|
* Gets the appropriate "iteratee" function. If `_.iteratee` is customized,
|
|
* this function returns the custom method, otherwise it returns `baseIteratee`.
|
|
* If arguments are provided, the chosen function is invoked with them and
|
|
* its result is returned.
|
|
*
|
|
* @private
|
|
* @param {*} [value] The value to convert to an iteratee.
|
|
* @param {number} [arity] The arity of the created iteratee.
|
|
* @returns {Function} Returns the chosen function or its result.
|
|
*/
|
|
function getIteratee() {
|
|
var result = lodash.iteratee || iteratee;
|
|
result = result === iteratee ? baseIteratee : result;
|
|
return arguments.length ? result(arguments[0], arguments[1]) : result;
|
|
}
|
|
|
|
/**
|
|
* Gets the data for `map`.
|
|
*
|
|
* @private
|
|
* @param {Object} map The map to query.
|
|
* @param {string} key The reference key.
|
|
* @returns {*} Returns the map data.
|
|
*/
|
|
function getMapData(map, key) {
|
|
var data = map.__data__;
|
|
return isKeyable(key)
|
|
? data[typeof key == 'string' ? 'string' : 'hash']
|
|
: data.map;
|
|
}
|
|
|
|
/**
|
|
* Gets the property names, values, and compare flags of `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the match data of `object`.
|
|
*/
|
|
function getMatchData(object) {
|
|
var result = keys(object),
|
|
length = result.length;
|
|
|
|
while (length--) {
|
|
var key = result[length],
|
|
value = object[key];
|
|
|
|
result[length] = [key, value, isStrictComparable(value)];
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Gets the native function at `key` of `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @param {string} key The key of the method to get.
|
|
* @returns {*} Returns the function if it's native, else `undefined`.
|
|
*/
|
|
function getNative(object, key) {
|
|
var value = getValue(object, key);
|
|
return baseIsNative(value) ? value : undefined;
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to query.
|
|
* @returns {string} Returns the raw `toStringTag`.
|
|
*/
|
|
function getRawTag(value) {
|
|
var isOwn = hasOwnProperty.call(value, symToStringTag),
|
|
tag = value[symToStringTag];
|
|
|
|
try {
|
|
value[symToStringTag] = undefined;
|
|
var unmasked = true;
|
|
} catch (e) {}
|
|
|
|
var result = nativeObjectToString.call(value);
|
|
if (unmasked) {
|
|
if (isOwn) {
|
|
value[symToStringTag] = tag;
|
|
} else {
|
|
delete value[symToStringTag];
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Creates an array of the own enumerable symbols of `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the array of symbols.
|
|
*/
|
|
var getSymbols = !nativeGetSymbols ? stubArray : function(object) {
|
|
if (object == null) {
|
|
return [];
|
|
}
|
|
object = Object(object);
|
|
return arrayFilter(nativeGetSymbols(object), function(symbol) {
|
|
return propertyIsEnumerable.call(object, symbol);
|
|
});
|
|
};
|
|
|
|
/**
|
|
* Creates an array of the own and inherited enumerable symbols of `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the array of symbols.
|
|
*/
|
|
var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) {
|
|
var result = [];
|
|
while (object) {
|
|
arrayPush(result, getSymbols(object));
|
|
object = getPrototype(object);
|
|
}
|
|
return result;
|
|
};
|
|
|
|
/**
|
|
* Gets the `toStringTag` of `value`.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to query.
|
|
* @returns {string} Returns the `toStringTag`.
|
|
*/
|
|
var getTag = baseGetTag;
|
|
|
|
// Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.
|
|
if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||
|
|
(Map && getTag(new Map) != mapTag) ||
|
|
(Promise && getTag(Promise.resolve()) != promiseTag) ||
|
|
(Set && getTag(new Set) != setTag) ||
|
|
(WeakMap && getTag(new WeakMap) != weakMapTag)) {
|
|
getTag = function(value) {
|
|
var result = baseGetTag(value),
|
|
Ctor = result == objectTag ? value.constructor : undefined,
|
|
ctorString = Ctor ? toSource(Ctor) : '';
|
|
|
|
if (ctorString) {
|
|
switch (ctorString) {
|
|
case dataViewCtorString: return dataViewTag;
|
|
case mapCtorString: return mapTag;
|
|
case promiseCtorString: return promiseTag;
|
|
case setCtorString: return setTag;
|
|
case weakMapCtorString: return weakMapTag;
|
|
}
|
|
}
|
|
return result;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Gets the view, applying any `transforms` to the `start` and `end` positions.
|
|
*
|
|
* @private
|
|
* @param {number} start The start of the view.
|
|
* @param {number} end The end of the view.
|
|
* @param {Array} transforms The transformations to apply to the view.
|
|
* @returns {Object} Returns an object containing the `start` and `end`
|
|
* positions of the view.
|
|
*/
|
|
function getView(start, end, transforms) {
|
|
var index = -1,
|
|
length = transforms.length;
|
|
|
|
while (++index < length) {
|
|
var data = transforms[index],
|
|
size = data.size;
|
|
|
|
switch (data.type) {
|
|
case 'drop': start += size; break;
|
|
case 'dropRight': end -= size; break;
|
|
case 'take': end = nativeMin(end, start + size); break;
|
|
case 'takeRight': start = nativeMax(start, end - size); break;
|
|
}
|
|
}
|
|
return { 'start': start, 'end': end };
|
|
}
|
|
|
|
/**
|
|
* Extracts wrapper details from the `source` body comment.
|
|
*
|
|
* @private
|
|
* @param {string} source The source to inspect.
|
|
* @returns {Array} Returns the wrapper details.
|
|
*/
|
|
function getWrapDetails(source) {
|
|
var match = source.match(reWrapDetails);
|
|
return match ? match[1].split(reSplitDetails) : [];
|
|
}
|
|
|
|
/**
|
|
* Checks if `path` exists on `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @param {Array|string} path The path to check.
|
|
* @param {Function} hasFunc The function to check properties.
|
|
* @returns {boolean} Returns `true` if `path` exists, else `false`.
|
|
*/
|
|
function hasPath(object, path, hasFunc) {
|
|
path = castPath(path, object);
|
|
|
|
var index = -1,
|
|
length = path.length,
|
|
result = false;
|
|
|
|
while (++index < length) {
|
|
var key = toKey(path[index]);
|
|
if (!(result = object != null && hasFunc(object, key))) {
|
|
break;
|
|
}
|
|
object = object[key];
|
|
}
|
|
if (result || ++index != length) {
|
|
return result;
|
|
}
|
|
length = object == null ? 0 : object.length;
|
|
return !!length && isLength(length) && isIndex(key, length) &&
|
|
(isArray(object) || isArguments(object));
|
|
}
|
|
|
|
/**
|
|
* Initializes an array clone.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to clone.
|
|
* @returns {Array} Returns the initialized clone.
|
|
*/
|
|
function initCloneArray(array) {
|
|
var length = array.length,
|
|
result = new array.constructor(length);
|
|
|
|
// Add properties assigned by `RegExp#exec`.
|
|
if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {
|
|
result.index = array.index;
|
|
result.input = array.input;
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Initializes an object clone.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to clone.
|
|
* @returns {Object} Returns the initialized clone.
|
|
*/
|
|
function initCloneObject(object) {
|
|
return (typeof object.constructor == 'function' && !isPrototype(object))
|
|
? baseCreate(getPrototype(object))
|
|
: {};
|
|
}
|
|
|
|
/**
|
|
* Initializes an object clone based on its `toStringTag`.
|
|
*
|
|
* **Note:** This function only supports cloning values with tags of
|
|
* `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to clone.
|
|
* @param {string} tag The `toStringTag` of the object to clone.
|
|
* @param {boolean} [isDeep] Specify a deep clone.
|
|
* @returns {Object} Returns the initialized clone.
|
|
*/
|
|
function initCloneByTag(object, tag, isDeep) {
|
|
var Ctor = object.constructor;
|
|
switch (tag) {
|
|
case arrayBufferTag:
|
|
return cloneArrayBuffer(object);
|
|
|
|
case boolTag:
|
|
case dateTag:
|
|
return new Ctor(+object);
|
|
|
|
case dataViewTag:
|
|
return cloneDataView(object, isDeep);
|
|
|
|
case float32Tag: case float64Tag:
|
|
case int8Tag: case int16Tag: case int32Tag:
|
|
case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag:
|
|
return cloneTypedArray(object, isDeep);
|
|
|
|
case mapTag:
|
|
return new Ctor;
|
|
|
|
case numberTag:
|
|
case stringTag:
|
|
return new Ctor(object);
|
|
|
|
case regexpTag:
|
|
return cloneRegExp(object);
|
|
|
|
case setTag:
|
|
return new Ctor;
|
|
|
|
case symbolTag:
|
|
return cloneSymbol(object);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Inserts wrapper `details` in a comment at the top of the `source` body.
|
|
*
|
|
* @private
|
|
* @param {string} source The source to modify.
|
|
* @returns {Array} details The details to insert.
|
|
* @returns {string} Returns the modified source.
|
|
*/
|
|
function insertWrapDetails(source, details) {
|
|
var length = details.length;
|
|
if (!length) {
|
|
return source;
|
|
}
|
|
var lastIndex = length - 1;
|
|
details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex];
|
|
details = details.join(length > 2 ? ', ' : ' ');
|
|
return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n');
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is a flattenable `arguments` object or array.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is flattenable, else `false`.
|
|
*/
|
|
function isFlattenable(value) {
|
|
return isArray(value) || isArguments(value) ||
|
|
!!(spreadableSymbol && value && value[spreadableSymbol]);
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is a valid array-like index.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
|
|
* @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
|
|
*/
|
|
function isIndex(value, length) {
|
|
var type = typeof value;
|
|
length = length == null ? MAX_SAFE_INTEGER : length;
|
|
|
|
return !!length &&
|
|
(type == 'number' ||
|
|
(type != 'symbol' && reIsUint.test(value))) &&
|
|
(value > -1 && value % 1 == 0 && value < length);
|
|
}
|
|
|
|
/**
|
|
* Checks if the given arguments are from an iteratee call.
|
|
*
|
|
* @private
|
|
* @param {*} value The potential iteratee value argument.
|
|
* @param {*} index The potential iteratee index or key argument.
|
|
* @param {*} object The potential iteratee object argument.
|
|
* @returns {boolean} Returns `true` if the arguments are from an iteratee call,
|
|
* else `false`.
|
|
*/
|
|
function isIterateeCall(value, index, object) {
|
|
if (!isObject(object)) {
|
|
return false;
|
|
}
|
|
var type = typeof index;
|
|
if (type == 'number'
|
|
? (isArrayLike(object) && isIndex(index, object.length))
|
|
: (type == 'string' && index in object)
|
|
) {
|
|
return eq(object[index], value);
|
|
}
|
|
return false;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is a property name and not a property path.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @param {Object} [object] The object to query keys on.
|
|
* @returns {boolean} Returns `true` if `value` is a property name, else `false`.
|
|
*/
|
|
function isKey(value, object) {
|
|
if (isArray(value)) {
|
|
return false;
|
|
}
|
|
var type = typeof value;
|
|
if (type == 'number' || type == 'symbol' || type == 'boolean' ||
|
|
value == null || isSymbol(value)) {
|
|
return true;
|
|
}
|
|
return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||
|
|
(object != null && value in Object(object));
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is suitable for use as unique object key.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is suitable, else `false`.
|
|
*/
|
|
function isKeyable(value) {
|
|
var type = typeof value;
|
|
return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')
|
|
? (value !== '__proto__')
|
|
: (value === null);
|
|
}
|
|
|
|
/**
|
|
* Checks if `func` has a lazy counterpart.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to check.
|
|
* @returns {boolean} Returns `true` if `func` has a lazy counterpart,
|
|
* else `false`.
|
|
*/
|
|
function isLaziable(func) {
|
|
var funcName = getFuncName(func),
|
|
other = lodash[funcName];
|
|
|
|
if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) {
|
|
return false;
|
|
}
|
|
if (func === other) {
|
|
return true;
|
|
}
|
|
var data = getData(other);
|
|
return !!data && func === data[0];
|
|
}
|
|
|
|
/**
|
|
* Checks if `func` has its source masked.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to check.
|
|
* @returns {boolean} Returns `true` if `func` is masked, else `false`.
|
|
*/
|
|
function isMasked(func) {
|
|
return !!maskSrcKey && (maskSrcKey in func);
|
|
}
|
|
|
|
/**
|
|
* Checks if `func` is capable of being masked.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `func` is maskable, else `false`.
|
|
*/
|
|
var isMaskable = coreJsData ? isFunction : stubFalse;
|
|
|
|
/**
|
|
* Checks if `value` is likely a prototype object.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a prototype, else `false`.
|
|
*/
|
|
function isPrototype(value) {
|
|
var Ctor = value && value.constructor,
|
|
proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;
|
|
|
|
return value === proto;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is suitable for strict equality comparisons, i.e. `===`.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` if suitable for strict
|
|
* equality comparisons, else `false`.
|
|
*/
|
|
function isStrictComparable(value) {
|
|
return value === value && !isObject(value);
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `matchesProperty` for source values suitable
|
|
* for strict equality comparisons, i.e. `===`.
|
|
*
|
|
* @private
|
|
* @param {string} key The key of the property to get.
|
|
* @param {*} srcValue The value to match.
|
|
* @returns {Function} Returns the new spec function.
|
|
*/
|
|
function matchesStrictComparable(key, srcValue) {
|
|
return function(object) {
|
|
if (object == null) {
|
|
return false;
|
|
}
|
|
return object[key] === srcValue &&
|
|
(srcValue !== undefined || (key in Object(object)));
|
|
};
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.memoize` which clears the memoized function's
|
|
* cache when it exceeds `MAX_MEMOIZE_SIZE`.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to have its output memoized.
|
|
* @returns {Function} Returns the new memoized function.
|
|
*/
|
|
function memoizeCapped(func) {
|
|
var result = memoize(func, function(key) {
|
|
if (cache.size === MAX_MEMOIZE_SIZE) {
|
|
cache.clear();
|
|
}
|
|
return key;
|
|
});
|
|
|
|
var cache = result.cache;
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Merges the function metadata of `source` into `data`.
|
|
*
|
|
* Merging metadata reduces the number of wrappers used to invoke a function.
|
|
* This is possible because methods like `_.bind`, `_.curry`, and `_.partial`
|
|
* may be applied regardless of execution order. Methods like `_.ary` and
|
|
* `_.rearg` modify function arguments, making the order in which they are
|
|
* executed important, preventing the merging of metadata. However, we make
|
|
* an exception for a safe combined case where curried functions have `_.ary`
|
|
* and or `_.rearg` applied.
|
|
*
|
|
* @private
|
|
* @param {Array} data The destination metadata.
|
|
* @param {Array} source The source metadata.
|
|
* @returns {Array} Returns `data`.
|
|
*/
|
|
function mergeData(data, source) {
|
|
var bitmask = data[1],
|
|
srcBitmask = source[1],
|
|
newBitmask = bitmask | srcBitmask,
|
|
isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG);
|
|
|
|
var isCombo =
|
|
((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) ||
|
|
((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) ||
|
|
((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG));
|
|
|
|
// Exit early if metadata can't be merged.
|
|
if (!(isCommon || isCombo)) {
|
|
return data;
|
|
}
|
|
// Use source `thisArg` if available.
|
|
if (srcBitmask & WRAP_BIND_FLAG) {
|
|
data[2] = source[2];
|
|
// Set when currying a bound function.
|
|
newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG;
|
|
}
|
|
// Compose partial arguments.
|
|
var value = source[3];
|
|
if (value) {
|
|
var partials = data[3];
|
|
data[3] = partials ? composeArgs(partials, value, source[4]) : value;
|
|
data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4];
|
|
}
|
|
// Compose partial right arguments.
|
|
value = source[5];
|
|
if (value) {
|
|
partials = data[5];
|
|
data[5] = partials ? composeArgsRight(partials, value, source[6]) : value;
|
|
data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6];
|
|
}
|
|
// Use source `argPos` if available.
|
|
value = source[7];
|
|
if (value) {
|
|
data[7] = value;
|
|
}
|
|
// Use source `ary` if it's smaller.
|
|
if (srcBitmask & WRAP_ARY_FLAG) {
|
|
data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]);
|
|
}
|
|
// Use source `arity` if one is not provided.
|
|
if (data[9] == null) {
|
|
data[9] = source[9];
|
|
}
|
|
// Use source `func` and merge bitmasks.
|
|
data[0] = source[0];
|
|
data[1] = newBitmask;
|
|
|
|
return data;
|
|
}
|
|
|
|
/**
|
|
* This function is like
|
|
* [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
|
|
* except that it includes inherited enumerable properties.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the array of property names.
|
|
*/
|
|
function nativeKeysIn(object) {
|
|
var result = [];
|
|
if (object != null) {
|
|
for (var key in Object(object)) {
|
|
result.push(key);
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Converts `value` to a string using `Object.prototype.toString`.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to convert.
|
|
* @returns {string} Returns the converted string.
|
|
*/
|
|
function objectToString(value) {
|
|
return nativeObjectToString.call(value);
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `baseRest` which transforms the rest array.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to apply a rest parameter to.
|
|
* @param {number} [start=func.length-1] The start position of the rest parameter.
|
|
* @param {Function} transform The rest array transform.
|
|
* @returns {Function} Returns the new function.
|
|
*/
|
|
function overRest(func, start, transform) {
|
|
start = nativeMax(start === undefined ? (func.length - 1) : start, 0);
|
|
return function() {
|
|
var args = arguments,
|
|
index = -1,
|
|
length = nativeMax(args.length - start, 0),
|
|
array = Array(length);
|
|
|
|
while (++index < length) {
|
|
array[index] = args[start + index];
|
|
}
|
|
index = -1;
|
|
var otherArgs = Array(start + 1);
|
|
while (++index < start) {
|
|
otherArgs[index] = args[index];
|
|
}
|
|
otherArgs[start] = transform(array);
|
|
return apply(func, this, otherArgs);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Gets the parent value at `path` of `object`.
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @param {Array} path The path to get the parent value of.
|
|
* @returns {*} Returns the parent value.
|
|
*/
|
|
function parent(object, path) {
|
|
return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1));
|
|
}
|
|
|
|
/**
|
|
* Reorder `array` according to the specified indexes where the element at
|
|
* the first index is assigned as the first element, the element at
|
|
* the second index is assigned as the second element, and so on.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to reorder.
|
|
* @param {Array} indexes The arranged array indexes.
|
|
* @returns {Array} Returns `array`.
|
|
*/
|
|
function reorder(array, indexes) {
|
|
var arrLength = array.length,
|
|
length = nativeMin(indexes.length, arrLength),
|
|
oldArray = copyArray(array);
|
|
|
|
while (length--) {
|
|
var index = indexes[length];
|
|
array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined;
|
|
}
|
|
return array;
|
|
}
|
|
|
|
/**
|
|
* Gets the value at `key`, unless `key` is "__proto__" or "constructor".
|
|
*
|
|
* @private
|
|
* @param {Object} object The object to query.
|
|
* @param {string} key The key of the property to get.
|
|
* @returns {*} Returns the property value.
|
|
*/
|
|
function safeGet(object, key) {
|
|
if (key === 'constructor' && typeof object[key] === 'function') {
|
|
return;
|
|
}
|
|
|
|
if (key == '__proto__') {
|
|
return;
|
|
}
|
|
|
|
return object[key];
|
|
}
|
|
|
|
/**
|
|
* Sets metadata for `func`.
|
|
*
|
|
* **Note:** If this function becomes hot, i.e. is invoked a lot in a short
|
|
* period of time, it will trip its breaker and transition to an identity
|
|
* function to avoid garbage collection pauses in V8. See
|
|
* [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070)
|
|
* for more details.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to associate metadata with.
|
|
* @param {*} data The metadata.
|
|
* @returns {Function} Returns `func`.
|
|
*/
|
|
var setData = shortOut(baseSetData);
|
|
|
|
/**
|
|
* A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout).
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to delay.
|
|
* @param {number} wait The number of milliseconds to delay invocation.
|
|
* @returns {number|Object} Returns the timer id or timeout object.
|
|
*/
|
|
var setTimeout = ctxSetTimeout || function(func, wait) {
|
|
return root.setTimeout(func, wait);
|
|
};
|
|
|
|
/**
|
|
* Sets the `toString` method of `func` to return `string`.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to modify.
|
|
* @param {Function} string The `toString` result.
|
|
* @returns {Function} Returns `func`.
|
|
*/
|
|
var setToString = shortOut(baseSetToString);
|
|
|
|
/**
|
|
* Sets the `toString` method of `wrapper` to mimic the source of `reference`
|
|
* with wrapper details in a comment at the top of the source body.
|
|
*
|
|
* @private
|
|
* @param {Function} wrapper The function to modify.
|
|
* @param {Function} reference The reference function.
|
|
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
|
|
* @returns {Function} Returns `wrapper`.
|
|
*/
|
|
function setWrapToString(wrapper, reference, bitmask) {
|
|
var source = (reference + '');
|
|
return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask)));
|
|
}
|
|
|
|
/**
|
|
* Creates a function that'll short out and invoke `identity` instead
|
|
* of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN`
|
|
* milliseconds.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to restrict.
|
|
* @returns {Function} Returns the new shortable function.
|
|
*/
|
|
function shortOut(func) {
|
|
var count = 0,
|
|
lastCalled = 0;
|
|
|
|
return function() {
|
|
var stamp = nativeNow(),
|
|
remaining = HOT_SPAN - (stamp - lastCalled);
|
|
|
|
lastCalled = stamp;
|
|
if (remaining > 0) {
|
|
if (++count >= HOT_COUNT) {
|
|
return arguments[0];
|
|
}
|
|
} else {
|
|
count = 0;
|
|
}
|
|
return func.apply(undefined, arguments);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* A specialized version of `_.shuffle` which mutates and sets the size of `array`.
|
|
*
|
|
* @private
|
|
* @param {Array} array The array to shuffle.
|
|
* @param {number} [size=array.length] The size of `array`.
|
|
* @returns {Array} Returns `array`.
|
|
*/
|
|
function shuffleSelf(array, size) {
|
|
var index = -1,
|
|
length = array.length,
|
|
lastIndex = length - 1;
|
|
|
|
size = size === undefined ? length : size;
|
|
while (++index < size) {
|
|
var rand = baseRandom(index, lastIndex),
|
|
value = array[rand];
|
|
|
|
array[rand] = array[index];
|
|
array[index] = value;
|
|
}
|
|
array.length = size;
|
|
return array;
|
|
}
|
|
|
|
/**
|
|
* Converts `string` to a property path array.
|
|
*
|
|
* @private
|
|
* @param {string} string The string to convert.
|
|
* @returns {Array} Returns the property path array.
|
|
*/
|
|
var stringToPath = memoizeCapped(function(string) {
|
|
var result = [];
|
|
if (string.charCodeAt(0) === 46 /* . */) {
|
|
result.push('');
|
|
}
|
|
string.replace(rePropName, function(match, number, quote, subString) {
|
|
result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match));
|
|
});
|
|
return result;
|
|
});
|
|
|
|
/**
|
|
* Converts `value` to a string key if it's not a string or symbol.
|
|
*
|
|
* @private
|
|
* @param {*} value The value to inspect.
|
|
* @returns {string|symbol} Returns the key.
|
|
*/
|
|
function toKey(value) {
|
|
if (typeof value == 'string' || isSymbol(value)) {
|
|
return value;
|
|
}
|
|
var result = (value + '');
|
|
return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;
|
|
}
|
|
|
|
/**
|
|
* Converts `func` to its source code.
|
|
*
|
|
* @private
|
|
* @param {Function} func The function to convert.
|
|
* @returns {string} Returns the source code.
|
|
*/
|
|
function toSource(func) {
|
|
if (func != null) {
|
|
try {
|
|
return funcToString.call(func);
|
|
} catch (e) {}
|
|
try {
|
|
return (func + '');
|
|
} catch (e) {}
|
|
}
|
|
return '';
|
|
}
|
|
|
|
/**
|
|
* Updates wrapper `details` based on `bitmask` flags.
|
|
*
|
|
* @private
|
|
* @returns {Array} details The details to modify.
|
|
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
|
|
* @returns {Array} Returns `details`.
|
|
*/
|
|
function updateWrapDetails(details, bitmask) {
|
|
arrayEach(wrapFlags, function(pair) {
|
|
var value = '_.' + pair[0];
|
|
if ((bitmask & pair[1]) && !arrayIncludes(details, value)) {
|
|
details.push(value);
|
|
}
|
|
});
|
|
return details.sort();
|
|
}
|
|
|
|
/**
|
|
* Creates a clone of `wrapper`.
|
|
*
|
|
* @private
|
|
* @param {Object} wrapper The wrapper to clone.
|
|
* @returns {Object} Returns the cloned wrapper.
|
|
*/
|
|
function wrapperClone(wrapper) {
|
|
if (wrapper instanceof LazyWrapper) {
|
|
return wrapper.clone();
|
|
}
|
|
var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__);
|
|
result.__actions__ = copyArray(wrapper.__actions__);
|
|
result.__index__ = wrapper.__index__;
|
|
result.__values__ = wrapper.__values__;
|
|
return result;
|
|
}
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Creates an array of elements split into groups the length of `size`.
|
|
* If `array` can't be split evenly, the final chunk will be the remaining
|
|
* elements.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to process.
|
|
* @param {number} [size=1] The length of each chunk
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {Array} Returns the new array of chunks.
|
|
* @example
|
|
*
|
|
* _.chunk(['a', 'b', 'c', 'd'], 2);
|
|
* // => [['a', 'b'], ['c', 'd']]
|
|
*
|
|
* _.chunk(['a', 'b', 'c', 'd'], 3);
|
|
* // => [['a', 'b', 'c'], ['d']]
|
|
*/
|
|
function chunk(array, size, guard) {
|
|
if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) {
|
|
size = 1;
|
|
} else {
|
|
size = nativeMax(toInteger(size), 0);
|
|
}
|
|
var length = array == null ? 0 : array.length;
|
|
if (!length || size < 1) {
|
|
return [];
|
|
}
|
|
var index = 0,
|
|
resIndex = 0,
|
|
result = Array(nativeCeil(length / size));
|
|
|
|
while (index < length) {
|
|
result[resIndex++] = baseSlice(array, index, (index += size));
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Creates an array with all falsey values removed. The values `false`, `null`,
|
|
* `0`, `""`, `undefined`, and `NaN` are falsey.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {Array} array The array to compact.
|
|
* @returns {Array} Returns the new array of filtered values.
|
|
* @example
|
|
*
|
|
* _.compact([0, 1, false, 2, '', 3]);
|
|
* // => [1, 2, 3]
|
|
*/
|
|
function compact(array) {
|
|
var index = -1,
|
|
length = array == null ? 0 : array.length,
|
|
resIndex = 0,
|
|
result = [];
|
|
|
|
while (++index < length) {
|
|
var value = array[index];
|
|
if (value) {
|
|
result[resIndex++] = value;
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Creates a new array concatenating `array` with any additional arrays
|
|
* and/or values.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to concatenate.
|
|
* @param {...*} [values] The values to concatenate.
|
|
* @returns {Array} Returns the new concatenated array.
|
|
* @example
|
|
*
|
|
* var array = [1];
|
|
* var other = _.concat(array, 2, [3], [[4]]);
|
|
*
|
|
* console.log(other);
|
|
* // => [1, 2, 3, [4]]
|
|
*
|
|
* console.log(array);
|
|
* // => [1]
|
|
*/
|
|
function concat() {
|
|
var length = arguments.length;
|
|
if (!length) {
|
|
return [];
|
|
}
|
|
var args = Array(length - 1),
|
|
array = arguments[0],
|
|
index = length;
|
|
|
|
while (index--) {
|
|
args[index - 1] = arguments[index];
|
|
}
|
|
return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1));
|
|
}
|
|
|
|
/**
|
|
* Creates an array of `array` values not included in the other given arrays
|
|
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
|
|
* for equality comparisons. The order and references of result values are
|
|
* determined by the first array.
|
|
*
|
|
* **Note:** Unlike `_.pullAll`, this method returns a new array.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {...Array} [values] The values to exclude.
|
|
* @returns {Array} Returns the new array of filtered values.
|
|
* @see _.without, _.xor
|
|
* @example
|
|
*
|
|
* _.difference([2, 1], [2, 3]);
|
|
* // => [1]
|
|
*/
|
|
var difference = baseRest(function(array, values) {
|
|
return isArrayLikeObject(array)
|
|
? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true))
|
|
: [];
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.difference` except that it accepts `iteratee` which
|
|
* is invoked for each element of `array` and `values` to generate the criterion
|
|
* by which they're compared. The order and references of result values are
|
|
* determined by the first array. The iteratee is invoked with one argument:
|
|
* (value).
|
|
*
|
|
* **Note:** Unlike `_.pullAllBy`, this method returns a new array.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {...Array} [values] The values to exclude.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {Array} Returns the new array of filtered values.
|
|
* @example
|
|
*
|
|
* _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor);
|
|
* // => [1.2]
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x');
|
|
* // => [{ 'x': 2 }]
|
|
*/
|
|
var differenceBy = baseRest(function(array, values) {
|
|
var iteratee = last(values);
|
|
if (isArrayLikeObject(iteratee)) {
|
|
iteratee = undefined;
|
|
}
|
|
return isArrayLikeObject(array)
|
|
? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2))
|
|
: [];
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.difference` except that it accepts `comparator`
|
|
* which is invoked to compare elements of `array` to `values`. The order and
|
|
* references of result values are determined by the first array. The comparator
|
|
* is invoked with two arguments: (arrVal, othVal).
|
|
*
|
|
* **Note:** Unlike `_.pullAllWith`, this method returns a new array.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {...Array} [values] The values to exclude.
|
|
* @param {Function} [comparator] The comparator invoked per element.
|
|
* @returns {Array} Returns the new array of filtered values.
|
|
* @example
|
|
*
|
|
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
|
|
*
|
|
* _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual);
|
|
* // => [{ 'x': 2, 'y': 1 }]
|
|
*/
|
|
var differenceWith = baseRest(function(array, values) {
|
|
var comparator = last(values);
|
|
if (isArrayLikeObject(comparator)) {
|
|
comparator = undefined;
|
|
}
|
|
return isArrayLikeObject(array)
|
|
? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator)
|
|
: [];
|
|
});
|
|
|
|
/**
|
|
* Creates a slice of `array` with `n` elements dropped from the beginning.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.5.0
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @param {number} [n=1] The number of elements to drop.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
* @example
|
|
*
|
|
* _.drop([1, 2, 3]);
|
|
* // => [2, 3]
|
|
*
|
|
* _.drop([1, 2, 3], 2);
|
|
* // => [3]
|
|
*
|
|
* _.drop([1, 2, 3], 5);
|
|
* // => []
|
|
*
|
|
* _.drop([1, 2, 3], 0);
|
|
* // => [1, 2, 3]
|
|
*/
|
|
function drop(array, n, guard) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (!length) {
|
|
return [];
|
|
}
|
|
n = (guard || n === undefined) ? 1 : toInteger(n);
|
|
return baseSlice(array, n < 0 ? 0 : n, length);
|
|
}
|
|
|
|
/**
|
|
* Creates a slice of `array` with `n` elements dropped from the end.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @param {number} [n=1] The number of elements to drop.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
* @example
|
|
*
|
|
* _.dropRight([1, 2, 3]);
|
|
* // => [1, 2]
|
|
*
|
|
* _.dropRight([1, 2, 3], 2);
|
|
* // => [1]
|
|
*
|
|
* _.dropRight([1, 2, 3], 5);
|
|
* // => []
|
|
*
|
|
* _.dropRight([1, 2, 3], 0);
|
|
* // => [1, 2, 3]
|
|
*/
|
|
function dropRight(array, n, guard) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (!length) {
|
|
return [];
|
|
}
|
|
n = (guard || n === undefined) ? 1 : toInteger(n);
|
|
n = length - n;
|
|
return baseSlice(array, 0, n < 0 ? 0 : n);
|
|
}
|
|
|
|
/**
|
|
* Creates a slice of `array` excluding elements dropped from the end.
|
|
* Elements are dropped until `predicate` returns falsey. The predicate is
|
|
* invoked with three arguments: (value, index, array).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'active': true },
|
|
* { 'user': 'fred', 'active': false },
|
|
* { 'user': 'pebbles', 'active': false }
|
|
* ];
|
|
*
|
|
* _.dropRightWhile(users, function(o) { return !o.active; });
|
|
* // => objects for ['barney']
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.dropRightWhile(users, { 'user': 'pebbles', 'active': false });
|
|
* // => objects for ['barney', 'fred']
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.dropRightWhile(users, ['active', false]);
|
|
* // => objects for ['barney']
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.dropRightWhile(users, 'active');
|
|
* // => objects for ['barney', 'fred', 'pebbles']
|
|
*/
|
|
function dropRightWhile(array, predicate) {
|
|
return (array && array.length)
|
|
? baseWhile(array, getIteratee(predicate, 3), true, true)
|
|
: [];
|
|
}
|
|
|
|
/**
|
|
* Creates a slice of `array` excluding elements dropped from the beginning.
|
|
* Elements are dropped until `predicate` returns falsey. The predicate is
|
|
* invoked with three arguments: (value, index, array).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'active': false },
|
|
* { 'user': 'fred', 'active': false },
|
|
* { 'user': 'pebbles', 'active': true }
|
|
* ];
|
|
*
|
|
* _.dropWhile(users, function(o) { return !o.active; });
|
|
* // => objects for ['pebbles']
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.dropWhile(users, { 'user': 'barney', 'active': false });
|
|
* // => objects for ['fred', 'pebbles']
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.dropWhile(users, ['active', false]);
|
|
* // => objects for ['pebbles']
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.dropWhile(users, 'active');
|
|
* // => objects for ['barney', 'fred', 'pebbles']
|
|
*/
|
|
function dropWhile(array, predicate) {
|
|
return (array && array.length)
|
|
? baseWhile(array, getIteratee(predicate, 3), true)
|
|
: [];
|
|
}
|
|
|
|
/**
|
|
* Fills elements of `array` with `value` from `start` up to, but not
|
|
* including, `end`.
|
|
*
|
|
* **Note:** This method mutates `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.2.0
|
|
* @category Array
|
|
* @param {Array} array The array to fill.
|
|
* @param {*} value The value to fill `array` with.
|
|
* @param {number} [start=0] The start position.
|
|
* @param {number} [end=array.length] The end position.
|
|
* @returns {Array} Returns `array`.
|
|
* @example
|
|
*
|
|
* var array = [1, 2, 3];
|
|
*
|
|
* _.fill(array, 'a');
|
|
* console.log(array);
|
|
* // => ['a', 'a', 'a']
|
|
*
|
|
* _.fill(Array(3), 2);
|
|
* // => [2, 2, 2]
|
|
*
|
|
* _.fill([4, 6, 8, 10], '*', 1, 3);
|
|
* // => [4, '*', '*', 10]
|
|
*/
|
|
function fill(array, value, start, end) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (!length) {
|
|
return [];
|
|
}
|
|
if (start && typeof start != 'number' && isIterateeCall(array, value, start)) {
|
|
start = 0;
|
|
end = length;
|
|
}
|
|
return baseFill(array, value, start, end);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.find` except that it returns the index of the first
|
|
* element `predicate` returns truthy for instead of the element itself.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 1.1.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @param {number} [fromIndex=0] The index to search from.
|
|
* @returns {number} Returns the index of the found element, else `-1`.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'active': false },
|
|
* { 'user': 'fred', 'active': false },
|
|
* { 'user': 'pebbles', 'active': true }
|
|
* ];
|
|
*
|
|
* _.findIndex(users, function(o) { return o.user == 'barney'; });
|
|
* // => 0
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.findIndex(users, { 'user': 'fred', 'active': false });
|
|
* // => 1
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.findIndex(users, ['active', false]);
|
|
* // => 0
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.findIndex(users, 'active');
|
|
* // => 2
|
|
*/
|
|
function findIndex(array, predicate, fromIndex) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (!length) {
|
|
return -1;
|
|
}
|
|
var index = fromIndex == null ? 0 : toInteger(fromIndex);
|
|
if (index < 0) {
|
|
index = nativeMax(length + index, 0);
|
|
}
|
|
return baseFindIndex(array, getIteratee(predicate, 3), index);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.findIndex` except that it iterates over elements
|
|
* of `collection` from right to left.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @param {number} [fromIndex=array.length-1] The index to search from.
|
|
* @returns {number} Returns the index of the found element, else `-1`.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'active': true },
|
|
* { 'user': 'fred', 'active': false },
|
|
* { 'user': 'pebbles', 'active': false }
|
|
* ];
|
|
*
|
|
* _.findLastIndex(users, function(o) { return o.user == 'pebbles'; });
|
|
* // => 2
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.findLastIndex(users, { 'user': 'barney', 'active': true });
|
|
* // => 0
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.findLastIndex(users, ['active', false]);
|
|
* // => 2
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.findLastIndex(users, 'active');
|
|
* // => 0
|
|
*/
|
|
function findLastIndex(array, predicate, fromIndex) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (!length) {
|
|
return -1;
|
|
}
|
|
var index = length - 1;
|
|
if (fromIndex !== undefined) {
|
|
index = toInteger(fromIndex);
|
|
index = fromIndex < 0
|
|
? nativeMax(length + index, 0)
|
|
: nativeMin(index, length - 1);
|
|
}
|
|
return baseFindIndex(array, getIteratee(predicate, 3), index, true);
|
|
}
|
|
|
|
/**
|
|
* Flattens `array` a single level deep.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {Array} array The array to flatten.
|
|
* @returns {Array} Returns the new flattened array.
|
|
* @example
|
|
*
|
|
* _.flatten([1, [2, [3, [4]], 5]]);
|
|
* // => [1, 2, [3, [4]], 5]
|
|
*/
|
|
function flatten(array) {
|
|
var length = array == null ? 0 : array.length;
|
|
return length ? baseFlatten(array, 1) : [];
|
|
}
|
|
|
|
/**
|
|
* Recursively flattens `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to flatten.
|
|
* @returns {Array} Returns the new flattened array.
|
|
* @example
|
|
*
|
|
* _.flattenDeep([1, [2, [3, [4]], 5]]);
|
|
* // => [1, 2, 3, 4, 5]
|
|
*/
|
|
function flattenDeep(array) {
|
|
var length = array == null ? 0 : array.length;
|
|
return length ? baseFlatten(array, INFINITY) : [];
|
|
}
|
|
|
|
/**
|
|
* Recursively flatten `array` up to `depth` times.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.4.0
|
|
* @category Array
|
|
* @param {Array} array The array to flatten.
|
|
* @param {number} [depth=1] The maximum recursion depth.
|
|
* @returns {Array} Returns the new flattened array.
|
|
* @example
|
|
*
|
|
* var array = [1, [2, [3, [4]], 5]];
|
|
*
|
|
* _.flattenDepth(array, 1);
|
|
* // => [1, 2, [3, [4]], 5]
|
|
*
|
|
* _.flattenDepth(array, 2);
|
|
* // => [1, 2, 3, [4], 5]
|
|
*/
|
|
function flattenDepth(array, depth) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (!length) {
|
|
return [];
|
|
}
|
|
depth = depth === undefined ? 1 : toInteger(depth);
|
|
return baseFlatten(array, depth);
|
|
}
|
|
|
|
/**
|
|
* The inverse of `_.toPairs`; this method returns an object composed
|
|
* from key-value `pairs`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} pairs The key-value pairs.
|
|
* @returns {Object} Returns the new object.
|
|
* @example
|
|
*
|
|
* _.fromPairs([['a', 1], ['b', 2]]);
|
|
* // => { 'a': 1, 'b': 2 }
|
|
*/
|
|
function fromPairs(pairs) {
|
|
var index = -1,
|
|
length = pairs == null ? 0 : pairs.length,
|
|
result = {};
|
|
|
|
while (++index < length) {
|
|
var pair = pairs[index];
|
|
result[pair[0]] = pair[1];
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Gets the first element of `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @alias first
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @returns {*} Returns the first element of `array`.
|
|
* @example
|
|
*
|
|
* _.head([1, 2, 3]);
|
|
* // => 1
|
|
*
|
|
* _.head([]);
|
|
* // => undefined
|
|
*/
|
|
function head(array) {
|
|
return (array && array.length) ? array[0] : undefined;
|
|
}
|
|
|
|
/**
|
|
* Gets the index at which the first occurrence of `value` is found in `array`
|
|
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
|
|
* for equality comparisons. If `fromIndex` is negative, it's used as the
|
|
* offset from the end of `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {*} value The value to search for.
|
|
* @param {number} [fromIndex=0] The index to search from.
|
|
* @returns {number} Returns the index of the matched value, else `-1`.
|
|
* @example
|
|
*
|
|
* _.indexOf([1, 2, 1, 2], 2);
|
|
* // => 1
|
|
*
|
|
* // Search from the `fromIndex`.
|
|
* _.indexOf([1, 2, 1, 2], 2, 2);
|
|
* // => 3
|
|
*/
|
|
function indexOf(array, value, fromIndex) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (!length) {
|
|
return -1;
|
|
}
|
|
var index = fromIndex == null ? 0 : toInteger(fromIndex);
|
|
if (index < 0) {
|
|
index = nativeMax(length + index, 0);
|
|
}
|
|
return baseIndexOf(array, value, index);
|
|
}
|
|
|
|
/**
|
|
* Gets all but the last element of `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
* @example
|
|
*
|
|
* _.initial([1, 2, 3]);
|
|
* // => [1, 2]
|
|
*/
|
|
function initial(array) {
|
|
var length = array == null ? 0 : array.length;
|
|
return length ? baseSlice(array, 0, -1) : [];
|
|
}
|
|
|
|
/**
|
|
* Creates an array of unique values that are included in all given arrays
|
|
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
|
|
* for equality comparisons. The order and references of result values are
|
|
* determined by the first array.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {...Array} [arrays] The arrays to inspect.
|
|
* @returns {Array} Returns the new array of intersecting values.
|
|
* @example
|
|
*
|
|
* _.intersection([2, 1], [2, 3]);
|
|
* // => [2]
|
|
*/
|
|
var intersection = baseRest(function(arrays) {
|
|
var mapped = arrayMap(arrays, castArrayLikeObject);
|
|
return (mapped.length && mapped[0] === arrays[0])
|
|
? baseIntersection(mapped)
|
|
: [];
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.intersection` except that it accepts `iteratee`
|
|
* which is invoked for each element of each `arrays` to generate the criterion
|
|
* by which they're compared. The order and references of result values are
|
|
* determined by the first array. The iteratee is invoked with one argument:
|
|
* (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {...Array} [arrays] The arrays to inspect.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {Array} Returns the new array of intersecting values.
|
|
* @example
|
|
*
|
|
* _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor);
|
|
* // => [2.1]
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
|
|
* // => [{ 'x': 1 }]
|
|
*/
|
|
var intersectionBy = baseRest(function(arrays) {
|
|
var iteratee = last(arrays),
|
|
mapped = arrayMap(arrays, castArrayLikeObject);
|
|
|
|
if (iteratee === last(mapped)) {
|
|
iteratee = undefined;
|
|
} else {
|
|
mapped.pop();
|
|
}
|
|
return (mapped.length && mapped[0] === arrays[0])
|
|
? baseIntersection(mapped, getIteratee(iteratee, 2))
|
|
: [];
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.intersection` except that it accepts `comparator`
|
|
* which is invoked to compare elements of `arrays`. The order and references
|
|
* of result values are determined by the first array. The comparator is
|
|
* invoked with two arguments: (arrVal, othVal).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {...Array} [arrays] The arrays to inspect.
|
|
* @param {Function} [comparator] The comparator invoked per element.
|
|
* @returns {Array} Returns the new array of intersecting values.
|
|
* @example
|
|
*
|
|
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
|
|
* var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
|
|
*
|
|
* _.intersectionWith(objects, others, _.isEqual);
|
|
* // => [{ 'x': 1, 'y': 2 }]
|
|
*/
|
|
var intersectionWith = baseRest(function(arrays) {
|
|
var comparator = last(arrays),
|
|
mapped = arrayMap(arrays, castArrayLikeObject);
|
|
|
|
comparator = typeof comparator == 'function' ? comparator : undefined;
|
|
if (comparator) {
|
|
mapped.pop();
|
|
}
|
|
return (mapped.length && mapped[0] === arrays[0])
|
|
? baseIntersection(mapped, undefined, comparator)
|
|
: [];
|
|
});
|
|
|
|
/**
|
|
* Converts all elements in `array` into a string separated by `separator`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to convert.
|
|
* @param {string} [separator=','] The element separator.
|
|
* @returns {string} Returns the joined string.
|
|
* @example
|
|
*
|
|
* _.join(['a', 'b', 'c'], '~');
|
|
* // => 'a~b~c'
|
|
*/
|
|
function join(array, separator) {
|
|
return array == null ? '' : nativeJoin.call(array, separator);
|
|
}
|
|
|
|
/**
|
|
* Gets the last element of `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @returns {*} Returns the last element of `array`.
|
|
* @example
|
|
*
|
|
* _.last([1, 2, 3]);
|
|
* // => 3
|
|
*/
|
|
function last(array) {
|
|
var length = array == null ? 0 : array.length;
|
|
return length ? array[length - 1] : undefined;
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.indexOf` except that it iterates over elements of
|
|
* `array` from right to left.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {*} value The value to search for.
|
|
* @param {number} [fromIndex=array.length-1] The index to search from.
|
|
* @returns {number} Returns the index of the matched value, else `-1`.
|
|
* @example
|
|
*
|
|
* _.lastIndexOf([1, 2, 1, 2], 2);
|
|
* // => 3
|
|
*
|
|
* // Search from the `fromIndex`.
|
|
* _.lastIndexOf([1, 2, 1, 2], 2, 2);
|
|
* // => 1
|
|
*/
|
|
function lastIndexOf(array, value, fromIndex) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (!length) {
|
|
return -1;
|
|
}
|
|
var index = length;
|
|
if (fromIndex !== undefined) {
|
|
index = toInteger(fromIndex);
|
|
index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1);
|
|
}
|
|
return value === value
|
|
? strictLastIndexOf(array, value, index)
|
|
: baseFindIndex(array, baseIsNaN, index, true);
|
|
}
|
|
|
|
/**
|
|
* Gets the element at index `n` of `array`. If `n` is negative, the nth
|
|
* element from the end is returned.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.11.0
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @param {number} [n=0] The index of the element to return.
|
|
* @returns {*} Returns the nth element of `array`.
|
|
* @example
|
|
*
|
|
* var array = ['a', 'b', 'c', 'd'];
|
|
*
|
|
* _.nth(array, 1);
|
|
* // => 'b'
|
|
*
|
|
* _.nth(array, -2);
|
|
* // => 'c';
|
|
*/
|
|
function nth(array, n) {
|
|
return (array && array.length) ? baseNth(array, toInteger(n)) : undefined;
|
|
}
|
|
|
|
/**
|
|
* Removes all given values from `array` using
|
|
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
|
|
* for equality comparisons.
|
|
*
|
|
* **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove`
|
|
* to remove elements from an array by predicate.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to modify.
|
|
* @param {...*} [values] The values to remove.
|
|
* @returns {Array} Returns `array`.
|
|
* @example
|
|
*
|
|
* var array = ['a', 'b', 'c', 'a', 'b', 'c'];
|
|
*
|
|
* _.pull(array, 'a', 'c');
|
|
* console.log(array);
|
|
* // => ['b', 'b']
|
|
*/
|
|
var pull = baseRest(pullAll);
|
|
|
|
/**
|
|
* This method is like `_.pull` except that it accepts an array of values to remove.
|
|
*
|
|
* **Note:** Unlike `_.difference`, this method mutates `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to modify.
|
|
* @param {Array} values The values to remove.
|
|
* @returns {Array} Returns `array`.
|
|
* @example
|
|
*
|
|
* var array = ['a', 'b', 'c', 'a', 'b', 'c'];
|
|
*
|
|
* _.pullAll(array, ['a', 'c']);
|
|
* console.log(array);
|
|
* // => ['b', 'b']
|
|
*/
|
|
function pullAll(array, values) {
|
|
return (array && array.length && values && values.length)
|
|
? basePullAll(array, values)
|
|
: array;
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.pullAll` except that it accepts `iteratee` which is
|
|
* invoked for each element of `array` and `values` to generate the criterion
|
|
* by which they're compared. The iteratee is invoked with one argument: (value).
|
|
*
|
|
* **Note:** Unlike `_.differenceBy`, this method mutates `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to modify.
|
|
* @param {Array} values The values to remove.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {Array} Returns `array`.
|
|
* @example
|
|
*
|
|
* var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }];
|
|
*
|
|
* _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x');
|
|
* console.log(array);
|
|
* // => [{ 'x': 2 }]
|
|
*/
|
|
function pullAllBy(array, values, iteratee) {
|
|
return (array && array.length && values && values.length)
|
|
? basePullAll(array, values, getIteratee(iteratee, 2))
|
|
: array;
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.pullAll` except that it accepts `comparator` which
|
|
* is invoked to compare elements of `array` to `values`. The comparator is
|
|
* invoked with two arguments: (arrVal, othVal).
|
|
*
|
|
* **Note:** Unlike `_.differenceWith`, this method mutates `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.6.0
|
|
* @category Array
|
|
* @param {Array} array The array to modify.
|
|
* @param {Array} values The values to remove.
|
|
* @param {Function} [comparator] The comparator invoked per element.
|
|
* @returns {Array} Returns `array`.
|
|
* @example
|
|
*
|
|
* var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }];
|
|
*
|
|
* _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual);
|
|
* console.log(array);
|
|
* // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }]
|
|
*/
|
|
function pullAllWith(array, values, comparator) {
|
|
return (array && array.length && values && values.length)
|
|
? basePullAll(array, values, undefined, comparator)
|
|
: array;
|
|
}
|
|
|
|
/**
|
|
* Removes elements from `array` corresponding to `indexes` and returns an
|
|
* array of removed elements.
|
|
*
|
|
* **Note:** Unlike `_.at`, this method mutates `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to modify.
|
|
* @param {...(number|number[])} [indexes] The indexes of elements to remove.
|
|
* @returns {Array} Returns the new array of removed elements.
|
|
* @example
|
|
*
|
|
* var array = ['a', 'b', 'c', 'd'];
|
|
* var pulled = _.pullAt(array, [1, 3]);
|
|
*
|
|
* console.log(array);
|
|
* // => ['a', 'c']
|
|
*
|
|
* console.log(pulled);
|
|
* // => ['b', 'd']
|
|
*/
|
|
var pullAt = flatRest(function(array, indexes) {
|
|
var length = array == null ? 0 : array.length,
|
|
result = baseAt(array, indexes);
|
|
|
|
basePullAt(array, arrayMap(indexes, function(index) {
|
|
return isIndex(index, length) ? +index : index;
|
|
}).sort(compareAscending));
|
|
|
|
return result;
|
|
});
|
|
|
|
/**
|
|
* Removes all elements from `array` that `predicate` returns truthy for
|
|
* and returns an array of the removed elements. The predicate is invoked
|
|
* with three arguments: (value, index, array).
|
|
*
|
|
* **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull`
|
|
* to pull elements from an array by value.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to modify.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @returns {Array} Returns the new array of removed elements.
|
|
* @example
|
|
*
|
|
* var array = [1, 2, 3, 4];
|
|
* var evens = _.remove(array, function(n) {
|
|
* return n % 2 == 0;
|
|
* });
|
|
*
|
|
* console.log(array);
|
|
* // => [1, 3]
|
|
*
|
|
* console.log(evens);
|
|
* // => [2, 4]
|
|
*/
|
|
function remove(array, predicate) {
|
|
var result = [];
|
|
if (!(array && array.length)) {
|
|
return result;
|
|
}
|
|
var index = -1,
|
|
indexes = [],
|
|
length = array.length;
|
|
|
|
predicate = getIteratee(predicate, 3);
|
|
while (++index < length) {
|
|
var value = array[index];
|
|
if (predicate(value, index, array)) {
|
|
result.push(value);
|
|
indexes.push(index);
|
|
}
|
|
}
|
|
basePullAt(array, indexes);
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Reverses `array` so that the first element becomes the last, the second
|
|
* element becomes the second to last, and so on.
|
|
*
|
|
* **Note:** This method mutates `array` and is based on
|
|
* [`Array#reverse`](https://mdn.io/Array/reverse).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to modify.
|
|
* @returns {Array} Returns `array`.
|
|
* @example
|
|
*
|
|
* var array = [1, 2, 3];
|
|
*
|
|
* _.reverse(array);
|
|
* // => [3, 2, 1]
|
|
*
|
|
* console.log(array);
|
|
* // => [3, 2, 1]
|
|
*/
|
|
function reverse(array) {
|
|
return array == null ? array : nativeReverse.call(array);
|
|
}
|
|
|
|
/**
|
|
* Creates a slice of `array` from `start` up to, but not including, `end`.
|
|
*
|
|
* **Note:** This method is used instead of
|
|
* [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are
|
|
* returned.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to slice.
|
|
* @param {number} [start=0] The start position.
|
|
* @param {number} [end=array.length] The end position.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
*/
|
|
function slice(array, start, end) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (!length) {
|
|
return [];
|
|
}
|
|
if (end && typeof end != 'number' && isIterateeCall(array, start, end)) {
|
|
start = 0;
|
|
end = length;
|
|
}
|
|
else {
|
|
start = start == null ? 0 : toInteger(start);
|
|
end = end === undefined ? length : toInteger(end);
|
|
}
|
|
return baseSlice(array, start, end);
|
|
}
|
|
|
|
/**
|
|
* Uses a binary search to determine the lowest index at which `value`
|
|
* should be inserted into `array` in order to maintain its sort order.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {Array} array The sorted array to inspect.
|
|
* @param {*} value The value to evaluate.
|
|
* @returns {number} Returns the index at which `value` should be inserted
|
|
* into `array`.
|
|
* @example
|
|
*
|
|
* _.sortedIndex([30, 50], 40);
|
|
* // => 1
|
|
*/
|
|
function sortedIndex(array, value) {
|
|
return baseSortedIndex(array, value);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.sortedIndex` except that it accepts `iteratee`
|
|
* which is invoked for `value` and each element of `array` to compute their
|
|
* sort ranking. The iteratee is invoked with one argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The sorted array to inspect.
|
|
* @param {*} value The value to evaluate.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {number} Returns the index at which `value` should be inserted
|
|
* into `array`.
|
|
* @example
|
|
*
|
|
* var objects = [{ 'x': 4 }, { 'x': 5 }];
|
|
*
|
|
* _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });
|
|
* // => 0
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.sortedIndexBy(objects, { 'x': 4 }, 'x');
|
|
* // => 0
|
|
*/
|
|
function sortedIndexBy(array, value, iteratee) {
|
|
return baseSortedIndexBy(array, value, getIteratee(iteratee, 2));
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.indexOf` except that it performs a binary
|
|
* search on a sorted `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {*} value The value to search for.
|
|
* @returns {number} Returns the index of the matched value, else `-1`.
|
|
* @example
|
|
*
|
|
* _.sortedIndexOf([4, 5, 5, 5, 6], 5);
|
|
* // => 1
|
|
*/
|
|
function sortedIndexOf(array, value) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (length) {
|
|
var index = baseSortedIndex(array, value);
|
|
if (index < length && eq(array[index], value)) {
|
|
return index;
|
|
}
|
|
}
|
|
return -1;
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.sortedIndex` except that it returns the highest
|
|
* index at which `value` should be inserted into `array` in order to
|
|
* maintain its sort order.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Array
|
|
* @param {Array} array The sorted array to inspect.
|
|
* @param {*} value The value to evaluate.
|
|
* @returns {number} Returns the index at which `value` should be inserted
|
|
* into `array`.
|
|
* @example
|
|
*
|
|
* _.sortedLastIndex([4, 5, 5, 5, 6], 5);
|
|
* // => 4
|
|
*/
|
|
function sortedLastIndex(array, value) {
|
|
return baseSortedIndex(array, value, true);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.sortedLastIndex` except that it accepts `iteratee`
|
|
* which is invoked for `value` and each element of `array` to compute their
|
|
* sort ranking. The iteratee is invoked with one argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The sorted array to inspect.
|
|
* @param {*} value The value to evaluate.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {number} Returns the index at which `value` should be inserted
|
|
* into `array`.
|
|
* @example
|
|
*
|
|
* var objects = [{ 'x': 4 }, { 'x': 5 }];
|
|
*
|
|
* _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });
|
|
* // => 1
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.sortedLastIndexBy(objects, { 'x': 4 }, 'x');
|
|
* // => 1
|
|
*/
|
|
function sortedLastIndexBy(array, value, iteratee) {
|
|
return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.lastIndexOf` except that it performs a binary
|
|
* search on a sorted `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {*} value The value to search for.
|
|
* @returns {number} Returns the index of the matched value, else `-1`.
|
|
* @example
|
|
*
|
|
* _.sortedLastIndexOf([4, 5, 5, 5, 6], 5);
|
|
* // => 3
|
|
*/
|
|
function sortedLastIndexOf(array, value) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (length) {
|
|
var index = baseSortedIndex(array, value, true) - 1;
|
|
if (eq(array[index], value)) {
|
|
return index;
|
|
}
|
|
}
|
|
return -1;
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.uniq` except that it's designed and optimized
|
|
* for sorted arrays.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @returns {Array} Returns the new duplicate free array.
|
|
* @example
|
|
*
|
|
* _.sortedUniq([1, 1, 2]);
|
|
* // => [1, 2]
|
|
*/
|
|
function sortedUniq(array) {
|
|
return (array && array.length)
|
|
? baseSortedUniq(array)
|
|
: [];
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.uniqBy` except that it's designed and optimized
|
|
* for sorted arrays.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {Function} [iteratee] The iteratee invoked per element.
|
|
* @returns {Array} Returns the new duplicate free array.
|
|
* @example
|
|
*
|
|
* _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor);
|
|
* // => [1.1, 2.3]
|
|
*/
|
|
function sortedUniqBy(array, iteratee) {
|
|
return (array && array.length)
|
|
? baseSortedUniq(array, getIteratee(iteratee, 2))
|
|
: [];
|
|
}
|
|
|
|
/**
|
|
* Gets all but the first element of `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
* @example
|
|
*
|
|
* _.tail([1, 2, 3]);
|
|
* // => [2, 3]
|
|
*/
|
|
function tail(array) {
|
|
var length = array == null ? 0 : array.length;
|
|
return length ? baseSlice(array, 1, length) : [];
|
|
}
|
|
|
|
/**
|
|
* Creates a slice of `array` with `n` elements taken from the beginning.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @param {number} [n=1] The number of elements to take.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
* @example
|
|
*
|
|
* _.take([1, 2, 3]);
|
|
* // => [1]
|
|
*
|
|
* _.take([1, 2, 3], 2);
|
|
* // => [1, 2]
|
|
*
|
|
* _.take([1, 2, 3], 5);
|
|
* // => [1, 2, 3]
|
|
*
|
|
* _.take([1, 2, 3], 0);
|
|
* // => []
|
|
*/
|
|
function take(array, n, guard) {
|
|
if (!(array && array.length)) {
|
|
return [];
|
|
}
|
|
n = (guard || n === undefined) ? 1 : toInteger(n);
|
|
return baseSlice(array, 0, n < 0 ? 0 : n);
|
|
}
|
|
|
|
/**
|
|
* Creates a slice of `array` with `n` elements taken from the end.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @param {number} [n=1] The number of elements to take.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
* @example
|
|
*
|
|
* _.takeRight([1, 2, 3]);
|
|
* // => [3]
|
|
*
|
|
* _.takeRight([1, 2, 3], 2);
|
|
* // => [2, 3]
|
|
*
|
|
* _.takeRight([1, 2, 3], 5);
|
|
* // => [1, 2, 3]
|
|
*
|
|
* _.takeRight([1, 2, 3], 0);
|
|
* // => []
|
|
*/
|
|
function takeRight(array, n, guard) {
|
|
var length = array == null ? 0 : array.length;
|
|
if (!length) {
|
|
return [];
|
|
}
|
|
n = (guard || n === undefined) ? 1 : toInteger(n);
|
|
n = length - n;
|
|
return baseSlice(array, n < 0 ? 0 : n, length);
|
|
}
|
|
|
|
/**
|
|
* Creates a slice of `array` with elements taken from the end. Elements are
|
|
* taken until `predicate` returns falsey. The predicate is invoked with
|
|
* three arguments: (value, index, array).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'active': true },
|
|
* { 'user': 'fred', 'active': false },
|
|
* { 'user': 'pebbles', 'active': false }
|
|
* ];
|
|
*
|
|
* _.takeRightWhile(users, function(o) { return !o.active; });
|
|
* // => objects for ['fred', 'pebbles']
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.takeRightWhile(users, { 'user': 'pebbles', 'active': false });
|
|
* // => objects for ['pebbles']
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.takeRightWhile(users, ['active', false]);
|
|
* // => objects for ['fred', 'pebbles']
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.takeRightWhile(users, 'active');
|
|
* // => []
|
|
*/
|
|
function takeRightWhile(array, predicate) {
|
|
return (array && array.length)
|
|
? baseWhile(array, getIteratee(predicate, 3), false, true)
|
|
: [];
|
|
}
|
|
|
|
/**
|
|
* Creates a slice of `array` with elements taken from the beginning. Elements
|
|
* are taken until `predicate` returns falsey. The predicate is invoked with
|
|
* three arguments: (value, index, array).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to query.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @returns {Array} Returns the slice of `array`.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'active': false },
|
|
* { 'user': 'fred', 'active': false },
|
|
* { 'user': 'pebbles', 'active': true }
|
|
* ];
|
|
*
|
|
* _.takeWhile(users, function(o) { return !o.active; });
|
|
* // => objects for ['barney', 'fred']
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.takeWhile(users, { 'user': 'barney', 'active': false });
|
|
* // => objects for ['barney']
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.takeWhile(users, ['active', false]);
|
|
* // => objects for ['barney', 'fred']
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.takeWhile(users, 'active');
|
|
* // => []
|
|
*/
|
|
function takeWhile(array, predicate) {
|
|
return (array && array.length)
|
|
? baseWhile(array, getIteratee(predicate, 3))
|
|
: [];
|
|
}
|
|
|
|
/**
|
|
* Creates an array of unique values, in order, from all given arrays using
|
|
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
|
|
* for equality comparisons.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {...Array} [arrays] The arrays to inspect.
|
|
* @returns {Array} Returns the new array of combined values.
|
|
* @example
|
|
*
|
|
* _.union([2], [1, 2]);
|
|
* // => [2, 1]
|
|
*/
|
|
var union = baseRest(function(arrays) {
|
|
return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true));
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.union` except that it accepts `iteratee` which is
|
|
* invoked for each element of each `arrays` to generate the criterion by
|
|
* which uniqueness is computed. Result values are chosen from the first
|
|
* array in which the value occurs. The iteratee is invoked with one argument:
|
|
* (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {...Array} [arrays] The arrays to inspect.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {Array} Returns the new array of combined values.
|
|
* @example
|
|
*
|
|
* _.unionBy([2.1], [1.2, 2.3], Math.floor);
|
|
* // => [2.1, 1.2]
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
|
|
* // => [{ 'x': 1 }, { 'x': 2 }]
|
|
*/
|
|
var unionBy = baseRest(function(arrays) {
|
|
var iteratee = last(arrays);
|
|
if (isArrayLikeObject(iteratee)) {
|
|
iteratee = undefined;
|
|
}
|
|
return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2));
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.union` except that it accepts `comparator` which
|
|
* is invoked to compare elements of `arrays`. Result values are chosen from
|
|
* the first array in which the value occurs. The comparator is invoked
|
|
* with two arguments: (arrVal, othVal).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {...Array} [arrays] The arrays to inspect.
|
|
* @param {Function} [comparator] The comparator invoked per element.
|
|
* @returns {Array} Returns the new array of combined values.
|
|
* @example
|
|
*
|
|
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
|
|
* var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
|
|
*
|
|
* _.unionWith(objects, others, _.isEqual);
|
|
* // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]
|
|
*/
|
|
var unionWith = baseRest(function(arrays) {
|
|
var comparator = last(arrays);
|
|
comparator = typeof comparator == 'function' ? comparator : undefined;
|
|
return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator);
|
|
});
|
|
|
|
/**
|
|
* Creates a duplicate-free version of an array, using
|
|
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
|
|
* for equality comparisons, in which only the first occurrence of each element
|
|
* is kept. The order of result values is determined by the order they occur
|
|
* in the array.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @returns {Array} Returns the new duplicate free array.
|
|
* @example
|
|
*
|
|
* _.uniq([2, 1, 2]);
|
|
* // => [2, 1]
|
|
*/
|
|
function uniq(array) {
|
|
return (array && array.length) ? baseUniq(array) : [];
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.uniq` except that it accepts `iteratee` which is
|
|
* invoked for each element in `array` to generate the criterion by which
|
|
* uniqueness is computed. The order of result values is determined by the
|
|
* order they occur in the array. The iteratee is invoked with one argument:
|
|
* (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {Array} Returns the new duplicate free array.
|
|
* @example
|
|
*
|
|
* _.uniqBy([2.1, 1.2, 2.3], Math.floor);
|
|
* // => [2.1, 1.2]
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x');
|
|
* // => [{ 'x': 1 }, { 'x': 2 }]
|
|
*/
|
|
function uniqBy(array, iteratee) {
|
|
return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : [];
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.uniq` except that it accepts `comparator` which
|
|
* is invoked to compare elements of `array`. The order of result values is
|
|
* determined by the order they occur in the array.The comparator is invoked
|
|
* with two arguments: (arrVal, othVal).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {Function} [comparator] The comparator invoked per element.
|
|
* @returns {Array} Returns the new duplicate free array.
|
|
* @example
|
|
*
|
|
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }];
|
|
*
|
|
* _.uniqWith(objects, _.isEqual);
|
|
* // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]
|
|
*/
|
|
function uniqWith(array, comparator) {
|
|
comparator = typeof comparator == 'function' ? comparator : undefined;
|
|
return (array && array.length) ? baseUniq(array, undefined, comparator) : [];
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.zip` except that it accepts an array of grouped
|
|
* elements and creates an array regrouping the elements to their pre-zip
|
|
* configuration.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 1.2.0
|
|
* @category Array
|
|
* @param {Array} array The array of grouped elements to process.
|
|
* @returns {Array} Returns the new array of regrouped elements.
|
|
* @example
|
|
*
|
|
* var zipped = _.zip(['a', 'b'], [1, 2], [true, false]);
|
|
* // => [['a', 1, true], ['b', 2, false]]
|
|
*
|
|
* _.unzip(zipped);
|
|
* // => [['a', 'b'], [1, 2], [true, false]]
|
|
*/
|
|
function unzip(array) {
|
|
if (!(array && array.length)) {
|
|
return [];
|
|
}
|
|
var length = 0;
|
|
array = arrayFilter(array, function(group) {
|
|
if (isArrayLikeObject(group)) {
|
|
length = nativeMax(group.length, length);
|
|
return true;
|
|
}
|
|
});
|
|
return baseTimes(length, function(index) {
|
|
return arrayMap(array, baseProperty(index));
|
|
});
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.unzip` except that it accepts `iteratee` to specify
|
|
* how regrouped values should be combined. The iteratee is invoked with the
|
|
* elements of each group: (...group).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.8.0
|
|
* @category Array
|
|
* @param {Array} array The array of grouped elements to process.
|
|
* @param {Function} [iteratee=_.identity] The function to combine
|
|
* regrouped values.
|
|
* @returns {Array} Returns the new array of regrouped elements.
|
|
* @example
|
|
*
|
|
* var zipped = _.zip([1, 2], [10, 20], [100, 200]);
|
|
* // => [[1, 10, 100], [2, 20, 200]]
|
|
*
|
|
* _.unzipWith(zipped, _.add);
|
|
* // => [3, 30, 300]
|
|
*/
|
|
function unzipWith(array, iteratee) {
|
|
if (!(array && array.length)) {
|
|
return [];
|
|
}
|
|
var result = unzip(array);
|
|
if (iteratee == null) {
|
|
return result;
|
|
}
|
|
return arrayMap(result, function(group) {
|
|
return apply(iteratee, undefined, group);
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Creates an array excluding all given values using
|
|
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
|
|
* for equality comparisons.
|
|
*
|
|
* **Note:** Unlike `_.pull`, this method returns a new array.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {Array} array The array to inspect.
|
|
* @param {...*} [values] The values to exclude.
|
|
* @returns {Array} Returns the new array of filtered values.
|
|
* @see _.difference, _.xor
|
|
* @example
|
|
*
|
|
* _.without([2, 1, 2, 3], 1, 2);
|
|
* // => [3]
|
|
*/
|
|
var without = baseRest(function(array, values) {
|
|
return isArrayLikeObject(array)
|
|
? baseDifference(array, values)
|
|
: [];
|
|
});
|
|
|
|
/**
|
|
* Creates an array of unique values that is the
|
|
* [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference)
|
|
* of the given arrays. The order of result values is determined by the order
|
|
* they occur in the arrays.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.4.0
|
|
* @category Array
|
|
* @param {...Array} [arrays] The arrays to inspect.
|
|
* @returns {Array} Returns the new array of filtered values.
|
|
* @see _.difference, _.without
|
|
* @example
|
|
*
|
|
* _.xor([2, 1], [2, 3]);
|
|
* // => [1, 3]
|
|
*/
|
|
var xor = baseRest(function(arrays) {
|
|
return baseXor(arrayFilter(arrays, isArrayLikeObject));
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.xor` except that it accepts `iteratee` which is
|
|
* invoked for each element of each `arrays` to generate the criterion by
|
|
* which by which they're compared. The order of result values is determined
|
|
* by the order they occur in the arrays. The iteratee is invoked with one
|
|
* argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {...Array} [arrays] The arrays to inspect.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {Array} Returns the new array of filtered values.
|
|
* @example
|
|
*
|
|
* _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor);
|
|
* // => [1.2, 3.4]
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
|
|
* // => [{ 'x': 2 }]
|
|
*/
|
|
var xorBy = baseRest(function(arrays) {
|
|
var iteratee = last(arrays);
|
|
if (isArrayLikeObject(iteratee)) {
|
|
iteratee = undefined;
|
|
}
|
|
return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2));
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.xor` except that it accepts `comparator` which is
|
|
* invoked to compare elements of `arrays`. The order of result values is
|
|
* determined by the order they occur in the arrays. The comparator is invoked
|
|
* with two arguments: (arrVal, othVal).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Array
|
|
* @param {...Array} [arrays] The arrays to inspect.
|
|
* @param {Function} [comparator] The comparator invoked per element.
|
|
* @returns {Array} Returns the new array of filtered values.
|
|
* @example
|
|
*
|
|
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
|
|
* var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
|
|
*
|
|
* _.xorWith(objects, others, _.isEqual);
|
|
* // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]
|
|
*/
|
|
var xorWith = baseRest(function(arrays) {
|
|
var comparator = last(arrays);
|
|
comparator = typeof comparator == 'function' ? comparator : undefined;
|
|
return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator);
|
|
});
|
|
|
|
/**
|
|
* Creates an array of grouped elements, the first of which contains the
|
|
* first elements of the given arrays, the second of which contains the
|
|
* second elements of the given arrays, and so on.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Array
|
|
* @param {...Array} [arrays] The arrays to process.
|
|
* @returns {Array} Returns the new array of grouped elements.
|
|
* @example
|
|
*
|
|
* _.zip(['a', 'b'], [1, 2], [true, false]);
|
|
* // => [['a', 1, true], ['b', 2, false]]
|
|
*/
|
|
var zip = baseRest(unzip);
|
|
|
|
/**
|
|
* This method is like `_.fromPairs` except that it accepts two arrays,
|
|
* one of property identifiers and one of corresponding values.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.4.0
|
|
* @category Array
|
|
* @param {Array} [props=[]] The property identifiers.
|
|
* @param {Array} [values=[]] The property values.
|
|
* @returns {Object} Returns the new object.
|
|
* @example
|
|
*
|
|
* _.zipObject(['a', 'b'], [1, 2]);
|
|
* // => { 'a': 1, 'b': 2 }
|
|
*/
|
|
function zipObject(props, values) {
|
|
return baseZipObject(props || [], values || [], assignValue);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.zipObject` except that it supports property paths.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.1.0
|
|
* @category Array
|
|
* @param {Array} [props=[]] The property identifiers.
|
|
* @param {Array} [values=[]] The property values.
|
|
* @returns {Object} Returns the new object.
|
|
* @example
|
|
*
|
|
* _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]);
|
|
* // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } }
|
|
*/
|
|
function zipObjectDeep(props, values) {
|
|
return baseZipObject(props || [], values || [], baseSet);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.zip` except that it accepts `iteratee` to specify
|
|
* how grouped values should be combined. The iteratee is invoked with the
|
|
* elements of each group: (...group).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.8.0
|
|
* @category Array
|
|
* @param {...Array} [arrays] The arrays to process.
|
|
* @param {Function} [iteratee=_.identity] The function to combine
|
|
* grouped values.
|
|
* @returns {Array} Returns the new array of grouped elements.
|
|
* @example
|
|
*
|
|
* _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) {
|
|
* return a + b + c;
|
|
* });
|
|
* // => [111, 222]
|
|
*/
|
|
var zipWith = baseRest(function(arrays) {
|
|
var length = arrays.length,
|
|
iteratee = length > 1 ? arrays[length - 1] : undefined;
|
|
|
|
iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined;
|
|
return unzipWith(arrays, iteratee);
|
|
});
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Creates a `lodash` wrapper instance that wraps `value` with explicit method
|
|
* chain sequences enabled. The result of such sequences must be unwrapped
|
|
* with `_#value`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 1.3.0
|
|
* @category Seq
|
|
* @param {*} value The value to wrap.
|
|
* @returns {Object} Returns the new `lodash` wrapper instance.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'age': 36 },
|
|
* { 'user': 'fred', 'age': 40 },
|
|
* { 'user': 'pebbles', 'age': 1 }
|
|
* ];
|
|
*
|
|
* var youngest = _
|
|
* .chain(users)
|
|
* .sortBy('age')
|
|
* .map(function(o) {
|
|
* return o.user + ' is ' + o.age;
|
|
* })
|
|
* .head()
|
|
* .value();
|
|
* // => 'pebbles is 1'
|
|
*/
|
|
function chain(value) {
|
|
var result = lodash(value);
|
|
result.__chain__ = true;
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* This method invokes `interceptor` and returns `value`. The interceptor
|
|
* is invoked with one argument; (value). The purpose of this method is to
|
|
* "tap into" a method chain sequence in order to modify intermediate results.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Seq
|
|
* @param {*} value The value to provide to `interceptor`.
|
|
* @param {Function} interceptor The function to invoke.
|
|
* @returns {*} Returns `value`.
|
|
* @example
|
|
*
|
|
* _([1, 2, 3])
|
|
* .tap(function(array) {
|
|
* // Mutate input array.
|
|
* array.pop();
|
|
* })
|
|
* .reverse()
|
|
* .value();
|
|
* // => [2, 1]
|
|
*/
|
|
function tap(value, interceptor) {
|
|
interceptor(value);
|
|
return value;
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.tap` except that it returns the result of `interceptor`.
|
|
* The purpose of this method is to "pass thru" values replacing intermediate
|
|
* results in a method chain sequence.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Seq
|
|
* @param {*} value The value to provide to `interceptor`.
|
|
* @param {Function} interceptor The function to invoke.
|
|
* @returns {*} Returns the result of `interceptor`.
|
|
* @example
|
|
*
|
|
* _(' abc ')
|
|
* .chain()
|
|
* .trim()
|
|
* .thru(function(value) {
|
|
* return [value];
|
|
* })
|
|
* .value();
|
|
* // => ['abc']
|
|
*/
|
|
function thru(value, interceptor) {
|
|
return interceptor(value);
|
|
}
|
|
|
|
/**
|
|
* This method is the wrapper version of `_.at`.
|
|
*
|
|
* @name at
|
|
* @memberOf _
|
|
* @since 1.0.0
|
|
* @category Seq
|
|
* @param {...(string|string[])} [paths] The property paths to pick.
|
|
* @returns {Object} Returns the new `lodash` wrapper instance.
|
|
* @example
|
|
*
|
|
* var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };
|
|
*
|
|
* _(object).at(['a[0].b.c', 'a[1]']).value();
|
|
* // => [3, 4]
|
|
*/
|
|
var wrapperAt = flatRest(function(paths) {
|
|
var length = paths.length,
|
|
start = length ? paths[0] : 0,
|
|
value = this.__wrapped__,
|
|
interceptor = function(object) { return baseAt(object, paths); };
|
|
|
|
if (length > 1 || this.__actions__.length ||
|
|
!(value instanceof LazyWrapper) || !isIndex(start)) {
|
|
return this.thru(interceptor);
|
|
}
|
|
value = value.slice(start, +start + (length ? 1 : 0));
|
|
value.__actions__.push({
|
|
'func': thru,
|
|
'args': [interceptor],
|
|
'thisArg': undefined
|
|
});
|
|
return new LodashWrapper(value, this.__chain__).thru(function(array) {
|
|
if (length && !array.length) {
|
|
array.push(undefined);
|
|
}
|
|
return array;
|
|
});
|
|
});
|
|
|
|
/**
|
|
* Creates a `lodash` wrapper instance with explicit method chain sequences enabled.
|
|
*
|
|
* @name chain
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Seq
|
|
* @returns {Object} Returns the new `lodash` wrapper instance.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'age': 36 },
|
|
* { 'user': 'fred', 'age': 40 }
|
|
* ];
|
|
*
|
|
* // A sequence without explicit chaining.
|
|
* _(users).head();
|
|
* // => { 'user': 'barney', 'age': 36 }
|
|
*
|
|
* // A sequence with explicit chaining.
|
|
* _(users)
|
|
* .chain()
|
|
* .head()
|
|
* .pick('user')
|
|
* .value();
|
|
* // => { 'user': 'barney' }
|
|
*/
|
|
function wrapperChain() {
|
|
return chain(this);
|
|
}
|
|
|
|
/**
|
|
* Executes the chain sequence and returns the wrapped result.
|
|
*
|
|
* @name commit
|
|
* @memberOf _
|
|
* @since 3.2.0
|
|
* @category Seq
|
|
* @returns {Object} Returns the new `lodash` wrapper instance.
|
|
* @example
|
|
*
|
|
* var array = [1, 2];
|
|
* var wrapped = _(array).push(3);
|
|
*
|
|
* console.log(array);
|
|
* // => [1, 2]
|
|
*
|
|
* wrapped = wrapped.commit();
|
|
* console.log(array);
|
|
* // => [1, 2, 3]
|
|
*
|
|
* wrapped.last();
|
|
* // => 3
|
|
*
|
|
* console.log(array);
|
|
* // => [1, 2, 3]
|
|
*/
|
|
function wrapperCommit() {
|
|
return new LodashWrapper(this.value(), this.__chain__);
|
|
}
|
|
|
|
/**
|
|
* Gets the next value on a wrapped object following the
|
|
* [iterator protocol](https://mdn.io/iteration_protocols#iterator).
|
|
*
|
|
* @name next
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Seq
|
|
* @returns {Object} Returns the next iterator value.
|
|
* @example
|
|
*
|
|
* var wrapped = _([1, 2]);
|
|
*
|
|
* wrapped.next();
|
|
* // => { 'done': false, 'value': 1 }
|
|
*
|
|
* wrapped.next();
|
|
* // => { 'done': false, 'value': 2 }
|
|
*
|
|
* wrapped.next();
|
|
* // => { 'done': true, 'value': undefined }
|
|
*/
|
|
function wrapperNext() {
|
|
if (this.__values__ === undefined) {
|
|
this.__values__ = toArray(this.value());
|
|
}
|
|
var done = this.__index__ >= this.__values__.length,
|
|
value = done ? undefined : this.__values__[this.__index__++];
|
|
|
|
return { 'done': done, 'value': value };
|
|
}
|
|
|
|
/**
|
|
* Enables the wrapper to be iterable.
|
|
*
|
|
* @name Symbol.iterator
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Seq
|
|
* @returns {Object} Returns the wrapper object.
|
|
* @example
|
|
*
|
|
* var wrapped = _([1, 2]);
|
|
*
|
|
* wrapped[Symbol.iterator]() === wrapped;
|
|
* // => true
|
|
*
|
|
* Array.from(wrapped);
|
|
* // => [1, 2]
|
|
*/
|
|
function wrapperToIterator() {
|
|
return this;
|
|
}
|
|
|
|
/**
|
|
* Creates a clone of the chain sequence planting `value` as the wrapped value.
|
|
*
|
|
* @name plant
|
|
* @memberOf _
|
|
* @since 3.2.0
|
|
* @category Seq
|
|
* @param {*} value The value to plant.
|
|
* @returns {Object} Returns the new `lodash` wrapper instance.
|
|
* @example
|
|
*
|
|
* function square(n) {
|
|
* return n * n;
|
|
* }
|
|
*
|
|
* var wrapped = _([1, 2]).map(square);
|
|
* var other = wrapped.plant([3, 4]);
|
|
*
|
|
* other.value();
|
|
* // => [9, 16]
|
|
*
|
|
* wrapped.value();
|
|
* // => [1, 4]
|
|
*/
|
|
function wrapperPlant(value) {
|
|
var result,
|
|
parent = this;
|
|
|
|
while (parent instanceof baseLodash) {
|
|
var clone = wrapperClone(parent);
|
|
clone.__index__ = 0;
|
|
clone.__values__ = undefined;
|
|
if (result) {
|
|
previous.__wrapped__ = clone;
|
|
} else {
|
|
result = clone;
|
|
}
|
|
var previous = clone;
|
|
parent = parent.__wrapped__;
|
|
}
|
|
previous.__wrapped__ = value;
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* This method is the wrapper version of `_.reverse`.
|
|
*
|
|
* **Note:** This method mutates the wrapped array.
|
|
*
|
|
* @name reverse
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Seq
|
|
* @returns {Object} Returns the new `lodash` wrapper instance.
|
|
* @example
|
|
*
|
|
* var array = [1, 2, 3];
|
|
*
|
|
* _(array).reverse().value()
|
|
* // => [3, 2, 1]
|
|
*
|
|
* console.log(array);
|
|
* // => [3, 2, 1]
|
|
*/
|
|
function wrapperReverse() {
|
|
var value = this.__wrapped__;
|
|
if (value instanceof LazyWrapper) {
|
|
var wrapped = value;
|
|
if (this.__actions__.length) {
|
|
wrapped = new LazyWrapper(this);
|
|
}
|
|
wrapped = wrapped.reverse();
|
|
wrapped.__actions__.push({
|
|
'func': thru,
|
|
'args': [reverse],
|
|
'thisArg': undefined
|
|
});
|
|
return new LodashWrapper(wrapped, this.__chain__);
|
|
}
|
|
return this.thru(reverse);
|
|
}
|
|
|
|
/**
|
|
* Executes the chain sequence to resolve the unwrapped value.
|
|
*
|
|
* @name value
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @alias toJSON, valueOf
|
|
* @category Seq
|
|
* @returns {*} Returns the resolved unwrapped value.
|
|
* @example
|
|
*
|
|
* _([1, 2, 3]).value();
|
|
* // => [1, 2, 3]
|
|
*/
|
|
function wrapperValue() {
|
|
return baseWrapperValue(this.__wrapped__, this.__actions__);
|
|
}
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Creates an object composed of keys generated from the results of running
|
|
* each element of `collection` thru `iteratee`. The corresponding value of
|
|
* each key is the number of times the key was returned by `iteratee`. The
|
|
* iteratee is invoked with one argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.5.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The iteratee to transform keys.
|
|
* @returns {Object} Returns the composed aggregate object.
|
|
* @example
|
|
*
|
|
* _.countBy([6.1, 4.2, 6.3], Math.floor);
|
|
* // => { '4': 1, '6': 2 }
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.countBy(['one', 'two', 'three'], 'length');
|
|
* // => { '3': 2, '5': 1 }
|
|
*/
|
|
var countBy = createAggregator(function(result, value, key) {
|
|
if (hasOwnProperty.call(result, key)) {
|
|
++result[key];
|
|
} else {
|
|
baseAssignValue(result, key, 1);
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Checks if `predicate` returns truthy for **all** elements of `collection`.
|
|
* Iteration is stopped once `predicate` returns falsey. The predicate is
|
|
* invoked with three arguments: (value, index|key, collection).
|
|
*
|
|
* **Note:** This method returns `true` for
|
|
* [empty collections](https://en.wikipedia.org/wiki/Empty_set) because
|
|
* [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of
|
|
* elements of empty collections.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {boolean} Returns `true` if all elements pass the predicate check,
|
|
* else `false`.
|
|
* @example
|
|
*
|
|
* _.every([true, 1, null, 'yes'], Boolean);
|
|
* // => false
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'age': 36, 'active': false },
|
|
* { 'user': 'fred', 'age': 40, 'active': false }
|
|
* ];
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.every(users, { 'user': 'barney', 'active': false });
|
|
* // => false
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.every(users, ['active', false]);
|
|
* // => true
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.every(users, 'active');
|
|
* // => false
|
|
*/
|
|
function every(collection, predicate, guard) {
|
|
var func = isArray(collection) ? arrayEvery : baseEvery;
|
|
if (guard && isIterateeCall(collection, predicate, guard)) {
|
|
predicate = undefined;
|
|
}
|
|
return func(collection, getIteratee(predicate, 3));
|
|
}
|
|
|
|
/**
|
|
* Iterates over elements of `collection`, returning an array of all elements
|
|
* `predicate` returns truthy for. The predicate is invoked with three
|
|
* arguments: (value, index|key, collection).
|
|
*
|
|
* **Note:** Unlike `_.remove`, this method returns a new array.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @returns {Array} Returns the new filtered array.
|
|
* @see _.reject
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'age': 36, 'active': true },
|
|
* { 'user': 'fred', 'age': 40, 'active': false }
|
|
* ];
|
|
*
|
|
* _.filter(users, function(o) { return !o.active; });
|
|
* // => objects for ['fred']
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.filter(users, { 'age': 36, 'active': true });
|
|
* // => objects for ['barney']
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.filter(users, ['active', false]);
|
|
* // => objects for ['fred']
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.filter(users, 'active');
|
|
* // => objects for ['barney']
|
|
*
|
|
* // Combining several predicates using `_.overEvery` or `_.overSome`.
|
|
* _.filter(users, _.overSome([{ 'age': 36 }, ['age', 40]]));
|
|
* // => objects for ['fred', 'barney']
|
|
*/
|
|
function filter(collection, predicate) {
|
|
var func = isArray(collection) ? arrayFilter : baseFilter;
|
|
return func(collection, getIteratee(predicate, 3));
|
|
}
|
|
|
|
/**
|
|
* Iterates over elements of `collection`, returning the first element
|
|
* `predicate` returns truthy for. The predicate is invoked with three
|
|
* arguments: (value, index|key, collection).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to inspect.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @param {number} [fromIndex=0] The index to search from.
|
|
* @returns {*} Returns the matched element, else `undefined`.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'age': 36, 'active': true },
|
|
* { 'user': 'fred', 'age': 40, 'active': false },
|
|
* { 'user': 'pebbles', 'age': 1, 'active': true }
|
|
* ];
|
|
*
|
|
* _.find(users, function(o) { return o.age < 40; });
|
|
* // => object for 'barney'
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.find(users, { 'age': 1, 'active': true });
|
|
* // => object for 'pebbles'
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.find(users, ['active', false]);
|
|
* // => object for 'fred'
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.find(users, 'active');
|
|
* // => object for 'barney'
|
|
*/
|
|
var find = createFind(findIndex);
|
|
|
|
/**
|
|
* This method is like `_.find` except that it iterates over elements of
|
|
* `collection` from right to left.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.0.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to inspect.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @param {number} [fromIndex=collection.length-1] The index to search from.
|
|
* @returns {*} Returns the matched element, else `undefined`.
|
|
* @example
|
|
*
|
|
* _.findLast([1, 2, 3, 4], function(n) {
|
|
* return n % 2 == 1;
|
|
* });
|
|
* // => 3
|
|
*/
|
|
var findLast = createFind(findLastIndex);
|
|
|
|
/**
|
|
* Creates a flattened array of values by running each element in `collection`
|
|
* thru `iteratee` and flattening the mapped results. The iteratee is invoked
|
|
* with three arguments: (value, index|key, collection).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @returns {Array} Returns the new flattened array.
|
|
* @example
|
|
*
|
|
* function duplicate(n) {
|
|
* return [n, n];
|
|
* }
|
|
*
|
|
* _.flatMap([1, 2], duplicate);
|
|
* // => [1, 1, 2, 2]
|
|
*/
|
|
function flatMap(collection, iteratee) {
|
|
return baseFlatten(map(collection, iteratee), 1);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.flatMap` except that it recursively flattens the
|
|
* mapped results.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.7.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @returns {Array} Returns the new flattened array.
|
|
* @example
|
|
*
|
|
* function duplicate(n) {
|
|
* return [[[n, n]]];
|
|
* }
|
|
*
|
|
* _.flatMapDeep([1, 2], duplicate);
|
|
* // => [1, 1, 2, 2]
|
|
*/
|
|
function flatMapDeep(collection, iteratee) {
|
|
return baseFlatten(map(collection, iteratee), INFINITY);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.flatMap` except that it recursively flattens the
|
|
* mapped results up to `depth` times.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.7.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @param {number} [depth=1] The maximum recursion depth.
|
|
* @returns {Array} Returns the new flattened array.
|
|
* @example
|
|
*
|
|
* function duplicate(n) {
|
|
* return [[[n, n]]];
|
|
* }
|
|
*
|
|
* _.flatMapDepth([1, 2], duplicate, 2);
|
|
* // => [[1, 1], [2, 2]]
|
|
*/
|
|
function flatMapDepth(collection, iteratee, depth) {
|
|
depth = depth === undefined ? 1 : toInteger(depth);
|
|
return baseFlatten(map(collection, iteratee), depth);
|
|
}
|
|
|
|
/**
|
|
* Iterates over elements of `collection` and invokes `iteratee` for each element.
|
|
* The iteratee is invoked with three arguments: (value, index|key, collection).
|
|
* Iteratee functions may exit iteration early by explicitly returning `false`.
|
|
*
|
|
* **Note:** As with other "Collections" methods, objects with a "length"
|
|
* property are iterated like arrays. To avoid this behavior use `_.forIn`
|
|
* or `_.forOwn` for object iteration.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @alias each
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @returns {Array|Object} Returns `collection`.
|
|
* @see _.forEachRight
|
|
* @example
|
|
*
|
|
* _.forEach([1, 2], function(value) {
|
|
* console.log(value);
|
|
* });
|
|
* // => Logs `1` then `2`.
|
|
*
|
|
* _.forEach({ 'a': 1, 'b': 2 }, function(value, key) {
|
|
* console.log(key);
|
|
* });
|
|
* // => Logs 'a' then 'b' (iteration order is not guaranteed).
|
|
*/
|
|
function forEach(collection, iteratee) {
|
|
var func = isArray(collection) ? arrayEach : baseEach;
|
|
return func(collection, getIteratee(iteratee, 3));
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.forEach` except that it iterates over elements of
|
|
* `collection` from right to left.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.0.0
|
|
* @alias eachRight
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @returns {Array|Object} Returns `collection`.
|
|
* @see _.forEach
|
|
* @example
|
|
*
|
|
* _.forEachRight([1, 2], function(value) {
|
|
* console.log(value);
|
|
* });
|
|
* // => Logs `2` then `1`.
|
|
*/
|
|
function forEachRight(collection, iteratee) {
|
|
var func = isArray(collection) ? arrayEachRight : baseEachRight;
|
|
return func(collection, getIteratee(iteratee, 3));
|
|
}
|
|
|
|
/**
|
|
* Creates an object composed of keys generated from the results of running
|
|
* each element of `collection` thru `iteratee`. The order of grouped values
|
|
* is determined by the order they occur in `collection`. The corresponding
|
|
* value of each key is an array of elements responsible for generating the
|
|
* key. The iteratee is invoked with one argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The iteratee to transform keys.
|
|
* @returns {Object} Returns the composed aggregate object.
|
|
* @example
|
|
*
|
|
* _.groupBy([6.1, 4.2, 6.3], Math.floor);
|
|
* // => { '4': [4.2], '6': [6.1, 6.3] }
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.groupBy(['one', 'two', 'three'], 'length');
|
|
* // => { '3': ['one', 'two'], '5': ['three'] }
|
|
*/
|
|
var groupBy = createAggregator(function(result, value, key) {
|
|
if (hasOwnProperty.call(result, key)) {
|
|
result[key].push(value);
|
|
} else {
|
|
baseAssignValue(result, key, [value]);
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Checks if `value` is in `collection`. If `collection` is a string, it's
|
|
* checked for a substring of `value`, otherwise
|
|
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
|
|
* is used for equality comparisons. If `fromIndex` is negative, it's used as
|
|
* the offset from the end of `collection`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object|string} collection The collection to inspect.
|
|
* @param {*} value The value to search for.
|
|
* @param {number} [fromIndex=0] The index to search from.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.
|
|
* @returns {boolean} Returns `true` if `value` is found, else `false`.
|
|
* @example
|
|
*
|
|
* _.includes([1, 2, 3], 1);
|
|
* // => true
|
|
*
|
|
* _.includes([1, 2, 3], 1, 2);
|
|
* // => false
|
|
*
|
|
* _.includes({ 'a': 1, 'b': 2 }, 1);
|
|
* // => true
|
|
*
|
|
* _.includes('abcd', 'bc');
|
|
* // => true
|
|
*/
|
|
function includes(collection, value, fromIndex, guard) {
|
|
collection = isArrayLike(collection) ? collection : values(collection);
|
|
fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0;
|
|
|
|
var length = collection.length;
|
|
if (fromIndex < 0) {
|
|
fromIndex = nativeMax(length + fromIndex, 0);
|
|
}
|
|
return isString(collection)
|
|
? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1)
|
|
: (!!length && baseIndexOf(collection, value, fromIndex) > -1);
|
|
}
|
|
|
|
/**
|
|
* Invokes the method at `path` of each element in `collection`, returning
|
|
* an array of the results of each invoked method. Any additional arguments
|
|
* are provided to each invoked method. If `path` is a function, it's invoked
|
|
* for, and `this` bound to, each element in `collection`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Array|Function|string} path The path of the method to invoke or
|
|
* the function invoked per iteration.
|
|
* @param {...*} [args] The arguments to invoke each method with.
|
|
* @returns {Array} Returns the array of results.
|
|
* @example
|
|
*
|
|
* _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort');
|
|
* // => [[1, 5, 7], [1, 2, 3]]
|
|
*
|
|
* _.invokeMap([123, 456], String.prototype.split, '');
|
|
* // => [['1', '2', '3'], ['4', '5', '6']]
|
|
*/
|
|
var invokeMap = baseRest(function(collection, path, args) {
|
|
var index = -1,
|
|
isFunc = typeof path == 'function',
|
|
result = isArrayLike(collection) ? Array(collection.length) : [];
|
|
|
|
baseEach(collection, function(value) {
|
|
result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args);
|
|
});
|
|
return result;
|
|
});
|
|
|
|
/**
|
|
* Creates an object composed of keys generated from the results of running
|
|
* each element of `collection` thru `iteratee`. The corresponding value of
|
|
* each key is the last element responsible for generating the key. The
|
|
* iteratee is invoked with one argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The iteratee to transform keys.
|
|
* @returns {Object} Returns the composed aggregate object.
|
|
* @example
|
|
*
|
|
* var array = [
|
|
* { 'dir': 'left', 'code': 97 },
|
|
* { 'dir': 'right', 'code': 100 }
|
|
* ];
|
|
*
|
|
* _.keyBy(array, function(o) {
|
|
* return String.fromCharCode(o.code);
|
|
* });
|
|
* // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } }
|
|
*
|
|
* _.keyBy(array, 'dir');
|
|
* // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } }
|
|
*/
|
|
var keyBy = createAggregator(function(result, value, key) {
|
|
baseAssignValue(result, key, value);
|
|
});
|
|
|
|
/**
|
|
* Creates an array of values by running each element in `collection` thru
|
|
* `iteratee`. The iteratee is invoked with three arguments:
|
|
* (value, index|key, collection).
|
|
*
|
|
* Many lodash methods are guarded to work as iteratees for methods like
|
|
* `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`.
|
|
*
|
|
* The guarded methods are:
|
|
* `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`,
|
|
* `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`,
|
|
* `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`,
|
|
* `template`, `trim`, `trimEnd`, `trimStart`, and `words`
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @returns {Array} Returns the new mapped array.
|
|
* @example
|
|
*
|
|
* function square(n) {
|
|
* return n * n;
|
|
* }
|
|
*
|
|
* _.map([4, 8], square);
|
|
* // => [16, 64]
|
|
*
|
|
* _.map({ 'a': 4, 'b': 8 }, square);
|
|
* // => [16, 64] (iteration order is not guaranteed)
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney' },
|
|
* { 'user': 'fred' }
|
|
* ];
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.map(users, 'user');
|
|
* // => ['barney', 'fred']
|
|
*/
|
|
function map(collection, iteratee) {
|
|
var func = isArray(collection) ? arrayMap : baseMap;
|
|
return func(collection, getIteratee(iteratee, 3));
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.sortBy` except that it allows specifying the sort
|
|
* orders of the iteratees to sort by. If `orders` is unspecified, all values
|
|
* are sorted in ascending order. Otherwise, specify an order of "desc" for
|
|
* descending or "asc" for ascending sort order of corresponding values.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]]
|
|
* The iteratees to sort by.
|
|
* @param {string[]} [orders] The sort orders of `iteratees`.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.
|
|
* @returns {Array} Returns the new sorted array.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'fred', 'age': 48 },
|
|
* { 'user': 'barney', 'age': 34 },
|
|
* { 'user': 'fred', 'age': 40 },
|
|
* { 'user': 'barney', 'age': 36 }
|
|
* ];
|
|
*
|
|
* // Sort by `user` in ascending order and by `age` in descending order.
|
|
* _.orderBy(users, ['user', 'age'], ['asc', 'desc']);
|
|
* // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]
|
|
*/
|
|
function orderBy(collection, iteratees, orders, guard) {
|
|
if (collection == null) {
|
|
return [];
|
|
}
|
|
if (!isArray(iteratees)) {
|
|
iteratees = iteratees == null ? [] : [iteratees];
|
|
}
|
|
orders = guard ? undefined : orders;
|
|
if (!isArray(orders)) {
|
|
orders = orders == null ? [] : [orders];
|
|
}
|
|
return baseOrderBy(collection, iteratees, orders);
|
|
}
|
|
|
|
/**
|
|
* Creates an array of elements split into two groups, the first of which
|
|
* contains elements `predicate` returns truthy for, the second of which
|
|
* contains elements `predicate` returns falsey for. The predicate is
|
|
* invoked with one argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @returns {Array} Returns the array of grouped elements.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'age': 36, 'active': false },
|
|
* { 'user': 'fred', 'age': 40, 'active': true },
|
|
* { 'user': 'pebbles', 'age': 1, 'active': false }
|
|
* ];
|
|
*
|
|
* _.partition(users, function(o) { return o.active; });
|
|
* // => objects for [['fred'], ['barney', 'pebbles']]
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.partition(users, { 'age': 1, 'active': false });
|
|
* // => objects for [['pebbles'], ['barney', 'fred']]
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.partition(users, ['active', false]);
|
|
* // => objects for [['barney', 'pebbles'], ['fred']]
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.partition(users, 'active');
|
|
* // => objects for [['fred'], ['barney', 'pebbles']]
|
|
*/
|
|
var partition = createAggregator(function(result, value, key) {
|
|
result[key ? 0 : 1].push(value);
|
|
}, function() { return [[], []]; });
|
|
|
|
/**
|
|
* Reduces `collection` to a value which is the accumulated result of running
|
|
* each element in `collection` thru `iteratee`, where each successive
|
|
* invocation is supplied the return value of the previous. If `accumulator`
|
|
* is not given, the first element of `collection` is used as the initial
|
|
* value. The iteratee is invoked with four arguments:
|
|
* (accumulator, value, index|key, collection).
|
|
*
|
|
* Many lodash methods are guarded to work as iteratees for methods like
|
|
* `_.reduce`, `_.reduceRight`, and `_.transform`.
|
|
*
|
|
* The guarded methods are:
|
|
* `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`,
|
|
* and `sortBy`
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @param {*} [accumulator] The initial value.
|
|
* @returns {*} Returns the accumulated value.
|
|
* @see _.reduceRight
|
|
* @example
|
|
*
|
|
* _.reduce([1, 2], function(sum, n) {
|
|
* return sum + n;
|
|
* }, 0);
|
|
* // => 3
|
|
*
|
|
* _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {
|
|
* (result[value] || (result[value] = [])).push(key);
|
|
* return result;
|
|
* }, {});
|
|
* // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed)
|
|
*/
|
|
function reduce(collection, iteratee, accumulator) {
|
|
var func = isArray(collection) ? arrayReduce : baseReduce,
|
|
initAccum = arguments.length < 3;
|
|
|
|
return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.reduce` except that it iterates over elements of
|
|
* `collection` from right to left.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @param {*} [accumulator] The initial value.
|
|
* @returns {*} Returns the accumulated value.
|
|
* @see _.reduce
|
|
* @example
|
|
*
|
|
* var array = [[0, 1], [2, 3], [4, 5]];
|
|
*
|
|
* _.reduceRight(array, function(flattened, other) {
|
|
* return flattened.concat(other);
|
|
* }, []);
|
|
* // => [4, 5, 2, 3, 0, 1]
|
|
*/
|
|
function reduceRight(collection, iteratee, accumulator) {
|
|
var func = isArray(collection) ? arrayReduceRight : baseReduce,
|
|
initAccum = arguments.length < 3;
|
|
|
|
return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight);
|
|
}
|
|
|
|
/**
|
|
* The opposite of `_.filter`; this method returns the elements of `collection`
|
|
* that `predicate` does **not** return truthy for.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @returns {Array} Returns the new filtered array.
|
|
* @see _.filter
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'age': 36, 'active': false },
|
|
* { 'user': 'fred', 'age': 40, 'active': true }
|
|
* ];
|
|
*
|
|
* _.reject(users, function(o) { return !o.active; });
|
|
* // => objects for ['fred']
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.reject(users, { 'age': 40, 'active': true });
|
|
* // => objects for ['barney']
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.reject(users, ['active', false]);
|
|
* // => objects for ['fred']
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.reject(users, 'active');
|
|
* // => objects for ['barney']
|
|
*/
|
|
function reject(collection, predicate) {
|
|
var func = isArray(collection) ? arrayFilter : baseFilter;
|
|
return func(collection, negate(getIteratee(predicate, 3)));
|
|
}
|
|
|
|
/**
|
|
* Gets a random element from `collection`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.0.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to sample.
|
|
* @returns {*} Returns the random element.
|
|
* @example
|
|
*
|
|
* _.sample([1, 2, 3, 4]);
|
|
* // => 2
|
|
*/
|
|
function sample(collection) {
|
|
var func = isArray(collection) ? arraySample : baseSample;
|
|
return func(collection);
|
|
}
|
|
|
|
/**
|
|
* Gets `n` random elements at unique keys from `collection` up to the
|
|
* size of `collection`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to sample.
|
|
* @param {number} [n=1] The number of elements to sample.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {Array} Returns the random elements.
|
|
* @example
|
|
*
|
|
* _.sampleSize([1, 2, 3], 2);
|
|
* // => [3, 1]
|
|
*
|
|
* _.sampleSize([1, 2, 3], 4);
|
|
* // => [2, 3, 1]
|
|
*/
|
|
function sampleSize(collection, n, guard) {
|
|
if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) {
|
|
n = 1;
|
|
} else {
|
|
n = toInteger(n);
|
|
}
|
|
var func = isArray(collection) ? arraySampleSize : baseSampleSize;
|
|
return func(collection, n);
|
|
}
|
|
|
|
/**
|
|
* Creates an array of shuffled values, using a version of the
|
|
* [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to shuffle.
|
|
* @returns {Array} Returns the new shuffled array.
|
|
* @example
|
|
*
|
|
* _.shuffle([1, 2, 3, 4]);
|
|
* // => [4, 1, 3, 2]
|
|
*/
|
|
function shuffle(collection) {
|
|
var func = isArray(collection) ? arrayShuffle : baseShuffle;
|
|
return func(collection);
|
|
}
|
|
|
|
/**
|
|
* Gets the size of `collection` by returning its length for array-like
|
|
* values or the number of own enumerable string keyed properties for objects.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object|string} collection The collection to inspect.
|
|
* @returns {number} Returns the collection size.
|
|
* @example
|
|
*
|
|
* _.size([1, 2, 3]);
|
|
* // => 3
|
|
*
|
|
* _.size({ 'a': 1, 'b': 2 });
|
|
* // => 2
|
|
*
|
|
* _.size('pebbles');
|
|
* // => 7
|
|
*/
|
|
function size(collection) {
|
|
if (collection == null) {
|
|
return 0;
|
|
}
|
|
if (isArrayLike(collection)) {
|
|
return isString(collection) ? stringSize(collection) : collection.length;
|
|
}
|
|
var tag = getTag(collection);
|
|
if (tag == mapTag || tag == setTag) {
|
|
return collection.size;
|
|
}
|
|
return baseKeys(collection).length;
|
|
}
|
|
|
|
/**
|
|
* Checks if `predicate` returns truthy for **any** element of `collection`.
|
|
* Iteration is stopped once `predicate` returns truthy. The predicate is
|
|
* invoked with three arguments: (value, index|key, collection).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {boolean} Returns `true` if any element passes the predicate check,
|
|
* else `false`.
|
|
* @example
|
|
*
|
|
* _.some([null, 0, 'yes', false], Boolean);
|
|
* // => true
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'active': true },
|
|
* { 'user': 'fred', 'active': false }
|
|
* ];
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.some(users, { 'user': 'barney', 'active': false });
|
|
* // => false
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.some(users, ['active', false]);
|
|
* // => true
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.some(users, 'active');
|
|
* // => true
|
|
*/
|
|
function some(collection, predicate, guard) {
|
|
var func = isArray(collection) ? arraySome : baseSome;
|
|
if (guard && isIterateeCall(collection, predicate, guard)) {
|
|
predicate = undefined;
|
|
}
|
|
return func(collection, getIteratee(predicate, 3));
|
|
}
|
|
|
|
/**
|
|
* Creates an array of elements, sorted in ascending order by the results of
|
|
* running each element in a collection thru each iteratee. This method
|
|
* performs a stable sort, that is, it preserves the original sort order of
|
|
* equal elements. The iteratees are invoked with one argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Collection
|
|
* @param {Array|Object} collection The collection to iterate over.
|
|
* @param {...(Function|Function[])} [iteratees=[_.identity]]
|
|
* The iteratees to sort by.
|
|
* @returns {Array} Returns the new sorted array.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'fred', 'age': 48 },
|
|
* { 'user': 'barney', 'age': 36 },
|
|
* { 'user': 'fred', 'age': 30 },
|
|
* { 'user': 'barney', 'age': 34 }
|
|
* ];
|
|
*
|
|
* _.sortBy(users, [function(o) { return o.user; }]);
|
|
* // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 30]]
|
|
*
|
|
* _.sortBy(users, ['user', 'age']);
|
|
* // => objects for [['barney', 34], ['barney', 36], ['fred', 30], ['fred', 48]]
|
|
*/
|
|
var sortBy = baseRest(function(collection, iteratees) {
|
|
if (collection == null) {
|
|
return [];
|
|
}
|
|
var length = iteratees.length;
|
|
if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) {
|
|
iteratees = [];
|
|
} else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) {
|
|
iteratees = [iteratees[0]];
|
|
}
|
|
return baseOrderBy(collection, baseFlatten(iteratees, 1), []);
|
|
});
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Gets the timestamp of the number of milliseconds that have elapsed since
|
|
* the Unix epoch (1 January 1970 00:00:00 UTC).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.4.0
|
|
* @category Date
|
|
* @returns {number} Returns the timestamp.
|
|
* @example
|
|
*
|
|
* _.defer(function(stamp) {
|
|
* console.log(_.now() - stamp);
|
|
* }, _.now());
|
|
* // => Logs the number of milliseconds it took for the deferred invocation.
|
|
*/
|
|
var now = ctxNow || function() {
|
|
return root.Date.now();
|
|
};
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* The opposite of `_.before`; this method creates a function that invokes
|
|
* `func` once it's called `n` or more times.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Function
|
|
* @param {number} n The number of calls before `func` is invoked.
|
|
* @param {Function} func The function to restrict.
|
|
* @returns {Function} Returns the new restricted function.
|
|
* @example
|
|
*
|
|
* var saves = ['profile', 'settings'];
|
|
*
|
|
* var done = _.after(saves.length, function() {
|
|
* console.log('done saving!');
|
|
* });
|
|
*
|
|
* _.forEach(saves, function(type) {
|
|
* asyncSave({ 'type': type, 'complete': done });
|
|
* });
|
|
* // => Logs 'done saving!' after the two async saves have completed.
|
|
*/
|
|
function after(n, func) {
|
|
if (typeof func != 'function') {
|
|
throw new TypeError(FUNC_ERROR_TEXT);
|
|
}
|
|
n = toInteger(n);
|
|
return function() {
|
|
if (--n < 1) {
|
|
return func.apply(this, arguments);
|
|
}
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function that invokes `func`, with up to `n` arguments,
|
|
* ignoring any additional arguments.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Function
|
|
* @param {Function} func The function to cap arguments for.
|
|
* @param {number} [n=func.length] The arity cap.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {Function} Returns the new capped function.
|
|
* @example
|
|
*
|
|
* _.map(['6', '8', '10'], _.ary(parseInt, 1));
|
|
* // => [6, 8, 10]
|
|
*/
|
|
function ary(func, n, guard) {
|
|
n = guard ? undefined : n;
|
|
n = (func && n == null) ? func.length : n;
|
|
return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n);
|
|
}
|
|
|
|
/**
|
|
* Creates a function that invokes `func`, with the `this` binding and arguments
|
|
* of the created function, while it's called less than `n` times. Subsequent
|
|
* calls to the created function return the result of the last `func` invocation.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Function
|
|
* @param {number} n The number of calls at which `func` is no longer invoked.
|
|
* @param {Function} func The function to restrict.
|
|
* @returns {Function} Returns the new restricted function.
|
|
* @example
|
|
*
|
|
* jQuery(element).on('click', _.before(5, addContactToList));
|
|
* // => Allows adding up to 4 contacts to the list.
|
|
*/
|
|
function before(n, func) {
|
|
var result;
|
|
if (typeof func != 'function') {
|
|
throw new TypeError(FUNC_ERROR_TEXT);
|
|
}
|
|
n = toInteger(n);
|
|
return function() {
|
|
if (--n > 0) {
|
|
result = func.apply(this, arguments);
|
|
}
|
|
if (n <= 1) {
|
|
func = undefined;
|
|
}
|
|
return result;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function that invokes `func` with the `this` binding of `thisArg`
|
|
* and `partials` prepended to the arguments it receives.
|
|
*
|
|
* The `_.bind.placeholder` value, which defaults to `_` in monolithic builds,
|
|
* may be used as a placeholder for partially applied arguments.
|
|
*
|
|
* **Note:** Unlike native `Function#bind`, this method doesn't set the "length"
|
|
* property of bound functions.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Function
|
|
* @param {Function} func The function to bind.
|
|
* @param {*} thisArg The `this` binding of `func`.
|
|
* @param {...*} [partials] The arguments to be partially applied.
|
|
* @returns {Function} Returns the new bound function.
|
|
* @example
|
|
*
|
|
* function greet(greeting, punctuation) {
|
|
* return greeting + ' ' + this.user + punctuation;
|
|
* }
|
|
*
|
|
* var object = { 'user': 'fred' };
|
|
*
|
|
* var bound = _.bind(greet, object, 'hi');
|
|
* bound('!');
|
|
* // => 'hi fred!'
|
|
*
|
|
* // Bound with placeholders.
|
|
* var bound = _.bind(greet, object, _, '!');
|
|
* bound('hi');
|
|
* // => 'hi fred!'
|
|
*/
|
|
var bind = baseRest(function(func, thisArg, partials) {
|
|
var bitmask = WRAP_BIND_FLAG;
|
|
if (partials.length) {
|
|
var holders = replaceHolders(partials, getHolder(bind));
|
|
bitmask |= WRAP_PARTIAL_FLAG;
|
|
}
|
|
return createWrap(func, bitmask, thisArg, partials, holders);
|
|
});
|
|
|
|
/**
|
|
* Creates a function that invokes the method at `object[key]` with `partials`
|
|
* prepended to the arguments it receives.
|
|
*
|
|
* This method differs from `_.bind` by allowing bound functions to reference
|
|
* methods that may be redefined or don't yet exist. See
|
|
* [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern)
|
|
* for more details.
|
|
*
|
|
* The `_.bindKey.placeholder` value, which defaults to `_` in monolithic
|
|
* builds, may be used as a placeholder for partially applied arguments.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.10.0
|
|
* @category Function
|
|
* @param {Object} object The object to invoke the method on.
|
|
* @param {string} key The key of the method.
|
|
* @param {...*} [partials] The arguments to be partially applied.
|
|
* @returns {Function} Returns the new bound function.
|
|
* @example
|
|
*
|
|
* var object = {
|
|
* 'user': 'fred',
|
|
* 'greet': function(greeting, punctuation) {
|
|
* return greeting + ' ' + this.user + punctuation;
|
|
* }
|
|
* };
|
|
*
|
|
* var bound = _.bindKey(object, 'greet', 'hi');
|
|
* bound('!');
|
|
* // => 'hi fred!'
|
|
*
|
|
* object.greet = function(greeting, punctuation) {
|
|
* return greeting + 'ya ' + this.user + punctuation;
|
|
* };
|
|
*
|
|
* bound('!');
|
|
* // => 'hiya fred!'
|
|
*
|
|
* // Bound with placeholders.
|
|
* var bound = _.bindKey(object, 'greet', _, '!');
|
|
* bound('hi');
|
|
* // => 'hiya fred!'
|
|
*/
|
|
var bindKey = baseRest(function(object, key, partials) {
|
|
var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG;
|
|
if (partials.length) {
|
|
var holders = replaceHolders(partials, getHolder(bindKey));
|
|
bitmask |= WRAP_PARTIAL_FLAG;
|
|
}
|
|
return createWrap(key, bitmask, object, partials, holders);
|
|
});
|
|
|
|
/**
|
|
* Creates a function that accepts arguments of `func` and either invokes
|
|
* `func` returning its result, if at least `arity` number of arguments have
|
|
* been provided, or returns a function that accepts the remaining `func`
|
|
* arguments, and so on. The arity of `func` may be specified if `func.length`
|
|
* is not sufficient.
|
|
*
|
|
* The `_.curry.placeholder` value, which defaults to `_` in monolithic builds,
|
|
* may be used as a placeholder for provided arguments.
|
|
*
|
|
* **Note:** This method doesn't set the "length" property of curried functions.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.0.0
|
|
* @category Function
|
|
* @param {Function} func The function to curry.
|
|
* @param {number} [arity=func.length] The arity of `func`.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {Function} Returns the new curried function.
|
|
* @example
|
|
*
|
|
* var abc = function(a, b, c) {
|
|
* return [a, b, c];
|
|
* };
|
|
*
|
|
* var curried = _.curry(abc);
|
|
*
|
|
* curried(1)(2)(3);
|
|
* // => [1, 2, 3]
|
|
*
|
|
* curried(1, 2)(3);
|
|
* // => [1, 2, 3]
|
|
*
|
|
* curried(1, 2, 3);
|
|
* // => [1, 2, 3]
|
|
*
|
|
* // Curried with placeholders.
|
|
* curried(1)(_, 3)(2);
|
|
* // => [1, 2, 3]
|
|
*/
|
|
function curry(func, arity, guard) {
|
|
arity = guard ? undefined : arity;
|
|
var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity);
|
|
result.placeholder = curry.placeholder;
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.curry` except that arguments are applied to `func`
|
|
* in the manner of `_.partialRight` instead of `_.partial`.
|
|
*
|
|
* The `_.curryRight.placeholder` value, which defaults to `_` in monolithic
|
|
* builds, may be used as a placeholder for provided arguments.
|
|
*
|
|
* **Note:** This method doesn't set the "length" property of curried functions.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Function
|
|
* @param {Function} func The function to curry.
|
|
* @param {number} [arity=func.length] The arity of `func`.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {Function} Returns the new curried function.
|
|
* @example
|
|
*
|
|
* var abc = function(a, b, c) {
|
|
* return [a, b, c];
|
|
* };
|
|
*
|
|
* var curried = _.curryRight(abc);
|
|
*
|
|
* curried(3)(2)(1);
|
|
* // => [1, 2, 3]
|
|
*
|
|
* curried(2, 3)(1);
|
|
* // => [1, 2, 3]
|
|
*
|
|
* curried(1, 2, 3);
|
|
* // => [1, 2, 3]
|
|
*
|
|
* // Curried with placeholders.
|
|
* curried(3)(1, _)(2);
|
|
* // => [1, 2, 3]
|
|
*/
|
|
function curryRight(func, arity, guard) {
|
|
arity = guard ? undefined : arity;
|
|
var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity);
|
|
result.placeholder = curryRight.placeholder;
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Creates a debounced function that delays invoking `func` until after `wait`
|
|
* milliseconds have elapsed since the last time the debounced function was
|
|
* invoked. The debounced function comes with a `cancel` method to cancel
|
|
* delayed `func` invocations and a `flush` method to immediately invoke them.
|
|
* Provide `options` to indicate whether `func` should be invoked on the
|
|
* leading and/or trailing edge of the `wait` timeout. The `func` is invoked
|
|
* with the last arguments provided to the debounced function. Subsequent
|
|
* calls to the debounced function return the result of the last `func`
|
|
* invocation.
|
|
*
|
|
* **Note:** If `leading` and `trailing` options are `true`, `func` is
|
|
* invoked on the trailing edge of the timeout only if the debounced function
|
|
* is invoked more than once during the `wait` timeout.
|
|
*
|
|
* If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
|
|
* until to the next tick, similar to `setTimeout` with a timeout of `0`.
|
|
*
|
|
* See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
|
|
* for details over the differences between `_.debounce` and `_.throttle`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Function
|
|
* @param {Function} func The function to debounce.
|
|
* @param {number} [wait=0] The number of milliseconds to delay.
|
|
* @param {Object} [options={}] The options object.
|
|
* @param {boolean} [options.leading=false]
|
|
* Specify invoking on the leading edge of the timeout.
|
|
* @param {number} [options.maxWait]
|
|
* The maximum time `func` is allowed to be delayed before it's invoked.
|
|
* @param {boolean} [options.trailing=true]
|
|
* Specify invoking on the trailing edge of the timeout.
|
|
* @returns {Function} Returns the new debounced function.
|
|
* @example
|
|
*
|
|
* // Avoid costly calculations while the window size is in flux.
|
|
* jQuery(window).on('resize', _.debounce(calculateLayout, 150));
|
|
*
|
|
* // Invoke `sendMail` when clicked, debouncing subsequent calls.
|
|
* jQuery(element).on('click', _.debounce(sendMail, 300, {
|
|
* 'leading': true,
|
|
* 'trailing': false
|
|
* }));
|
|
*
|
|
* // Ensure `batchLog` is invoked once after 1 second of debounced calls.
|
|
* var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });
|
|
* var source = new EventSource('/stream');
|
|
* jQuery(source).on('message', debounced);
|
|
*
|
|
* // Cancel the trailing debounced invocation.
|
|
* jQuery(window).on('popstate', debounced.cancel);
|
|
*/
|
|
function debounce(func, wait, options) {
|
|
var lastArgs,
|
|
lastThis,
|
|
maxWait,
|
|
result,
|
|
timerId,
|
|
lastCallTime,
|
|
lastInvokeTime = 0,
|
|
leading = false,
|
|
maxing = false,
|
|
trailing = true;
|
|
|
|
if (typeof func != 'function') {
|
|
throw new TypeError(FUNC_ERROR_TEXT);
|
|
}
|
|
wait = toNumber(wait) || 0;
|
|
if (isObject(options)) {
|
|
leading = !!options.leading;
|
|
maxing = 'maxWait' in options;
|
|
maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;
|
|
trailing = 'trailing' in options ? !!options.trailing : trailing;
|
|
}
|
|
|
|
function invokeFunc(time) {
|
|
var args = lastArgs,
|
|
thisArg = lastThis;
|
|
|
|
lastArgs = lastThis = undefined;
|
|
lastInvokeTime = time;
|
|
result = func.apply(thisArg, args);
|
|
return result;
|
|
}
|
|
|
|
function leadingEdge(time) {
|
|
// Reset any `maxWait` timer.
|
|
lastInvokeTime = time;
|
|
// Start the timer for the trailing edge.
|
|
timerId = setTimeout(timerExpired, wait);
|
|
// Invoke the leading edge.
|
|
return leading ? invokeFunc(time) : result;
|
|
}
|
|
|
|
function remainingWait(time) {
|
|
var timeSinceLastCall = time - lastCallTime,
|
|
timeSinceLastInvoke = time - lastInvokeTime,
|
|
timeWaiting = wait - timeSinceLastCall;
|
|
|
|
return maxing
|
|
? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke)
|
|
: timeWaiting;
|
|
}
|
|
|
|
function shouldInvoke(time) {
|
|
var timeSinceLastCall = time - lastCallTime,
|
|
timeSinceLastInvoke = time - lastInvokeTime;
|
|
|
|
// Either this is the first call, activity has stopped and we're at the
|
|
// trailing edge, the system time has gone backwards and we're treating
|
|
// it as the trailing edge, or we've hit the `maxWait` limit.
|
|
return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||
|
|
(timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));
|
|
}
|
|
|
|
function timerExpired() {
|
|
var time = now();
|
|
if (shouldInvoke(time)) {
|
|
return trailingEdge(time);
|
|
}
|
|
// Restart the timer.
|
|
timerId = setTimeout(timerExpired, remainingWait(time));
|
|
}
|
|
|
|
function trailingEdge(time) {
|
|
timerId = undefined;
|
|
|
|
// Only invoke if we have `lastArgs` which means `func` has been
|
|
// debounced at least once.
|
|
if (trailing && lastArgs) {
|
|
return invokeFunc(time);
|
|
}
|
|
lastArgs = lastThis = undefined;
|
|
return result;
|
|
}
|
|
|
|
function cancel() {
|
|
if (timerId !== undefined) {
|
|
clearTimeout(timerId);
|
|
}
|
|
lastInvokeTime = 0;
|
|
lastArgs = lastCallTime = lastThis = timerId = undefined;
|
|
}
|
|
|
|
function flush() {
|
|
return timerId === undefined ? result : trailingEdge(now());
|
|
}
|
|
|
|
function debounced() {
|
|
var time = now(),
|
|
isInvoking = shouldInvoke(time);
|
|
|
|
lastArgs = arguments;
|
|
lastThis = this;
|
|
lastCallTime = time;
|
|
|
|
if (isInvoking) {
|
|
if (timerId === undefined) {
|
|
return leadingEdge(lastCallTime);
|
|
}
|
|
if (maxing) {
|
|
// Handle invocations in a tight loop.
|
|
clearTimeout(timerId);
|
|
timerId = setTimeout(timerExpired, wait);
|
|
return invokeFunc(lastCallTime);
|
|
}
|
|
}
|
|
if (timerId === undefined) {
|
|
timerId = setTimeout(timerExpired, wait);
|
|
}
|
|
return result;
|
|
}
|
|
debounced.cancel = cancel;
|
|
debounced.flush = flush;
|
|
return debounced;
|
|
}
|
|
|
|
/**
|
|
* Defers invoking the `func` until the current call stack has cleared. Any
|
|
* additional arguments are provided to `func` when it's invoked.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Function
|
|
* @param {Function} func The function to defer.
|
|
* @param {...*} [args] The arguments to invoke `func` with.
|
|
* @returns {number} Returns the timer id.
|
|
* @example
|
|
*
|
|
* _.defer(function(text) {
|
|
* console.log(text);
|
|
* }, 'deferred');
|
|
* // => Logs 'deferred' after one millisecond.
|
|
*/
|
|
var defer = baseRest(function(func, args) {
|
|
return baseDelay(func, 1, args);
|
|
});
|
|
|
|
/**
|
|
* Invokes `func` after `wait` milliseconds. Any additional arguments are
|
|
* provided to `func` when it's invoked.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Function
|
|
* @param {Function} func The function to delay.
|
|
* @param {number} wait The number of milliseconds to delay invocation.
|
|
* @param {...*} [args] The arguments to invoke `func` with.
|
|
* @returns {number} Returns the timer id.
|
|
* @example
|
|
*
|
|
* _.delay(function(text) {
|
|
* console.log(text);
|
|
* }, 1000, 'later');
|
|
* // => Logs 'later' after one second.
|
|
*/
|
|
var delay = baseRest(function(func, wait, args) {
|
|
return baseDelay(func, toNumber(wait) || 0, args);
|
|
});
|
|
|
|
/**
|
|
* Creates a function that invokes `func` with arguments reversed.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Function
|
|
* @param {Function} func The function to flip arguments for.
|
|
* @returns {Function} Returns the new flipped function.
|
|
* @example
|
|
*
|
|
* var flipped = _.flip(function() {
|
|
* return _.toArray(arguments);
|
|
* });
|
|
*
|
|
* flipped('a', 'b', 'c', 'd');
|
|
* // => ['d', 'c', 'b', 'a']
|
|
*/
|
|
function flip(func) {
|
|
return createWrap(func, WRAP_FLIP_FLAG);
|
|
}
|
|
|
|
/**
|
|
* Creates a function that memoizes the result of `func`. If `resolver` is
|
|
* provided, it determines the cache key for storing the result based on the
|
|
* arguments provided to the memoized function. By default, the first argument
|
|
* provided to the memoized function is used as the map cache key. The `func`
|
|
* is invoked with the `this` binding of the memoized function.
|
|
*
|
|
* **Note:** The cache is exposed as the `cache` property on the memoized
|
|
* function. Its creation may be customized by replacing the `_.memoize.Cache`
|
|
* constructor with one whose instances implement the
|
|
* [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)
|
|
* method interface of `clear`, `delete`, `get`, `has`, and `set`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Function
|
|
* @param {Function} func The function to have its output memoized.
|
|
* @param {Function} [resolver] The function to resolve the cache key.
|
|
* @returns {Function} Returns the new memoized function.
|
|
* @example
|
|
*
|
|
* var object = { 'a': 1, 'b': 2 };
|
|
* var other = { 'c': 3, 'd': 4 };
|
|
*
|
|
* var values = _.memoize(_.values);
|
|
* values(object);
|
|
* // => [1, 2]
|
|
*
|
|
* values(other);
|
|
* // => [3, 4]
|
|
*
|
|
* object.a = 2;
|
|
* values(object);
|
|
* // => [1, 2]
|
|
*
|
|
* // Modify the result cache.
|
|
* values.cache.set(object, ['a', 'b']);
|
|
* values(object);
|
|
* // => ['a', 'b']
|
|
*
|
|
* // Replace `_.memoize.Cache`.
|
|
* _.memoize.Cache = WeakMap;
|
|
*/
|
|
function memoize(func, resolver) {
|
|
if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) {
|
|
throw new TypeError(FUNC_ERROR_TEXT);
|
|
}
|
|
var memoized = function() {
|
|
var args = arguments,
|
|
key = resolver ? resolver.apply(this, args) : args[0],
|
|
cache = memoized.cache;
|
|
|
|
if (cache.has(key)) {
|
|
return cache.get(key);
|
|
}
|
|
var result = func.apply(this, args);
|
|
memoized.cache = cache.set(key, result) || cache;
|
|
return result;
|
|
};
|
|
memoized.cache = new (memoize.Cache || MapCache);
|
|
return memoized;
|
|
}
|
|
|
|
// Expose `MapCache`.
|
|
memoize.Cache = MapCache;
|
|
|
|
/**
|
|
* Creates a function that negates the result of the predicate `func`. The
|
|
* `func` predicate is invoked with the `this` binding and arguments of the
|
|
* created function.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Function
|
|
* @param {Function} predicate The predicate to negate.
|
|
* @returns {Function} Returns the new negated function.
|
|
* @example
|
|
*
|
|
* function isEven(n) {
|
|
* return n % 2 == 0;
|
|
* }
|
|
*
|
|
* _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven));
|
|
* // => [1, 3, 5]
|
|
*/
|
|
function negate(predicate) {
|
|
if (typeof predicate != 'function') {
|
|
throw new TypeError(FUNC_ERROR_TEXT);
|
|
}
|
|
return function() {
|
|
var args = arguments;
|
|
switch (args.length) {
|
|
case 0: return !predicate.call(this);
|
|
case 1: return !predicate.call(this, args[0]);
|
|
case 2: return !predicate.call(this, args[0], args[1]);
|
|
case 3: return !predicate.call(this, args[0], args[1], args[2]);
|
|
}
|
|
return !predicate.apply(this, args);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates a function that is restricted to invoking `func` once. Repeat calls
|
|
* to the function return the value of the first invocation. The `func` is
|
|
* invoked with the `this` binding and arguments of the created function.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Function
|
|
* @param {Function} func The function to restrict.
|
|
* @returns {Function} Returns the new restricted function.
|
|
* @example
|
|
*
|
|
* var initialize = _.once(createApplication);
|
|
* initialize();
|
|
* initialize();
|
|
* // => `createApplication` is invoked once
|
|
*/
|
|
function once(func) {
|
|
return before(2, func);
|
|
}
|
|
|
|
/**
|
|
* Creates a function that invokes `func` with its arguments transformed.
|
|
*
|
|
* @static
|
|
* @since 4.0.0
|
|
* @memberOf _
|
|
* @category Function
|
|
* @param {Function} func The function to wrap.
|
|
* @param {...(Function|Function[])} [transforms=[_.identity]]
|
|
* The argument transforms.
|
|
* @returns {Function} Returns the new function.
|
|
* @example
|
|
*
|
|
* function doubled(n) {
|
|
* return n * 2;
|
|
* }
|
|
*
|
|
* function square(n) {
|
|
* return n * n;
|
|
* }
|
|
*
|
|
* var func = _.overArgs(function(x, y) {
|
|
* return [x, y];
|
|
* }, [square, doubled]);
|
|
*
|
|
* func(9, 3);
|
|
* // => [81, 6]
|
|
*
|
|
* func(10, 5);
|
|
* // => [100, 10]
|
|
*/
|
|
var overArgs = castRest(function(func, transforms) {
|
|
transforms = (transforms.length == 1 && isArray(transforms[0]))
|
|
? arrayMap(transforms[0], baseUnary(getIteratee()))
|
|
: arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee()));
|
|
|
|
var funcsLength = transforms.length;
|
|
return baseRest(function(args) {
|
|
var index = -1,
|
|
length = nativeMin(args.length, funcsLength);
|
|
|
|
while (++index < length) {
|
|
args[index] = transforms[index].call(this, args[index]);
|
|
}
|
|
return apply(func, this, args);
|
|
});
|
|
});
|
|
|
|
/**
|
|
* Creates a function that invokes `func` with `partials` prepended to the
|
|
* arguments it receives. This method is like `_.bind` except it does **not**
|
|
* alter the `this` binding.
|
|
*
|
|
* The `_.partial.placeholder` value, which defaults to `_` in monolithic
|
|
* builds, may be used as a placeholder for partially applied arguments.
|
|
*
|
|
* **Note:** This method doesn't set the "length" property of partially
|
|
* applied functions.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.2.0
|
|
* @category Function
|
|
* @param {Function} func The function to partially apply arguments to.
|
|
* @param {...*} [partials] The arguments to be partially applied.
|
|
* @returns {Function} Returns the new partially applied function.
|
|
* @example
|
|
*
|
|
* function greet(greeting, name) {
|
|
* return greeting + ' ' + name;
|
|
* }
|
|
*
|
|
* var sayHelloTo = _.partial(greet, 'hello');
|
|
* sayHelloTo('fred');
|
|
* // => 'hello fred'
|
|
*
|
|
* // Partially applied with placeholders.
|
|
* var greetFred = _.partial(greet, _, 'fred');
|
|
* greetFred('hi');
|
|
* // => 'hi fred'
|
|
*/
|
|
var partial = baseRest(function(func, partials) {
|
|
var holders = replaceHolders(partials, getHolder(partial));
|
|
return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders);
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.partial` except that partially applied arguments
|
|
* are appended to the arguments it receives.
|
|
*
|
|
* The `_.partialRight.placeholder` value, which defaults to `_` in monolithic
|
|
* builds, may be used as a placeholder for partially applied arguments.
|
|
*
|
|
* **Note:** This method doesn't set the "length" property of partially
|
|
* applied functions.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 1.0.0
|
|
* @category Function
|
|
* @param {Function} func The function to partially apply arguments to.
|
|
* @param {...*} [partials] The arguments to be partially applied.
|
|
* @returns {Function} Returns the new partially applied function.
|
|
* @example
|
|
*
|
|
* function greet(greeting, name) {
|
|
* return greeting + ' ' + name;
|
|
* }
|
|
*
|
|
* var greetFred = _.partialRight(greet, 'fred');
|
|
* greetFred('hi');
|
|
* // => 'hi fred'
|
|
*
|
|
* // Partially applied with placeholders.
|
|
* var sayHelloTo = _.partialRight(greet, 'hello', _);
|
|
* sayHelloTo('fred');
|
|
* // => 'hello fred'
|
|
*/
|
|
var partialRight = baseRest(function(func, partials) {
|
|
var holders = replaceHolders(partials, getHolder(partialRight));
|
|
return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders);
|
|
});
|
|
|
|
/**
|
|
* Creates a function that invokes `func` with arguments arranged according
|
|
* to the specified `indexes` where the argument value at the first index is
|
|
* provided as the first argument, the argument value at the second index is
|
|
* provided as the second argument, and so on.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Function
|
|
* @param {Function} func The function to rearrange arguments for.
|
|
* @param {...(number|number[])} indexes The arranged argument indexes.
|
|
* @returns {Function} Returns the new function.
|
|
* @example
|
|
*
|
|
* var rearged = _.rearg(function(a, b, c) {
|
|
* return [a, b, c];
|
|
* }, [2, 0, 1]);
|
|
*
|
|
* rearged('b', 'c', 'a')
|
|
* // => ['a', 'b', 'c']
|
|
*/
|
|
var rearg = flatRest(function(func, indexes) {
|
|
return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes);
|
|
});
|
|
|
|
/**
|
|
* Creates a function that invokes `func` with the `this` binding of the
|
|
* created function and arguments from `start` and beyond provided as
|
|
* an array.
|
|
*
|
|
* **Note:** This method is based on the
|
|
* [rest parameter](https://mdn.io/rest_parameters).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Function
|
|
* @param {Function} func The function to apply a rest parameter to.
|
|
* @param {number} [start=func.length-1] The start position of the rest parameter.
|
|
* @returns {Function} Returns the new function.
|
|
* @example
|
|
*
|
|
* var say = _.rest(function(what, names) {
|
|
* return what + ' ' + _.initial(names).join(', ') +
|
|
* (_.size(names) > 1 ? ', & ' : '') + _.last(names);
|
|
* });
|
|
*
|
|
* say('hello', 'fred', 'barney', 'pebbles');
|
|
* // => 'hello fred, barney, & pebbles'
|
|
*/
|
|
function rest(func, start) {
|
|
if (typeof func != 'function') {
|
|
throw new TypeError(FUNC_ERROR_TEXT);
|
|
}
|
|
start = start === undefined ? start : toInteger(start);
|
|
return baseRest(func, start);
|
|
}
|
|
|
|
/**
|
|
* Creates a function that invokes `func` with the `this` binding of the
|
|
* create function and an array of arguments much like
|
|
* [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply).
|
|
*
|
|
* **Note:** This method is based on the
|
|
* [spread operator](https://mdn.io/spread_operator).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.2.0
|
|
* @category Function
|
|
* @param {Function} func The function to spread arguments over.
|
|
* @param {number} [start=0] The start position of the spread.
|
|
* @returns {Function} Returns the new function.
|
|
* @example
|
|
*
|
|
* var say = _.spread(function(who, what) {
|
|
* return who + ' says ' + what;
|
|
* });
|
|
*
|
|
* say(['fred', 'hello']);
|
|
* // => 'fred says hello'
|
|
*
|
|
* var numbers = Promise.all([
|
|
* Promise.resolve(40),
|
|
* Promise.resolve(36)
|
|
* ]);
|
|
*
|
|
* numbers.then(_.spread(function(x, y) {
|
|
* return x + y;
|
|
* }));
|
|
* // => a Promise of 76
|
|
*/
|
|
function spread(func, start) {
|
|
if (typeof func != 'function') {
|
|
throw new TypeError(FUNC_ERROR_TEXT);
|
|
}
|
|
start = start == null ? 0 : nativeMax(toInteger(start), 0);
|
|
return baseRest(function(args) {
|
|
var array = args[start],
|
|
otherArgs = castSlice(args, 0, start);
|
|
|
|
if (array) {
|
|
arrayPush(otherArgs, array);
|
|
}
|
|
return apply(func, this, otherArgs);
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Creates a throttled function that only invokes `func` at most once per
|
|
* every `wait` milliseconds. The throttled function comes with a `cancel`
|
|
* method to cancel delayed `func` invocations and a `flush` method to
|
|
* immediately invoke them. Provide `options` to indicate whether `func`
|
|
* should be invoked on the leading and/or trailing edge of the `wait`
|
|
* timeout. The `func` is invoked with the last arguments provided to the
|
|
* throttled function. Subsequent calls to the throttled function return the
|
|
* result of the last `func` invocation.
|
|
*
|
|
* **Note:** If `leading` and `trailing` options are `true`, `func` is
|
|
* invoked on the trailing edge of the timeout only if the throttled function
|
|
* is invoked more than once during the `wait` timeout.
|
|
*
|
|
* If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
|
|
* until to the next tick, similar to `setTimeout` with a timeout of `0`.
|
|
*
|
|
* See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
|
|
* for details over the differences between `_.throttle` and `_.debounce`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Function
|
|
* @param {Function} func The function to throttle.
|
|
* @param {number} [wait=0] The number of milliseconds to throttle invocations to.
|
|
* @param {Object} [options={}] The options object.
|
|
* @param {boolean} [options.leading=true]
|
|
* Specify invoking on the leading edge of the timeout.
|
|
* @param {boolean} [options.trailing=true]
|
|
* Specify invoking on the trailing edge of the timeout.
|
|
* @returns {Function} Returns the new throttled function.
|
|
* @example
|
|
*
|
|
* // Avoid excessively updating the position while scrolling.
|
|
* jQuery(window).on('scroll', _.throttle(updatePosition, 100));
|
|
*
|
|
* // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes.
|
|
* var throttled = _.throttle(renewToken, 300000, { 'trailing': false });
|
|
* jQuery(element).on('click', throttled);
|
|
*
|
|
* // Cancel the trailing throttled invocation.
|
|
* jQuery(window).on('popstate', throttled.cancel);
|
|
*/
|
|
function throttle(func, wait, options) {
|
|
var leading = true,
|
|
trailing = true;
|
|
|
|
if (typeof func != 'function') {
|
|
throw new TypeError(FUNC_ERROR_TEXT);
|
|
}
|
|
if (isObject(options)) {
|
|
leading = 'leading' in options ? !!options.leading : leading;
|
|
trailing = 'trailing' in options ? !!options.trailing : trailing;
|
|
}
|
|
return debounce(func, wait, {
|
|
'leading': leading,
|
|
'maxWait': wait,
|
|
'trailing': trailing
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Creates a function that accepts up to one argument, ignoring any
|
|
* additional arguments.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Function
|
|
* @param {Function} func The function to cap arguments for.
|
|
* @returns {Function} Returns the new capped function.
|
|
* @example
|
|
*
|
|
* _.map(['6', '8', '10'], _.unary(parseInt));
|
|
* // => [6, 8, 10]
|
|
*/
|
|
function unary(func) {
|
|
return ary(func, 1);
|
|
}
|
|
|
|
/**
|
|
* Creates a function that provides `value` to `wrapper` as its first
|
|
* argument. Any additional arguments provided to the function are appended
|
|
* to those provided to the `wrapper`. The wrapper is invoked with the `this`
|
|
* binding of the created function.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Function
|
|
* @param {*} value The value to wrap.
|
|
* @param {Function} [wrapper=identity] The wrapper function.
|
|
* @returns {Function} Returns the new function.
|
|
* @example
|
|
*
|
|
* var p = _.wrap(_.escape, function(func, text) {
|
|
* return '<p>' + func(text) + '</p>';
|
|
* });
|
|
*
|
|
* p('fred, barney, & pebbles');
|
|
* // => '<p>fred, barney, & pebbles</p>'
|
|
*/
|
|
function wrap(value, wrapper) {
|
|
return partial(castFunction(wrapper), value);
|
|
}
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Casts `value` as an array if it's not one.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.4.0
|
|
* @category Lang
|
|
* @param {*} value The value to inspect.
|
|
* @returns {Array} Returns the cast array.
|
|
* @example
|
|
*
|
|
* _.castArray(1);
|
|
* // => [1]
|
|
*
|
|
* _.castArray({ 'a': 1 });
|
|
* // => [{ 'a': 1 }]
|
|
*
|
|
* _.castArray('abc');
|
|
* // => ['abc']
|
|
*
|
|
* _.castArray(null);
|
|
* // => [null]
|
|
*
|
|
* _.castArray(undefined);
|
|
* // => [undefined]
|
|
*
|
|
* _.castArray();
|
|
* // => []
|
|
*
|
|
* var array = [1, 2, 3];
|
|
* console.log(_.castArray(array) === array);
|
|
* // => true
|
|
*/
|
|
function castArray() {
|
|
if (!arguments.length) {
|
|
return [];
|
|
}
|
|
var value = arguments[0];
|
|
return isArray(value) ? value : [value];
|
|
}
|
|
|
|
/**
|
|
* Creates a shallow clone of `value`.
|
|
*
|
|
* **Note:** This method is loosely based on the
|
|
* [structured clone algorithm](https://mdn.io/Structured_clone_algorithm)
|
|
* and supports cloning arrays, array buffers, booleans, date objects, maps,
|
|
* numbers, `Object` objects, regexes, sets, strings, symbols, and typed
|
|
* arrays. The own enumerable properties of `arguments` objects are cloned
|
|
* as plain objects. An empty object is returned for uncloneable values such
|
|
* as error objects, functions, DOM nodes, and WeakMaps.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to clone.
|
|
* @returns {*} Returns the cloned value.
|
|
* @see _.cloneDeep
|
|
* @example
|
|
*
|
|
* var objects = [{ 'a': 1 }, { 'b': 2 }];
|
|
*
|
|
* var shallow = _.clone(objects);
|
|
* console.log(shallow[0] === objects[0]);
|
|
* // => true
|
|
*/
|
|
function clone(value) {
|
|
return baseClone(value, CLONE_SYMBOLS_FLAG);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.clone` except that it accepts `customizer` which
|
|
* is invoked to produce the cloned value. If `customizer` returns `undefined`,
|
|
* cloning is handled by the method instead. The `customizer` is invoked with
|
|
* up to four arguments; (value [, index|key, object, stack]).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to clone.
|
|
* @param {Function} [customizer] The function to customize cloning.
|
|
* @returns {*} Returns the cloned value.
|
|
* @see _.cloneDeepWith
|
|
* @example
|
|
*
|
|
* function customizer(value) {
|
|
* if (_.isElement(value)) {
|
|
* return value.cloneNode(false);
|
|
* }
|
|
* }
|
|
*
|
|
* var el = _.cloneWith(document.body, customizer);
|
|
*
|
|
* console.log(el === document.body);
|
|
* // => false
|
|
* console.log(el.nodeName);
|
|
* // => 'BODY'
|
|
* console.log(el.childNodes.length);
|
|
* // => 0
|
|
*/
|
|
function cloneWith(value, customizer) {
|
|
customizer = typeof customizer == 'function' ? customizer : undefined;
|
|
return baseClone(value, CLONE_SYMBOLS_FLAG, customizer);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.clone` except that it recursively clones `value`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 1.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to recursively clone.
|
|
* @returns {*} Returns the deep cloned value.
|
|
* @see _.clone
|
|
* @example
|
|
*
|
|
* var objects = [{ 'a': 1 }, { 'b': 2 }];
|
|
*
|
|
* var deep = _.cloneDeep(objects);
|
|
* console.log(deep[0] === objects[0]);
|
|
* // => false
|
|
*/
|
|
function cloneDeep(value) {
|
|
return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.cloneWith` except that it recursively clones `value`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to recursively clone.
|
|
* @param {Function} [customizer] The function to customize cloning.
|
|
* @returns {*} Returns the deep cloned value.
|
|
* @see _.cloneWith
|
|
* @example
|
|
*
|
|
* function customizer(value) {
|
|
* if (_.isElement(value)) {
|
|
* return value.cloneNode(true);
|
|
* }
|
|
* }
|
|
*
|
|
* var el = _.cloneDeepWith(document.body, customizer);
|
|
*
|
|
* console.log(el === document.body);
|
|
* // => false
|
|
* console.log(el.nodeName);
|
|
* // => 'BODY'
|
|
* console.log(el.childNodes.length);
|
|
* // => 20
|
|
*/
|
|
function cloneDeepWith(value, customizer) {
|
|
customizer = typeof customizer == 'function' ? customizer : undefined;
|
|
return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer);
|
|
}
|
|
|
|
/**
|
|
* Checks if `object` conforms to `source` by invoking the predicate
|
|
* properties of `source` with the corresponding property values of `object`.
|
|
*
|
|
* **Note:** This method is equivalent to `_.conforms` when `source` is
|
|
* partially applied.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.14.0
|
|
* @category Lang
|
|
* @param {Object} object The object to inspect.
|
|
* @param {Object} source The object of property predicates to conform to.
|
|
* @returns {boolean} Returns `true` if `object` conforms, else `false`.
|
|
* @example
|
|
*
|
|
* var object = { 'a': 1, 'b': 2 };
|
|
*
|
|
* _.conformsTo(object, { 'b': function(n) { return n > 1; } });
|
|
* // => true
|
|
*
|
|
* _.conformsTo(object, { 'b': function(n) { return n > 2; } });
|
|
* // => false
|
|
*/
|
|
function conformsTo(object, source) {
|
|
return source == null || baseConformsTo(object, source, keys(source));
|
|
}
|
|
|
|
/**
|
|
* Performs a
|
|
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
|
|
* comparison between two values to determine if they are equivalent.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to compare.
|
|
* @param {*} other The other value to compare.
|
|
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
|
|
* @example
|
|
*
|
|
* var object = { 'a': 1 };
|
|
* var other = { 'a': 1 };
|
|
*
|
|
* _.eq(object, object);
|
|
* // => true
|
|
*
|
|
* _.eq(object, other);
|
|
* // => false
|
|
*
|
|
* _.eq('a', 'a');
|
|
* // => true
|
|
*
|
|
* _.eq('a', Object('a'));
|
|
* // => false
|
|
*
|
|
* _.eq(NaN, NaN);
|
|
* // => true
|
|
*/
|
|
function eq(value, other) {
|
|
return value === other || (value !== value && other !== other);
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is greater than `other`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.9.0
|
|
* @category Lang
|
|
* @param {*} value The value to compare.
|
|
* @param {*} other The other value to compare.
|
|
* @returns {boolean} Returns `true` if `value` is greater than `other`,
|
|
* else `false`.
|
|
* @see _.lt
|
|
* @example
|
|
*
|
|
* _.gt(3, 1);
|
|
* // => true
|
|
*
|
|
* _.gt(3, 3);
|
|
* // => false
|
|
*
|
|
* _.gt(1, 3);
|
|
* // => false
|
|
*/
|
|
var gt = createRelationalOperation(baseGt);
|
|
|
|
/**
|
|
* Checks if `value` is greater than or equal to `other`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.9.0
|
|
* @category Lang
|
|
* @param {*} value The value to compare.
|
|
* @param {*} other The other value to compare.
|
|
* @returns {boolean} Returns `true` if `value` is greater than or equal to
|
|
* `other`, else `false`.
|
|
* @see _.lte
|
|
* @example
|
|
*
|
|
* _.gte(3, 1);
|
|
* // => true
|
|
*
|
|
* _.gte(3, 3);
|
|
* // => true
|
|
*
|
|
* _.gte(1, 3);
|
|
* // => false
|
|
*/
|
|
var gte = createRelationalOperation(function(value, other) {
|
|
return value >= other;
|
|
});
|
|
|
|
/**
|
|
* Checks if `value` is likely an `arguments` object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is an `arguments` object,
|
|
* else `false`.
|
|
* @example
|
|
*
|
|
* _.isArguments(function() { return arguments; }());
|
|
* // => true
|
|
*
|
|
* _.isArguments([1, 2, 3]);
|
|
* // => false
|
|
*/
|
|
var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {
|
|
return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&
|
|
!propertyIsEnumerable.call(value, 'callee');
|
|
};
|
|
|
|
/**
|
|
* Checks if `value` is classified as an `Array` object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is an array, else `false`.
|
|
* @example
|
|
*
|
|
* _.isArray([1, 2, 3]);
|
|
* // => true
|
|
*
|
|
* _.isArray(document.body.children);
|
|
* // => false
|
|
*
|
|
* _.isArray('abc');
|
|
* // => false
|
|
*
|
|
* _.isArray(_.noop);
|
|
* // => false
|
|
*/
|
|
var isArray = Array.isArray;
|
|
|
|
/**
|
|
* Checks if `value` is classified as an `ArrayBuffer` object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.3.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.
|
|
* @example
|
|
*
|
|
* _.isArrayBuffer(new ArrayBuffer(2));
|
|
* // => true
|
|
*
|
|
* _.isArrayBuffer(new Array(2));
|
|
* // => false
|
|
*/
|
|
var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer;
|
|
|
|
/**
|
|
* Checks if `value` is array-like. A value is considered array-like if it's
|
|
* not a function and has a `value.length` that's an integer greater than or
|
|
* equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is array-like, else `false`.
|
|
* @example
|
|
*
|
|
* _.isArrayLike([1, 2, 3]);
|
|
* // => true
|
|
*
|
|
* _.isArrayLike(document.body.children);
|
|
* // => true
|
|
*
|
|
* _.isArrayLike('abc');
|
|
* // => true
|
|
*
|
|
* _.isArrayLike(_.noop);
|
|
* // => false
|
|
*/
|
|
function isArrayLike(value) {
|
|
return value != null && isLength(value.length) && !isFunction(value);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.isArrayLike` except that it also checks if `value`
|
|
* is an object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is an array-like object,
|
|
* else `false`.
|
|
* @example
|
|
*
|
|
* _.isArrayLikeObject([1, 2, 3]);
|
|
* // => true
|
|
*
|
|
* _.isArrayLikeObject(document.body.children);
|
|
* // => true
|
|
*
|
|
* _.isArrayLikeObject('abc');
|
|
* // => false
|
|
*
|
|
* _.isArrayLikeObject(_.noop);
|
|
* // => false
|
|
*/
|
|
function isArrayLikeObject(value) {
|
|
return isObjectLike(value) && isArrayLike(value);
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is classified as a boolean primitive or object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a boolean, else `false`.
|
|
* @example
|
|
*
|
|
* _.isBoolean(false);
|
|
* // => true
|
|
*
|
|
* _.isBoolean(null);
|
|
* // => false
|
|
*/
|
|
function isBoolean(value) {
|
|
return value === true || value === false ||
|
|
(isObjectLike(value) && baseGetTag(value) == boolTag);
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is a buffer.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.3.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a buffer, else `false`.
|
|
* @example
|
|
*
|
|
* _.isBuffer(new Buffer(2));
|
|
* // => true
|
|
*
|
|
* _.isBuffer(new Uint8Array(2));
|
|
* // => false
|
|
*/
|
|
var isBuffer = nativeIsBuffer || stubFalse;
|
|
|
|
/**
|
|
* Checks if `value` is classified as a `Date` object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a date object, else `false`.
|
|
* @example
|
|
*
|
|
* _.isDate(new Date);
|
|
* // => true
|
|
*
|
|
* _.isDate('Mon April 23 2012');
|
|
* // => false
|
|
*/
|
|
var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate;
|
|
|
|
/**
|
|
* Checks if `value` is likely a DOM element.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a DOM element, else `false`.
|
|
* @example
|
|
*
|
|
* _.isElement(document.body);
|
|
* // => true
|
|
*
|
|
* _.isElement('<body>');
|
|
* // => false
|
|
*/
|
|
function isElement(value) {
|
|
return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value);
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is an empty object, collection, map, or set.
|
|
*
|
|
* Objects are considered empty if they have no own enumerable string keyed
|
|
* properties.
|
|
*
|
|
* Array-like values such as `arguments` objects, arrays, buffers, strings, or
|
|
* jQuery-like collections are considered empty if they have a `length` of `0`.
|
|
* Similarly, maps and sets are considered empty if they have a `size` of `0`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is empty, else `false`.
|
|
* @example
|
|
*
|
|
* _.isEmpty(null);
|
|
* // => true
|
|
*
|
|
* _.isEmpty(true);
|
|
* // => true
|
|
*
|
|
* _.isEmpty(1);
|
|
* // => true
|
|
*
|
|
* _.isEmpty([1, 2, 3]);
|
|
* // => false
|
|
*
|
|
* _.isEmpty({ 'a': 1 });
|
|
* // => false
|
|
*/
|
|
function isEmpty(value) {
|
|
if (value == null) {
|
|
return true;
|
|
}
|
|
if (isArrayLike(value) &&
|
|
(isArray(value) || typeof value == 'string' || typeof value.splice == 'function' ||
|
|
isBuffer(value) || isTypedArray(value) || isArguments(value))) {
|
|
return !value.length;
|
|
}
|
|
var tag = getTag(value);
|
|
if (tag == mapTag || tag == setTag) {
|
|
return !value.size;
|
|
}
|
|
if (isPrototype(value)) {
|
|
return !baseKeys(value).length;
|
|
}
|
|
for (var key in value) {
|
|
if (hasOwnProperty.call(value, key)) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
|
|
/**
|
|
* Performs a deep comparison between two values to determine if they are
|
|
* equivalent.
|
|
*
|
|
* **Note:** This method supports comparing arrays, array buffers, booleans,
|
|
* date objects, error objects, maps, numbers, `Object` objects, regexes,
|
|
* sets, strings, symbols, and typed arrays. `Object` objects are compared
|
|
* by their own, not inherited, enumerable properties. Functions and DOM
|
|
* nodes are compared by strict equality, i.e. `===`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to compare.
|
|
* @param {*} other The other value to compare.
|
|
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
|
|
* @example
|
|
*
|
|
* var object = { 'a': 1 };
|
|
* var other = { 'a': 1 };
|
|
*
|
|
* _.isEqual(object, other);
|
|
* // => true
|
|
*
|
|
* object === other;
|
|
* // => false
|
|
*/
|
|
function isEqual(value, other) {
|
|
return baseIsEqual(value, other);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.isEqual` except that it accepts `customizer` which
|
|
* is invoked to compare values. If `customizer` returns `undefined`, comparisons
|
|
* are handled by the method instead. The `customizer` is invoked with up to
|
|
* six arguments: (objValue, othValue [, index|key, object, other, stack]).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to compare.
|
|
* @param {*} other The other value to compare.
|
|
* @param {Function} [customizer] The function to customize comparisons.
|
|
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
|
|
* @example
|
|
*
|
|
* function isGreeting(value) {
|
|
* return /^h(?:i|ello)$/.test(value);
|
|
* }
|
|
*
|
|
* function customizer(objValue, othValue) {
|
|
* if (isGreeting(objValue) && isGreeting(othValue)) {
|
|
* return true;
|
|
* }
|
|
* }
|
|
*
|
|
* var array = ['hello', 'goodbye'];
|
|
* var other = ['hi', 'goodbye'];
|
|
*
|
|
* _.isEqualWith(array, other, customizer);
|
|
* // => true
|
|
*/
|
|
function isEqualWith(value, other, customizer) {
|
|
customizer = typeof customizer == 'function' ? customizer : undefined;
|
|
var result = customizer ? customizer(value, other) : undefined;
|
|
return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`,
|
|
* `SyntaxError`, `TypeError`, or `URIError` object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is an error object, else `false`.
|
|
* @example
|
|
*
|
|
* _.isError(new Error);
|
|
* // => true
|
|
*
|
|
* _.isError(Error);
|
|
* // => false
|
|
*/
|
|
function isError(value) {
|
|
if (!isObjectLike(value)) {
|
|
return false;
|
|
}
|
|
var tag = baseGetTag(value);
|
|
return tag == errorTag || tag == domExcTag ||
|
|
(typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value));
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is a finite primitive number.
|
|
*
|
|
* **Note:** This method is based on
|
|
* [`Number.isFinite`](https://mdn.io/Number/isFinite).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a finite number, else `false`.
|
|
* @example
|
|
*
|
|
* _.isFinite(3);
|
|
* // => true
|
|
*
|
|
* _.isFinite(Number.MIN_VALUE);
|
|
* // => true
|
|
*
|
|
* _.isFinite(Infinity);
|
|
* // => false
|
|
*
|
|
* _.isFinite('3');
|
|
* // => false
|
|
*/
|
|
function isFinite(value) {
|
|
return typeof value == 'number' && nativeIsFinite(value);
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is classified as a `Function` object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a function, else `false`.
|
|
* @example
|
|
*
|
|
* _.isFunction(_);
|
|
* // => true
|
|
*
|
|
* _.isFunction(/abc/);
|
|
* // => false
|
|
*/
|
|
function isFunction(value) {
|
|
if (!isObject(value)) {
|
|
return false;
|
|
}
|
|
// The use of `Object#toString` avoids issues with the `typeof` operator
|
|
// in Safari 9 which returns 'object' for typed arrays and other constructors.
|
|
var tag = baseGetTag(value);
|
|
return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is an integer.
|
|
*
|
|
* **Note:** This method is based on
|
|
* [`Number.isInteger`](https://mdn.io/Number/isInteger).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is an integer, else `false`.
|
|
* @example
|
|
*
|
|
* _.isInteger(3);
|
|
* // => true
|
|
*
|
|
* _.isInteger(Number.MIN_VALUE);
|
|
* // => false
|
|
*
|
|
* _.isInteger(Infinity);
|
|
* // => false
|
|
*
|
|
* _.isInteger('3');
|
|
* // => false
|
|
*/
|
|
function isInteger(value) {
|
|
return typeof value == 'number' && value == toInteger(value);
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is a valid array-like length.
|
|
*
|
|
* **Note:** This method is loosely based on
|
|
* [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
|
|
* @example
|
|
*
|
|
* _.isLength(3);
|
|
* // => true
|
|
*
|
|
* _.isLength(Number.MIN_VALUE);
|
|
* // => false
|
|
*
|
|
* _.isLength(Infinity);
|
|
* // => false
|
|
*
|
|
* _.isLength('3');
|
|
* // => false
|
|
*/
|
|
function isLength(value) {
|
|
return typeof value == 'number' &&
|
|
value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is the
|
|
* [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)
|
|
* of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is an object, else `false`.
|
|
* @example
|
|
*
|
|
* _.isObject({});
|
|
* // => true
|
|
*
|
|
* _.isObject([1, 2, 3]);
|
|
* // => true
|
|
*
|
|
* _.isObject(_.noop);
|
|
* // => true
|
|
*
|
|
* _.isObject(null);
|
|
* // => false
|
|
*/
|
|
function isObject(value) {
|
|
var type = typeof value;
|
|
return value != null && (type == 'object' || type == 'function');
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is object-like. A value is object-like if it's not `null`
|
|
* and has a `typeof` result of "object".
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is object-like, else `false`.
|
|
* @example
|
|
*
|
|
* _.isObjectLike({});
|
|
* // => true
|
|
*
|
|
* _.isObjectLike([1, 2, 3]);
|
|
* // => true
|
|
*
|
|
* _.isObjectLike(_.noop);
|
|
* // => false
|
|
*
|
|
* _.isObjectLike(null);
|
|
* // => false
|
|
*/
|
|
function isObjectLike(value) {
|
|
return value != null && typeof value == 'object';
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is classified as a `Map` object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.3.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a map, else `false`.
|
|
* @example
|
|
*
|
|
* _.isMap(new Map);
|
|
* // => true
|
|
*
|
|
* _.isMap(new WeakMap);
|
|
* // => false
|
|
*/
|
|
var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;
|
|
|
|
/**
|
|
* Performs a partial deep comparison between `object` and `source` to
|
|
* determine if `object` contains equivalent property values.
|
|
*
|
|
* **Note:** This method is equivalent to `_.matches` when `source` is
|
|
* partially applied.
|
|
*
|
|
* Partial comparisons will match empty array and empty object `source`
|
|
* values against any array or object value, respectively. See `_.isEqual`
|
|
* for a list of supported value comparisons.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Lang
|
|
* @param {Object} object The object to inspect.
|
|
* @param {Object} source The object of property values to match.
|
|
* @returns {boolean} Returns `true` if `object` is a match, else `false`.
|
|
* @example
|
|
*
|
|
* var object = { 'a': 1, 'b': 2 };
|
|
*
|
|
* _.isMatch(object, { 'b': 2 });
|
|
* // => true
|
|
*
|
|
* _.isMatch(object, { 'b': 1 });
|
|
* // => false
|
|
*/
|
|
function isMatch(object, source) {
|
|
return object === source || baseIsMatch(object, source, getMatchData(source));
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.isMatch` except that it accepts `customizer` which
|
|
* is invoked to compare values. If `customizer` returns `undefined`, comparisons
|
|
* are handled by the method instead. The `customizer` is invoked with five
|
|
* arguments: (objValue, srcValue, index|key, object, source).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {Object} object The object to inspect.
|
|
* @param {Object} source The object of property values to match.
|
|
* @param {Function} [customizer] The function to customize comparisons.
|
|
* @returns {boolean} Returns `true` if `object` is a match, else `false`.
|
|
* @example
|
|
*
|
|
* function isGreeting(value) {
|
|
* return /^h(?:i|ello)$/.test(value);
|
|
* }
|
|
*
|
|
* function customizer(objValue, srcValue) {
|
|
* if (isGreeting(objValue) && isGreeting(srcValue)) {
|
|
* return true;
|
|
* }
|
|
* }
|
|
*
|
|
* var object = { 'greeting': 'hello' };
|
|
* var source = { 'greeting': 'hi' };
|
|
*
|
|
* _.isMatchWith(object, source, customizer);
|
|
* // => true
|
|
*/
|
|
function isMatchWith(object, source, customizer) {
|
|
customizer = typeof customizer == 'function' ? customizer : undefined;
|
|
return baseIsMatch(object, source, getMatchData(source), customizer);
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is `NaN`.
|
|
*
|
|
* **Note:** This method is based on
|
|
* [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as
|
|
* global [`isNaN`](https://mdn.io/isNaN) which returns `true` for
|
|
* `undefined` and other non-number values.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
|
|
* @example
|
|
*
|
|
* _.isNaN(NaN);
|
|
* // => true
|
|
*
|
|
* _.isNaN(new Number(NaN));
|
|
* // => true
|
|
*
|
|
* isNaN(undefined);
|
|
* // => true
|
|
*
|
|
* _.isNaN(undefined);
|
|
* // => false
|
|
*/
|
|
function isNaN(value) {
|
|
// An `NaN` primitive is the only value that is not equal to itself.
|
|
// Perform the `toStringTag` check first to avoid errors with some
|
|
// ActiveX objects in IE.
|
|
return isNumber(value) && value != +value;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is a pristine native function.
|
|
*
|
|
* **Note:** This method can't reliably detect native functions in the presence
|
|
* of the core-js package because core-js circumvents this kind of detection.
|
|
* Despite multiple requests, the core-js maintainer has made it clear: any
|
|
* attempt to fix the detection will be obstructed. As a result, we're left
|
|
* with little choice but to throw an error. Unfortunately, this also affects
|
|
* packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill),
|
|
* which rely on core-js.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a native function,
|
|
* else `false`.
|
|
* @example
|
|
*
|
|
* _.isNative(Array.prototype.push);
|
|
* // => true
|
|
*
|
|
* _.isNative(_);
|
|
* // => false
|
|
*/
|
|
function isNative(value) {
|
|
if (isMaskable(value)) {
|
|
throw new Error(CORE_ERROR_TEXT);
|
|
}
|
|
return baseIsNative(value);
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is `null`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is `null`, else `false`.
|
|
* @example
|
|
*
|
|
* _.isNull(null);
|
|
* // => true
|
|
*
|
|
* _.isNull(void 0);
|
|
* // => false
|
|
*/
|
|
function isNull(value) {
|
|
return value === null;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is `null` or `undefined`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is nullish, else `false`.
|
|
* @example
|
|
*
|
|
* _.isNil(null);
|
|
* // => true
|
|
*
|
|
* _.isNil(void 0);
|
|
* // => true
|
|
*
|
|
* _.isNil(NaN);
|
|
* // => false
|
|
*/
|
|
function isNil(value) {
|
|
return value == null;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is classified as a `Number` primitive or object.
|
|
*
|
|
* **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are
|
|
* classified as numbers, use the `_.isFinite` method.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a number, else `false`.
|
|
* @example
|
|
*
|
|
* _.isNumber(3);
|
|
* // => true
|
|
*
|
|
* _.isNumber(Number.MIN_VALUE);
|
|
* // => true
|
|
*
|
|
* _.isNumber(Infinity);
|
|
* // => true
|
|
*
|
|
* _.isNumber('3');
|
|
* // => false
|
|
*/
|
|
function isNumber(value) {
|
|
return typeof value == 'number' ||
|
|
(isObjectLike(value) && baseGetTag(value) == numberTag);
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is a plain object, that is, an object created by the
|
|
* `Object` constructor or one with a `[[Prototype]]` of `null`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.8.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a plain object, else `false`.
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* }
|
|
*
|
|
* _.isPlainObject(new Foo);
|
|
* // => false
|
|
*
|
|
* _.isPlainObject([1, 2, 3]);
|
|
* // => false
|
|
*
|
|
* _.isPlainObject({ 'x': 0, 'y': 0 });
|
|
* // => true
|
|
*
|
|
* _.isPlainObject(Object.create(null));
|
|
* // => true
|
|
*/
|
|
function isPlainObject(value) {
|
|
if (!isObjectLike(value) || baseGetTag(value) != objectTag) {
|
|
return false;
|
|
}
|
|
var proto = getPrototype(value);
|
|
if (proto === null) {
|
|
return true;
|
|
}
|
|
var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor;
|
|
return typeof Ctor == 'function' && Ctor instanceof Ctor &&
|
|
funcToString.call(Ctor) == objectCtorString;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is classified as a `RegExp` object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.1.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a regexp, else `false`.
|
|
* @example
|
|
*
|
|
* _.isRegExp(/abc/);
|
|
* // => true
|
|
*
|
|
* _.isRegExp('/abc/');
|
|
* // => false
|
|
*/
|
|
var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp;
|
|
|
|
/**
|
|
* Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754
|
|
* double precision number which isn't the result of a rounded unsafe integer.
|
|
*
|
|
* **Note:** This method is based on
|
|
* [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a safe integer, else `false`.
|
|
* @example
|
|
*
|
|
* _.isSafeInteger(3);
|
|
* // => true
|
|
*
|
|
* _.isSafeInteger(Number.MIN_VALUE);
|
|
* // => false
|
|
*
|
|
* _.isSafeInteger(Infinity);
|
|
* // => false
|
|
*
|
|
* _.isSafeInteger('3');
|
|
* // => false
|
|
*/
|
|
function isSafeInteger(value) {
|
|
return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is classified as a `Set` object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.3.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a set, else `false`.
|
|
* @example
|
|
*
|
|
* _.isSet(new Set);
|
|
* // => true
|
|
*
|
|
* _.isSet(new WeakSet);
|
|
* // => false
|
|
*/
|
|
var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;
|
|
|
|
/**
|
|
* Checks if `value` is classified as a `String` primitive or object.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a string, else `false`.
|
|
* @example
|
|
*
|
|
* _.isString('abc');
|
|
* // => true
|
|
*
|
|
* _.isString(1);
|
|
* // => false
|
|
*/
|
|
function isString(value) {
|
|
return typeof value == 'string' ||
|
|
(!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag);
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is classified as a `Symbol` primitive or object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a symbol, else `false`.
|
|
* @example
|
|
*
|
|
* _.isSymbol(Symbol.iterator);
|
|
* // => true
|
|
*
|
|
* _.isSymbol('abc');
|
|
* // => false
|
|
*/
|
|
function isSymbol(value) {
|
|
return typeof value == 'symbol' ||
|
|
(isObjectLike(value) && baseGetTag(value) == symbolTag);
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is classified as a typed array.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
|
|
* @example
|
|
*
|
|
* _.isTypedArray(new Uint8Array);
|
|
* // => true
|
|
*
|
|
* _.isTypedArray([]);
|
|
* // => false
|
|
*/
|
|
var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;
|
|
|
|
/**
|
|
* Checks if `value` is `undefined`.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is `undefined`, else `false`.
|
|
* @example
|
|
*
|
|
* _.isUndefined(void 0);
|
|
* // => true
|
|
*
|
|
* _.isUndefined(null);
|
|
* // => false
|
|
*/
|
|
function isUndefined(value) {
|
|
return value === undefined;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is classified as a `WeakMap` object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.3.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a weak map, else `false`.
|
|
* @example
|
|
*
|
|
* _.isWeakMap(new WeakMap);
|
|
* // => true
|
|
*
|
|
* _.isWeakMap(new Map);
|
|
* // => false
|
|
*/
|
|
function isWeakMap(value) {
|
|
return isObjectLike(value) && getTag(value) == weakMapTag;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is classified as a `WeakSet` object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.3.0
|
|
* @category Lang
|
|
* @param {*} value The value to check.
|
|
* @returns {boolean} Returns `true` if `value` is a weak set, else `false`.
|
|
* @example
|
|
*
|
|
* _.isWeakSet(new WeakSet);
|
|
* // => true
|
|
*
|
|
* _.isWeakSet(new Set);
|
|
* // => false
|
|
*/
|
|
function isWeakSet(value) {
|
|
return isObjectLike(value) && baseGetTag(value) == weakSetTag;
|
|
}
|
|
|
|
/**
|
|
* Checks if `value` is less than `other`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.9.0
|
|
* @category Lang
|
|
* @param {*} value The value to compare.
|
|
* @param {*} other The other value to compare.
|
|
* @returns {boolean} Returns `true` if `value` is less than `other`,
|
|
* else `false`.
|
|
* @see _.gt
|
|
* @example
|
|
*
|
|
* _.lt(1, 3);
|
|
* // => true
|
|
*
|
|
* _.lt(3, 3);
|
|
* // => false
|
|
*
|
|
* _.lt(3, 1);
|
|
* // => false
|
|
*/
|
|
var lt = createRelationalOperation(baseLt);
|
|
|
|
/**
|
|
* Checks if `value` is less than or equal to `other`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.9.0
|
|
* @category Lang
|
|
* @param {*} value The value to compare.
|
|
* @param {*} other The other value to compare.
|
|
* @returns {boolean} Returns `true` if `value` is less than or equal to
|
|
* `other`, else `false`.
|
|
* @see _.gte
|
|
* @example
|
|
*
|
|
* _.lte(1, 3);
|
|
* // => true
|
|
*
|
|
* _.lte(3, 3);
|
|
* // => true
|
|
*
|
|
* _.lte(3, 1);
|
|
* // => false
|
|
*/
|
|
var lte = createRelationalOperation(function(value, other) {
|
|
return value <= other;
|
|
});
|
|
|
|
/**
|
|
* Converts `value` to an array.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Lang
|
|
* @param {*} value The value to convert.
|
|
* @returns {Array} Returns the converted array.
|
|
* @example
|
|
*
|
|
* _.toArray({ 'a': 1, 'b': 2 });
|
|
* // => [1, 2]
|
|
*
|
|
* _.toArray('abc');
|
|
* // => ['a', 'b', 'c']
|
|
*
|
|
* _.toArray(1);
|
|
* // => []
|
|
*
|
|
* _.toArray(null);
|
|
* // => []
|
|
*/
|
|
function toArray(value) {
|
|
if (!value) {
|
|
return [];
|
|
}
|
|
if (isArrayLike(value)) {
|
|
return isString(value) ? stringToArray(value) : copyArray(value);
|
|
}
|
|
if (symIterator && value[symIterator]) {
|
|
return iteratorToArray(value[symIterator]());
|
|
}
|
|
var tag = getTag(value),
|
|
func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values);
|
|
|
|
return func(value);
|
|
}
|
|
|
|
/**
|
|
* Converts `value` to a finite number.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.12.0
|
|
* @category Lang
|
|
* @param {*} value The value to convert.
|
|
* @returns {number} Returns the converted number.
|
|
* @example
|
|
*
|
|
* _.toFinite(3.2);
|
|
* // => 3.2
|
|
*
|
|
* _.toFinite(Number.MIN_VALUE);
|
|
* // => 5e-324
|
|
*
|
|
* _.toFinite(Infinity);
|
|
* // => 1.7976931348623157e+308
|
|
*
|
|
* _.toFinite('3.2');
|
|
* // => 3.2
|
|
*/
|
|
function toFinite(value) {
|
|
if (!value) {
|
|
return value === 0 ? value : 0;
|
|
}
|
|
value = toNumber(value);
|
|
if (value === INFINITY || value === -INFINITY) {
|
|
var sign = (value < 0 ? -1 : 1);
|
|
return sign * MAX_INTEGER;
|
|
}
|
|
return value === value ? value : 0;
|
|
}
|
|
|
|
/**
|
|
* Converts `value` to an integer.
|
|
*
|
|
* **Note:** This method is loosely based on
|
|
* [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to convert.
|
|
* @returns {number} Returns the converted integer.
|
|
* @example
|
|
*
|
|
* _.toInteger(3.2);
|
|
* // => 3
|
|
*
|
|
* _.toInteger(Number.MIN_VALUE);
|
|
* // => 0
|
|
*
|
|
* _.toInteger(Infinity);
|
|
* // => 1.7976931348623157e+308
|
|
*
|
|
* _.toInteger('3.2');
|
|
* // => 3
|
|
*/
|
|
function toInteger(value) {
|
|
var result = toFinite(value),
|
|
remainder = result % 1;
|
|
|
|
return result === result ? (remainder ? result - remainder : result) : 0;
|
|
}
|
|
|
|
/**
|
|
* Converts `value` to an integer suitable for use as the length of an
|
|
* array-like object.
|
|
*
|
|
* **Note:** This method is based on
|
|
* [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to convert.
|
|
* @returns {number} Returns the converted integer.
|
|
* @example
|
|
*
|
|
* _.toLength(3.2);
|
|
* // => 3
|
|
*
|
|
* _.toLength(Number.MIN_VALUE);
|
|
* // => 0
|
|
*
|
|
* _.toLength(Infinity);
|
|
* // => 4294967295
|
|
*
|
|
* _.toLength('3.2');
|
|
* // => 3
|
|
*/
|
|
function toLength(value) {
|
|
return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0;
|
|
}
|
|
|
|
/**
|
|
* Converts `value` to a number.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to process.
|
|
* @returns {number} Returns the number.
|
|
* @example
|
|
*
|
|
* _.toNumber(3.2);
|
|
* // => 3.2
|
|
*
|
|
* _.toNumber(Number.MIN_VALUE);
|
|
* // => 5e-324
|
|
*
|
|
* _.toNumber(Infinity);
|
|
* // => Infinity
|
|
*
|
|
* _.toNumber('3.2');
|
|
* // => 3.2
|
|
*/
|
|
function toNumber(value) {
|
|
if (typeof value == 'number') {
|
|
return value;
|
|
}
|
|
if (isSymbol(value)) {
|
|
return NAN;
|
|
}
|
|
if (isObject(value)) {
|
|
var other = typeof value.valueOf == 'function' ? value.valueOf() : value;
|
|
value = isObject(other) ? (other + '') : other;
|
|
}
|
|
if (typeof value != 'string') {
|
|
return value === 0 ? value : +value;
|
|
}
|
|
value = baseTrim(value);
|
|
var isBinary = reIsBinary.test(value);
|
|
return (isBinary || reIsOctal.test(value))
|
|
? freeParseInt(value.slice(2), isBinary ? 2 : 8)
|
|
: (reIsBadHex.test(value) ? NAN : +value);
|
|
}
|
|
|
|
/**
|
|
* Converts `value` to a plain object flattening inherited enumerable string
|
|
* keyed properties of `value` to own properties of the plain object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to convert.
|
|
* @returns {Object} Returns the converted plain object.
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.b = 2;
|
|
* }
|
|
*
|
|
* Foo.prototype.c = 3;
|
|
*
|
|
* _.assign({ 'a': 1 }, new Foo);
|
|
* // => { 'a': 1, 'b': 2 }
|
|
*
|
|
* _.assign({ 'a': 1 }, _.toPlainObject(new Foo));
|
|
* // => { 'a': 1, 'b': 2, 'c': 3 }
|
|
*/
|
|
function toPlainObject(value) {
|
|
return copyObject(value, keysIn(value));
|
|
}
|
|
|
|
/**
|
|
* Converts `value` to a safe integer. A safe integer can be compared and
|
|
* represented correctly.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to convert.
|
|
* @returns {number} Returns the converted integer.
|
|
* @example
|
|
*
|
|
* _.toSafeInteger(3.2);
|
|
* // => 3
|
|
*
|
|
* _.toSafeInteger(Number.MIN_VALUE);
|
|
* // => 0
|
|
*
|
|
* _.toSafeInteger(Infinity);
|
|
* // => 9007199254740991
|
|
*
|
|
* _.toSafeInteger('3.2');
|
|
* // => 3
|
|
*/
|
|
function toSafeInteger(value) {
|
|
return value
|
|
? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER)
|
|
: (value === 0 ? value : 0);
|
|
}
|
|
|
|
/**
|
|
* Converts `value` to a string. An empty string is returned for `null`
|
|
* and `undefined` values. The sign of `-0` is preserved.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Lang
|
|
* @param {*} value The value to convert.
|
|
* @returns {string} Returns the converted string.
|
|
* @example
|
|
*
|
|
* _.toString(null);
|
|
* // => ''
|
|
*
|
|
* _.toString(-0);
|
|
* // => '-0'
|
|
*
|
|
* _.toString([1, 2, 3]);
|
|
* // => '1,2,3'
|
|
*/
|
|
function toString(value) {
|
|
return value == null ? '' : baseToString(value);
|
|
}
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Assigns own enumerable string keyed properties of source objects to the
|
|
* destination object. Source objects are applied from left to right.
|
|
* Subsequent sources overwrite property assignments of previous sources.
|
|
*
|
|
* **Note:** This method mutates `object` and is loosely based on
|
|
* [`Object.assign`](https://mdn.io/Object/assign).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.10.0
|
|
* @category Object
|
|
* @param {Object} object The destination object.
|
|
* @param {...Object} [sources] The source objects.
|
|
* @returns {Object} Returns `object`.
|
|
* @see _.assignIn
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* }
|
|
*
|
|
* function Bar() {
|
|
* this.c = 3;
|
|
* }
|
|
*
|
|
* Foo.prototype.b = 2;
|
|
* Bar.prototype.d = 4;
|
|
*
|
|
* _.assign({ 'a': 0 }, new Foo, new Bar);
|
|
* // => { 'a': 1, 'c': 3 }
|
|
*/
|
|
var assign = createAssigner(function(object, source) {
|
|
if (isPrototype(source) || isArrayLike(source)) {
|
|
copyObject(source, keys(source), object);
|
|
return;
|
|
}
|
|
for (var key in source) {
|
|
if (hasOwnProperty.call(source, key)) {
|
|
assignValue(object, key, source[key]);
|
|
}
|
|
}
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.assign` except that it iterates over own and
|
|
* inherited source properties.
|
|
*
|
|
* **Note:** This method mutates `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @alias extend
|
|
* @category Object
|
|
* @param {Object} object The destination object.
|
|
* @param {...Object} [sources] The source objects.
|
|
* @returns {Object} Returns `object`.
|
|
* @see _.assign
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* }
|
|
*
|
|
* function Bar() {
|
|
* this.c = 3;
|
|
* }
|
|
*
|
|
* Foo.prototype.b = 2;
|
|
* Bar.prototype.d = 4;
|
|
*
|
|
* _.assignIn({ 'a': 0 }, new Foo, new Bar);
|
|
* // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 }
|
|
*/
|
|
var assignIn = createAssigner(function(object, source) {
|
|
copyObject(source, keysIn(source), object);
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.assignIn` except that it accepts `customizer`
|
|
* which is invoked to produce the assigned values. If `customizer` returns
|
|
* `undefined`, assignment is handled by the method instead. The `customizer`
|
|
* is invoked with five arguments: (objValue, srcValue, key, object, source).
|
|
*
|
|
* **Note:** This method mutates `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @alias extendWith
|
|
* @category Object
|
|
* @param {Object} object The destination object.
|
|
* @param {...Object} sources The source objects.
|
|
* @param {Function} [customizer] The function to customize assigned values.
|
|
* @returns {Object} Returns `object`.
|
|
* @see _.assignWith
|
|
* @example
|
|
*
|
|
* function customizer(objValue, srcValue) {
|
|
* return _.isUndefined(objValue) ? srcValue : objValue;
|
|
* }
|
|
*
|
|
* var defaults = _.partialRight(_.assignInWith, customizer);
|
|
*
|
|
* defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
|
|
* // => { 'a': 1, 'b': 2 }
|
|
*/
|
|
var assignInWith = createAssigner(function(object, source, srcIndex, customizer) {
|
|
copyObject(source, keysIn(source), object, customizer);
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.assign` except that it accepts `customizer`
|
|
* which is invoked to produce the assigned values. If `customizer` returns
|
|
* `undefined`, assignment is handled by the method instead. The `customizer`
|
|
* is invoked with five arguments: (objValue, srcValue, key, object, source).
|
|
*
|
|
* **Note:** This method mutates `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Object
|
|
* @param {Object} object The destination object.
|
|
* @param {...Object} sources The source objects.
|
|
* @param {Function} [customizer] The function to customize assigned values.
|
|
* @returns {Object} Returns `object`.
|
|
* @see _.assignInWith
|
|
* @example
|
|
*
|
|
* function customizer(objValue, srcValue) {
|
|
* return _.isUndefined(objValue) ? srcValue : objValue;
|
|
* }
|
|
*
|
|
* var defaults = _.partialRight(_.assignWith, customizer);
|
|
*
|
|
* defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
|
|
* // => { 'a': 1, 'b': 2 }
|
|
*/
|
|
var assignWith = createAssigner(function(object, source, srcIndex, customizer) {
|
|
copyObject(source, keys(source), object, customizer);
|
|
});
|
|
|
|
/**
|
|
* Creates an array of values corresponding to `paths` of `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 1.0.0
|
|
* @category Object
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {...(string|string[])} [paths] The property paths to pick.
|
|
* @returns {Array} Returns the picked values.
|
|
* @example
|
|
*
|
|
* var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };
|
|
*
|
|
* _.at(object, ['a[0].b.c', 'a[1]']);
|
|
* // => [3, 4]
|
|
*/
|
|
var at = flatRest(baseAt);
|
|
|
|
/**
|
|
* Creates an object that inherits from the `prototype` object. If a
|
|
* `properties` object is given, its own enumerable string keyed properties
|
|
* are assigned to the created object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.3.0
|
|
* @category Object
|
|
* @param {Object} prototype The object to inherit from.
|
|
* @param {Object} [properties] The properties to assign to the object.
|
|
* @returns {Object} Returns the new object.
|
|
* @example
|
|
*
|
|
* function Shape() {
|
|
* this.x = 0;
|
|
* this.y = 0;
|
|
* }
|
|
*
|
|
* function Circle() {
|
|
* Shape.call(this);
|
|
* }
|
|
*
|
|
* Circle.prototype = _.create(Shape.prototype, {
|
|
* 'constructor': Circle
|
|
* });
|
|
*
|
|
* var circle = new Circle;
|
|
* circle instanceof Circle;
|
|
* // => true
|
|
*
|
|
* circle instanceof Shape;
|
|
* // => true
|
|
*/
|
|
function create(prototype, properties) {
|
|
var result = baseCreate(prototype);
|
|
return properties == null ? result : baseAssign(result, properties);
|
|
}
|
|
|
|
/**
|
|
* Assigns own and inherited enumerable string keyed properties of source
|
|
* objects to the destination object for all destination properties that
|
|
* resolve to `undefined`. Source objects are applied from left to right.
|
|
* Once a property is set, additional values of the same property are ignored.
|
|
*
|
|
* **Note:** This method mutates `object`.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Object
|
|
* @param {Object} object The destination object.
|
|
* @param {...Object} [sources] The source objects.
|
|
* @returns {Object} Returns `object`.
|
|
* @see _.defaultsDeep
|
|
* @example
|
|
*
|
|
* _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
|
|
* // => { 'a': 1, 'b': 2 }
|
|
*/
|
|
var defaults = baseRest(function(object, sources) {
|
|
object = Object(object);
|
|
|
|
var index = -1;
|
|
var length = sources.length;
|
|
var guard = length > 2 ? sources[2] : undefined;
|
|
|
|
if (guard && isIterateeCall(sources[0], sources[1], guard)) {
|
|
length = 1;
|
|
}
|
|
|
|
while (++index < length) {
|
|
var source = sources[index];
|
|
var props = keysIn(source);
|
|
var propsIndex = -1;
|
|
var propsLength = props.length;
|
|
|
|
while (++propsIndex < propsLength) {
|
|
var key = props[propsIndex];
|
|
var value = object[key];
|
|
|
|
if (value === undefined ||
|
|
(eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) {
|
|
object[key] = source[key];
|
|
}
|
|
}
|
|
}
|
|
|
|
return object;
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.defaults` except that it recursively assigns
|
|
* default properties.
|
|
*
|
|
* **Note:** This method mutates `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.10.0
|
|
* @category Object
|
|
* @param {Object} object The destination object.
|
|
* @param {...Object} [sources] The source objects.
|
|
* @returns {Object} Returns `object`.
|
|
* @see _.defaults
|
|
* @example
|
|
*
|
|
* _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } });
|
|
* // => { 'a': { 'b': 2, 'c': 3 } }
|
|
*/
|
|
var defaultsDeep = baseRest(function(args) {
|
|
args.push(undefined, customDefaultsMerge);
|
|
return apply(mergeWith, undefined, args);
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.find` except that it returns the key of the first
|
|
* element `predicate` returns truthy for instead of the element itself.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 1.1.0
|
|
* @category Object
|
|
* @param {Object} object The object to inspect.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @returns {string|undefined} Returns the key of the matched element,
|
|
* else `undefined`.
|
|
* @example
|
|
*
|
|
* var users = {
|
|
* 'barney': { 'age': 36, 'active': true },
|
|
* 'fred': { 'age': 40, 'active': false },
|
|
* 'pebbles': { 'age': 1, 'active': true }
|
|
* };
|
|
*
|
|
* _.findKey(users, function(o) { return o.age < 40; });
|
|
* // => 'barney' (iteration order is not guaranteed)
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.findKey(users, { 'age': 1, 'active': true });
|
|
* // => 'pebbles'
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.findKey(users, ['active', false]);
|
|
* // => 'fred'
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.findKey(users, 'active');
|
|
* // => 'barney'
|
|
*/
|
|
function findKey(object, predicate) {
|
|
return baseFindKey(object, getIteratee(predicate, 3), baseForOwn);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.findKey` except that it iterates over elements of
|
|
* a collection in the opposite order.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.0.0
|
|
* @category Object
|
|
* @param {Object} object The object to inspect.
|
|
* @param {Function} [predicate=_.identity] The function invoked per iteration.
|
|
* @returns {string|undefined} Returns the key of the matched element,
|
|
* else `undefined`.
|
|
* @example
|
|
*
|
|
* var users = {
|
|
* 'barney': { 'age': 36, 'active': true },
|
|
* 'fred': { 'age': 40, 'active': false },
|
|
* 'pebbles': { 'age': 1, 'active': true }
|
|
* };
|
|
*
|
|
* _.findLastKey(users, function(o) { return o.age < 40; });
|
|
* // => returns 'pebbles' assuming `_.findKey` returns 'barney'
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.findLastKey(users, { 'age': 36, 'active': true });
|
|
* // => 'barney'
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.findLastKey(users, ['active', false]);
|
|
* // => 'fred'
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.findLastKey(users, 'active');
|
|
* // => 'pebbles'
|
|
*/
|
|
function findLastKey(object, predicate) {
|
|
return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight);
|
|
}
|
|
|
|
/**
|
|
* Iterates over own and inherited enumerable string keyed properties of an
|
|
* object and invokes `iteratee` for each property. The iteratee is invoked
|
|
* with three arguments: (value, key, object). Iteratee functions may exit
|
|
* iteration early by explicitly returning `false`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.3.0
|
|
* @category Object
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @returns {Object} Returns `object`.
|
|
* @see _.forInRight
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* this.b = 2;
|
|
* }
|
|
*
|
|
* Foo.prototype.c = 3;
|
|
*
|
|
* _.forIn(new Foo, function(value, key) {
|
|
* console.log(key);
|
|
* });
|
|
* // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed).
|
|
*/
|
|
function forIn(object, iteratee) {
|
|
return object == null
|
|
? object
|
|
: baseFor(object, getIteratee(iteratee, 3), keysIn);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.forIn` except that it iterates over properties of
|
|
* `object` in the opposite order.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.0.0
|
|
* @category Object
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @returns {Object} Returns `object`.
|
|
* @see _.forIn
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* this.b = 2;
|
|
* }
|
|
*
|
|
* Foo.prototype.c = 3;
|
|
*
|
|
* _.forInRight(new Foo, function(value, key) {
|
|
* console.log(key);
|
|
* });
|
|
* // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'.
|
|
*/
|
|
function forInRight(object, iteratee) {
|
|
return object == null
|
|
? object
|
|
: baseForRight(object, getIteratee(iteratee, 3), keysIn);
|
|
}
|
|
|
|
/**
|
|
* Iterates over own enumerable string keyed properties of an object and
|
|
* invokes `iteratee` for each property. The iteratee is invoked with three
|
|
* arguments: (value, key, object). Iteratee functions may exit iteration
|
|
* early by explicitly returning `false`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.3.0
|
|
* @category Object
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @returns {Object} Returns `object`.
|
|
* @see _.forOwnRight
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* this.b = 2;
|
|
* }
|
|
*
|
|
* Foo.prototype.c = 3;
|
|
*
|
|
* _.forOwn(new Foo, function(value, key) {
|
|
* console.log(key);
|
|
* });
|
|
* // => Logs 'a' then 'b' (iteration order is not guaranteed).
|
|
*/
|
|
function forOwn(object, iteratee) {
|
|
return object && baseForOwn(object, getIteratee(iteratee, 3));
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.forOwn` except that it iterates over properties of
|
|
* `object` in the opposite order.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.0.0
|
|
* @category Object
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @returns {Object} Returns `object`.
|
|
* @see _.forOwn
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* this.b = 2;
|
|
* }
|
|
*
|
|
* Foo.prototype.c = 3;
|
|
*
|
|
* _.forOwnRight(new Foo, function(value, key) {
|
|
* console.log(key);
|
|
* });
|
|
* // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'.
|
|
*/
|
|
function forOwnRight(object, iteratee) {
|
|
return object && baseForOwnRight(object, getIteratee(iteratee, 3));
|
|
}
|
|
|
|
/**
|
|
* Creates an array of function property names from own enumerable properties
|
|
* of `object`.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Object
|
|
* @param {Object} object The object to inspect.
|
|
* @returns {Array} Returns the function names.
|
|
* @see _.functionsIn
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = _.constant('a');
|
|
* this.b = _.constant('b');
|
|
* }
|
|
*
|
|
* Foo.prototype.c = _.constant('c');
|
|
*
|
|
* _.functions(new Foo);
|
|
* // => ['a', 'b']
|
|
*/
|
|
function functions(object) {
|
|
return object == null ? [] : baseFunctions(object, keys(object));
|
|
}
|
|
|
|
/**
|
|
* Creates an array of function property names from own and inherited
|
|
* enumerable properties of `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Object
|
|
* @param {Object} object The object to inspect.
|
|
* @returns {Array} Returns the function names.
|
|
* @see _.functions
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = _.constant('a');
|
|
* this.b = _.constant('b');
|
|
* }
|
|
*
|
|
* Foo.prototype.c = _.constant('c');
|
|
*
|
|
* _.functionsIn(new Foo);
|
|
* // => ['a', 'b', 'c']
|
|
*/
|
|
function functionsIn(object) {
|
|
return object == null ? [] : baseFunctions(object, keysIn(object));
|
|
}
|
|
|
|
/**
|
|
* Gets the value at `path` of `object`. If the resolved value is
|
|
* `undefined`, the `defaultValue` is returned in its place.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.7.0
|
|
* @category Object
|
|
* @param {Object} object The object to query.
|
|
* @param {Array|string} path The path of the property to get.
|
|
* @param {*} [defaultValue] The value returned for `undefined` resolved values.
|
|
* @returns {*} Returns the resolved value.
|
|
* @example
|
|
*
|
|
* var object = { 'a': [{ 'b': { 'c': 3 } }] };
|
|
*
|
|
* _.get(object, 'a[0].b.c');
|
|
* // => 3
|
|
*
|
|
* _.get(object, ['a', '0', 'b', 'c']);
|
|
* // => 3
|
|
*
|
|
* _.get(object, 'a.b.c', 'default');
|
|
* // => 'default'
|
|
*/
|
|
function get(object, path, defaultValue) {
|
|
var result = object == null ? undefined : baseGet(object, path);
|
|
return result === undefined ? defaultValue : result;
|
|
}
|
|
|
|
/**
|
|
* Checks if `path` is a direct property of `object`.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Object
|
|
* @param {Object} object The object to query.
|
|
* @param {Array|string} path The path to check.
|
|
* @returns {boolean} Returns `true` if `path` exists, else `false`.
|
|
* @example
|
|
*
|
|
* var object = { 'a': { 'b': 2 } };
|
|
* var other = _.create({ 'a': _.create({ 'b': 2 }) });
|
|
*
|
|
* _.has(object, 'a');
|
|
* // => true
|
|
*
|
|
* _.has(object, 'a.b');
|
|
* // => true
|
|
*
|
|
* _.has(object, ['a', 'b']);
|
|
* // => true
|
|
*
|
|
* _.has(other, 'a');
|
|
* // => false
|
|
*/
|
|
function has(object, path) {
|
|
return object != null && hasPath(object, path, baseHas);
|
|
}
|
|
|
|
/**
|
|
* Checks if `path` is a direct or inherited property of `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Object
|
|
* @param {Object} object The object to query.
|
|
* @param {Array|string} path The path to check.
|
|
* @returns {boolean} Returns `true` if `path` exists, else `false`.
|
|
* @example
|
|
*
|
|
* var object = _.create({ 'a': _.create({ 'b': 2 }) });
|
|
*
|
|
* _.hasIn(object, 'a');
|
|
* // => true
|
|
*
|
|
* _.hasIn(object, 'a.b');
|
|
* // => true
|
|
*
|
|
* _.hasIn(object, ['a', 'b']);
|
|
* // => true
|
|
*
|
|
* _.hasIn(object, 'b');
|
|
* // => false
|
|
*/
|
|
function hasIn(object, path) {
|
|
return object != null && hasPath(object, path, baseHasIn);
|
|
}
|
|
|
|
/**
|
|
* Creates an object composed of the inverted keys and values of `object`.
|
|
* If `object` contains duplicate values, subsequent values overwrite
|
|
* property assignments of previous values.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.7.0
|
|
* @category Object
|
|
* @param {Object} object The object to invert.
|
|
* @returns {Object} Returns the new inverted object.
|
|
* @example
|
|
*
|
|
* var object = { 'a': 1, 'b': 2, 'c': 1 };
|
|
*
|
|
* _.invert(object);
|
|
* // => { '1': 'c', '2': 'b' }
|
|
*/
|
|
var invert = createInverter(function(result, value, key) {
|
|
if (value != null &&
|
|
typeof value.toString != 'function') {
|
|
value = nativeObjectToString.call(value);
|
|
}
|
|
|
|
result[value] = key;
|
|
}, constant(identity));
|
|
|
|
/**
|
|
* This method is like `_.invert` except that the inverted object is generated
|
|
* from the results of running each element of `object` thru `iteratee`. The
|
|
* corresponding inverted value of each inverted key is an array of keys
|
|
* responsible for generating the inverted value. The iteratee is invoked
|
|
* with one argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.1.0
|
|
* @category Object
|
|
* @param {Object} object The object to invert.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {Object} Returns the new inverted object.
|
|
* @example
|
|
*
|
|
* var object = { 'a': 1, 'b': 2, 'c': 1 };
|
|
*
|
|
* _.invertBy(object);
|
|
* // => { '1': ['a', 'c'], '2': ['b'] }
|
|
*
|
|
* _.invertBy(object, function(value) {
|
|
* return 'group' + value;
|
|
* });
|
|
* // => { 'group1': ['a', 'c'], 'group2': ['b'] }
|
|
*/
|
|
var invertBy = createInverter(function(result, value, key) {
|
|
if (value != null &&
|
|
typeof value.toString != 'function') {
|
|
value = nativeObjectToString.call(value);
|
|
}
|
|
|
|
if (hasOwnProperty.call(result, value)) {
|
|
result[value].push(key);
|
|
} else {
|
|
result[value] = [key];
|
|
}
|
|
}, getIteratee);
|
|
|
|
/**
|
|
* Invokes the method at `path` of `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Object
|
|
* @param {Object} object The object to query.
|
|
* @param {Array|string} path The path of the method to invoke.
|
|
* @param {...*} [args] The arguments to invoke the method with.
|
|
* @returns {*} Returns the result of the invoked method.
|
|
* @example
|
|
*
|
|
* var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] };
|
|
*
|
|
* _.invoke(object, 'a[0].b.c.slice', 1, 3);
|
|
* // => [2, 3]
|
|
*/
|
|
var invoke = baseRest(baseInvoke);
|
|
|
|
/**
|
|
* Creates an array of the own enumerable property names of `object`.
|
|
*
|
|
* **Note:** Non-object values are coerced to objects. See the
|
|
* [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
|
|
* for more details.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Object
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the array of property names.
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* this.b = 2;
|
|
* }
|
|
*
|
|
* Foo.prototype.c = 3;
|
|
*
|
|
* _.keys(new Foo);
|
|
* // => ['a', 'b'] (iteration order is not guaranteed)
|
|
*
|
|
* _.keys('hi');
|
|
* // => ['0', '1']
|
|
*/
|
|
function keys(object) {
|
|
return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);
|
|
}
|
|
|
|
/**
|
|
* Creates an array of the own and inherited enumerable property names of `object`.
|
|
*
|
|
* **Note:** Non-object values are coerced to objects.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Object
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the array of property names.
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* this.b = 2;
|
|
* }
|
|
*
|
|
* Foo.prototype.c = 3;
|
|
*
|
|
* _.keysIn(new Foo);
|
|
* // => ['a', 'b', 'c'] (iteration order is not guaranteed)
|
|
*/
|
|
function keysIn(object) {
|
|
return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object);
|
|
}
|
|
|
|
/**
|
|
* The opposite of `_.mapValues`; this method creates an object with the
|
|
* same values as `object` and keys generated by running each own enumerable
|
|
* string keyed property of `object` thru `iteratee`. The iteratee is invoked
|
|
* with three arguments: (value, key, object).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.8.0
|
|
* @category Object
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @returns {Object} Returns the new mapped object.
|
|
* @see _.mapValues
|
|
* @example
|
|
*
|
|
* _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) {
|
|
* return key + value;
|
|
* });
|
|
* // => { 'a1': 1, 'b2': 2 }
|
|
*/
|
|
function mapKeys(object, iteratee) {
|
|
var result = {};
|
|
iteratee = getIteratee(iteratee, 3);
|
|
|
|
baseForOwn(object, function(value, key, object) {
|
|
baseAssignValue(result, iteratee(value, key, object), value);
|
|
});
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Creates an object with the same keys as `object` and values generated
|
|
* by running each own enumerable string keyed property of `object` thru
|
|
* `iteratee`. The iteratee is invoked with three arguments:
|
|
* (value, key, object).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.4.0
|
|
* @category Object
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @returns {Object} Returns the new mapped object.
|
|
* @see _.mapKeys
|
|
* @example
|
|
*
|
|
* var users = {
|
|
* 'fred': { 'user': 'fred', 'age': 40 },
|
|
* 'pebbles': { 'user': 'pebbles', 'age': 1 }
|
|
* };
|
|
*
|
|
* _.mapValues(users, function(o) { return o.age; });
|
|
* // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.mapValues(users, 'age');
|
|
* // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)
|
|
*/
|
|
function mapValues(object, iteratee) {
|
|
var result = {};
|
|
iteratee = getIteratee(iteratee, 3);
|
|
|
|
baseForOwn(object, function(value, key, object) {
|
|
baseAssignValue(result, key, iteratee(value, key, object));
|
|
});
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.assign` except that it recursively merges own and
|
|
* inherited enumerable string keyed properties of source objects into the
|
|
* destination object. Source properties that resolve to `undefined` are
|
|
* skipped if a destination value exists. Array and plain object properties
|
|
* are merged recursively. Other objects and value types are overridden by
|
|
* assignment. Source objects are applied from left to right. Subsequent
|
|
* sources overwrite property assignments of previous sources.
|
|
*
|
|
* **Note:** This method mutates `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.5.0
|
|
* @category Object
|
|
* @param {Object} object The destination object.
|
|
* @param {...Object} [sources] The source objects.
|
|
* @returns {Object} Returns `object`.
|
|
* @example
|
|
*
|
|
* var object = {
|
|
* 'a': [{ 'b': 2 }, { 'd': 4 }]
|
|
* };
|
|
*
|
|
* var other = {
|
|
* 'a': [{ 'c': 3 }, { 'e': 5 }]
|
|
* };
|
|
*
|
|
* _.merge(object, other);
|
|
* // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] }
|
|
*/
|
|
var merge = createAssigner(function(object, source, srcIndex) {
|
|
baseMerge(object, source, srcIndex);
|
|
});
|
|
|
|
/**
|
|
* This method is like `_.merge` except that it accepts `customizer` which
|
|
* is invoked to produce the merged values of the destination and source
|
|
* properties. If `customizer` returns `undefined`, merging is handled by the
|
|
* method instead. The `customizer` is invoked with six arguments:
|
|
* (objValue, srcValue, key, object, source, stack).
|
|
*
|
|
* **Note:** This method mutates `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Object
|
|
* @param {Object} object The destination object.
|
|
* @param {...Object} sources The source objects.
|
|
* @param {Function} customizer The function to customize assigned values.
|
|
* @returns {Object} Returns `object`.
|
|
* @example
|
|
*
|
|
* function customizer(objValue, srcValue) {
|
|
* if (_.isArray(objValue)) {
|
|
* return objValue.concat(srcValue);
|
|
* }
|
|
* }
|
|
*
|
|
* var object = { 'a': [1], 'b': [2] };
|
|
* var other = { 'a': [3], 'b': [4] };
|
|
*
|
|
* _.mergeWith(object, other, customizer);
|
|
* // => { 'a': [1, 3], 'b': [2, 4] }
|
|
*/
|
|
var mergeWith = createAssigner(function(object, source, srcIndex, customizer) {
|
|
baseMerge(object, source, srcIndex, customizer);
|
|
});
|
|
|
|
/**
|
|
* The opposite of `_.pick`; this method creates an object composed of the
|
|
* own and inherited enumerable property paths of `object` that are not omitted.
|
|
*
|
|
* **Note:** This method is considerably slower than `_.pick`.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Object
|
|
* @param {Object} object The source object.
|
|
* @param {...(string|string[])} [paths] The property paths to omit.
|
|
* @returns {Object} Returns the new object.
|
|
* @example
|
|
*
|
|
* var object = { 'a': 1, 'b': '2', 'c': 3 };
|
|
*
|
|
* _.omit(object, ['a', 'c']);
|
|
* // => { 'b': '2' }
|
|
*/
|
|
var omit = flatRest(function(object, paths) {
|
|
var result = {};
|
|
if (object == null) {
|
|
return result;
|
|
}
|
|
var isDeep = false;
|
|
paths = arrayMap(paths, function(path) {
|
|
path = castPath(path, object);
|
|
isDeep || (isDeep = path.length > 1);
|
|
return path;
|
|
});
|
|
copyObject(object, getAllKeysIn(object), result);
|
|
if (isDeep) {
|
|
result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone);
|
|
}
|
|
var length = paths.length;
|
|
while (length--) {
|
|
baseUnset(result, paths[length]);
|
|
}
|
|
return result;
|
|
});
|
|
|
|
/**
|
|
* The opposite of `_.pickBy`; this method creates an object composed of
|
|
* the own and inherited enumerable string keyed properties of `object` that
|
|
* `predicate` doesn't return truthy for. The predicate is invoked with two
|
|
* arguments: (value, key).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Object
|
|
* @param {Object} object The source object.
|
|
* @param {Function} [predicate=_.identity] The function invoked per property.
|
|
* @returns {Object} Returns the new object.
|
|
* @example
|
|
*
|
|
* var object = { 'a': 1, 'b': '2', 'c': 3 };
|
|
*
|
|
* _.omitBy(object, _.isNumber);
|
|
* // => { 'b': '2' }
|
|
*/
|
|
function omitBy(object, predicate) {
|
|
return pickBy(object, negate(getIteratee(predicate)));
|
|
}
|
|
|
|
/**
|
|
* Creates an object composed of the picked `object` properties.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Object
|
|
* @param {Object} object The source object.
|
|
* @param {...(string|string[])} [paths] The property paths to pick.
|
|
* @returns {Object} Returns the new object.
|
|
* @example
|
|
*
|
|
* var object = { 'a': 1, 'b': '2', 'c': 3 };
|
|
*
|
|
* _.pick(object, ['a', 'c']);
|
|
* // => { 'a': 1, 'c': 3 }
|
|
*/
|
|
var pick = flatRest(function(object, paths) {
|
|
return object == null ? {} : basePick(object, paths);
|
|
});
|
|
|
|
/**
|
|
* Creates an object composed of the `object` properties `predicate` returns
|
|
* truthy for. The predicate is invoked with two arguments: (value, key).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Object
|
|
* @param {Object} object The source object.
|
|
* @param {Function} [predicate=_.identity] The function invoked per property.
|
|
* @returns {Object} Returns the new object.
|
|
* @example
|
|
*
|
|
* var object = { 'a': 1, 'b': '2', 'c': 3 };
|
|
*
|
|
* _.pickBy(object, _.isNumber);
|
|
* // => { 'a': 1, 'c': 3 }
|
|
*/
|
|
function pickBy(object, predicate) {
|
|
if (object == null) {
|
|
return {};
|
|
}
|
|
var props = arrayMap(getAllKeysIn(object), function(prop) {
|
|
return [prop];
|
|
});
|
|
predicate = getIteratee(predicate);
|
|
return basePickBy(object, props, function(value, path) {
|
|
return predicate(value, path[0]);
|
|
});
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.get` except that if the resolved value is a
|
|
* function it's invoked with the `this` binding of its parent object and
|
|
* its result is returned.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Object
|
|
* @param {Object} object The object to query.
|
|
* @param {Array|string} path The path of the property to resolve.
|
|
* @param {*} [defaultValue] The value returned for `undefined` resolved values.
|
|
* @returns {*} Returns the resolved value.
|
|
* @example
|
|
*
|
|
* var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] };
|
|
*
|
|
* _.result(object, 'a[0].b.c1');
|
|
* // => 3
|
|
*
|
|
* _.result(object, 'a[0].b.c2');
|
|
* // => 4
|
|
*
|
|
* _.result(object, 'a[0].b.c3', 'default');
|
|
* // => 'default'
|
|
*
|
|
* _.result(object, 'a[0].b.c3', _.constant('default'));
|
|
* // => 'default'
|
|
*/
|
|
function result(object, path, defaultValue) {
|
|
path = castPath(path, object);
|
|
|
|
var index = -1,
|
|
length = path.length;
|
|
|
|
// Ensure the loop is entered when path is empty.
|
|
if (!length) {
|
|
length = 1;
|
|
object = undefined;
|
|
}
|
|
while (++index < length) {
|
|
var value = object == null ? undefined : object[toKey(path[index])];
|
|
if (value === undefined) {
|
|
index = length;
|
|
value = defaultValue;
|
|
}
|
|
object = isFunction(value) ? value.call(object) : value;
|
|
}
|
|
return object;
|
|
}
|
|
|
|
/**
|
|
* Sets the value at `path` of `object`. If a portion of `path` doesn't exist,
|
|
* it's created. Arrays are created for missing index properties while objects
|
|
* are created for all other missing properties. Use `_.setWith` to customize
|
|
* `path` creation.
|
|
*
|
|
* **Note:** This method mutates `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.7.0
|
|
* @category Object
|
|
* @param {Object} object The object to modify.
|
|
* @param {Array|string} path The path of the property to set.
|
|
* @param {*} value The value to set.
|
|
* @returns {Object} Returns `object`.
|
|
* @example
|
|
*
|
|
* var object = { 'a': [{ 'b': { 'c': 3 } }] };
|
|
*
|
|
* _.set(object, 'a[0].b.c', 4);
|
|
* console.log(object.a[0].b.c);
|
|
* // => 4
|
|
*
|
|
* _.set(object, ['x', '0', 'y', 'z'], 5);
|
|
* console.log(object.x[0].y.z);
|
|
* // => 5
|
|
*/
|
|
function set(object, path, value) {
|
|
return object == null ? object : baseSet(object, path, value);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.set` except that it accepts `customizer` which is
|
|
* invoked to produce the objects of `path`. If `customizer` returns `undefined`
|
|
* path creation is handled by the method instead. The `customizer` is invoked
|
|
* with three arguments: (nsValue, key, nsObject).
|
|
*
|
|
* **Note:** This method mutates `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Object
|
|
* @param {Object} object The object to modify.
|
|
* @param {Array|string} path The path of the property to set.
|
|
* @param {*} value The value to set.
|
|
* @param {Function} [customizer] The function to customize assigned values.
|
|
* @returns {Object} Returns `object`.
|
|
* @example
|
|
*
|
|
* var object = {};
|
|
*
|
|
* _.setWith(object, '[0][1]', 'a', Object);
|
|
* // => { '0': { '1': 'a' } }
|
|
*/
|
|
function setWith(object, path, value, customizer) {
|
|
customizer = typeof customizer == 'function' ? customizer : undefined;
|
|
return object == null ? object : baseSet(object, path, value, customizer);
|
|
}
|
|
|
|
/**
|
|
* Creates an array of own enumerable string keyed-value pairs for `object`
|
|
* which can be consumed by `_.fromPairs`. If `object` is a map or set, its
|
|
* entries are returned.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @alias entries
|
|
* @category Object
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the key-value pairs.
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* this.b = 2;
|
|
* }
|
|
*
|
|
* Foo.prototype.c = 3;
|
|
*
|
|
* _.toPairs(new Foo);
|
|
* // => [['a', 1], ['b', 2]] (iteration order is not guaranteed)
|
|
*/
|
|
var toPairs = createToPairs(keys);
|
|
|
|
/**
|
|
* Creates an array of own and inherited enumerable string keyed-value pairs
|
|
* for `object` which can be consumed by `_.fromPairs`. If `object` is a map
|
|
* or set, its entries are returned.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @alias entriesIn
|
|
* @category Object
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the key-value pairs.
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* this.b = 2;
|
|
* }
|
|
*
|
|
* Foo.prototype.c = 3;
|
|
*
|
|
* _.toPairsIn(new Foo);
|
|
* // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed)
|
|
*/
|
|
var toPairsIn = createToPairs(keysIn);
|
|
|
|
/**
|
|
* An alternative to `_.reduce`; this method transforms `object` to a new
|
|
* `accumulator` object which is the result of running each of its own
|
|
* enumerable string keyed properties thru `iteratee`, with each invocation
|
|
* potentially mutating the `accumulator` object. If `accumulator` is not
|
|
* provided, a new object with the same `[[Prototype]]` will be used. The
|
|
* iteratee is invoked with four arguments: (accumulator, value, key, object).
|
|
* Iteratee functions may exit iteration early by explicitly returning `false`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 1.3.0
|
|
* @category Object
|
|
* @param {Object} object The object to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @param {*} [accumulator] The custom accumulator value.
|
|
* @returns {*} Returns the accumulated value.
|
|
* @example
|
|
*
|
|
* _.transform([2, 3, 4], function(result, n) {
|
|
* result.push(n *= n);
|
|
* return n % 2 == 0;
|
|
* }, []);
|
|
* // => [4, 9]
|
|
*
|
|
* _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {
|
|
* (result[value] || (result[value] = [])).push(key);
|
|
* }, {});
|
|
* // => { '1': ['a', 'c'], '2': ['b'] }
|
|
*/
|
|
function transform(object, iteratee, accumulator) {
|
|
var isArr = isArray(object),
|
|
isArrLike = isArr || isBuffer(object) || isTypedArray(object);
|
|
|
|
iteratee = getIteratee(iteratee, 4);
|
|
if (accumulator == null) {
|
|
var Ctor = object && object.constructor;
|
|
if (isArrLike) {
|
|
accumulator = isArr ? new Ctor : [];
|
|
}
|
|
else if (isObject(object)) {
|
|
accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {};
|
|
}
|
|
else {
|
|
accumulator = {};
|
|
}
|
|
}
|
|
(isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) {
|
|
return iteratee(accumulator, value, index, object);
|
|
});
|
|
return accumulator;
|
|
}
|
|
|
|
/**
|
|
* Removes the property at `path` of `object`.
|
|
*
|
|
* **Note:** This method mutates `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Object
|
|
* @param {Object} object The object to modify.
|
|
* @param {Array|string} path The path of the property to unset.
|
|
* @returns {boolean} Returns `true` if the property is deleted, else `false`.
|
|
* @example
|
|
*
|
|
* var object = { 'a': [{ 'b': { 'c': 7 } }] };
|
|
* _.unset(object, 'a[0].b.c');
|
|
* // => true
|
|
*
|
|
* console.log(object);
|
|
* // => { 'a': [{ 'b': {} }] };
|
|
*
|
|
* _.unset(object, ['a', '0', 'b', 'c']);
|
|
* // => true
|
|
*
|
|
* console.log(object);
|
|
* // => { 'a': [{ 'b': {} }] };
|
|
*/
|
|
function unset(object, path) {
|
|
return object == null ? true : baseUnset(object, path);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.set` except that accepts `updater` to produce the
|
|
* value to set. Use `_.updateWith` to customize `path` creation. The `updater`
|
|
* is invoked with one argument: (value).
|
|
*
|
|
* **Note:** This method mutates `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.6.0
|
|
* @category Object
|
|
* @param {Object} object The object to modify.
|
|
* @param {Array|string} path The path of the property to set.
|
|
* @param {Function} updater The function to produce the updated value.
|
|
* @returns {Object} Returns `object`.
|
|
* @example
|
|
*
|
|
* var object = { 'a': [{ 'b': { 'c': 3 } }] };
|
|
*
|
|
* _.update(object, 'a[0].b.c', function(n) { return n * n; });
|
|
* console.log(object.a[0].b.c);
|
|
* // => 9
|
|
*
|
|
* _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; });
|
|
* console.log(object.x[0].y.z);
|
|
* // => 0
|
|
*/
|
|
function update(object, path, updater) {
|
|
return object == null ? object : baseUpdate(object, path, castFunction(updater));
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.update` except that it accepts `customizer` which is
|
|
* invoked to produce the objects of `path`. If `customizer` returns `undefined`
|
|
* path creation is handled by the method instead. The `customizer` is invoked
|
|
* with three arguments: (nsValue, key, nsObject).
|
|
*
|
|
* **Note:** This method mutates `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.6.0
|
|
* @category Object
|
|
* @param {Object} object The object to modify.
|
|
* @param {Array|string} path The path of the property to set.
|
|
* @param {Function} updater The function to produce the updated value.
|
|
* @param {Function} [customizer] The function to customize assigned values.
|
|
* @returns {Object} Returns `object`.
|
|
* @example
|
|
*
|
|
* var object = {};
|
|
*
|
|
* _.updateWith(object, '[0][1]', _.constant('a'), Object);
|
|
* // => { '0': { '1': 'a' } }
|
|
*/
|
|
function updateWith(object, path, updater, customizer) {
|
|
customizer = typeof customizer == 'function' ? customizer : undefined;
|
|
return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer);
|
|
}
|
|
|
|
/**
|
|
* Creates an array of the own enumerable string keyed property values of `object`.
|
|
*
|
|
* **Note:** Non-object values are coerced to objects.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Object
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the array of property values.
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* this.b = 2;
|
|
* }
|
|
*
|
|
* Foo.prototype.c = 3;
|
|
*
|
|
* _.values(new Foo);
|
|
* // => [1, 2] (iteration order is not guaranteed)
|
|
*
|
|
* _.values('hi');
|
|
* // => ['h', 'i']
|
|
*/
|
|
function values(object) {
|
|
return object == null ? [] : baseValues(object, keys(object));
|
|
}
|
|
|
|
/**
|
|
* Creates an array of the own and inherited enumerable string keyed property
|
|
* values of `object`.
|
|
*
|
|
* **Note:** Non-object values are coerced to objects.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Object
|
|
* @param {Object} object The object to query.
|
|
* @returns {Array} Returns the array of property values.
|
|
* @example
|
|
*
|
|
* function Foo() {
|
|
* this.a = 1;
|
|
* this.b = 2;
|
|
* }
|
|
*
|
|
* Foo.prototype.c = 3;
|
|
*
|
|
* _.valuesIn(new Foo);
|
|
* // => [1, 2, 3] (iteration order is not guaranteed)
|
|
*/
|
|
function valuesIn(object) {
|
|
return object == null ? [] : baseValues(object, keysIn(object));
|
|
}
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Clamps `number` within the inclusive `lower` and `upper` bounds.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Number
|
|
* @param {number} number The number to clamp.
|
|
* @param {number} [lower] The lower bound.
|
|
* @param {number} upper The upper bound.
|
|
* @returns {number} Returns the clamped number.
|
|
* @example
|
|
*
|
|
* _.clamp(-10, -5, 5);
|
|
* // => -5
|
|
*
|
|
* _.clamp(10, -5, 5);
|
|
* // => 5
|
|
*/
|
|
function clamp(number, lower, upper) {
|
|
if (upper === undefined) {
|
|
upper = lower;
|
|
lower = undefined;
|
|
}
|
|
if (upper !== undefined) {
|
|
upper = toNumber(upper);
|
|
upper = upper === upper ? upper : 0;
|
|
}
|
|
if (lower !== undefined) {
|
|
lower = toNumber(lower);
|
|
lower = lower === lower ? lower : 0;
|
|
}
|
|
return baseClamp(toNumber(number), lower, upper);
|
|
}
|
|
|
|
/**
|
|
* Checks if `n` is between `start` and up to, but not including, `end`. If
|
|
* `end` is not specified, it's set to `start` with `start` then set to `0`.
|
|
* If `start` is greater than `end` the params are swapped to support
|
|
* negative ranges.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.3.0
|
|
* @category Number
|
|
* @param {number} number The number to check.
|
|
* @param {number} [start=0] The start of the range.
|
|
* @param {number} end The end of the range.
|
|
* @returns {boolean} Returns `true` if `number` is in the range, else `false`.
|
|
* @see _.range, _.rangeRight
|
|
* @example
|
|
*
|
|
* _.inRange(3, 2, 4);
|
|
* // => true
|
|
*
|
|
* _.inRange(4, 8);
|
|
* // => true
|
|
*
|
|
* _.inRange(4, 2);
|
|
* // => false
|
|
*
|
|
* _.inRange(2, 2);
|
|
* // => false
|
|
*
|
|
* _.inRange(1.2, 2);
|
|
* // => true
|
|
*
|
|
* _.inRange(5.2, 4);
|
|
* // => false
|
|
*
|
|
* _.inRange(-3, -2, -6);
|
|
* // => true
|
|
*/
|
|
function inRange(number, start, end) {
|
|
start = toFinite(start);
|
|
if (end === undefined) {
|
|
end = start;
|
|
start = 0;
|
|
} else {
|
|
end = toFinite(end);
|
|
}
|
|
number = toNumber(number);
|
|
return baseInRange(number, start, end);
|
|
}
|
|
|
|
/**
|
|
* Produces a random number between the inclusive `lower` and `upper` bounds.
|
|
* If only one argument is provided a number between `0` and the given number
|
|
* is returned. If `floating` is `true`, or either `lower` or `upper` are
|
|
* floats, a floating-point number is returned instead of an integer.
|
|
*
|
|
* **Note:** JavaScript follows the IEEE-754 standard for resolving
|
|
* floating-point values which can produce unexpected results.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.7.0
|
|
* @category Number
|
|
* @param {number} [lower=0] The lower bound.
|
|
* @param {number} [upper=1] The upper bound.
|
|
* @param {boolean} [floating] Specify returning a floating-point number.
|
|
* @returns {number} Returns the random number.
|
|
* @example
|
|
*
|
|
* _.random(0, 5);
|
|
* // => an integer between 0 and 5
|
|
*
|
|
* _.random(5);
|
|
* // => also an integer between 0 and 5
|
|
*
|
|
* _.random(5, true);
|
|
* // => a floating-point number between 0 and 5
|
|
*
|
|
* _.random(1.2, 5.2);
|
|
* // => a floating-point number between 1.2 and 5.2
|
|
*/
|
|
function random(lower, upper, floating) {
|
|
if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) {
|
|
upper = floating = undefined;
|
|
}
|
|
if (floating === undefined) {
|
|
if (typeof upper == 'boolean') {
|
|
floating = upper;
|
|
upper = undefined;
|
|
}
|
|
else if (typeof lower == 'boolean') {
|
|
floating = lower;
|
|
lower = undefined;
|
|
}
|
|
}
|
|
if (lower === undefined && upper === undefined) {
|
|
lower = 0;
|
|
upper = 1;
|
|
}
|
|
else {
|
|
lower = toFinite(lower);
|
|
if (upper === undefined) {
|
|
upper = lower;
|
|
lower = 0;
|
|
} else {
|
|
upper = toFinite(upper);
|
|
}
|
|
}
|
|
if (lower > upper) {
|
|
var temp = lower;
|
|
lower = upper;
|
|
upper = temp;
|
|
}
|
|
if (floating || lower % 1 || upper % 1) {
|
|
var rand = nativeRandom();
|
|
return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper);
|
|
}
|
|
return baseRandom(lower, upper);
|
|
}
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to convert.
|
|
* @returns {string} Returns the camel cased string.
|
|
* @example
|
|
*
|
|
* _.camelCase('Foo Bar');
|
|
* // => 'fooBar'
|
|
*
|
|
* _.camelCase('--foo-bar--');
|
|
* // => 'fooBar'
|
|
*
|
|
* _.camelCase('__FOO_BAR__');
|
|
* // => 'fooBar'
|
|
*/
|
|
var camelCase = createCompounder(function(result, word, index) {
|
|
word = word.toLowerCase();
|
|
return result + (index ? capitalize(word) : word);
|
|
});
|
|
|
|
/**
|
|
* Converts the first character of `string` to upper case and the remaining
|
|
* to lower case.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to capitalize.
|
|
* @returns {string} Returns the capitalized string.
|
|
* @example
|
|
*
|
|
* _.capitalize('FRED');
|
|
* // => 'Fred'
|
|
*/
|
|
function capitalize(string) {
|
|
return upperFirst(toString(string).toLowerCase());
|
|
}
|
|
|
|
/**
|
|
* Deburrs `string` by converting
|
|
* [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table)
|
|
* and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A)
|
|
* letters to basic Latin letters and removing
|
|
* [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to deburr.
|
|
* @returns {string} Returns the deburred string.
|
|
* @example
|
|
*
|
|
* _.deburr('déjà vu');
|
|
* // => 'deja vu'
|
|
*/
|
|
function deburr(string) {
|
|
string = toString(string);
|
|
return string && string.replace(reLatin, deburrLetter).replace(reComboMark, '');
|
|
}
|
|
|
|
/**
|
|
* Checks if `string` ends with the given target string.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to inspect.
|
|
* @param {string} [target] The string to search for.
|
|
* @param {number} [position=string.length] The position to search up to.
|
|
* @returns {boolean} Returns `true` if `string` ends with `target`,
|
|
* else `false`.
|
|
* @example
|
|
*
|
|
* _.endsWith('abc', 'c');
|
|
* // => true
|
|
*
|
|
* _.endsWith('abc', 'b');
|
|
* // => false
|
|
*
|
|
* _.endsWith('abc', 'b', 2);
|
|
* // => true
|
|
*/
|
|
function endsWith(string, target, position) {
|
|
string = toString(string);
|
|
target = baseToString(target);
|
|
|
|
var length = string.length;
|
|
position = position === undefined
|
|
? length
|
|
: baseClamp(toInteger(position), 0, length);
|
|
|
|
var end = position;
|
|
position -= target.length;
|
|
return position >= 0 && string.slice(position, end) == target;
|
|
}
|
|
|
|
/**
|
|
* Converts the characters "&", "<", ">", '"', and "'" in `string` to their
|
|
* corresponding HTML entities.
|
|
*
|
|
* **Note:** No other characters are escaped. To escape additional
|
|
* characters use a third-party library like [_he_](https://mths.be/he).
|
|
*
|
|
* Though the ">" character is escaped for symmetry, characters like
|
|
* ">" and "/" don't need escaping in HTML and have no special meaning
|
|
* unless they're part of a tag or unquoted attribute value. See
|
|
* [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands)
|
|
* (under "semi-related fun fact") for more details.
|
|
*
|
|
* When working with HTML you should always
|
|
* [quote attribute values](http://wonko.com/post/html-escaping) to reduce
|
|
* XSS vectors.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category String
|
|
* @param {string} [string=''] The string to escape.
|
|
* @returns {string} Returns the escaped string.
|
|
* @example
|
|
*
|
|
* _.escape('fred, barney, & pebbles');
|
|
* // => 'fred, barney, & pebbles'
|
|
*/
|
|
function escape(string) {
|
|
string = toString(string);
|
|
return (string && reHasUnescapedHtml.test(string))
|
|
? string.replace(reUnescapedHtml, escapeHtmlChar)
|
|
: string;
|
|
}
|
|
|
|
/**
|
|
* Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+",
|
|
* "?", "(", ")", "[", "]", "{", "}", and "|" in `string`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to escape.
|
|
* @returns {string} Returns the escaped string.
|
|
* @example
|
|
*
|
|
* _.escapeRegExp('[lodash](https://lodash.com/)');
|
|
* // => '\[lodash\]\(https://lodash\.com/\)'
|
|
*/
|
|
function escapeRegExp(string) {
|
|
string = toString(string);
|
|
return (string && reHasRegExpChar.test(string))
|
|
? string.replace(reRegExpChar, '\\$&')
|
|
: string;
|
|
}
|
|
|
|
/**
|
|
* Converts `string` to
|
|
* [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to convert.
|
|
* @returns {string} Returns the kebab cased string.
|
|
* @example
|
|
*
|
|
* _.kebabCase('Foo Bar');
|
|
* // => 'foo-bar'
|
|
*
|
|
* _.kebabCase('fooBar');
|
|
* // => 'foo-bar'
|
|
*
|
|
* _.kebabCase('__FOO_BAR__');
|
|
* // => 'foo-bar'
|
|
*/
|
|
var kebabCase = createCompounder(function(result, word, index) {
|
|
return result + (index ? '-' : '') + word.toLowerCase();
|
|
});
|
|
|
|
/**
|
|
* Converts `string`, as space separated words, to lower case.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to convert.
|
|
* @returns {string} Returns the lower cased string.
|
|
* @example
|
|
*
|
|
* _.lowerCase('--Foo-Bar--');
|
|
* // => 'foo bar'
|
|
*
|
|
* _.lowerCase('fooBar');
|
|
* // => 'foo bar'
|
|
*
|
|
* _.lowerCase('__FOO_BAR__');
|
|
* // => 'foo bar'
|
|
*/
|
|
var lowerCase = createCompounder(function(result, word, index) {
|
|
return result + (index ? ' ' : '') + word.toLowerCase();
|
|
});
|
|
|
|
/**
|
|
* Converts the first character of `string` to lower case.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to convert.
|
|
* @returns {string} Returns the converted string.
|
|
* @example
|
|
*
|
|
* _.lowerFirst('Fred');
|
|
* // => 'fred'
|
|
*
|
|
* _.lowerFirst('FRED');
|
|
* // => 'fRED'
|
|
*/
|
|
var lowerFirst = createCaseFirst('toLowerCase');
|
|
|
|
/**
|
|
* Pads `string` on the left and right sides if it's shorter than `length`.
|
|
* Padding characters are truncated if they can't be evenly divided by `length`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to pad.
|
|
* @param {number} [length=0] The padding length.
|
|
* @param {string} [chars=' '] The string used as padding.
|
|
* @returns {string} Returns the padded string.
|
|
* @example
|
|
*
|
|
* _.pad('abc', 8);
|
|
* // => ' abc '
|
|
*
|
|
* _.pad('abc', 8, '_-');
|
|
* // => '_-abc_-_'
|
|
*
|
|
* _.pad('abc', 3);
|
|
* // => 'abc'
|
|
*/
|
|
function pad(string, length, chars) {
|
|
string = toString(string);
|
|
length = toInteger(length);
|
|
|
|
var strLength = length ? stringSize(string) : 0;
|
|
if (!length || strLength >= length) {
|
|
return string;
|
|
}
|
|
var mid = (length - strLength) / 2;
|
|
return (
|
|
createPadding(nativeFloor(mid), chars) +
|
|
string +
|
|
createPadding(nativeCeil(mid), chars)
|
|
);
|
|
}
|
|
|
|
/**
|
|
* Pads `string` on the right side if it's shorter than `length`. Padding
|
|
* characters are truncated if they exceed `length`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to pad.
|
|
* @param {number} [length=0] The padding length.
|
|
* @param {string} [chars=' '] The string used as padding.
|
|
* @returns {string} Returns the padded string.
|
|
* @example
|
|
*
|
|
* _.padEnd('abc', 6);
|
|
* // => 'abc '
|
|
*
|
|
* _.padEnd('abc', 6, '_-');
|
|
* // => 'abc_-_'
|
|
*
|
|
* _.padEnd('abc', 3);
|
|
* // => 'abc'
|
|
*/
|
|
function padEnd(string, length, chars) {
|
|
string = toString(string);
|
|
length = toInteger(length);
|
|
|
|
var strLength = length ? stringSize(string) : 0;
|
|
return (length && strLength < length)
|
|
? (string + createPadding(length - strLength, chars))
|
|
: string;
|
|
}
|
|
|
|
/**
|
|
* Pads `string` on the left side if it's shorter than `length`. Padding
|
|
* characters are truncated if they exceed `length`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to pad.
|
|
* @param {number} [length=0] The padding length.
|
|
* @param {string} [chars=' '] The string used as padding.
|
|
* @returns {string} Returns the padded string.
|
|
* @example
|
|
*
|
|
* _.padStart('abc', 6);
|
|
* // => ' abc'
|
|
*
|
|
* _.padStart('abc', 6, '_-');
|
|
* // => '_-_abc'
|
|
*
|
|
* _.padStart('abc', 3);
|
|
* // => 'abc'
|
|
*/
|
|
function padStart(string, length, chars) {
|
|
string = toString(string);
|
|
length = toInteger(length);
|
|
|
|
var strLength = length ? stringSize(string) : 0;
|
|
return (length && strLength < length)
|
|
? (createPadding(length - strLength, chars) + string)
|
|
: string;
|
|
}
|
|
|
|
/**
|
|
* Converts `string` to an integer of the specified radix. If `radix` is
|
|
* `undefined` or `0`, a `radix` of `10` is used unless `value` is a
|
|
* hexadecimal, in which case a `radix` of `16` is used.
|
|
*
|
|
* **Note:** This method aligns with the
|
|
* [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 1.1.0
|
|
* @category String
|
|
* @param {string} string The string to convert.
|
|
* @param {number} [radix=10] The radix to interpret `value` by.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {number} Returns the converted integer.
|
|
* @example
|
|
*
|
|
* _.parseInt('08');
|
|
* // => 8
|
|
*
|
|
* _.map(['6', '08', '10'], _.parseInt);
|
|
* // => [6, 8, 10]
|
|
*/
|
|
function parseInt(string, radix, guard) {
|
|
if (guard || radix == null) {
|
|
radix = 0;
|
|
} else if (radix) {
|
|
radix = +radix;
|
|
}
|
|
return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0);
|
|
}
|
|
|
|
/**
|
|
* Repeats the given string `n` times.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to repeat.
|
|
* @param {number} [n=1] The number of times to repeat the string.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {string} Returns the repeated string.
|
|
* @example
|
|
*
|
|
* _.repeat('*', 3);
|
|
* // => '***'
|
|
*
|
|
* _.repeat('abc', 2);
|
|
* // => 'abcabc'
|
|
*
|
|
* _.repeat('abc', 0);
|
|
* // => ''
|
|
*/
|
|
function repeat(string, n, guard) {
|
|
if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) {
|
|
n = 1;
|
|
} else {
|
|
n = toInteger(n);
|
|
}
|
|
return baseRepeat(toString(string), n);
|
|
}
|
|
|
|
/**
|
|
* Replaces matches for `pattern` in `string` with `replacement`.
|
|
*
|
|
* **Note:** This method is based on
|
|
* [`String#replace`](https://mdn.io/String/replace).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to modify.
|
|
* @param {RegExp|string} pattern The pattern to replace.
|
|
* @param {Function|string} replacement The match replacement.
|
|
* @returns {string} Returns the modified string.
|
|
* @example
|
|
*
|
|
* _.replace('Hi Fred', 'Fred', 'Barney');
|
|
* // => 'Hi Barney'
|
|
*/
|
|
function replace() {
|
|
var args = arguments,
|
|
string = toString(args[0]);
|
|
|
|
return args.length < 3 ? string : string.replace(args[1], args[2]);
|
|
}
|
|
|
|
/**
|
|
* Converts `string` to
|
|
* [snake case](https://en.wikipedia.org/wiki/Snake_case).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to convert.
|
|
* @returns {string} Returns the snake cased string.
|
|
* @example
|
|
*
|
|
* _.snakeCase('Foo Bar');
|
|
* // => 'foo_bar'
|
|
*
|
|
* _.snakeCase('fooBar');
|
|
* // => 'foo_bar'
|
|
*
|
|
* _.snakeCase('--FOO-BAR--');
|
|
* // => 'foo_bar'
|
|
*/
|
|
var snakeCase = createCompounder(function(result, word, index) {
|
|
return result + (index ? '_' : '') + word.toLowerCase();
|
|
});
|
|
|
|
/**
|
|
* Splits `string` by `separator`.
|
|
*
|
|
* **Note:** This method is based on
|
|
* [`String#split`](https://mdn.io/String/split).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to split.
|
|
* @param {RegExp|string} separator The separator pattern to split by.
|
|
* @param {number} [limit] The length to truncate results to.
|
|
* @returns {Array} Returns the string segments.
|
|
* @example
|
|
*
|
|
* _.split('a-b-c', '-', 2);
|
|
* // => ['a', 'b']
|
|
*/
|
|
function split(string, separator, limit) {
|
|
if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) {
|
|
separator = limit = undefined;
|
|
}
|
|
limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0;
|
|
if (!limit) {
|
|
return [];
|
|
}
|
|
string = toString(string);
|
|
if (string && (
|
|
typeof separator == 'string' ||
|
|
(separator != null && !isRegExp(separator))
|
|
)) {
|
|
separator = baseToString(separator);
|
|
if (!separator && hasUnicode(string)) {
|
|
return castSlice(stringToArray(string), 0, limit);
|
|
}
|
|
}
|
|
return string.split(separator, limit);
|
|
}
|
|
|
|
/**
|
|
* Converts `string` to
|
|
* [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.1.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to convert.
|
|
* @returns {string} Returns the start cased string.
|
|
* @example
|
|
*
|
|
* _.startCase('--foo-bar--');
|
|
* // => 'Foo Bar'
|
|
*
|
|
* _.startCase('fooBar');
|
|
* // => 'Foo Bar'
|
|
*
|
|
* _.startCase('__FOO_BAR__');
|
|
* // => 'FOO BAR'
|
|
*/
|
|
var startCase = createCompounder(function(result, word, index) {
|
|
return result + (index ? ' ' : '') + upperFirst(word);
|
|
});
|
|
|
|
/**
|
|
* Checks if `string` starts with the given target string.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to inspect.
|
|
* @param {string} [target] The string to search for.
|
|
* @param {number} [position=0] The position to search from.
|
|
* @returns {boolean} Returns `true` if `string` starts with `target`,
|
|
* else `false`.
|
|
* @example
|
|
*
|
|
* _.startsWith('abc', 'a');
|
|
* // => true
|
|
*
|
|
* _.startsWith('abc', 'b');
|
|
* // => false
|
|
*
|
|
* _.startsWith('abc', 'b', 1);
|
|
* // => true
|
|
*/
|
|
function startsWith(string, target, position) {
|
|
string = toString(string);
|
|
position = position == null
|
|
? 0
|
|
: baseClamp(toInteger(position), 0, string.length);
|
|
|
|
target = baseToString(target);
|
|
return string.slice(position, position + target.length) == target;
|
|
}
|
|
|
|
/**
|
|
* Creates a compiled template function that can interpolate data properties
|
|
* in "interpolate" delimiters, HTML-escape interpolated data properties in
|
|
* "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data
|
|
* properties may be accessed as free variables in the template. If a setting
|
|
* object is given, it takes precedence over `_.templateSettings` values.
|
|
*
|
|
* **Note:** In the development build `_.template` utilizes
|
|
* [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl)
|
|
* for easier debugging.
|
|
*
|
|
* For more information on precompiling templates see
|
|
* [lodash's custom builds documentation](https://lodash.com/custom-builds).
|
|
*
|
|
* For more information on Chrome extension sandboxes see
|
|
* [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval).
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category String
|
|
* @param {string} [string=''] The template string.
|
|
* @param {Object} [options={}] The options object.
|
|
* @param {RegExp} [options.escape=_.templateSettings.escape]
|
|
* The HTML "escape" delimiter.
|
|
* @param {RegExp} [options.evaluate=_.templateSettings.evaluate]
|
|
* The "evaluate" delimiter.
|
|
* @param {Object} [options.imports=_.templateSettings.imports]
|
|
* An object to import into the template as free variables.
|
|
* @param {RegExp} [options.interpolate=_.templateSettings.interpolate]
|
|
* The "interpolate" delimiter.
|
|
* @param {string} [options.sourceURL='lodash.templateSources[n]']
|
|
* The sourceURL of the compiled template.
|
|
* @param {string} [options.variable='obj']
|
|
* The data object variable name.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {Function} Returns the compiled template function.
|
|
* @example
|
|
*
|
|
* // Use the "interpolate" delimiter to create a compiled template.
|
|
* var compiled = _.template('hello <%= user %>!');
|
|
* compiled({ 'user': 'fred' });
|
|
* // => 'hello fred!'
|
|
*
|
|
* // Use the HTML "escape" delimiter to escape data property values.
|
|
* var compiled = _.template('<b><%- value %></b>');
|
|
* compiled({ 'value': '<script>' });
|
|
* // => '<b><script></b>'
|
|
*
|
|
* // Use the "evaluate" delimiter to execute JavaScript and generate HTML.
|
|
* var compiled = _.template('<% _.forEach(users, function(user) { %><li><%- user %></li><% }); %>');
|
|
* compiled({ 'users': ['fred', 'barney'] });
|
|
* // => '<li>fred</li><li>barney</li>'
|
|
*
|
|
* // Use the internal `print` function in "evaluate" delimiters.
|
|
* var compiled = _.template('<% print("hello " + user); %>!');
|
|
* compiled({ 'user': 'barney' });
|
|
* // => 'hello barney!'
|
|
*
|
|
* // Use the ES template literal delimiter as an "interpolate" delimiter.
|
|
* // Disable support by replacing the "interpolate" delimiter.
|
|
* var compiled = _.template('hello ${ user }!');
|
|
* compiled({ 'user': 'pebbles' });
|
|
* // => 'hello pebbles!'
|
|
*
|
|
* // Use backslashes to treat delimiters as plain text.
|
|
* var compiled = _.template('<%= "\\<%- value %\\>" %>');
|
|
* compiled({ 'value': 'ignored' });
|
|
* // => '<%- value %>'
|
|
*
|
|
* // Use the `imports` option to import `jQuery` as `jq`.
|
|
* var text = '<% jq.each(users, function(user) { %><li><%- user %></li><% }); %>';
|
|
* var compiled = _.template(text, { 'imports': { 'jq': jQuery } });
|
|
* compiled({ 'users': ['fred', 'barney'] });
|
|
* // => '<li>fred</li><li>barney</li>'
|
|
*
|
|
* // Use the `sourceURL` option to specify a custom sourceURL for the template.
|
|
* var compiled = _.template('hello <%= user %>!', { 'sourceURL': '/basic/greeting.jst' });
|
|
* compiled(data);
|
|
* // => Find the source of "greeting.jst" under the Sources tab or Resources panel of the web inspector.
|
|
*
|
|
* // Use the `variable` option to ensure a with-statement isn't used in the compiled template.
|
|
* var compiled = _.template('hi <%= data.user %>!', { 'variable': 'data' });
|
|
* compiled.source;
|
|
* // => function(data) {
|
|
* // var __t, __p = '';
|
|
* // __p += 'hi ' + ((__t = ( data.user )) == null ? '' : __t) + '!';
|
|
* // return __p;
|
|
* // }
|
|
*
|
|
* // Use custom template delimiters.
|
|
* _.templateSettings.interpolate = /{{([\s\S]+?)}}/g;
|
|
* var compiled = _.template('hello {{ user }}!');
|
|
* compiled({ 'user': 'mustache' });
|
|
* // => 'hello mustache!'
|
|
*
|
|
* // Use the `source` property to inline compiled templates for meaningful
|
|
* // line numbers in error messages and stack traces.
|
|
* fs.writeFileSync(path.join(process.cwd(), 'jst.js'), '\
|
|
* var JST = {\
|
|
* "main": ' + _.template(mainText).source + '\
|
|
* };\
|
|
* ');
|
|
*/
|
|
function template(string, options, guard) {
|
|
// Based on John Resig's `tmpl` implementation
|
|
// (http://ejohn.org/blog/javascript-micro-templating/)
|
|
// and Laura Doktorova's doT.js (https://github.com/olado/doT).
|
|
var settings = lodash.templateSettings;
|
|
|
|
if (guard && isIterateeCall(string, options, guard)) {
|
|
options = undefined;
|
|
}
|
|
string = toString(string);
|
|
options = assignInWith({}, options, settings, customDefaultsAssignIn);
|
|
|
|
var imports = assignInWith({}, options.imports, settings.imports, customDefaultsAssignIn),
|
|
importsKeys = keys(imports),
|
|
importsValues = baseValues(imports, importsKeys);
|
|
|
|
var isEscaping,
|
|
isEvaluating,
|
|
index = 0,
|
|
interpolate = options.interpolate || reNoMatch,
|
|
source = "__p += '";
|
|
|
|
// Compile the regexp to match each delimiter.
|
|
var reDelimiters = RegExp(
|
|
(options.escape || reNoMatch).source + '|' +
|
|
interpolate.source + '|' +
|
|
(interpolate === reInterpolate ? reEsTemplate : reNoMatch).source + '|' +
|
|
(options.evaluate || reNoMatch).source + '|$'
|
|
, 'g');
|
|
|
|
// Use a sourceURL for easier debugging.
|
|
// The sourceURL gets injected into the source that's eval-ed, so be careful
|
|
// to normalize all kinds of whitespace, so e.g. newlines (and unicode versions of it) can't sneak in
|
|
// and escape the comment, thus injecting code that gets evaled.
|
|
var sourceURL = '//# sourceURL=' +
|
|
(hasOwnProperty.call(options, 'sourceURL')
|
|
? (options.sourceURL + '').replace(/\s/g, ' ')
|
|
: ('lodash.templateSources[' + (++templateCounter) + ']')
|
|
) + '\n';
|
|
|
|
string.replace(reDelimiters, function(match, escapeValue, interpolateValue, esTemplateValue, evaluateValue, offset) {
|
|
interpolateValue || (interpolateValue = esTemplateValue);
|
|
|
|
// Escape characters that can't be included in string literals.
|
|
source += string.slice(index, offset).replace(reUnescapedString, escapeStringChar);
|
|
|
|
// Replace delimiters with snippets.
|
|
if (escapeValue) {
|
|
isEscaping = true;
|
|
source += "' +\n__e(" + escapeValue + ") +\n'";
|
|
}
|
|
if (evaluateValue) {
|
|
isEvaluating = true;
|
|
source += "';\n" + evaluateValue + ";\n__p += '";
|
|
}
|
|
if (interpolateValue) {
|
|
source += "' +\n((__t = (" + interpolateValue + ")) == null ? '' : __t) +\n'";
|
|
}
|
|
index = offset + match.length;
|
|
|
|
// The JS engine embedded in Adobe products needs `match` returned in
|
|
// order to produce the correct `offset` value.
|
|
return match;
|
|
});
|
|
|
|
source += "';\n";
|
|
|
|
// If `variable` is not specified wrap a with-statement around the generated
|
|
// code to add the data object to the top of the scope chain.
|
|
var variable = hasOwnProperty.call(options, 'variable') && options.variable;
|
|
if (!variable) {
|
|
source = 'with (obj) {\n' + source + '\n}\n';
|
|
}
|
|
// Throw an error if a forbidden character was found in `variable`, to prevent
|
|
// potential command injection attacks.
|
|
else if (reForbiddenIdentifierChars.test(variable)) {
|
|
throw new Error(INVALID_TEMPL_VAR_ERROR_TEXT);
|
|
}
|
|
|
|
// Cleanup code by stripping empty strings.
|
|
source = (isEvaluating ? source.replace(reEmptyStringLeading, '') : source)
|
|
.replace(reEmptyStringMiddle, '$1')
|
|
.replace(reEmptyStringTrailing, '$1;');
|
|
|
|
// Frame code as the function body.
|
|
source = 'function(' + (variable || 'obj') + ') {\n' +
|
|
(variable
|
|
? ''
|
|
: 'obj || (obj = {});\n'
|
|
) +
|
|
"var __t, __p = ''" +
|
|
(isEscaping
|
|
? ', __e = _.escape'
|
|
: ''
|
|
) +
|
|
(isEvaluating
|
|
? ', __j = Array.prototype.join;\n' +
|
|
"function print() { __p += __j.call(arguments, '') }\n"
|
|
: ';\n'
|
|
) +
|
|
source +
|
|
'return __p\n}';
|
|
|
|
var result = attempt(function() {
|
|
return Function(importsKeys, sourceURL + 'return ' + source)
|
|
.apply(undefined, importsValues);
|
|
});
|
|
|
|
// Provide the compiled function's source by its `toString` method or
|
|
// the `source` property as a convenience for inlining compiled templates.
|
|
result.source = source;
|
|
if (isError(result)) {
|
|
throw result;
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Converts `string`, as a whole, to lower case just like
|
|
* [String#toLowerCase](https://mdn.io/toLowerCase).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to convert.
|
|
* @returns {string} Returns the lower cased string.
|
|
* @example
|
|
*
|
|
* _.toLower('--Foo-Bar--');
|
|
* // => '--foo-bar--'
|
|
*
|
|
* _.toLower('fooBar');
|
|
* // => 'foobar'
|
|
*
|
|
* _.toLower('__FOO_BAR__');
|
|
* // => '__foo_bar__'
|
|
*/
|
|
function toLower(value) {
|
|
return toString(value).toLowerCase();
|
|
}
|
|
|
|
/**
|
|
* Converts `string`, as a whole, to upper case just like
|
|
* [String#toUpperCase](https://mdn.io/toUpperCase).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to convert.
|
|
* @returns {string} Returns the upper cased string.
|
|
* @example
|
|
*
|
|
* _.toUpper('--foo-bar--');
|
|
* // => '--FOO-BAR--'
|
|
*
|
|
* _.toUpper('fooBar');
|
|
* // => 'FOOBAR'
|
|
*
|
|
* _.toUpper('__foo_bar__');
|
|
* // => '__FOO_BAR__'
|
|
*/
|
|
function toUpper(value) {
|
|
return toString(value).toUpperCase();
|
|
}
|
|
|
|
/**
|
|
* Removes leading and trailing whitespace or specified characters from `string`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to trim.
|
|
* @param {string} [chars=whitespace] The characters to trim.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {string} Returns the trimmed string.
|
|
* @example
|
|
*
|
|
* _.trim(' abc ');
|
|
* // => 'abc'
|
|
*
|
|
* _.trim('-_-abc-_-', '_-');
|
|
* // => 'abc'
|
|
*
|
|
* _.map([' foo ', ' bar '], _.trim);
|
|
* // => ['foo', 'bar']
|
|
*/
|
|
function trim(string, chars, guard) {
|
|
string = toString(string);
|
|
if (string && (guard || chars === undefined)) {
|
|
return baseTrim(string);
|
|
}
|
|
if (!string || !(chars = baseToString(chars))) {
|
|
return string;
|
|
}
|
|
var strSymbols = stringToArray(string),
|
|
chrSymbols = stringToArray(chars),
|
|
start = charsStartIndex(strSymbols, chrSymbols),
|
|
end = charsEndIndex(strSymbols, chrSymbols) + 1;
|
|
|
|
return castSlice(strSymbols, start, end).join('');
|
|
}
|
|
|
|
/**
|
|
* Removes trailing whitespace or specified characters from `string`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to trim.
|
|
* @param {string} [chars=whitespace] The characters to trim.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {string} Returns the trimmed string.
|
|
* @example
|
|
*
|
|
* _.trimEnd(' abc ');
|
|
* // => ' abc'
|
|
*
|
|
* _.trimEnd('-_-abc-_-', '_-');
|
|
* // => '-_-abc'
|
|
*/
|
|
function trimEnd(string, chars, guard) {
|
|
string = toString(string);
|
|
if (string && (guard || chars === undefined)) {
|
|
return string.slice(0, trimmedEndIndex(string) + 1);
|
|
}
|
|
if (!string || !(chars = baseToString(chars))) {
|
|
return string;
|
|
}
|
|
var strSymbols = stringToArray(string),
|
|
end = charsEndIndex(strSymbols, stringToArray(chars)) + 1;
|
|
|
|
return castSlice(strSymbols, 0, end).join('');
|
|
}
|
|
|
|
/**
|
|
* Removes leading whitespace or specified characters from `string`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to trim.
|
|
* @param {string} [chars=whitespace] The characters to trim.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {string} Returns the trimmed string.
|
|
* @example
|
|
*
|
|
* _.trimStart(' abc ');
|
|
* // => 'abc '
|
|
*
|
|
* _.trimStart('-_-abc-_-', '_-');
|
|
* // => 'abc-_-'
|
|
*/
|
|
function trimStart(string, chars, guard) {
|
|
string = toString(string);
|
|
if (string && (guard || chars === undefined)) {
|
|
return string.replace(reTrimStart, '');
|
|
}
|
|
if (!string || !(chars = baseToString(chars))) {
|
|
return string;
|
|
}
|
|
var strSymbols = stringToArray(string),
|
|
start = charsStartIndex(strSymbols, stringToArray(chars));
|
|
|
|
return castSlice(strSymbols, start).join('');
|
|
}
|
|
|
|
/**
|
|
* Truncates `string` if it's longer than the given maximum string length.
|
|
* The last characters of the truncated string are replaced with the omission
|
|
* string which defaults to "...".
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to truncate.
|
|
* @param {Object} [options={}] The options object.
|
|
* @param {number} [options.length=30] The maximum string length.
|
|
* @param {string} [options.omission='...'] The string to indicate text is omitted.
|
|
* @param {RegExp|string} [options.separator] The separator pattern to truncate to.
|
|
* @returns {string} Returns the truncated string.
|
|
* @example
|
|
*
|
|
* _.truncate('hi-diddly-ho there, neighborino');
|
|
* // => 'hi-diddly-ho there, neighbo...'
|
|
*
|
|
* _.truncate('hi-diddly-ho there, neighborino', {
|
|
* 'length': 24,
|
|
* 'separator': ' '
|
|
* });
|
|
* // => 'hi-diddly-ho there,...'
|
|
*
|
|
* _.truncate('hi-diddly-ho there, neighborino', {
|
|
* 'length': 24,
|
|
* 'separator': /,? +/
|
|
* });
|
|
* // => 'hi-diddly-ho there...'
|
|
*
|
|
* _.truncate('hi-diddly-ho there, neighborino', {
|
|
* 'omission': ' [...]'
|
|
* });
|
|
* // => 'hi-diddly-ho there, neig [...]'
|
|
*/
|
|
function truncate(string, options) {
|
|
var length = DEFAULT_TRUNC_LENGTH,
|
|
omission = DEFAULT_TRUNC_OMISSION;
|
|
|
|
if (isObject(options)) {
|
|
var separator = 'separator' in options ? options.separator : separator;
|
|
length = 'length' in options ? toInteger(options.length) : length;
|
|
omission = 'omission' in options ? baseToString(options.omission) : omission;
|
|
}
|
|
string = toString(string);
|
|
|
|
var strLength = string.length;
|
|
if (hasUnicode(string)) {
|
|
var strSymbols = stringToArray(string);
|
|
strLength = strSymbols.length;
|
|
}
|
|
if (length >= strLength) {
|
|
return string;
|
|
}
|
|
var end = length - stringSize(omission);
|
|
if (end < 1) {
|
|
return omission;
|
|
}
|
|
var result = strSymbols
|
|
? castSlice(strSymbols, 0, end).join('')
|
|
: string.slice(0, end);
|
|
|
|
if (separator === undefined) {
|
|
return result + omission;
|
|
}
|
|
if (strSymbols) {
|
|
end += (result.length - end);
|
|
}
|
|
if (isRegExp(separator)) {
|
|
if (string.slice(end).search(separator)) {
|
|
var match,
|
|
substring = result;
|
|
|
|
if (!separator.global) {
|
|
separator = RegExp(separator.source, toString(reFlags.exec(separator)) + 'g');
|
|
}
|
|
separator.lastIndex = 0;
|
|
while ((match = separator.exec(substring))) {
|
|
var newEnd = match.index;
|
|
}
|
|
result = result.slice(0, newEnd === undefined ? end : newEnd);
|
|
}
|
|
} else if (string.indexOf(baseToString(separator), end) != end) {
|
|
var index = result.lastIndexOf(separator);
|
|
if (index > -1) {
|
|
result = result.slice(0, index);
|
|
}
|
|
}
|
|
return result + omission;
|
|
}
|
|
|
|
/**
|
|
* The inverse of `_.escape`; this method converts the HTML entities
|
|
* `&`, `<`, `>`, `"`, and `'` in `string` to
|
|
* their corresponding characters.
|
|
*
|
|
* **Note:** No other HTML entities are unescaped. To unescape additional
|
|
* HTML entities use a third-party library like [_he_](https://mths.be/he).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 0.6.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to unescape.
|
|
* @returns {string} Returns the unescaped string.
|
|
* @example
|
|
*
|
|
* _.unescape('fred, barney, & pebbles');
|
|
* // => 'fred, barney, & pebbles'
|
|
*/
|
|
function unescape(string) {
|
|
string = toString(string);
|
|
return (string && reHasEscapedHtml.test(string))
|
|
? string.replace(reEscapedHtml, unescapeHtmlChar)
|
|
: string;
|
|
}
|
|
|
|
/**
|
|
* Converts `string`, as space separated words, to upper case.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to convert.
|
|
* @returns {string} Returns the upper cased string.
|
|
* @example
|
|
*
|
|
* _.upperCase('--foo-bar');
|
|
* // => 'FOO BAR'
|
|
*
|
|
* _.upperCase('fooBar');
|
|
* // => 'FOO BAR'
|
|
*
|
|
* _.upperCase('__foo_bar__');
|
|
* // => 'FOO BAR'
|
|
*/
|
|
var upperCase = createCompounder(function(result, word, index) {
|
|
return result + (index ? ' ' : '') + word.toUpperCase();
|
|
});
|
|
|
|
/**
|
|
* Converts the first character of `string` to upper case.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to convert.
|
|
* @returns {string} Returns the converted string.
|
|
* @example
|
|
*
|
|
* _.upperFirst('fred');
|
|
* // => 'Fred'
|
|
*
|
|
* _.upperFirst('FRED');
|
|
* // => 'FRED'
|
|
*/
|
|
var upperFirst = createCaseFirst('toUpperCase');
|
|
|
|
/**
|
|
* Splits `string` into an array of its words.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category String
|
|
* @param {string} [string=''] The string to inspect.
|
|
* @param {RegExp|string} [pattern] The pattern to match words.
|
|
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
|
|
* @returns {Array} Returns the words of `string`.
|
|
* @example
|
|
*
|
|
* _.words('fred, barney, & pebbles');
|
|
* // => ['fred', 'barney', 'pebbles']
|
|
*
|
|
* _.words('fred, barney, & pebbles', /[^, ]+/g);
|
|
* // => ['fred', 'barney', '&', 'pebbles']
|
|
*/
|
|
function words(string, pattern, guard) {
|
|
string = toString(string);
|
|
pattern = guard ? undefined : pattern;
|
|
|
|
if (pattern === undefined) {
|
|
return hasUnicodeWord(string) ? unicodeWords(string) : asciiWords(string);
|
|
}
|
|
return string.match(pattern) || [];
|
|
}
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Attempts to invoke `func`, returning either the result or the caught error
|
|
* object. Any additional arguments are provided to `func` when it's invoked.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Util
|
|
* @param {Function} func The function to attempt.
|
|
* @param {...*} [args] The arguments to invoke `func` with.
|
|
* @returns {*} Returns the `func` result or error object.
|
|
* @example
|
|
*
|
|
* // Avoid throwing errors for invalid selectors.
|
|
* var elements = _.attempt(function(selector) {
|
|
* return document.querySelectorAll(selector);
|
|
* }, '>_>');
|
|
*
|
|
* if (_.isError(elements)) {
|
|
* elements = [];
|
|
* }
|
|
*/
|
|
var attempt = baseRest(function(func, args) {
|
|
try {
|
|
return apply(func, undefined, args);
|
|
} catch (e) {
|
|
return isError(e) ? e : new Error(e);
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Binds methods of an object to the object itself, overwriting the existing
|
|
* method.
|
|
*
|
|
* **Note:** This method doesn't set the "length" property of bound functions.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Util
|
|
* @param {Object} object The object to bind and assign the bound methods to.
|
|
* @param {...(string|string[])} methodNames The object method names to bind.
|
|
* @returns {Object} Returns `object`.
|
|
* @example
|
|
*
|
|
* var view = {
|
|
* 'label': 'docs',
|
|
* 'click': function() {
|
|
* console.log('clicked ' + this.label);
|
|
* }
|
|
* };
|
|
*
|
|
* _.bindAll(view, ['click']);
|
|
* jQuery(element).on('click', view.click);
|
|
* // => Logs 'clicked docs' when clicked.
|
|
*/
|
|
var bindAll = flatRest(function(object, methodNames) {
|
|
arrayEach(methodNames, function(key) {
|
|
key = toKey(key);
|
|
baseAssignValue(object, key, bind(object[key], object));
|
|
});
|
|
return object;
|
|
});
|
|
|
|
/**
|
|
* Creates a function that iterates over `pairs` and invokes the corresponding
|
|
* function of the first predicate to return truthy. The predicate-function
|
|
* pairs are invoked with the `this` binding and arguments of the created
|
|
* function.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Util
|
|
* @param {Array} pairs The predicate-function pairs.
|
|
* @returns {Function} Returns the new composite function.
|
|
* @example
|
|
*
|
|
* var func = _.cond([
|
|
* [_.matches({ 'a': 1 }), _.constant('matches A')],
|
|
* [_.conforms({ 'b': _.isNumber }), _.constant('matches B')],
|
|
* [_.stubTrue, _.constant('no match')]
|
|
* ]);
|
|
*
|
|
* func({ 'a': 1, 'b': 2 });
|
|
* // => 'matches A'
|
|
*
|
|
* func({ 'a': 0, 'b': 1 });
|
|
* // => 'matches B'
|
|
*
|
|
* func({ 'a': '1', 'b': '2' });
|
|
* // => 'no match'
|
|
*/
|
|
function cond(pairs) {
|
|
var length = pairs == null ? 0 : pairs.length,
|
|
toIteratee = getIteratee();
|
|
|
|
pairs = !length ? [] : arrayMap(pairs, function(pair) {
|
|
if (typeof pair[1] != 'function') {
|
|
throw new TypeError(FUNC_ERROR_TEXT);
|
|
}
|
|
return [toIteratee(pair[0]), pair[1]];
|
|
});
|
|
|
|
return baseRest(function(args) {
|
|
var index = -1;
|
|
while (++index < length) {
|
|
var pair = pairs[index];
|
|
if (apply(pair[0], this, args)) {
|
|
return apply(pair[1], this, args);
|
|
}
|
|
}
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Creates a function that invokes the predicate properties of `source` with
|
|
* the corresponding property values of a given object, returning `true` if
|
|
* all predicates return truthy, else `false`.
|
|
*
|
|
* **Note:** The created function is equivalent to `_.conformsTo` with
|
|
* `source` partially applied.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Util
|
|
* @param {Object} source The object of property predicates to conform to.
|
|
* @returns {Function} Returns the new spec function.
|
|
* @example
|
|
*
|
|
* var objects = [
|
|
* { 'a': 2, 'b': 1 },
|
|
* { 'a': 1, 'b': 2 }
|
|
* ];
|
|
*
|
|
* _.filter(objects, _.conforms({ 'b': function(n) { return n > 1; } }));
|
|
* // => [{ 'a': 1, 'b': 2 }]
|
|
*/
|
|
function conforms(source) {
|
|
return baseConforms(baseClone(source, CLONE_DEEP_FLAG));
|
|
}
|
|
|
|
/**
|
|
* Creates a function that returns `value`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.4.0
|
|
* @category Util
|
|
* @param {*} value The value to return from the new function.
|
|
* @returns {Function} Returns the new constant function.
|
|
* @example
|
|
*
|
|
* var objects = _.times(2, _.constant({ 'a': 1 }));
|
|
*
|
|
* console.log(objects);
|
|
* // => [{ 'a': 1 }, { 'a': 1 }]
|
|
*
|
|
* console.log(objects[0] === objects[1]);
|
|
* // => true
|
|
*/
|
|
function constant(value) {
|
|
return function() {
|
|
return value;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Checks `value` to determine whether a default value should be returned in
|
|
* its place. The `defaultValue` is returned if `value` is `NaN`, `null`,
|
|
* or `undefined`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.14.0
|
|
* @category Util
|
|
* @param {*} value The value to check.
|
|
* @param {*} defaultValue The default value.
|
|
* @returns {*} Returns the resolved value.
|
|
* @example
|
|
*
|
|
* _.defaultTo(1, 10);
|
|
* // => 1
|
|
*
|
|
* _.defaultTo(undefined, 10);
|
|
* // => 10
|
|
*/
|
|
function defaultTo(value, defaultValue) {
|
|
return (value == null || value !== value) ? defaultValue : value;
|
|
}
|
|
|
|
/**
|
|
* Creates a function that returns the result of invoking the given functions
|
|
* with the `this` binding of the created function, where each successive
|
|
* invocation is supplied the return value of the previous.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Util
|
|
* @param {...(Function|Function[])} [funcs] The functions to invoke.
|
|
* @returns {Function} Returns the new composite function.
|
|
* @see _.flowRight
|
|
* @example
|
|
*
|
|
* function square(n) {
|
|
* return n * n;
|
|
* }
|
|
*
|
|
* var addSquare = _.flow([_.add, square]);
|
|
* addSquare(1, 2);
|
|
* // => 9
|
|
*/
|
|
var flow = createFlow();
|
|
|
|
/**
|
|
* This method is like `_.flow` except that it creates a function that
|
|
* invokes the given functions from right to left.
|
|
*
|
|
* @static
|
|
* @since 3.0.0
|
|
* @memberOf _
|
|
* @category Util
|
|
* @param {...(Function|Function[])} [funcs] The functions to invoke.
|
|
* @returns {Function} Returns the new composite function.
|
|
* @see _.flow
|
|
* @example
|
|
*
|
|
* function square(n) {
|
|
* return n * n;
|
|
* }
|
|
*
|
|
* var addSquare = _.flowRight([square, _.add]);
|
|
* addSquare(1, 2);
|
|
* // => 9
|
|
*/
|
|
var flowRight = createFlow(true);
|
|
|
|
/**
|
|
* This method returns the first argument it receives.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Util
|
|
* @param {*} value Any value.
|
|
* @returns {*} Returns `value`.
|
|
* @example
|
|
*
|
|
* var object = { 'a': 1 };
|
|
*
|
|
* console.log(_.identity(object) === object);
|
|
* // => true
|
|
*/
|
|
function identity(value) {
|
|
return value;
|
|
}
|
|
|
|
/**
|
|
* Creates a function that invokes `func` with the arguments of the created
|
|
* function. If `func` is a property name, the created function returns the
|
|
* property value for a given element. If `func` is an array or object, the
|
|
* created function returns `true` for elements that contain the equivalent
|
|
* source properties, otherwise it returns `false`.
|
|
*
|
|
* @static
|
|
* @since 4.0.0
|
|
* @memberOf _
|
|
* @category Util
|
|
* @param {*} [func=_.identity] The value to convert to a callback.
|
|
* @returns {Function} Returns the callback.
|
|
* @example
|
|
*
|
|
* var users = [
|
|
* { 'user': 'barney', 'age': 36, 'active': true },
|
|
* { 'user': 'fred', 'age': 40, 'active': false }
|
|
* ];
|
|
*
|
|
* // The `_.matches` iteratee shorthand.
|
|
* _.filter(users, _.iteratee({ 'user': 'barney', 'active': true }));
|
|
* // => [{ 'user': 'barney', 'age': 36, 'active': true }]
|
|
*
|
|
* // The `_.matchesProperty` iteratee shorthand.
|
|
* _.filter(users, _.iteratee(['user', 'fred']));
|
|
* // => [{ 'user': 'fred', 'age': 40 }]
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.map(users, _.iteratee('user'));
|
|
* // => ['barney', 'fred']
|
|
*
|
|
* // Create custom iteratee shorthands.
|
|
* _.iteratee = _.wrap(_.iteratee, function(iteratee, func) {
|
|
* return !_.isRegExp(func) ? iteratee(func) : function(string) {
|
|
* return func.test(string);
|
|
* };
|
|
* });
|
|
*
|
|
* _.filter(['abc', 'def'], /ef/);
|
|
* // => ['def']
|
|
*/
|
|
function iteratee(func) {
|
|
return baseIteratee(typeof func == 'function' ? func : baseClone(func, CLONE_DEEP_FLAG));
|
|
}
|
|
|
|
/**
|
|
* Creates a function that performs a partial deep comparison between a given
|
|
* object and `source`, returning `true` if the given object has equivalent
|
|
* property values, else `false`.
|
|
*
|
|
* **Note:** The created function is equivalent to `_.isMatch` with `source`
|
|
* partially applied.
|
|
*
|
|
* Partial comparisons will match empty array and empty object `source`
|
|
* values against any array or object value, respectively. See `_.isEqual`
|
|
* for a list of supported value comparisons.
|
|
*
|
|
* **Note:** Multiple values can be checked by combining several matchers
|
|
* using `_.overSome`
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Util
|
|
* @param {Object} source The object of property values to match.
|
|
* @returns {Function} Returns the new spec function.
|
|
* @example
|
|
*
|
|
* var objects = [
|
|
* { 'a': 1, 'b': 2, 'c': 3 },
|
|
* { 'a': 4, 'b': 5, 'c': 6 }
|
|
* ];
|
|
*
|
|
* _.filter(objects, _.matches({ 'a': 4, 'c': 6 }));
|
|
* // => [{ 'a': 4, 'b': 5, 'c': 6 }]
|
|
*
|
|
* // Checking for several possible values
|
|
* _.filter(objects, _.overSome([_.matches({ 'a': 1 }), _.matches({ 'a': 4 })]));
|
|
* // => [{ 'a': 1, 'b': 2, 'c': 3 }, { 'a': 4, 'b': 5, 'c': 6 }]
|
|
*/
|
|
function matches(source) {
|
|
return baseMatches(baseClone(source, CLONE_DEEP_FLAG));
|
|
}
|
|
|
|
/**
|
|
* Creates a function that performs a partial deep comparison between the
|
|
* value at `path` of a given object to `srcValue`, returning `true` if the
|
|
* object value is equivalent, else `false`.
|
|
*
|
|
* **Note:** Partial comparisons will match empty array and empty object
|
|
* `srcValue` values against any array or object value, respectively. See
|
|
* `_.isEqual` for a list of supported value comparisons.
|
|
*
|
|
* **Note:** Multiple values can be checked by combining several matchers
|
|
* using `_.overSome`
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.2.0
|
|
* @category Util
|
|
* @param {Array|string} path The path of the property to get.
|
|
* @param {*} srcValue The value to match.
|
|
* @returns {Function} Returns the new spec function.
|
|
* @example
|
|
*
|
|
* var objects = [
|
|
* { 'a': 1, 'b': 2, 'c': 3 },
|
|
* { 'a': 4, 'b': 5, 'c': 6 }
|
|
* ];
|
|
*
|
|
* _.find(objects, _.matchesProperty('a', 4));
|
|
* // => { 'a': 4, 'b': 5, 'c': 6 }
|
|
*
|
|
* // Checking for several possible values
|
|
* _.filter(objects, _.overSome([_.matchesProperty('a', 1), _.matchesProperty('a', 4)]));
|
|
* // => [{ 'a': 1, 'b': 2, 'c': 3 }, { 'a': 4, 'b': 5, 'c': 6 }]
|
|
*/
|
|
function matchesProperty(path, srcValue) {
|
|
return baseMatchesProperty(path, baseClone(srcValue, CLONE_DEEP_FLAG));
|
|
}
|
|
|
|
/**
|
|
* Creates a function that invokes the method at `path` of a given object.
|
|
* Any additional arguments are provided to the invoked method.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.7.0
|
|
* @category Util
|
|
* @param {Array|string} path The path of the method to invoke.
|
|
* @param {...*} [args] The arguments to invoke the method with.
|
|
* @returns {Function} Returns the new invoker function.
|
|
* @example
|
|
*
|
|
* var objects = [
|
|
* { 'a': { 'b': _.constant(2) } },
|
|
* { 'a': { 'b': _.constant(1) } }
|
|
* ];
|
|
*
|
|
* _.map(objects, _.method('a.b'));
|
|
* // => [2, 1]
|
|
*
|
|
* _.map(objects, _.method(['a', 'b']));
|
|
* // => [2, 1]
|
|
*/
|
|
var method = baseRest(function(path, args) {
|
|
return function(object) {
|
|
return baseInvoke(object, path, args);
|
|
};
|
|
});
|
|
|
|
/**
|
|
* The opposite of `_.method`; this method creates a function that invokes
|
|
* the method at a given path of `object`. Any additional arguments are
|
|
* provided to the invoked method.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.7.0
|
|
* @category Util
|
|
* @param {Object} object The object to query.
|
|
* @param {...*} [args] The arguments to invoke the method with.
|
|
* @returns {Function} Returns the new invoker function.
|
|
* @example
|
|
*
|
|
* var array = _.times(3, _.constant),
|
|
* object = { 'a': array, 'b': array, 'c': array };
|
|
*
|
|
* _.map(['a[2]', 'c[0]'], _.methodOf(object));
|
|
* // => [2, 0]
|
|
*
|
|
* _.map([['a', '2'], ['c', '0']], _.methodOf(object));
|
|
* // => [2, 0]
|
|
*/
|
|
var methodOf = baseRest(function(object, args) {
|
|
return function(path) {
|
|
return baseInvoke(object, path, args);
|
|
};
|
|
});
|
|
|
|
/**
|
|
* Adds all own enumerable string keyed function properties of a source
|
|
* object to the destination object. If `object` is a function, then methods
|
|
* are added to its prototype as well.
|
|
*
|
|
* **Note:** Use `_.runInContext` to create a pristine `lodash` function to
|
|
* avoid conflicts caused by modifying the original.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Util
|
|
* @param {Function|Object} [object=lodash] The destination object.
|
|
* @param {Object} source The object of functions to add.
|
|
* @param {Object} [options={}] The options object.
|
|
* @param {boolean} [options.chain=true] Specify whether mixins are chainable.
|
|
* @returns {Function|Object} Returns `object`.
|
|
* @example
|
|
*
|
|
* function vowels(string) {
|
|
* return _.filter(string, function(v) {
|
|
* return /[aeiou]/i.test(v);
|
|
* });
|
|
* }
|
|
*
|
|
* _.mixin({ 'vowels': vowels });
|
|
* _.vowels('fred');
|
|
* // => ['e']
|
|
*
|
|
* _('fred').vowels().value();
|
|
* // => ['e']
|
|
*
|
|
* _.mixin({ 'vowels': vowels }, { 'chain': false });
|
|
* _('fred').vowels();
|
|
* // => ['e']
|
|
*/
|
|
function mixin(object, source, options) {
|
|
var props = keys(source),
|
|
methodNames = baseFunctions(source, props);
|
|
|
|
if (options == null &&
|
|
!(isObject(source) && (methodNames.length || !props.length))) {
|
|
options = source;
|
|
source = object;
|
|
object = this;
|
|
methodNames = baseFunctions(source, keys(source));
|
|
}
|
|
var chain = !(isObject(options) && 'chain' in options) || !!options.chain,
|
|
isFunc = isFunction(object);
|
|
|
|
arrayEach(methodNames, function(methodName) {
|
|
var func = source[methodName];
|
|
object[methodName] = func;
|
|
if (isFunc) {
|
|
object.prototype[methodName] = function() {
|
|
var chainAll = this.__chain__;
|
|
if (chain || chainAll) {
|
|
var result = object(this.__wrapped__),
|
|
actions = result.__actions__ = copyArray(this.__actions__);
|
|
|
|
actions.push({ 'func': func, 'args': arguments, 'thisArg': object });
|
|
result.__chain__ = chainAll;
|
|
return result;
|
|
}
|
|
return func.apply(object, arrayPush([this.value()], arguments));
|
|
};
|
|
}
|
|
});
|
|
|
|
return object;
|
|
}
|
|
|
|
/**
|
|
* Reverts the `_` variable to its previous value and returns a reference to
|
|
* the `lodash` function.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Util
|
|
* @returns {Function} Returns the `lodash` function.
|
|
* @example
|
|
*
|
|
* var lodash = _.noConflict();
|
|
*/
|
|
function noConflict() {
|
|
if (root._ === this) {
|
|
root._ = oldDash;
|
|
}
|
|
return this;
|
|
}
|
|
|
|
/**
|
|
* This method returns `undefined`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.3.0
|
|
* @category Util
|
|
* @example
|
|
*
|
|
* _.times(2, _.noop);
|
|
* // => [undefined, undefined]
|
|
*/
|
|
function noop() {
|
|
// No operation performed.
|
|
}
|
|
|
|
/**
|
|
* Creates a function that gets the argument at index `n`. If `n` is negative,
|
|
* the nth argument from the end is returned.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Util
|
|
* @param {number} [n=0] The index of the argument to return.
|
|
* @returns {Function} Returns the new pass-thru function.
|
|
* @example
|
|
*
|
|
* var func = _.nthArg(1);
|
|
* func('a', 'b', 'c', 'd');
|
|
* // => 'b'
|
|
*
|
|
* var func = _.nthArg(-2);
|
|
* func('a', 'b', 'c', 'd');
|
|
* // => 'c'
|
|
*/
|
|
function nthArg(n) {
|
|
n = toInteger(n);
|
|
return baseRest(function(args) {
|
|
return baseNth(args, n);
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Creates a function that invokes `iteratees` with the arguments it receives
|
|
* and returns their results.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Util
|
|
* @param {...(Function|Function[])} [iteratees=[_.identity]]
|
|
* The iteratees to invoke.
|
|
* @returns {Function} Returns the new function.
|
|
* @example
|
|
*
|
|
* var func = _.over([Math.max, Math.min]);
|
|
*
|
|
* func(1, 2, 3, 4);
|
|
* // => [4, 1]
|
|
*/
|
|
var over = createOver(arrayMap);
|
|
|
|
/**
|
|
* Creates a function that checks if **all** of the `predicates` return
|
|
* truthy when invoked with the arguments it receives.
|
|
*
|
|
* Following shorthands are possible for providing predicates.
|
|
* Pass an `Object` and it will be used as an parameter for `_.matches` to create the predicate.
|
|
* Pass an `Array` of parameters for `_.matchesProperty` and the predicate will be created using them.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Util
|
|
* @param {...(Function|Function[])} [predicates=[_.identity]]
|
|
* The predicates to check.
|
|
* @returns {Function} Returns the new function.
|
|
* @example
|
|
*
|
|
* var func = _.overEvery([Boolean, isFinite]);
|
|
*
|
|
* func('1');
|
|
* // => true
|
|
*
|
|
* func(null);
|
|
* // => false
|
|
*
|
|
* func(NaN);
|
|
* // => false
|
|
*/
|
|
var overEvery = createOver(arrayEvery);
|
|
|
|
/**
|
|
* Creates a function that checks if **any** of the `predicates` return
|
|
* truthy when invoked with the arguments it receives.
|
|
*
|
|
* Following shorthands are possible for providing predicates.
|
|
* Pass an `Object` and it will be used as an parameter for `_.matches` to create the predicate.
|
|
* Pass an `Array` of parameters for `_.matchesProperty` and the predicate will be created using them.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Util
|
|
* @param {...(Function|Function[])} [predicates=[_.identity]]
|
|
* The predicates to check.
|
|
* @returns {Function} Returns the new function.
|
|
* @example
|
|
*
|
|
* var func = _.overSome([Boolean, isFinite]);
|
|
*
|
|
* func('1');
|
|
* // => true
|
|
*
|
|
* func(null);
|
|
* // => true
|
|
*
|
|
* func(NaN);
|
|
* // => false
|
|
*
|
|
* var matchesFunc = _.overSome([{ 'a': 1 }, { 'a': 2 }])
|
|
* var matchesPropertyFunc = _.overSome([['a', 1], ['a', 2]])
|
|
*/
|
|
var overSome = createOver(arraySome);
|
|
|
|
/**
|
|
* Creates a function that returns the value at `path` of a given object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 2.4.0
|
|
* @category Util
|
|
* @param {Array|string} path The path of the property to get.
|
|
* @returns {Function} Returns the new accessor function.
|
|
* @example
|
|
*
|
|
* var objects = [
|
|
* { 'a': { 'b': 2 } },
|
|
* { 'a': { 'b': 1 } }
|
|
* ];
|
|
*
|
|
* _.map(objects, _.property('a.b'));
|
|
* // => [2, 1]
|
|
*
|
|
* _.map(_.sortBy(objects, _.property(['a', 'b'])), 'a.b');
|
|
* // => [1, 2]
|
|
*/
|
|
function property(path) {
|
|
return isKey(path) ? baseProperty(toKey(path)) : basePropertyDeep(path);
|
|
}
|
|
|
|
/**
|
|
* The opposite of `_.property`; this method creates a function that returns
|
|
* the value at a given path of `object`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.0.0
|
|
* @category Util
|
|
* @param {Object} object The object to query.
|
|
* @returns {Function} Returns the new accessor function.
|
|
* @example
|
|
*
|
|
* var array = [0, 1, 2],
|
|
* object = { 'a': array, 'b': array, 'c': array };
|
|
*
|
|
* _.map(['a[2]', 'c[0]'], _.propertyOf(object));
|
|
* // => [2, 0]
|
|
*
|
|
* _.map([['a', '2'], ['c', '0']], _.propertyOf(object));
|
|
* // => [2, 0]
|
|
*/
|
|
function propertyOf(object) {
|
|
return function(path) {
|
|
return object == null ? undefined : baseGet(object, path);
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates an array of numbers (positive and/or negative) progressing from
|
|
* `start` up to, but not including, `end`. A step of `-1` is used if a negative
|
|
* `start` is specified without an `end` or `step`. If `end` is not specified,
|
|
* it's set to `start` with `start` then set to `0`.
|
|
*
|
|
* **Note:** JavaScript follows the IEEE-754 standard for resolving
|
|
* floating-point values which can produce unexpected results.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Util
|
|
* @param {number} [start=0] The start of the range.
|
|
* @param {number} end The end of the range.
|
|
* @param {number} [step=1] The value to increment or decrement by.
|
|
* @returns {Array} Returns the range of numbers.
|
|
* @see _.inRange, _.rangeRight
|
|
* @example
|
|
*
|
|
* _.range(4);
|
|
* // => [0, 1, 2, 3]
|
|
*
|
|
* _.range(-4);
|
|
* // => [0, -1, -2, -3]
|
|
*
|
|
* _.range(1, 5);
|
|
* // => [1, 2, 3, 4]
|
|
*
|
|
* _.range(0, 20, 5);
|
|
* // => [0, 5, 10, 15]
|
|
*
|
|
* _.range(0, -4, -1);
|
|
* // => [0, -1, -2, -3]
|
|
*
|
|
* _.range(1, 4, 0);
|
|
* // => [1, 1, 1]
|
|
*
|
|
* _.range(0);
|
|
* // => []
|
|
*/
|
|
var range = createRange();
|
|
|
|
/**
|
|
* This method is like `_.range` except that it populates values in
|
|
* descending order.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Util
|
|
* @param {number} [start=0] The start of the range.
|
|
* @param {number} end The end of the range.
|
|
* @param {number} [step=1] The value to increment or decrement by.
|
|
* @returns {Array} Returns the range of numbers.
|
|
* @see _.inRange, _.range
|
|
* @example
|
|
*
|
|
* _.rangeRight(4);
|
|
* // => [3, 2, 1, 0]
|
|
*
|
|
* _.rangeRight(-4);
|
|
* // => [-3, -2, -1, 0]
|
|
*
|
|
* _.rangeRight(1, 5);
|
|
* // => [4, 3, 2, 1]
|
|
*
|
|
* _.rangeRight(0, 20, 5);
|
|
* // => [15, 10, 5, 0]
|
|
*
|
|
* _.rangeRight(0, -4, -1);
|
|
* // => [-3, -2, -1, 0]
|
|
*
|
|
* _.rangeRight(1, 4, 0);
|
|
* // => [1, 1, 1]
|
|
*
|
|
* _.rangeRight(0);
|
|
* // => []
|
|
*/
|
|
var rangeRight = createRange(true);
|
|
|
|
/**
|
|
* This method returns a new empty array.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.13.0
|
|
* @category Util
|
|
* @returns {Array} Returns the new empty array.
|
|
* @example
|
|
*
|
|
* var arrays = _.times(2, _.stubArray);
|
|
*
|
|
* console.log(arrays);
|
|
* // => [[], []]
|
|
*
|
|
* console.log(arrays[0] === arrays[1]);
|
|
* // => false
|
|
*/
|
|
function stubArray() {
|
|
return [];
|
|
}
|
|
|
|
/**
|
|
* This method returns `false`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.13.0
|
|
* @category Util
|
|
* @returns {boolean} Returns `false`.
|
|
* @example
|
|
*
|
|
* _.times(2, _.stubFalse);
|
|
* // => [false, false]
|
|
*/
|
|
function stubFalse() {
|
|
return false;
|
|
}
|
|
|
|
/**
|
|
* This method returns a new empty object.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.13.0
|
|
* @category Util
|
|
* @returns {Object} Returns the new empty object.
|
|
* @example
|
|
*
|
|
* var objects = _.times(2, _.stubObject);
|
|
*
|
|
* console.log(objects);
|
|
* // => [{}, {}]
|
|
*
|
|
* console.log(objects[0] === objects[1]);
|
|
* // => false
|
|
*/
|
|
function stubObject() {
|
|
return {};
|
|
}
|
|
|
|
/**
|
|
* This method returns an empty string.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.13.0
|
|
* @category Util
|
|
* @returns {string} Returns the empty string.
|
|
* @example
|
|
*
|
|
* _.times(2, _.stubString);
|
|
* // => ['', '']
|
|
*/
|
|
function stubString() {
|
|
return '';
|
|
}
|
|
|
|
/**
|
|
* This method returns `true`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.13.0
|
|
* @category Util
|
|
* @returns {boolean} Returns `true`.
|
|
* @example
|
|
*
|
|
* _.times(2, _.stubTrue);
|
|
* // => [true, true]
|
|
*/
|
|
function stubTrue() {
|
|
return true;
|
|
}
|
|
|
|
/**
|
|
* Invokes the iteratee `n` times, returning an array of the results of
|
|
* each invocation. The iteratee is invoked with one argument; (index).
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Util
|
|
* @param {number} n The number of times to invoke `iteratee`.
|
|
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
|
|
* @returns {Array} Returns the array of results.
|
|
* @example
|
|
*
|
|
* _.times(3, String);
|
|
* // => ['0', '1', '2']
|
|
*
|
|
* _.times(4, _.constant(0));
|
|
* // => [0, 0, 0, 0]
|
|
*/
|
|
function times(n, iteratee) {
|
|
n = toInteger(n);
|
|
if (n < 1 || n > MAX_SAFE_INTEGER) {
|
|
return [];
|
|
}
|
|
var index = MAX_ARRAY_LENGTH,
|
|
length = nativeMin(n, MAX_ARRAY_LENGTH);
|
|
|
|
iteratee = getIteratee(iteratee);
|
|
n -= MAX_ARRAY_LENGTH;
|
|
|
|
var result = baseTimes(length, iteratee);
|
|
while (++index < n) {
|
|
iteratee(index);
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Converts `value` to a property path array.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Util
|
|
* @param {*} value The value to convert.
|
|
* @returns {Array} Returns the new property path array.
|
|
* @example
|
|
*
|
|
* _.toPath('a.b.c');
|
|
* // => ['a', 'b', 'c']
|
|
*
|
|
* _.toPath('a[0].b.c');
|
|
* // => ['a', '0', 'b', 'c']
|
|
*/
|
|
function toPath(value) {
|
|
if (isArray(value)) {
|
|
return arrayMap(value, toKey);
|
|
}
|
|
return isSymbol(value) ? [value] : copyArray(stringToPath(toString(value)));
|
|
}
|
|
|
|
/**
|
|
* Generates a unique ID. If `prefix` is given, the ID is appended to it.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Util
|
|
* @param {string} [prefix=''] The value to prefix the ID with.
|
|
* @returns {string} Returns the unique ID.
|
|
* @example
|
|
*
|
|
* _.uniqueId('contact_');
|
|
* // => 'contact_104'
|
|
*
|
|
* _.uniqueId();
|
|
* // => '105'
|
|
*/
|
|
function uniqueId(prefix) {
|
|
var id = ++idCounter;
|
|
return toString(prefix) + id;
|
|
}
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* Adds two numbers.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.4.0
|
|
* @category Math
|
|
* @param {number} augend The first number in an addition.
|
|
* @param {number} addend The second number in an addition.
|
|
* @returns {number} Returns the total.
|
|
* @example
|
|
*
|
|
* _.add(6, 4);
|
|
* // => 10
|
|
*/
|
|
var add = createMathOperation(function(augend, addend) {
|
|
return augend + addend;
|
|
}, 0);
|
|
|
|
/**
|
|
* Computes `number` rounded up to `precision`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.10.0
|
|
* @category Math
|
|
* @param {number} number The number to round up.
|
|
* @param {number} [precision=0] The precision to round up to.
|
|
* @returns {number} Returns the rounded up number.
|
|
* @example
|
|
*
|
|
* _.ceil(4.006);
|
|
* // => 5
|
|
*
|
|
* _.ceil(6.004, 2);
|
|
* // => 6.01
|
|
*
|
|
* _.ceil(6040, -2);
|
|
* // => 6100
|
|
*/
|
|
var ceil = createRound('ceil');
|
|
|
|
/**
|
|
* Divide two numbers.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.7.0
|
|
* @category Math
|
|
* @param {number} dividend The first number in a division.
|
|
* @param {number} divisor The second number in a division.
|
|
* @returns {number} Returns the quotient.
|
|
* @example
|
|
*
|
|
* _.divide(6, 4);
|
|
* // => 1.5
|
|
*/
|
|
var divide = createMathOperation(function(dividend, divisor) {
|
|
return dividend / divisor;
|
|
}, 1);
|
|
|
|
/**
|
|
* Computes `number` rounded down to `precision`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.10.0
|
|
* @category Math
|
|
* @param {number} number The number to round down.
|
|
* @param {number} [precision=0] The precision to round down to.
|
|
* @returns {number} Returns the rounded down number.
|
|
* @example
|
|
*
|
|
* _.floor(4.006);
|
|
* // => 4
|
|
*
|
|
* _.floor(0.046, 2);
|
|
* // => 0.04
|
|
*
|
|
* _.floor(4060, -2);
|
|
* // => 4000
|
|
*/
|
|
var floor = createRound('floor');
|
|
|
|
/**
|
|
* Computes the maximum value of `array`. If `array` is empty or falsey,
|
|
* `undefined` is returned.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Math
|
|
* @param {Array} array The array to iterate over.
|
|
* @returns {*} Returns the maximum value.
|
|
* @example
|
|
*
|
|
* _.max([4, 2, 8, 6]);
|
|
* // => 8
|
|
*
|
|
* _.max([]);
|
|
* // => undefined
|
|
*/
|
|
function max(array) {
|
|
return (array && array.length)
|
|
? baseExtremum(array, identity, baseGt)
|
|
: undefined;
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.max` except that it accepts `iteratee` which is
|
|
* invoked for each element in `array` to generate the criterion by which
|
|
* the value is ranked. The iteratee is invoked with one argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Math
|
|
* @param {Array} array The array to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {*} Returns the maximum value.
|
|
* @example
|
|
*
|
|
* var objects = [{ 'n': 1 }, { 'n': 2 }];
|
|
*
|
|
* _.maxBy(objects, function(o) { return o.n; });
|
|
* // => { 'n': 2 }
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.maxBy(objects, 'n');
|
|
* // => { 'n': 2 }
|
|
*/
|
|
function maxBy(array, iteratee) {
|
|
return (array && array.length)
|
|
? baseExtremum(array, getIteratee(iteratee, 2), baseGt)
|
|
: undefined;
|
|
}
|
|
|
|
/**
|
|
* Computes the mean of the values in `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Math
|
|
* @param {Array} array The array to iterate over.
|
|
* @returns {number} Returns the mean.
|
|
* @example
|
|
*
|
|
* _.mean([4, 2, 8, 6]);
|
|
* // => 5
|
|
*/
|
|
function mean(array) {
|
|
return baseMean(array, identity);
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.mean` except that it accepts `iteratee` which is
|
|
* invoked for each element in `array` to generate the value to be averaged.
|
|
* The iteratee is invoked with one argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.7.0
|
|
* @category Math
|
|
* @param {Array} array The array to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {number} Returns the mean.
|
|
* @example
|
|
*
|
|
* var objects = [{ 'n': 4 }, { 'n': 2 }, { 'n': 8 }, { 'n': 6 }];
|
|
*
|
|
* _.meanBy(objects, function(o) { return o.n; });
|
|
* // => 5
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.meanBy(objects, 'n');
|
|
* // => 5
|
|
*/
|
|
function meanBy(array, iteratee) {
|
|
return baseMean(array, getIteratee(iteratee, 2));
|
|
}
|
|
|
|
/**
|
|
* Computes the minimum value of `array`. If `array` is empty or falsey,
|
|
* `undefined` is returned.
|
|
*
|
|
* @static
|
|
* @since 0.1.0
|
|
* @memberOf _
|
|
* @category Math
|
|
* @param {Array} array The array to iterate over.
|
|
* @returns {*} Returns the minimum value.
|
|
* @example
|
|
*
|
|
* _.min([4, 2, 8, 6]);
|
|
* // => 2
|
|
*
|
|
* _.min([]);
|
|
* // => undefined
|
|
*/
|
|
function min(array) {
|
|
return (array && array.length)
|
|
? baseExtremum(array, identity, baseLt)
|
|
: undefined;
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.min` except that it accepts `iteratee` which is
|
|
* invoked for each element in `array` to generate the criterion by which
|
|
* the value is ranked. The iteratee is invoked with one argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Math
|
|
* @param {Array} array The array to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {*} Returns the minimum value.
|
|
* @example
|
|
*
|
|
* var objects = [{ 'n': 1 }, { 'n': 2 }];
|
|
*
|
|
* _.minBy(objects, function(o) { return o.n; });
|
|
* // => { 'n': 1 }
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.minBy(objects, 'n');
|
|
* // => { 'n': 1 }
|
|
*/
|
|
function minBy(array, iteratee) {
|
|
return (array && array.length)
|
|
? baseExtremum(array, getIteratee(iteratee, 2), baseLt)
|
|
: undefined;
|
|
}
|
|
|
|
/**
|
|
* Multiply two numbers.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.7.0
|
|
* @category Math
|
|
* @param {number} multiplier The first number in a multiplication.
|
|
* @param {number} multiplicand The second number in a multiplication.
|
|
* @returns {number} Returns the product.
|
|
* @example
|
|
*
|
|
* _.multiply(6, 4);
|
|
* // => 24
|
|
*/
|
|
var multiply = createMathOperation(function(multiplier, multiplicand) {
|
|
return multiplier * multiplicand;
|
|
}, 1);
|
|
|
|
/**
|
|
* Computes `number` rounded to `precision`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.10.0
|
|
* @category Math
|
|
* @param {number} number The number to round.
|
|
* @param {number} [precision=0] The precision to round to.
|
|
* @returns {number} Returns the rounded number.
|
|
* @example
|
|
*
|
|
* _.round(4.006);
|
|
* // => 4
|
|
*
|
|
* _.round(4.006, 2);
|
|
* // => 4.01
|
|
*
|
|
* _.round(4060, -2);
|
|
* // => 4100
|
|
*/
|
|
var round = createRound('round');
|
|
|
|
/**
|
|
* Subtract two numbers.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Math
|
|
* @param {number} minuend The first number in a subtraction.
|
|
* @param {number} subtrahend The second number in a subtraction.
|
|
* @returns {number} Returns the difference.
|
|
* @example
|
|
*
|
|
* _.subtract(6, 4);
|
|
* // => 2
|
|
*/
|
|
var subtract = createMathOperation(function(minuend, subtrahend) {
|
|
return minuend - subtrahend;
|
|
}, 0);
|
|
|
|
/**
|
|
* Computes the sum of the values in `array`.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 3.4.0
|
|
* @category Math
|
|
* @param {Array} array The array to iterate over.
|
|
* @returns {number} Returns the sum.
|
|
* @example
|
|
*
|
|
* _.sum([4, 2, 8, 6]);
|
|
* // => 20
|
|
*/
|
|
function sum(array) {
|
|
return (array && array.length)
|
|
? baseSum(array, identity)
|
|
: 0;
|
|
}
|
|
|
|
/**
|
|
* This method is like `_.sum` except that it accepts `iteratee` which is
|
|
* invoked for each element in `array` to generate the value to be summed.
|
|
* The iteratee is invoked with one argument: (value).
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @since 4.0.0
|
|
* @category Math
|
|
* @param {Array} array The array to iterate over.
|
|
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
|
|
* @returns {number} Returns the sum.
|
|
* @example
|
|
*
|
|
* var objects = [{ 'n': 4 }, { 'n': 2 }, { 'n': 8 }, { 'n': 6 }];
|
|
*
|
|
* _.sumBy(objects, function(o) { return o.n; });
|
|
* // => 20
|
|
*
|
|
* // The `_.property` iteratee shorthand.
|
|
* _.sumBy(objects, 'n');
|
|
* // => 20
|
|
*/
|
|
function sumBy(array, iteratee) {
|
|
return (array && array.length)
|
|
? baseSum(array, getIteratee(iteratee, 2))
|
|
: 0;
|
|
}
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
// Add methods that return wrapped values in chain sequences.
|
|
lodash.after = after;
|
|
lodash.ary = ary;
|
|
lodash.assign = assign;
|
|
lodash.assignIn = assignIn;
|
|
lodash.assignInWith = assignInWith;
|
|
lodash.assignWith = assignWith;
|
|
lodash.at = at;
|
|
lodash.before = before;
|
|
lodash.bind = bind;
|
|
lodash.bindAll = bindAll;
|
|
lodash.bindKey = bindKey;
|
|
lodash.castArray = castArray;
|
|
lodash.chain = chain;
|
|
lodash.chunk = chunk;
|
|
lodash.compact = compact;
|
|
lodash.concat = concat;
|
|
lodash.cond = cond;
|
|
lodash.conforms = conforms;
|
|
lodash.constant = constant;
|
|
lodash.countBy = countBy;
|
|
lodash.create = create;
|
|
lodash.curry = curry;
|
|
lodash.curryRight = curryRight;
|
|
lodash.debounce = debounce;
|
|
lodash.defaults = defaults;
|
|
lodash.defaultsDeep = defaultsDeep;
|
|
lodash.defer = defer;
|
|
lodash.delay = delay;
|
|
lodash.difference = difference;
|
|
lodash.differenceBy = differenceBy;
|
|
lodash.differenceWith = differenceWith;
|
|
lodash.drop = drop;
|
|
lodash.dropRight = dropRight;
|
|
lodash.dropRightWhile = dropRightWhile;
|
|
lodash.dropWhile = dropWhile;
|
|
lodash.fill = fill;
|
|
lodash.filter = filter;
|
|
lodash.flatMap = flatMap;
|
|
lodash.flatMapDeep = flatMapDeep;
|
|
lodash.flatMapDepth = flatMapDepth;
|
|
lodash.flatten = flatten;
|
|
lodash.flattenDeep = flattenDeep;
|
|
lodash.flattenDepth = flattenDepth;
|
|
lodash.flip = flip;
|
|
lodash.flow = flow;
|
|
lodash.flowRight = flowRight;
|
|
lodash.fromPairs = fromPairs;
|
|
lodash.functions = functions;
|
|
lodash.functionsIn = functionsIn;
|
|
lodash.groupBy = groupBy;
|
|
lodash.initial = initial;
|
|
lodash.intersection = intersection;
|
|
lodash.intersectionBy = intersectionBy;
|
|
lodash.intersectionWith = intersectionWith;
|
|
lodash.invert = invert;
|
|
lodash.invertBy = invertBy;
|
|
lodash.invokeMap = invokeMap;
|
|
lodash.iteratee = iteratee;
|
|
lodash.keyBy = keyBy;
|
|
lodash.keys = keys;
|
|
lodash.keysIn = keysIn;
|
|
lodash.map = map;
|
|
lodash.mapKeys = mapKeys;
|
|
lodash.mapValues = mapValues;
|
|
lodash.matches = matches;
|
|
lodash.matchesProperty = matchesProperty;
|
|
lodash.memoize = memoize;
|
|
lodash.merge = merge;
|
|
lodash.mergeWith = mergeWith;
|
|
lodash.method = method;
|
|
lodash.methodOf = methodOf;
|
|
lodash.mixin = mixin;
|
|
lodash.negate = negate;
|
|
lodash.nthArg = nthArg;
|
|
lodash.omit = omit;
|
|
lodash.omitBy = omitBy;
|
|
lodash.once = once;
|
|
lodash.orderBy = orderBy;
|
|
lodash.over = over;
|
|
lodash.overArgs = overArgs;
|
|
lodash.overEvery = overEvery;
|
|
lodash.overSome = overSome;
|
|
lodash.partial = partial;
|
|
lodash.partialRight = partialRight;
|
|
lodash.partition = partition;
|
|
lodash.pick = pick;
|
|
lodash.pickBy = pickBy;
|
|
lodash.property = property;
|
|
lodash.propertyOf = propertyOf;
|
|
lodash.pull = pull;
|
|
lodash.pullAll = pullAll;
|
|
lodash.pullAllBy = pullAllBy;
|
|
lodash.pullAllWith = pullAllWith;
|
|
lodash.pullAt = pullAt;
|
|
lodash.range = range;
|
|
lodash.rangeRight = rangeRight;
|
|
lodash.rearg = rearg;
|
|
lodash.reject = reject;
|
|
lodash.remove = remove;
|
|
lodash.rest = rest;
|
|
lodash.reverse = reverse;
|
|
lodash.sampleSize = sampleSize;
|
|
lodash.set = set;
|
|
lodash.setWith = setWith;
|
|
lodash.shuffle = shuffle;
|
|
lodash.slice = slice;
|
|
lodash.sortBy = sortBy;
|
|
lodash.sortedUniq = sortedUniq;
|
|
lodash.sortedUniqBy = sortedUniqBy;
|
|
lodash.split = split;
|
|
lodash.spread = spread;
|
|
lodash.tail = tail;
|
|
lodash.take = take;
|
|
lodash.takeRight = takeRight;
|
|
lodash.takeRightWhile = takeRightWhile;
|
|
lodash.takeWhile = takeWhile;
|
|
lodash.tap = tap;
|
|
lodash.throttle = throttle;
|
|
lodash.thru = thru;
|
|
lodash.toArray = toArray;
|
|
lodash.toPairs = toPairs;
|
|
lodash.toPairsIn = toPairsIn;
|
|
lodash.toPath = toPath;
|
|
lodash.toPlainObject = toPlainObject;
|
|
lodash.transform = transform;
|
|
lodash.unary = unary;
|
|
lodash.union = union;
|
|
lodash.unionBy = unionBy;
|
|
lodash.unionWith = unionWith;
|
|
lodash.uniq = uniq;
|
|
lodash.uniqBy = uniqBy;
|
|
lodash.uniqWith = uniqWith;
|
|
lodash.unset = unset;
|
|
lodash.unzip = unzip;
|
|
lodash.unzipWith = unzipWith;
|
|
lodash.update = update;
|
|
lodash.updateWith = updateWith;
|
|
lodash.values = values;
|
|
lodash.valuesIn = valuesIn;
|
|
lodash.without = without;
|
|
lodash.words = words;
|
|
lodash.wrap = wrap;
|
|
lodash.xor = xor;
|
|
lodash.xorBy = xorBy;
|
|
lodash.xorWith = xorWith;
|
|
lodash.zip = zip;
|
|
lodash.zipObject = zipObject;
|
|
lodash.zipObjectDeep = zipObjectDeep;
|
|
lodash.zipWith = zipWith;
|
|
|
|
// Add aliases.
|
|
lodash.entries = toPairs;
|
|
lodash.entriesIn = toPairsIn;
|
|
lodash.extend = assignIn;
|
|
lodash.extendWith = assignInWith;
|
|
|
|
// Add methods to `lodash.prototype`.
|
|
mixin(lodash, lodash);
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
// Add methods that return unwrapped values in chain sequences.
|
|
lodash.add = add;
|
|
lodash.attempt = attempt;
|
|
lodash.camelCase = camelCase;
|
|
lodash.capitalize = capitalize;
|
|
lodash.ceil = ceil;
|
|
lodash.clamp = clamp;
|
|
lodash.clone = clone;
|
|
lodash.cloneDeep = cloneDeep;
|
|
lodash.cloneDeepWith = cloneDeepWith;
|
|
lodash.cloneWith = cloneWith;
|
|
lodash.conformsTo = conformsTo;
|
|
lodash.deburr = deburr;
|
|
lodash.defaultTo = defaultTo;
|
|
lodash.divide = divide;
|
|
lodash.endsWith = endsWith;
|
|
lodash.eq = eq;
|
|
lodash.escape = escape;
|
|
lodash.escapeRegExp = escapeRegExp;
|
|
lodash.every = every;
|
|
lodash.find = find;
|
|
lodash.findIndex = findIndex;
|
|
lodash.findKey = findKey;
|
|
lodash.findLast = findLast;
|
|
lodash.findLastIndex = findLastIndex;
|
|
lodash.findLastKey = findLastKey;
|
|
lodash.floor = floor;
|
|
lodash.forEach = forEach;
|
|
lodash.forEachRight = forEachRight;
|
|
lodash.forIn = forIn;
|
|
lodash.forInRight = forInRight;
|
|
lodash.forOwn = forOwn;
|
|
lodash.forOwnRight = forOwnRight;
|
|
lodash.get = get;
|
|
lodash.gt = gt;
|
|
lodash.gte = gte;
|
|
lodash.has = has;
|
|
lodash.hasIn = hasIn;
|
|
lodash.head = head;
|
|
lodash.identity = identity;
|
|
lodash.includes = includes;
|
|
lodash.indexOf = indexOf;
|
|
lodash.inRange = inRange;
|
|
lodash.invoke = invoke;
|
|
lodash.isArguments = isArguments;
|
|
lodash.isArray = isArray;
|
|
lodash.isArrayBuffer = isArrayBuffer;
|
|
lodash.isArrayLike = isArrayLike;
|
|
lodash.isArrayLikeObject = isArrayLikeObject;
|
|
lodash.isBoolean = isBoolean;
|
|
lodash.isBuffer = isBuffer;
|
|
lodash.isDate = isDate;
|
|
lodash.isElement = isElement;
|
|
lodash.isEmpty = isEmpty;
|
|
lodash.isEqual = isEqual;
|
|
lodash.isEqualWith = isEqualWith;
|
|
lodash.isError = isError;
|
|
lodash.isFinite = isFinite;
|
|
lodash.isFunction = isFunction;
|
|
lodash.isInteger = isInteger;
|
|
lodash.isLength = isLength;
|
|
lodash.isMap = isMap;
|
|
lodash.isMatch = isMatch;
|
|
lodash.isMatchWith = isMatchWith;
|
|
lodash.isNaN = isNaN;
|
|
lodash.isNative = isNative;
|
|
lodash.isNil = isNil;
|
|
lodash.isNull = isNull;
|
|
lodash.isNumber = isNumber;
|
|
lodash.isObject = isObject;
|
|
lodash.isObjectLike = isObjectLike;
|
|
lodash.isPlainObject = isPlainObject;
|
|
lodash.isRegExp = isRegExp;
|
|
lodash.isSafeInteger = isSafeInteger;
|
|
lodash.isSet = isSet;
|
|
lodash.isString = isString;
|
|
lodash.isSymbol = isSymbol;
|
|
lodash.isTypedArray = isTypedArray;
|
|
lodash.isUndefined = isUndefined;
|
|
lodash.isWeakMap = isWeakMap;
|
|
lodash.isWeakSet = isWeakSet;
|
|
lodash.join = join;
|
|
lodash.kebabCase = kebabCase;
|
|
lodash.last = last;
|
|
lodash.lastIndexOf = lastIndexOf;
|
|
lodash.lowerCase = lowerCase;
|
|
lodash.lowerFirst = lowerFirst;
|
|
lodash.lt = lt;
|
|
lodash.lte = lte;
|
|
lodash.max = max;
|
|
lodash.maxBy = maxBy;
|
|
lodash.mean = mean;
|
|
lodash.meanBy = meanBy;
|
|
lodash.min = min;
|
|
lodash.minBy = minBy;
|
|
lodash.stubArray = stubArray;
|
|
lodash.stubFalse = stubFalse;
|
|
lodash.stubObject = stubObject;
|
|
lodash.stubString = stubString;
|
|
lodash.stubTrue = stubTrue;
|
|
lodash.multiply = multiply;
|
|
lodash.nth = nth;
|
|
lodash.noConflict = noConflict;
|
|
lodash.noop = noop;
|
|
lodash.now = now;
|
|
lodash.pad = pad;
|
|
lodash.padEnd = padEnd;
|
|
lodash.padStart = padStart;
|
|
lodash.parseInt = parseInt;
|
|
lodash.random = random;
|
|
lodash.reduce = reduce;
|
|
lodash.reduceRight = reduceRight;
|
|
lodash.repeat = repeat;
|
|
lodash.replace = replace;
|
|
lodash.result = result;
|
|
lodash.round = round;
|
|
lodash.runInContext = runInContext;
|
|
lodash.sample = sample;
|
|
lodash.size = size;
|
|
lodash.snakeCase = snakeCase;
|
|
lodash.some = some;
|
|
lodash.sortedIndex = sortedIndex;
|
|
lodash.sortedIndexBy = sortedIndexBy;
|
|
lodash.sortedIndexOf = sortedIndexOf;
|
|
lodash.sortedLastIndex = sortedLastIndex;
|
|
lodash.sortedLastIndexBy = sortedLastIndexBy;
|
|
lodash.sortedLastIndexOf = sortedLastIndexOf;
|
|
lodash.startCase = startCase;
|
|
lodash.startsWith = startsWith;
|
|
lodash.subtract = subtract;
|
|
lodash.sum = sum;
|
|
lodash.sumBy = sumBy;
|
|
lodash.template = template;
|
|
lodash.times = times;
|
|
lodash.toFinite = toFinite;
|
|
lodash.toInteger = toInteger;
|
|
lodash.toLength = toLength;
|
|
lodash.toLower = toLower;
|
|
lodash.toNumber = toNumber;
|
|
lodash.toSafeInteger = toSafeInteger;
|
|
lodash.toString = toString;
|
|
lodash.toUpper = toUpper;
|
|
lodash.trim = trim;
|
|
lodash.trimEnd = trimEnd;
|
|
lodash.trimStart = trimStart;
|
|
lodash.truncate = truncate;
|
|
lodash.unescape = unescape;
|
|
lodash.uniqueId = uniqueId;
|
|
lodash.upperCase = upperCase;
|
|
lodash.upperFirst = upperFirst;
|
|
|
|
// Add aliases.
|
|
lodash.each = forEach;
|
|
lodash.eachRight = forEachRight;
|
|
lodash.first = head;
|
|
|
|
mixin(lodash, (function() {
|
|
var source = {};
|
|
baseForOwn(lodash, function(func, methodName) {
|
|
if (!hasOwnProperty.call(lodash.prototype, methodName)) {
|
|
source[methodName] = func;
|
|
}
|
|
});
|
|
return source;
|
|
}()), { 'chain': false });
|
|
|
|
/*------------------------------------------------------------------------*/
|
|
|
|
/**
|
|
* The semantic version number.
|
|
*
|
|
* @static
|
|
* @memberOf _
|
|
* @type {string}
|
|
*/
|
|
lodash.VERSION = VERSION;
|
|
|
|
// Assign default placeholders.
|
|
arrayEach(['bind', 'bindKey', 'curry', 'curryRight', 'partial', 'partialRight'], function(methodName) {
|
|
lodash[methodName].placeholder = lodash;
|
|
});
|
|
|
|
// Add `LazyWrapper` methods for `_.drop` and `_.take` variants.
|
|
arrayEach(['drop', 'take'], function(methodName, index) {
|
|
LazyWrapper.prototype[methodName] = function(n) {
|
|
n = n === undefined ? 1 : nativeMax(toInteger(n), 0);
|
|
|
|
var result = (this.__filtered__ && !index)
|
|
? new LazyWrapper(this)
|
|
: this.clone();
|
|
|
|
if (result.__filtered__) {
|
|
result.__takeCount__ = nativeMin(n, result.__takeCount__);
|
|
} else {
|
|
result.__views__.push({
|
|
'size': nativeMin(n, MAX_ARRAY_LENGTH),
|
|
'type': methodName + (result.__dir__ < 0 ? 'Right' : '')
|
|
});
|
|
}
|
|
return result;
|
|
};
|
|
|
|
LazyWrapper.prototype[methodName + 'Right'] = function(n) {
|
|
return this.reverse()[methodName](n).reverse();
|
|
};
|
|
});
|
|
|
|
// Add `LazyWrapper` methods that accept an `iteratee` value.
|
|
arrayEach(['filter', 'map', 'takeWhile'], function(methodName, index) {
|
|
var type = index + 1,
|
|
isFilter = type == LAZY_FILTER_FLAG || type == LAZY_WHILE_FLAG;
|
|
|
|
LazyWrapper.prototype[methodName] = function(iteratee) {
|
|
var result = this.clone();
|
|
result.__iteratees__.push({
|
|
'iteratee': getIteratee(iteratee, 3),
|
|
'type': type
|
|
});
|
|
result.__filtered__ = result.__filtered__ || isFilter;
|
|
return result;
|
|
};
|
|
});
|
|
|
|
// Add `LazyWrapper` methods for `_.head` and `_.last`.
|
|
arrayEach(['head', 'last'], function(methodName, index) {
|
|
var takeName = 'take' + (index ? 'Right' : '');
|
|
|
|
LazyWrapper.prototype[methodName] = function() {
|
|
return this[takeName](1).value()[0];
|
|
};
|
|
});
|
|
|
|
// Add `LazyWrapper` methods for `_.initial` and `_.tail`.
|
|
arrayEach(['initial', 'tail'], function(methodName, index) {
|
|
var dropName = 'drop' + (index ? '' : 'Right');
|
|
|
|
LazyWrapper.prototype[methodName] = function() {
|
|
return this.__filtered__ ? new LazyWrapper(this) : this[dropName](1);
|
|
};
|
|
});
|
|
|
|
LazyWrapper.prototype.compact = function() {
|
|
return this.filter(identity);
|
|
};
|
|
|
|
LazyWrapper.prototype.find = function(predicate) {
|
|
return this.filter(predicate).head();
|
|
};
|
|
|
|
LazyWrapper.prototype.findLast = function(predicate) {
|
|
return this.reverse().find(predicate);
|
|
};
|
|
|
|
LazyWrapper.prototype.invokeMap = baseRest(function(path, args) {
|
|
if (typeof path == 'function') {
|
|
return new LazyWrapper(this);
|
|
}
|
|
return this.map(function(value) {
|
|
return baseInvoke(value, path, args);
|
|
});
|
|
});
|
|
|
|
LazyWrapper.prototype.reject = function(predicate) {
|
|
return this.filter(negate(getIteratee(predicate)));
|
|
};
|
|
|
|
LazyWrapper.prototype.slice = function(start, end) {
|
|
start = toInteger(start);
|
|
|
|
var result = this;
|
|
if (result.__filtered__ && (start > 0 || end < 0)) {
|
|
return new LazyWrapper(result);
|
|
}
|
|
if (start < 0) {
|
|
result = result.takeRight(-start);
|
|
} else if (start) {
|
|
result = result.drop(start);
|
|
}
|
|
if (end !== undefined) {
|
|
end = toInteger(end);
|
|
result = end < 0 ? result.dropRight(-end) : result.take(end - start);
|
|
}
|
|
return result;
|
|
};
|
|
|
|
LazyWrapper.prototype.takeRightWhile = function(predicate) {
|
|
return this.reverse().takeWhile(predicate).reverse();
|
|
};
|
|
|
|
LazyWrapper.prototype.toArray = function() {
|
|
return this.take(MAX_ARRAY_LENGTH);
|
|
};
|
|
|
|
// Add `LazyWrapper` methods to `lodash.prototype`.
|
|
baseForOwn(LazyWrapper.prototype, function(func, methodName) {
|
|
var checkIteratee = /^(?:filter|find|map|reject)|While$/.test(methodName),
|
|
isTaker = /^(?:head|last)$/.test(methodName),
|
|
lodashFunc = lodash[isTaker ? ('take' + (methodName == 'last' ? 'Right' : '')) : methodName],
|
|
retUnwrapped = isTaker || /^find/.test(methodName);
|
|
|
|
if (!lodashFunc) {
|
|
return;
|
|
}
|
|
lodash.prototype[methodName] = function() {
|
|
var value = this.__wrapped__,
|
|
args = isTaker ? [1] : arguments,
|
|
isLazy = value instanceof LazyWrapper,
|
|
iteratee = args[0],
|
|
useLazy = isLazy || isArray(value);
|
|
|
|
var interceptor = function(value) {
|
|
var result = lodashFunc.apply(lodash, arrayPush([value], args));
|
|
return (isTaker && chainAll) ? result[0] : result;
|
|
};
|
|
|
|
if (useLazy && checkIteratee && typeof iteratee == 'function' && iteratee.length != 1) {
|
|
// Avoid lazy use if the iteratee has a "length" value other than `1`.
|
|
isLazy = useLazy = false;
|
|
}
|
|
var chainAll = this.__chain__,
|
|
isHybrid = !!this.__actions__.length,
|
|
isUnwrapped = retUnwrapped && !chainAll,
|
|
onlyLazy = isLazy && !isHybrid;
|
|
|
|
if (!retUnwrapped && useLazy) {
|
|
value = onlyLazy ? value : new LazyWrapper(this);
|
|
var result = func.apply(value, args);
|
|
result.__actions__.push({ 'func': thru, 'args': [interceptor], 'thisArg': undefined });
|
|
return new LodashWrapper(result, chainAll);
|
|
}
|
|
if (isUnwrapped && onlyLazy) {
|
|
return func.apply(this, args);
|
|
}
|
|
result = this.thru(interceptor);
|
|
return isUnwrapped ? (isTaker ? result.value()[0] : result.value()) : result;
|
|
};
|
|
});
|
|
|
|
// Add `Array` methods to `lodash.prototype`.
|
|
arrayEach(['pop', 'push', 'shift', 'sort', 'splice', 'unshift'], function(methodName) {
|
|
var func = arrayProto[methodName],
|
|
chainName = /^(?:push|sort|unshift)$/.test(methodName) ? 'tap' : 'thru',
|
|
retUnwrapped = /^(?:pop|shift)$/.test(methodName);
|
|
|
|
lodash.prototype[methodName] = function() {
|
|
var args = arguments;
|
|
if (retUnwrapped && !this.__chain__) {
|
|
var value = this.value();
|
|
return func.apply(isArray(value) ? value : [], args);
|
|
}
|
|
return this[chainName](function(value) {
|
|
return func.apply(isArray(value) ? value : [], args);
|
|
});
|
|
};
|
|
});
|
|
|
|
// Map minified method names to their real names.
|
|
baseForOwn(LazyWrapper.prototype, function(func, methodName) {
|
|
var lodashFunc = lodash[methodName];
|
|
if (lodashFunc) {
|
|
var key = lodashFunc.name + '';
|
|
if (!hasOwnProperty.call(realNames, key)) {
|
|
realNames[key] = [];
|
|
}
|
|
realNames[key].push({ 'name': methodName, 'func': lodashFunc });
|
|
}
|
|
});
|
|
|
|
realNames[createHybrid(undefined, WRAP_BIND_KEY_FLAG).name] = [{
|
|
'name': 'wrapper',
|
|
'func': undefined
|
|
}];
|
|
|
|
// Add methods to `LazyWrapper`.
|
|
LazyWrapper.prototype.clone = lazyClone;
|
|
LazyWrapper.prototype.reverse = lazyReverse;
|
|
LazyWrapper.prototype.value = lazyValue;
|
|
|
|
// Add chain sequence methods to the `lodash` wrapper.
|
|
lodash.prototype.at = wrapperAt;
|
|
lodash.prototype.chain = wrapperChain;
|
|
lodash.prototype.commit = wrapperCommit;
|
|
lodash.prototype.next = wrapperNext;
|
|
lodash.prototype.plant = wrapperPlant;
|
|
lodash.prototype.reverse = wrapperReverse;
|
|
lodash.prototype.toJSON = lodash.prototype.valueOf = lodash.prototype.value = wrapperValue;
|
|
|
|
// Add lazy aliases.
|
|
lodash.prototype.first = lodash.prototype.head;
|
|
|
|
if (symIterator) {
|
|
lodash.prototype[symIterator] = wrapperToIterator;
|
|
}
|
|
return lodash;
|
|
});
|
|
|
|
/*--------------------------------------------------------------------------*/
|
|
|
|
// Export lodash.
|
|
var _ = runInContext();
|
|
|
|
// Some AMD build optimizers, like r.js, check for condition patterns like:
|
|
if (true) {
|
|
// Expose Lodash on the global object to prevent errors when Lodash is
|
|
// loaded by a script tag in the presence of an AMD loader.
|
|
// See http://requirejs.org/docs/errors.html#mismatch for more details.
|
|
// Use `_.noConflict` to remove Lodash from the global object.
|
|
root._ = _;
|
|
|
|
// Define as an anonymous module so, through path mapping, it can be
|
|
// referenced as the "underscore" module.
|
|
!(__WEBPACK_AMD_DEFINE_RESULT__ = (function() {
|
|
return _;
|
|
}).call(exports, __webpack_require__, exports, module),
|
|
__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
|
|
}
|
|
// Check for `exports` after `define` in case a build optimizer adds it.
|
|
else {}
|
|
}.call(this));
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/scss/app.scss":
|
|
/*!*********************************!*\
|
|
!*** ./resources/scss/app.scss ***!
|
|
\*********************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
// extracted by mini-css-extract-plugin
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/process/browser.js":
|
|
/*!*****************************************!*\
|
|
!*** ./node_modules/process/browser.js ***!
|
|
\*****************************************/
|
|
/***/ ((module) => {
|
|
|
|
// shim for using process in browser
|
|
var process = module.exports = {};
|
|
|
|
// cached from whatever global is present so that test runners that stub it
|
|
// don't break things. But we need to wrap it in a try catch in case it is
|
|
// wrapped in strict mode code which doesn't define any globals. It's inside a
|
|
// function because try/catches deoptimize in certain engines.
|
|
|
|
var cachedSetTimeout;
|
|
var cachedClearTimeout;
|
|
|
|
function defaultSetTimout() {
|
|
throw new Error('setTimeout has not been defined');
|
|
}
|
|
function defaultClearTimeout () {
|
|
throw new Error('clearTimeout has not been defined');
|
|
}
|
|
(function () {
|
|
try {
|
|
if (typeof setTimeout === 'function') {
|
|
cachedSetTimeout = setTimeout;
|
|
} else {
|
|
cachedSetTimeout = defaultSetTimout;
|
|
}
|
|
} catch (e) {
|
|
cachedSetTimeout = defaultSetTimout;
|
|
}
|
|
try {
|
|
if (typeof clearTimeout === 'function') {
|
|
cachedClearTimeout = clearTimeout;
|
|
} else {
|
|
cachedClearTimeout = defaultClearTimeout;
|
|
}
|
|
} catch (e) {
|
|
cachedClearTimeout = defaultClearTimeout;
|
|
}
|
|
} ())
|
|
function runTimeout(fun) {
|
|
if (cachedSetTimeout === setTimeout) {
|
|
//normal enviroments in sane situations
|
|
return setTimeout(fun, 0);
|
|
}
|
|
// if setTimeout wasn't available but was latter defined
|
|
if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {
|
|
cachedSetTimeout = setTimeout;
|
|
return setTimeout(fun, 0);
|
|
}
|
|
try {
|
|
// when when somebody has screwed with setTimeout but no I.E. maddness
|
|
return cachedSetTimeout(fun, 0);
|
|
} catch(e){
|
|
try {
|
|
// When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
|
|
return cachedSetTimeout.call(null, fun, 0);
|
|
} catch(e){
|
|
// same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error
|
|
return cachedSetTimeout.call(this, fun, 0);
|
|
}
|
|
}
|
|
|
|
|
|
}
|
|
function runClearTimeout(marker) {
|
|
if (cachedClearTimeout === clearTimeout) {
|
|
//normal enviroments in sane situations
|
|
return clearTimeout(marker);
|
|
}
|
|
// if clearTimeout wasn't available but was latter defined
|
|
if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {
|
|
cachedClearTimeout = clearTimeout;
|
|
return clearTimeout(marker);
|
|
}
|
|
try {
|
|
// when when somebody has screwed with setTimeout but no I.E. maddness
|
|
return cachedClearTimeout(marker);
|
|
} catch (e){
|
|
try {
|
|
// When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
|
|
return cachedClearTimeout.call(null, marker);
|
|
} catch (e){
|
|
// same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.
|
|
// Some versions of I.E. have different rules for clearTimeout vs setTimeout
|
|
return cachedClearTimeout.call(this, marker);
|
|
}
|
|
}
|
|
|
|
|
|
|
|
}
|
|
var queue = [];
|
|
var draining = false;
|
|
var currentQueue;
|
|
var queueIndex = -1;
|
|
|
|
function cleanUpNextTick() {
|
|
if (!draining || !currentQueue) {
|
|
return;
|
|
}
|
|
draining = false;
|
|
if (currentQueue.length) {
|
|
queue = currentQueue.concat(queue);
|
|
} else {
|
|
queueIndex = -1;
|
|
}
|
|
if (queue.length) {
|
|
drainQueue();
|
|
}
|
|
}
|
|
|
|
function drainQueue() {
|
|
if (draining) {
|
|
return;
|
|
}
|
|
var timeout = runTimeout(cleanUpNextTick);
|
|
draining = true;
|
|
|
|
var len = queue.length;
|
|
while(len) {
|
|
currentQueue = queue;
|
|
queue = [];
|
|
while (++queueIndex < len) {
|
|
if (currentQueue) {
|
|
currentQueue[queueIndex].run();
|
|
}
|
|
}
|
|
queueIndex = -1;
|
|
len = queue.length;
|
|
}
|
|
currentQueue = null;
|
|
draining = false;
|
|
runClearTimeout(timeout);
|
|
}
|
|
|
|
process.nextTick = function (fun) {
|
|
var args = new Array(arguments.length - 1);
|
|
if (arguments.length > 1) {
|
|
for (var i = 1; i < arguments.length; i++) {
|
|
args[i - 1] = arguments[i];
|
|
}
|
|
}
|
|
queue.push(new Item(fun, args));
|
|
if (queue.length === 1 && !draining) {
|
|
runTimeout(drainQueue);
|
|
}
|
|
};
|
|
|
|
// v8 likes predictible objects
|
|
function Item(fun, array) {
|
|
this.fun = fun;
|
|
this.array = array;
|
|
}
|
|
Item.prototype.run = function () {
|
|
this.fun.apply(null, this.array);
|
|
};
|
|
process.title = 'browser';
|
|
process.browser = true;
|
|
process.env = {};
|
|
process.argv = [];
|
|
process.version = ''; // empty string to avoid regexp issues
|
|
process.versions = {};
|
|
|
|
function noop() {}
|
|
|
|
process.on = noop;
|
|
process.addListener = noop;
|
|
process.once = noop;
|
|
process.off = noop;
|
|
process.removeListener = noop;
|
|
process.removeAllListeners = noop;
|
|
process.emit = noop;
|
|
process.prependListener = noop;
|
|
process.prependOnceListener = noop;
|
|
|
|
process.listeners = function (name) { return [] }
|
|
|
|
process.binding = function (name) {
|
|
throw new Error('process.binding is not supported');
|
|
};
|
|
|
|
process.cwd = function () { return '/' };
|
|
process.chdir = function (dir) {
|
|
throw new Error('process.chdir is not supported');
|
|
};
|
|
process.umask = function() { return 0; };
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/apps/App.vue":
|
|
/*!***********************************!*\
|
|
!*** ./resources/js/apps/App.vue ***!
|
|
\***********************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _App_vue_vue_type_template_id_2dea4962__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./App.vue?vue&type=template&id=2dea4962 */ "./resources/js/apps/App.vue?vue&type=template&id=2dea4962");
|
|
|
|
const script = {}
|
|
script.render = _App_vue_vue_type_template_id_2dea4962__WEBPACK_IMPORTED_MODULE_0__.render
|
|
/* hot reload */
|
|
if (false) {}
|
|
|
|
script.__file = "resources/js/apps/App.vue"
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (script);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/BlogPopular.vue":
|
|
/*!*************************************************!*\
|
|
!*** ./resources/js/components/BlogPopular.vue ***!
|
|
\*************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _BlogPopular_vue_vue_type_template_id_3498cf88__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./BlogPopular.vue?vue&type=template&id=3498cf88 */ "./resources/js/components/BlogPopular.vue?vue&type=template&id=3498cf88");
|
|
|
|
const script = {}
|
|
script.render = _BlogPopular_vue_vue_type_template_id_3498cf88__WEBPACK_IMPORTED_MODULE_0__.render
|
|
/* hot reload */
|
|
if (false) {}
|
|
|
|
script.__file = "resources/js/components/BlogPopular.vue"
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (script);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/BlogRecent.vue":
|
|
/*!************************************************!*\
|
|
!*** ./resources/js/components/BlogRecent.vue ***!
|
|
\************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _BlogRecent_vue_vue_type_template_id_6b89b6c8__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./BlogRecent.vue?vue&type=template&id=6b89b6c8 */ "./resources/js/components/BlogRecent.vue?vue&type=template&id=6b89b6c8");
|
|
|
|
const script = {}
|
|
script.render = _BlogRecent_vue_vue_type_template_id_6b89b6c8__WEBPACK_IMPORTED_MODULE_0__.render
|
|
/* hot reload */
|
|
if (false) {}
|
|
|
|
script.__file = "resources/js/components/BlogRecent.vue"
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (script);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/Container.vue":
|
|
/*!***********************************************!*\
|
|
!*** ./resources/js/components/Container.vue ***!
|
|
\***********************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _Container_vue_vue_type_template_id_ba1063b4__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./Container.vue?vue&type=template&id=ba1063b4 */ "./resources/js/components/Container.vue?vue&type=template&id=ba1063b4");
|
|
|
|
const script = {}
|
|
script.render = _Container_vue_vue_type_template_id_ba1063b4__WEBPACK_IMPORTED_MODULE_0__.render
|
|
/* hot reload */
|
|
if (false) {}
|
|
|
|
script.__file = "resources/js/components/Container.vue"
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (script);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/PageFooter.vue":
|
|
/*!************************************************!*\
|
|
!*** ./resources/js/components/PageFooter.vue ***!
|
|
\************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _PageFooter_vue_vue_type_template_id_5e81b4b5__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./PageFooter.vue?vue&type=template&id=5e81b4b5 */ "./resources/js/components/PageFooter.vue?vue&type=template&id=5e81b4b5");
|
|
|
|
const script = {}
|
|
script.render = _PageFooter_vue_vue_type_template_id_5e81b4b5__WEBPACK_IMPORTED_MODULE_0__.render
|
|
/* hot reload */
|
|
if (false) {}
|
|
|
|
script.__file = "resources/js/components/PageFooter.vue"
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (script);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/PageHeader.vue":
|
|
/*!************************************************!*\
|
|
!*** ./resources/js/components/PageHeader.vue ***!
|
|
\************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _PageHeader_vue_vue_type_template_id_7fb418a7__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./PageHeader.vue?vue&type=template&id=7fb418a7 */ "./resources/js/components/PageHeader.vue?vue&type=template&id=7fb418a7");
|
|
/* harmony import */ var _PageHeader_vue_vue_type_script_lang_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! ./PageHeader.vue?vue&type=script&lang=js */ "./resources/js/components/PageHeader.vue?vue&type=script&lang=js");
|
|
|
|
|
|
|
|
_PageHeader_vue_vue_type_script_lang_js__WEBPACK_IMPORTED_MODULE_1__.default.render = _PageHeader_vue_vue_type_template_id_7fb418a7__WEBPACK_IMPORTED_MODULE_0__.render
|
|
/* hot reload */
|
|
if (false) {}
|
|
|
|
_PageHeader_vue_vue_type_script_lang_js__WEBPACK_IMPORTED_MODULE_1__.default.__file = "resources/js/components/PageHeader.vue"
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (_PageHeader_vue_vue_type_script_lang_js__WEBPACK_IMPORTED_MODULE_1__.default);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/SiteNav.vue":
|
|
/*!*********************************************!*\
|
|
!*** ./resources/js/components/SiteNav.vue ***!
|
|
\*********************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _SiteNav_vue_vue_type_template_id_3cf6587e__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./SiteNav.vue?vue&type=template&id=3cf6587e */ "./resources/js/components/SiteNav.vue?vue&type=template&id=3cf6587e");
|
|
|
|
const script = {}
|
|
script.render = _SiteNav_vue_vue_type_template_id_3cf6587e__WEBPACK_IMPORTED_MODULE_0__.render
|
|
/* hot reload */
|
|
if (false) {}
|
|
|
|
script.__file = "resources/js/components/SiteNav.vue"
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (script);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/SplitContent.vue":
|
|
/*!**************************************************!*\
|
|
!*** ./resources/js/components/SplitContent.vue ***!
|
|
\**************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _SplitContent_vue_vue_type_template_id_1553872c__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./SplitContent.vue?vue&type=template&id=1553872c */ "./resources/js/components/SplitContent.vue?vue&type=template&id=1553872c");
|
|
|
|
const script = {}
|
|
script.render = _SplitContent_vue_vue_type_template_id_1553872c__WEBPACK_IMPORTED_MODULE_0__.render
|
|
/* hot reload */
|
|
if (false) {}
|
|
|
|
script.__file = "resources/js/components/SplitContent.vue"
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (script);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/views/Blog.vue":
|
|
/*!*************************************!*\
|
|
!*** ./resources/js/views/Blog.vue ***!
|
|
\*************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
const script = {}
|
|
script.__file = "resources/js/views/Blog.vue"
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (script);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/views/Contact.vue":
|
|
/*!****************************************!*\
|
|
!*** ./resources/js/views/Contact.vue ***!
|
|
\****************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
const script = {}
|
|
script.__file = "resources/js/views/Contact.vue"
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (script);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/views/Home.vue":
|
|
/*!*************************************!*\
|
|
!*** ./resources/js/views/Home.vue ***!
|
|
\*************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _Home_vue_vue_type_template_id_63cd6604__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./Home.vue?vue&type=template&id=63cd6604 */ "./resources/js/views/Home.vue?vue&type=template&id=63cd6604");
|
|
/* harmony import */ var _Home_vue_vue_type_script_lang_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! ./Home.vue?vue&type=script&lang=js */ "./resources/js/views/Home.vue?vue&type=script&lang=js");
|
|
|
|
|
|
|
|
_Home_vue_vue_type_script_lang_js__WEBPACK_IMPORTED_MODULE_1__.default.render = _Home_vue_vue_type_template_id_63cd6604__WEBPACK_IMPORTED_MODULE_0__.render
|
|
/* hot reload */
|
|
if (false) {}
|
|
|
|
_Home_vue_vue_type_script_lang_js__WEBPACK_IMPORTED_MODULE_1__.default.__file = "resources/js/views/Home.vue"
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (_Home_vue_vue_type_script_lang_js__WEBPACK_IMPORTED_MODULE_1__.default);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/views/Snippets.vue":
|
|
/*!*****************************************!*\
|
|
!*** ./resources/js/views/Snippets.vue ***!
|
|
\*****************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (__WEBPACK_DEFAULT_EXPORT__)
|
|
/* harmony export */ });
|
|
const script = {}
|
|
script.__file = "resources/js/views/Snippets.vue"
|
|
|
|
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (script);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/PageHeader.vue?vue&type=script&lang=js":
|
|
/*!************************************************************************!*\
|
|
!*** ./resources/js/components/PageHeader.vue?vue&type=script&lang=js ***!
|
|
\************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (/* reexport safe */ _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_PageHeader_vue_vue_type_script_lang_js__WEBPACK_IMPORTED_MODULE_0__.default)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_PageHeader_vue_vue_type_script_lang_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!../../../node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./PageHeader.vue?vue&type=script&lang=js */ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/PageHeader.vue?vue&type=script&lang=js");
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/views/Home.vue?vue&type=script&lang=js":
|
|
/*!*************************************************************!*\
|
|
!*** ./resources/js/views/Home.vue?vue&type=script&lang=js ***!
|
|
\*************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "default": () => (/* reexport safe */ _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_Home_vue_vue_type_script_lang_js__WEBPACK_IMPORTED_MODULE_0__.default)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_Home_vue_vue_type_script_lang_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!../../../node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./Home.vue?vue&type=script&lang=js */ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/views/Home.vue?vue&type=script&lang=js");
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/apps/App.vue?vue&type=template&id=2dea4962":
|
|
/*!*****************************************************************!*\
|
|
!*** ./resources/js/apps/App.vue?vue&type=template&id=2dea4962 ***!
|
|
\*****************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* reexport safe */ _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_App_vue_vue_type_template_id_2dea4962__WEBPACK_IMPORTED_MODULE_0__.render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_App_vue_vue_type_template_id_2dea4962__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!../../../node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!../../../node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./App.vue?vue&type=template&id=2dea4962 */ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/apps/App.vue?vue&type=template&id=2dea4962");
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/BlogPopular.vue?vue&type=template&id=3498cf88":
|
|
/*!*******************************************************************************!*\
|
|
!*** ./resources/js/components/BlogPopular.vue?vue&type=template&id=3498cf88 ***!
|
|
\*******************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* reexport safe */ _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_BlogPopular_vue_vue_type_template_id_3498cf88__WEBPACK_IMPORTED_MODULE_0__.render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_BlogPopular_vue_vue_type_template_id_3498cf88__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!../../../node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!../../../node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./BlogPopular.vue?vue&type=template&id=3498cf88 */ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/BlogPopular.vue?vue&type=template&id=3498cf88");
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/BlogRecent.vue?vue&type=template&id=6b89b6c8":
|
|
/*!******************************************************************************!*\
|
|
!*** ./resources/js/components/BlogRecent.vue?vue&type=template&id=6b89b6c8 ***!
|
|
\******************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* reexport safe */ _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_BlogRecent_vue_vue_type_template_id_6b89b6c8__WEBPACK_IMPORTED_MODULE_0__.render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_BlogRecent_vue_vue_type_template_id_6b89b6c8__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!../../../node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!../../../node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./BlogRecent.vue?vue&type=template&id=6b89b6c8 */ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/BlogRecent.vue?vue&type=template&id=6b89b6c8");
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/Container.vue?vue&type=template&id=ba1063b4":
|
|
/*!*****************************************************************************!*\
|
|
!*** ./resources/js/components/Container.vue?vue&type=template&id=ba1063b4 ***!
|
|
\*****************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* reexport safe */ _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_Container_vue_vue_type_template_id_ba1063b4__WEBPACK_IMPORTED_MODULE_0__.render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_Container_vue_vue_type_template_id_ba1063b4__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!../../../node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!../../../node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./Container.vue?vue&type=template&id=ba1063b4 */ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/Container.vue?vue&type=template&id=ba1063b4");
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/PageFooter.vue?vue&type=template&id=5e81b4b5":
|
|
/*!******************************************************************************!*\
|
|
!*** ./resources/js/components/PageFooter.vue?vue&type=template&id=5e81b4b5 ***!
|
|
\******************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* reexport safe */ _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_PageFooter_vue_vue_type_template_id_5e81b4b5__WEBPACK_IMPORTED_MODULE_0__.render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_PageFooter_vue_vue_type_template_id_5e81b4b5__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!../../../node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!../../../node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./PageFooter.vue?vue&type=template&id=5e81b4b5 */ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/PageFooter.vue?vue&type=template&id=5e81b4b5");
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/PageHeader.vue?vue&type=template&id=7fb418a7":
|
|
/*!******************************************************************************!*\
|
|
!*** ./resources/js/components/PageHeader.vue?vue&type=template&id=7fb418a7 ***!
|
|
\******************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* reexport safe */ _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_PageHeader_vue_vue_type_template_id_7fb418a7__WEBPACK_IMPORTED_MODULE_0__.render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_PageHeader_vue_vue_type_template_id_7fb418a7__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!../../../node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!../../../node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./PageHeader.vue?vue&type=template&id=7fb418a7 */ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/PageHeader.vue?vue&type=template&id=7fb418a7");
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/SiteNav.vue?vue&type=template&id=3cf6587e":
|
|
/*!***************************************************************************!*\
|
|
!*** ./resources/js/components/SiteNav.vue?vue&type=template&id=3cf6587e ***!
|
|
\***************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* reexport safe */ _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_SiteNav_vue_vue_type_template_id_3cf6587e__WEBPACK_IMPORTED_MODULE_0__.render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_SiteNav_vue_vue_type_template_id_3cf6587e__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!../../../node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!../../../node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./SiteNav.vue?vue&type=template&id=3cf6587e */ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/SiteNav.vue?vue&type=template&id=3cf6587e");
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/components/SplitContent.vue?vue&type=template&id=1553872c":
|
|
/*!********************************************************************************!*\
|
|
!*** ./resources/js/components/SplitContent.vue?vue&type=template&id=1553872c ***!
|
|
\********************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* reexport safe */ _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_SplitContent_vue_vue_type_template_id_1553872c__WEBPACK_IMPORTED_MODULE_0__.render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_SplitContent_vue_vue_type_template_id_1553872c__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!../../../node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!../../../node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./SplitContent.vue?vue&type=template&id=1553872c */ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/components/SplitContent.vue?vue&type=template&id=1553872c");
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./resources/js/views/Home.vue?vue&type=template&id=63cd6604":
|
|
/*!*******************************************************************!*\
|
|
!*** ./resources/js/views/Home.vue?vue&type=template&id=63cd6604 ***!
|
|
\*******************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "render": () => (/* reexport safe */ _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_Home_vue_vue_type_template_id_63cd6604__WEBPACK_IMPORTED_MODULE_0__.render)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _node_modules_babel_loader_lib_index_js_clonedRuleSet_5_use_0_node_modules_vue_loader_dist_templateLoader_js_ruleSet_1_rules_2_node_modules_vue_loader_dist_index_js_ruleSet_0_use_0_Home_vue_vue_type_template_id_63cd6604__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!../../../node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!../../../node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./Home.vue?vue&type=template&id=63cd6604 */ "./node_modules/babel-loader/lib/index.js??clonedRuleSet-5.use[0]!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[2]!./node_modules/vue-loader/dist/index.js??ruleSet[0].use[0]!./resources/js/views/Home.vue?vue&type=template&id=63cd6604");
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/vue-router/dist/vue-router.esm-bundler.js":
|
|
/*!****************************************************************!*\
|
|
!*** ./node_modules/vue-router/dist/vue-router.esm-bundler.js ***!
|
|
\****************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "NavigationFailureType": () => (/* binding */ NavigationFailureType),
|
|
/* harmony export */ "RouterLink": () => (/* binding */ RouterLink),
|
|
/* harmony export */ "RouterView": () => (/* binding */ RouterView),
|
|
/* harmony export */ "START_LOCATION": () => (/* binding */ START_LOCATION_NORMALIZED),
|
|
/* harmony export */ "createMemoryHistory": () => (/* binding */ createMemoryHistory),
|
|
/* harmony export */ "createRouter": () => (/* binding */ createRouter),
|
|
/* harmony export */ "createRouterMatcher": () => (/* binding */ createRouterMatcher),
|
|
/* harmony export */ "createWebHashHistory": () => (/* binding */ createWebHashHistory),
|
|
/* harmony export */ "createWebHistory": () => (/* binding */ createWebHistory),
|
|
/* harmony export */ "isNavigationFailure": () => (/* binding */ isNavigationFailure),
|
|
/* harmony export */ "matchedRouteKey": () => (/* binding */ matchedRouteKey),
|
|
/* harmony export */ "onBeforeRouteLeave": () => (/* binding */ onBeforeRouteLeave),
|
|
/* harmony export */ "onBeforeRouteUpdate": () => (/* binding */ onBeforeRouteUpdate),
|
|
/* harmony export */ "parseQuery": () => (/* binding */ parseQuery),
|
|
/* harmony export */ "routeLocationKey": () => (/* binding */ routeLocationKey),
|
|
/* harmony export */ "routerKey": () => (/* binding */ routerKey),
|
|
/* harmony export */ "routerViewLocationKey": () => (/* binding */ routerViewLocationKey),
|
|
/* harmony export */ "stringifyQuery": () => (/* binding */ stringifyQuery),
|
|
/* harmony export */ "useLink": () => (/* binding */ useLink),
|
|
/* harmony export */ "useRoute": () => (/* binding */ useRoute),
|
|
/* harmony export */ "useRouter": () => (/* binding */ useRouter),
|
|
/* harmony export */ "viewDepthKey": () => (/* binding */ viewDepthKey)
|
|
/* harmony export */ });
|
|
/* harmony import */ var vue__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! vue */ "./node_modules/vue/dist/vue.esm-bundler.js");
|
|
/* harmony import */ var _vue_devtools_api__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @vue/devtools-api */ "./node_modules/@vue/devtools-api/lib/esm/index.js");
|
|
/*!
|
|
* vue-router v4.0.11
|
|
* (c) 2021 Eduardo San Martin Morote
|
|
* @license MIT
|
|
*/
|
|
|
|
|
|
|
|
const hasSymbol = typeof Symbol === 'function' && typeof Symbol.toStringTag === 'symbol';
|
|
const PolySymbol = (name) =>
|
|
// vr = vue router
|
|
hasSymbol
|
|
? Symbol(( true) ? '[vue-router]: ' + name : 0)
|
|
: (( true) ? '[vue-router]: ' : 0) + name;
|
|
// rvlm = Router View Location Matched
|
|
/**
|
|
* RouteRecord being rendered by the closest ancestor Router View. Used for
|
|
* `onBeforeRouteUpdate` and `onBeforeRouteLeave`. rvlm stands for Router View
|
|
* Location Matched
|
|
*
|
|
* @internal
|
|
*/
|
|
const matchedRouteKey = /*#__PURE__*/ PolySymbol(( true) ? 'router view location matched' : 0);
|
|
/**
|
|
* Allows overriding the router view depth to control which component in
|
|
* `matched` is rendered. rvd stands for Router View Depth
|
|
*
|
|
* @internal
|
|
*/
|
|
const viewDepthKey = /*#__PURE__*/ PolySymbol(( true) ? 'router view depth' : 0);
|
|
/**
|
|
* Allows overriding the router instance returned by `useRouter` in tests. r
|
|
* stands for router
|
|
*
|
|
* @internal
|
|
*/
|
|
const routerKey = /*#__PURE__*/ PolySymbol(( true) ? 'router' : 0);
|
|
/**
|
|
* Allows overriding the current route returned by `useRoute` in tests. rl
|
|
* stands for route location
|
|
*
|
|
* @internal
|
|
*/
|
|
const routeLocationKey = /*#__PURE__*/ PolySymbol(( true) ? 'route location' : 0);
|
|
/**
|
|
* Allows overriding the current route used by router-view. Internally this is
|
|
* used when the `route` prop is passed.
|
|
*
|
|
* @internal
|
|
*/
|
|
const routerViewLocationKey = /*#__PURE__*/ PolySymbol(( true) ? 'router view location' : 0);
|
|
|
|
const isBrowser = typeof window !== 'undefined';
|
|
|
|
function isESModule(obj) {
|
|
return obj.__esModule || (hasSymbol && obj[Symbol.toStringTag] === 'Module');
|
|
}
|
|
const assign = Object.assign;
|
|
function applyToParams(fn, params) {
|
|
const newParams = {};
|
|
for (const key in params) {
|
|
const value = params[key];
|
|
newParams[key] = Array.isArray(value) ? value.map(fn) : fn(value);
|
|
}
|
|
return newParams;
|
|
}
|
|
const noop = () => { };
|
|
|
|
function warn(msg) {
|
|
// avoid using ...args as it breaks in older Edge builds
|
|
const args = Array.from(arguments).slice(1);
|
|
console.warn.apply(console, ['[Vue Router warn]: ' + msg].concat(args));
|
|
}
|
|
|
|
const TRAILING_SLASH_RE = /\/$/;
|
|
const removeTrailingSlash = (path) => path.replace(TRAILING_SLASH_RE, '');
|
|
/**
|
|
* Transforms an URI into a normalized history location
|
|
*
|
|
* @param parseQuery
|
|
* @param location - URI to normalize
|
|
* @param currentLocation - current absolute location. Allows resolving relative
|
|
* paths. Must start with `/`. Defaults to `/`
|
|
* @returns a normalized history location
|
|
*/
|
|
function parseURL(parseQuery, location, currentLocation = '/') {
|
|
let path, query = {}, searchString = '', hash = '';
|
|
// Could use URL and URLSearchParams but IE 11 doesn't support it
|
|
const searchPos = location.indexOf('?');
|
|
const hashPos = location.indexOf('#', searchPos > -1 ? searchPos : 0);
|
|
if (searchPos > -1) {
|
|
path = location.slice(0, searchPos);
|
|
searchString = location.slice(searchPos + 1, hashPos > -1 ? hashPos : location.length);
|
|
query = parseQuery(searchString);
|
|
}
|
|
if (hashPos > -1) {
|
|
path = path || location.slice(0, hashPos);
|
|
// keep the # character
|
|
hash = location.slice(hashPos, location.length);
|
|
}
|
|
// no search and no query
|
|
path = resolveRelativePath(path != null ? path : location, currentLocation);
|
|
// empty path means a relative query or hash `?foo=f`, `#thing`
|
|
return {
|
|
fullPath: path + (searchString && '?') + searchString + hash,
|
|
path,
|
|
query,
|
|
hash,
|
|
};
|
|
}
|
|
/**
|
|
* Stringifies a URL object
|
|
*
|
|
* @param stringifyQuery
|
|
* @param location
|
|
*/
|
|
function stringifyURL(stringifyQuery, location) {
|
|
const query = location.query ? stringifyQuery(location.query) : '';
|
|
return location.path + (query && '?') + query + (location.hash || '');
|
|
}
|
|
/**
|
|
* Strips off the base from the beginning of a location.pathname in a non
|
|
* case-sensitive way.
|
|
*
|
|
* @param pathname - location.pathname
|
|
* @param base - base to strip off
|
|
*/
|
|
function stripBase(pathname, base) {
|
|
// no base or base is not found at the beginning
|
|
if (!base || !pathname.toLowerCase().startsWith(base.toLowerCase()))
|
|
return pathname;
|
|
return pathname.slice(base.length) || '/';
|
|
}
|
|
/**
|
|
* Checks if two RouteLocation are equal. This means that both locations are
|
|
* pointing towards the same {@link RouteRecord} and that all `params`, `query`
|
|
* parameters and `hash` are the same
|
|
*
|
|
* @param a - first {@link RouteLocation}
|
|
* @param b - second {@link RouteLocation}
|
|
*/
|
|
function isSameRouteLocation(stringifyQuery, a, b) {
|
|
const aLastIndex = a.matched.length - 1;
|
|
const bLastIndex = b.matched.length - 1;
|
|
return (aLastIndex > -1 &&
|
|
aLastIndex === bLastIndex &&
|
|
isSameRouteRecord(a.matched[aLastIndex], b.matched[bLastIndex]) &&
|
|
isSameRouteLocationParams(a.params, b.params) &&
|
|
stringifyQuery(a.query) === stringifyQuery(b.query) &&
|
|
a.hash === b.hash);
|
|
}
|
|
/**
|
|
* Check if two `RouteRecords` are equal. Takes into account aliases: they are
|
|
* considered equal to the `RouteRecord` they are aliasing.
|
|
*
|
|
* @param a - first {@link RouteRecord}
|
|
* @param b - second {@link RouteRecord}
|
|
*/
|
|
function isSameRouteRecord(a, b) {
|
|
// since the original record has an undefined value for aliasOf
|
|
// but all aliases point to the original record, this will always compare
|
|
// the original record
|
|
return (a.aliasOf || a) === (b.aliasOf || b);
|
|
}
|
|
function isSameRouteLocationParams(a, b) {
|
|
if (Object.keys(a).length !== Object.keys(b).length)
|
|
return false;
|
|
for (const key in a) {
|
|
if (!isSameRouteLocationParamsValue(a[key], b[key]))
|
|
return false;
|
|
}
|
|
return true;
|
|
}
|
|
function isSameRouteLocationParamsValue(a, b) {
|
|
return Array.isArray(a)
|
|
? isEquivalentArray(a, b)
|
|
: Array.isArray(b)
|
|
? isEquivalentArray(b, a)
|
|
: a === b;
|
|
}
|
|
/**
|
|
* Check if two arrays are the same or if an array with one single entry is the
|
|
* same as another primitive value. Used to check query and parameters
|
|
*
|
|
* @param a - array of values
|
|
* @param b - array of values or a single value
|
|
*/
|
|
function isEquivalentArray(a, b) {
|
|
return Array.isArray(b)
|
|
? a.length === b.length && a.every((value, i) => value === b[i])
|
|
: a.length === 1 && a[0] === b;
|
|
}
|
|
/**
|
|
* Resolves a relative path that starts with `.`.
|
|
*
|
|
* @param to - path location we are resolving
|
|
* @param from - currentLocation.path, should start with `/`
|
|
*/
|
|
function resolveRelativePath(to, from) {
|
|
if (to.startsWith('/'))
|
|
return to;
|
|
if (( true) && !from.startsWith('/')) {
|
|
warn(`Cannot resolve a relative location without an absolute path. Trying to resolve "${to}" from "${from}". It should look like "/${from}".`);
|
|
return to;
|
|
}
|
|
if (!to)
|
|
return from;
|
|
const fromSegments = from.split('/');
|
|
const toSegments = to.split('/');
|
|
let position = fromSegments.length - 1;
|
|
let toPosition;
|
|
let segment;
|
|
for (toPosition = 0; toPosition < toSegments.length; toPosition++) {
|
|
segment = toSegments[toPosition];
|
|
// can't go below zero
|
|
if (position === 1 || segment === '.')
|
|
continue;
|
|
if (segment === '..')
|
|
position--;
|
|
// found something that is not relative path
|
|
else
|
|
break;
|
|
}
|
|
return (fromSegments.slice(0, position).join('/') +
|
|
'/' +
|
|
toSegments
|
|
.slice(toPosition - (toPosition === toSegments.length ? 1 : 0))
|
|
.join('/'));
|
|
}
|
|
|
|
var NavigationType;
|
|
(function (NavigationType) {
|
|
NavigationType["pop"] = "pop";
|
|
NavigationType["push"] = "push";
|
|
})(NavigationType || (NavigationType = {}));
|
|
var NavigationDirection;
|
|
(function (NavigationDirection) {
|
|
NavigationDirection["back"] = "back";
|
|
NavigationDirection["forward"] = "forward";
|
|
NavigationDirection["unknown"] = "";
|
|
})(NavigationDirection || (NavigationDirection = {}));
|
|
/**
|
|
* Starting location for Histories
|
|
*/
|
|
const START = '';
|
|
// Generic utils
|
|
/**
|
|
* Normalizes a base by removing any trailing slash and reading the base tag if
|
|
* present.
|
|
*
|
|
* @param base - base to normalize
|
|
*/
|
|
function normalizeBase(base) {
|
|
if (!base) {
|
|
if (isBrowser) {
|
|
// respect <base> tag
|
|
const baseEl = document.querySelector('base');
|
|
base = (baseEl && baseEl.getAttribute('href')) || '/';
|
|
// strip full URL origin
|
|
base = base.replace(/^\w+:\/\/[^\/]+/, '');
|
|
}
|
|
else {
|
|
base = '/';
|
|
}
|
|
}
|
|
// ensure leading slash when it was removed by the regex above avoid leading
|
|
// slash with hash because the file could be read from the disk like file://
|
|
// and the leading slash would cause problems
|
|
if (base[0] !== '/' && base[0] !== '#')
|
|
base = '/' + base;
|
|
// remove the trailing slash so all other method can just do `base + fullPath`
|
|
// to build an href
|
|
return removeTrailingSlash(base);
|
|
}
|
|
// remove any character before the hash
|
|
const BEFORE_HASH_RE = /^[^#]+#/;
|
|
function createHref(base, location) {
|
|
return base.replace(BEFORE_HASH_RE, '#') + location;
|
|
}
|
|
|
|
function getElementPosition(el, offset) {
|
|
const docRect = document.documentElement.getBoundingClientRect();
|
|
const elRect = el.getBoundingClientRect();
|
|
return {
|
|
behavior: offset.behavior,
|
|
left: elRect.left - docRect.left - (offset.left || 0),
|
|
top: elRect.top - docRect.top - (offset.top || 0),
|
|
};
|
|
}
|
|
const computeScrollPosition = () => ({
|
|
left: window.pageXOffset,
|
|
top: window.pageYOffset,
|
|
});
|
|
function scrollToPosition(position) {
|
|
let scrollToOptions;
|
|
if ('el' in position) {
|
|
const positionEl = position.el;
|
|
const isIdSelector = typeof positionEl === 'string' && positionEl.startsWith('#');
|
|
/**
|
|
* `id`s can accept pretty much any characters, including CSS combinators
|
|
* like `>` or `~`. It's still possible to retrieve elements using
|
|
* `document.getElementById('~')` but it needs to be escaped when using
|
|
* `document.querySelector('#\\~')` for it to be valid. The only
|
|
* requirements for `id`s are them to be unique on the page and to not be
|
|
* empty (`id=""`). Because of that, when passing an id selector, it should
|
|
* be properly escaped for it to work with `querySelector`. We could check
|
|
* for the id selector to be simple (no CSS combinators `+ >~`) but that
|
|
* would make things inconsistent since they are valid characters for an
|
|
* `id` but would need to be escaped when using `querySelector`, breaking
|
|
* their usage and ending up in no selector returned. Selectors need to be
|
|
* escaped:
|
|
*
|
|
* - `#1-thing` becomes `#\31 -thing`
|
|
* - `#with~symbols` becomes `#with\\~symbols`
|
|
*
|
|
* - More information about the topic can be found at
|
|
* https://mathiasbynens.be/notes/html5-id-class.
|
|
* - Practical example: https://mathiasbynens.be/demo/html5-id
|
|
*/
|
|
if (( true) && typeof position.el === 'string') {
|
|
if (!isIdSelector || !document.getElementById(position.el.slice(1))) {
|
|
try {
|
|
const foundEl = document.querySelector(position.el);
|
|
if (isIdSelector && foundEl) {
|
|
warn(`The selector "${position.el}" should be passed as "el: document.querySelector('${position.el}')" because it starts with "#".`);
|
|
// return to avoid other warnings
|
|
return;
|
|
}
|
|
}
|
|
catch (err) {
|
|
warn(`The selector "${position.el}" is invalid. If you are using an id selector, make sure to escape it. You can find more information about escaping characters in selectors at https://mathiasbynens.be/notes/css-escapes or use CSS.escape (https://developer.mozilla.org/en-US/docs/Web/API/CSS/escape).`);
|
|
// return to avoid other warnings
|
|
return;
|
|
}
|
|
}
|
|
}
|
|
const el = typeof positionEl === 'string'
|
|
? isIdSelector
|
|
? document.getElementById(positionEl.slice(1))
|
|
: document.querySelector(positionEl)
|
|
: positionEl;
|
|
if (!el) {
|
|
( true) &&
|
|
warn(`Couldn't find element using selector "${position.el}" returned by scrollBehavior.`);
|
|
return;
|
|
}
|
|
scrollToOptions = getElementPosition(el, position);
|
|
}
|
|
else {
|
|
scrollToOptions = position;
|
|
}
|
|
if ('scrollBehavior' in document.documentElement.style)
|
|
window.scrollTo(scrollToOptions);
|
|
else {
|
|
window.scrollTo(scrollToOptions.left != null ? scrollToOptions.left : window.pageXOffset, scrollToOptions.top != null ? scrollToOptions.top : window.pageYOffset);
|
|
}
|
|
}
|
|
function getScrollKey(path, delta) {
|
|
const position = history.state ? history.state.position - delta : -1;
|
|
return position + path;
|
|
}
|
|
const scrollPositions = new Map();
|
|
function saveScrollPosition(key, scrollPosition) {
|
|
scrollPositions.set(key, scrollPosition);
|
|
}
|
|
function getSavedScrollPosition(key) {
|
|
const scroll = scrollPositions.get(key);
|
|
// consume it so it's not used again
|
|
scrollPositions.delete(key);
|
|
return scroll;
|
|
}
|
|
// TODO: RFC about how to save scroll position
|
|
/**
|
|
* ScrollBehavior instance used by the router to compute and restore the scroll
|
|
* position when navigating.
|
|
*/
|
|
// export interface ScrollHandler<ScrollPositionEntry extends HistoryStateValue, ScrollPosition extends ScrollPositionEntry> {
|
|
// // returns a scroll position that can be saved in history
|
|
// compute(): ScrollPositionEntry
|
|
// // can take an extended ScrollPositionEntry
|
|
// scroll(position: ScrollPosition): void
|
|
// }
|
|
// export const scrollHandler: ScrollHandler<ScrollPosition> = {
|
|
// compute: computeScroll,
|
|
// scroll: scrollToPosition,
|
|
// }
|
|
|
|
let createBaseLocation = () => location.protocol + '//' + location.host;
|
|
/**
|
|
* Creates a normalized history location from a window.location object
|
|
* @param location -
|
|
*/
|
|
function createCurrentLocation(base, location) {
|
|
const { pathname, search, hash } = location;
|
|
// allows hash bases like #, /#, #/, #!, #!/, /#!/, or even /folder#end
|
|
const hashPos = base.indexOf('#');
|
|
if (hashPos > -1) {
|
|
let slicePos = hash.includes(base.slice(hashPos))
|
|
? base.slice(hashPos).length
|
|
: 1;
|
|
let pathFromHash = hash.slice(slicePos);
|
|
// prepend the starting slash to hash so the url starts with /#
|
|
if (pathFromHash[0] !== '/')
|
|
pathFromHash = '/' + pathFromHash;
|
|
return stripBase(pathFromHash, '');
|
|
}
|
|
const path = stripBase(pathname, base);
|
|
return path + search + hash;
|
|
}
|
|
function useHistoryListeners(base, historyState, currentLocation, replace) {
|
|
let listeners = [];
|
|
let teardowns = [];
|
|
// TODO: should it be a stack? a Dict. Check if the popstate listener
|
|
// can trigger twice
|
|
let pauseState = null;
|
|
const popStateHandler = ({ state, }) => {
|
|
const to = createCurrentLocation(base, location);
|
|
const from = currentLocation.value;
|
|
const fromState = historyState.value;
|
|
let delta = 0;
|
|
if (state) {
|
|
currentLocation.value = to;
|
|
historyState.value = state;
|
|
// ignore the popstate and reset the pauseState
|
|
if (pauseState && pauseState === from) {
|
|
pauseState = null;
|
|
return;
|
|
}
|
|
delta = fromState ? state.position - fromState.position : 0;
|
|
}
|
|
else {
|
|
replace(to);
|
|
}
|
|
// console.log({ deltaFromCurrent })
|
|
// Here we could also revert the navigation by calling history.go(-delta)
|
|
// this listener will have to be adapted to not trigger again and to wait for the url
|
|
// to be updated before triggering the listeners. Some kind of validation function would also
|
|
// need to be passed to the listeners so the navigation can be accepted
|
|
// call all listeners
|
|
listeners.forEach(listener => {
|
|
listener(currentLocation.value, from, {
|
|
delta,
|
|
type: NavigationType.pop,
|
|
direction: delta
|
|
? delta > 0
|
|
? NavigationDirection.forward
|
|
: NavigationDirection.back
|
|
: NavigationDirection.unknown,
|
|
});
|
|
});
|
|
};
|
|
function pauseListeners() {
|
|
pauseState = currentLocation.value;
|
|
}
|
|
function listen(callback) {
|
|
// setup the listener and prepare teardown callbacks
|
|
listeners.push(callback);
|
|
const teardown = () => {
|
|
const index = listeners.indexOf(callback);
|
|
if (index > -1)
|
|
listeners.splice(index, 1);
|
|
};
|
|
teardowns.push(teardown);
|
|
return teardown;
|
|
}
|
|
function beforeUnloadListener() {
|
|
const { history } = window;
|
|
if (!history.state)
|
|
return;
|
|
history.replaceState(assign({}, history.state, { scroll: computeScrollPosition() }), '');
|
|
}
|
|
function destroy() {
|
|
for (const teardown of teardowns)
|
|
teardown();
|
|
teardowns = [];
|
|
window.removeEventListener('popstate', popStateHandler);
|
|
window.removeEventListener('beforeunload', beforeUnloadListener);
|
|
}
|
|
// setup the listeners and prepare teardown callbacks
|
|
window.addEventListener('popstate', popStateHandler);
|
|
window.addEventListener('beforeunload', beforeUnloadListener);
|
|
return {
|
|
pauseListeners,
|
|
listen,
|
|
destroy,
|
|
};
|
|
}
|
|
/**
|
|
* Creates a state object
|
|
*/
|
|
function buildState(back, current, forward, replaced = false, computeScroll = false) {
|
|
return {
|
|
back,
|
|
current,
|
|
forward,
|
|
replaced,
|
|
position: window.history.length,
|
|
scroll: computeScroll ? computeScrollPosition() : null,
|
|
};
|
|
}
|
|
function useHistoryStateNavigation(base) {
|
|
const { history, location } = window;
|
|
// private variables
|
|
const currentLocation = {
|
|
value: createCurrentLocation(base, location),
|
|
};
|
|
const historyState = { value: history.state };
|
|
// build current history entry as this is a fresh navigation
|
|
if (!historyState.value) {
|
|
changeLocation(currentLocation.value, {
|
|
back: null,
|
|
current: currentLocation.value,
|
|
forward: null,
|
|
// the length is off by one, we need to decrease it
|
|
position: history.length - 1,
|
|
replaced: true,
|
|
// don't add a scroll as the user may have an anchor and we want
|
|
// scrollBehavior to be triggered without a saved position
|
|
scroll: null,
|
|
}, true);
|
|
}
|
|
function changeLocation(to, state, replace) {
|
|
/**
|
|
* if a base tag is provided and we are on a normal domain, we have to
|
|
* respect the provided `base` attribute because pushState() will use it and
|
|
* potentially erase anything before the `#` like at
|
|
* https://github.com/vuejs/vue-router-next/issues/685 where a base of
|
|
* `/folder/#` but a base of `/` would erase the `/folder/` section. If
|
|
* there is no host, the `<base>` tag makes no sense and if there isn't a
|
|
* base tag we can just use everything after the `#`.
|
|
*/
|
|
const hashIndex = base.indexOf('#');
|
|
const url = hashIndex > -1
|
|
? (location.host && document.querySelector('base')
|
|
? base
|
|
: base.slice(hashIndex)) + to
|
|
: createBaseLocation() + base + to;
|
|
try {
|
|
// BROWSER QUIRK
|
|
// NOTE: Safari throws a SecurityError when calling this function 100 times in 30 seconds
|
|
history[replace ? 'replaceState' : 'pushState'](state, '', url);
|
|
historyState.value = state;
|
|
}
|
|
catch (err) {
|
|
if ((true)) {
|
|
warn('Error with push/replace State', err);
|
|
}
|
|
else {}
|
|
// Force the navigation, this also resets the call count
|
|
location[replace ? 'replace' : 'assign'](url);
|
|
}
|
|
}
|
|
function replace(to, data) {
|
|
const state = assign({}, history.state, buildState(historyState.value.back,
|
|
// keep back and forward entries but override current position
|
|
to, historyState.value.forward, true), data, { position: historyState.value.position });
|
|
changeLocation(to, state, true);
|
|
currentLocation.value = to;
|
|
}
|
|
function push(to, data) {
|
|
// Add to current entry the information of where we are going
|
|
// as well as saving the current position
|
|
const currentState = assign({},
|
|
// use current history state to gracefully handle a wrong call to
|
|
// history.replaceState
|
|
// https://github.com/vuejs/vue-router-next/issues/366
|
|
historyState.value, history.state, {
|
|
forward: to,
|
|
scroll: computeScrollPosition(),
|
|
});
|
|
if (( true) && !history.state) {
|
|
warn(`history.state seems to have been manually replaced without preserving the necessary values. Make sure to preserve existing history state if you are manually calling history.replaceState:\n\n` +
|
|
`history.replaceState(history.state, '', url)\n\n` +
|
|
`You can find more information at https://next.router.vuejs.org/guide/migration/#usage-of-history-state.`);
|
|
}
|
|
changeLocation(currentState.current, currentState, true);
|
|
const state = assign({}, buildState(currentLocation.value, to, null), { position: currentState.position + 1 }, data);
|
|
changeLocation(to, state, false);
|
|
currentLocation.value = to;
|
|
}
|
|
return {
|
|
location: currentLocation,
|
|
state: historyState,
|
|
push,
|
|
replace,
|
|
};
|
|
}
|
|
/**
|
|
* Creates an HTML5 history. Most common history for single page applications.
|
|
*
|
|
* @param base -
|
|
*/
|
|
function createWebHistory(base) {
|
|
base = normalizeBase(base);
|
|
const historyNavigation = useHistoryStateNavigation(base);
|
|
const historyListeners = useHistoryListeners(base, historyNavigation.state, historyNavigation.location, historyNavigation.replace);
|
|
function go(delta, triggerListeners = true) {
|
|
if (!triggerListeners)
|
|
historyListeners.pauseListeners();
|
|
history.go(delta);
|
|
}
|
|
const routerHistory = assign({
|
|
// it's overridden right after
|
|
location: '',
|
|
base,
|
|
go,
|
|
createHref: createHref.bind(null, base),
|
|
}, historyNavigation, historyListeners);
|
|
Object.defineProperty(routerHistory, 'location', {
|
|
enumerable: true,
|
|
get: () => historyNavigation.location.value,
|
|
});
|
|
Object.defineProperty(routerHistory, 'state', {
|
|
enumerable: true,
|
|
get: () => historyNavigation.state.value,
|
|
});
|
|
return routerHistory;
|
|
}
|
|
|
|
/**
|
|
* Creates a in-memory based history. The main purpose of this history is to handle SSR. It starts in a special location that is nowhere.
|
|
* It's up to the user to replace that location with the starter location by either calling `router.push` or `router.replace`.
|
|
*
|
|
* @param base - Base applied to all urls, defaults to '/'
|
|
* @returns a history object that can be passed to the router constructor
|
|
*/
|
|
function createMemoryHistory(base = '') {
|
|
let listeners = [];
|
|
let queue = [START];
|
|
let position = 0;
|
|
function setLocation(location) {
|
|
position++;
|
|
if (position === queue.length) {
|
|
// we are at the end, we can simply append a new entry
|
|
queue.push(location);
|
|
}
|
|
else {
|
|
// we are in the middle, we remove everything from here in the queue
|
|
queue.splice(position);
|
|
queue.push(location);
|
|
}
|
|
}
|
|
function triggerListeners(to, from, { direction, delta }) {
|
|
const info = {
|
|
direction,
|
|
delta,
|
|
type: NavigationType.pop,
|
|
};
|
|
for (const callback of listeners) {
|
|
callback(to, from, info);
|
|
}
|
|
}
|
|
const routerHistory = {
|
|
// rewritten by Object.defineProperty
|
|
location: START,
|
|
// TODO: should be kept in queue
|
|
state: {},
|
|
base,
|
|
createHref: createHref.bind(null, base),
|
|
replace(to) {
|
|
// remove current entry and decrement position
|
|
queue.splice(position--, 1);
|
|
setLocation(to);
|
|
},
|
|
push(to, data) {
|
|
setLocation(to);
|
|
},
|
|
listen(callback) {
|
|
listeners.push(callback);
|
|
return () => {
|
|
const index = listeners.indexOf(callback);
|
|
if (index > -1)
|
|
listeners.splice(index, 1);
|
|
};
|
|
},
|
|
destroy() {
|
|
listeners = [];
|
|
queue = [START];
|
|
position = 0;
|
|
},
|
|
go(delta, shouldTrigger = true) {
|
|
const from = this.location;
|
|
const direction =
|
|
// we are considering delta === 0 going forward, but in abstract mode
|
|
// using 0 for the delta doesn't make sense like it does in html5 where
|
|
// it reloads the page
|
|
delta < 0 ? NavigationDirection.back : NavigationDirection.forward;
|
|
position = Math.max(0, Math.min(position + delta, queue.length - 1));
|
|
if (shouldTrigger) {
|
|
triggerListeners(this.location, from, {
|
|
direction,
|
|
delta,
|
|
});
|
|
}
|
|
},
|
|
};
|
|
Object.defineProperty(routerHistory, 'location', {
|
|
enumerable: true,
|
|
get: () => queue[position],
|
|
});
|
|
return routerHistory;
|
|
}
|
|
|
|
/**
|
|
* Creates a hash history. Useful for web applications with no host (e.g.
|
|
* `file://`) or when configuring a server to handle any URL is not possible.
|
|
*
|
|
* @param base - optional base to provide. Defaults to `location.pathname +
|
|
* location.search` If there is a `<base>` tag in the `head`, its value will be
|
|
* ignored in favor of this parameter **but note it affects all the
|
|
* history.pushState() calls**, meaning that if you use a `<base>` tag, it's
|
|
* `href` value **has to match this parameter** (ignoring anything after the
|
|
* `#`).
|
|
*
|
|
* @example
|
|
* ```js
|
|
* // at https://example.com/folder
|
|
* createWebHashHistory() // gives a url of `https://example.com/folder#`
|
|
* createWebHashHistory('/folder/') // gives a url of `https://example.com/folder/#`
|
|
* // if the `#` is provided in the base, it won't be added by `createWebHashHistory`
|
|
* createWebHashHistory('/folder/#/app/') // gives a url of `https://example.com/folder/#/app/`
|
|
* // you should avoid doing this because it changes the original url and breaks copying urls
|
|
* createWebHashHistory('/other-folder/') // gives a url of `https://example.com/other-folder/#`
|
|
*
|
|
* // at file:///usr/etc/folder/index.html
|
|
* // for locations with no `host`, the base is ignored
|
|
* createWebHashHistory('/iAmIgnored') // gives a url of `file:///usr/etc/folder/index.html#`
|
|
* ```
|
|
*/
|
|
function createWebHashHistory(base) {
|
|
// Make sure this implementation is fine in terms of encoding, specially for IE11
|
|
// for `file://`, directly use the pathname and ignore the base
|
|
// location.pathname contains an initial `/` even at the root: `https://example.com`
|
|
base = location.host ? base || location.pathname + location.search : '';
|
|
// allow the user to provide a `#` in the middle: `/base/#/app`
|
|
if (!base.includes('#'))
|
|
base += '#';
|
|
if (( true) && !base.endsWith('#/') && !base.endsWith('#')) {
|
|
warn(`A hash base must end with a "#":\n"${base}" should be "${base.replace(/#.*$/, '#')}".`);
|
|
}
|
|
return createWebHistory(base);
|
|
}
|
|
|
|
function isRouteLocation(route) {
|
|
return typeof route === 'string' || (route && typeof route === 'object');
|
|
}
|
|
function isRouteName(name) {
|
|
return typeof name === 'string' || typeof name === 'symbol';
|
|
}
|
|
|
|
/**
|
|
* Initial route location where the router is. Can be used in navigation guards
|
|
* to differentiate the initial navigation.
|
|
*
|
|
* @example
|
|
* ```js
|
|
* import { START_LOCATION } from 'vue-router'
|
|
*
|
|
* router.beforeEach((to, from) => {
|
|
* if (from === START_LOCATION) {
|
|
* // initial navigation
|
|
* }
|
|
* })
|
|
* ```
|
|
*/
|
|
const START_LOCATION_NORMALIZED = {
|
|
path: '/',
|
|
name: undefined,
|
|
params: {},
|
|
query: {},
|
|
hash: '',
|
|
fullPath: '/',
|
|
matched: [],
|
|
meta: {},
|
|
redirectedFrom: undefined,
|
|
};
|
|
|
|
const NavigationFailureSymbol = /*#__PURE__*/ PolySymbol(( true) ? 'navigation failure' : 0);
|
|
/**
|
|
* Enumeration with all possible types for navigation failures. Can be passed to
|
|
* {@link isNavigationFailure} to check for specific failures.
|
|
*/
|
|
var NavigationFailureType;
|
|
(function (NavigationFailureType) {
|
|
/**
|
|
* An aborted navigation is a navigation that failed because a navigation
|
|
* guard returned `false` or called `next(false)`
|
|
*/
|
|
NavigationFailureType[NavigationFailureType["aborted"] = 4] = "aborted";
|
|
/**
|
|
* A cancelled navigation is a navigation that failed because a more recent
|
|
* navigation finished started (not necessarily finished).
|
|
*/
|
|
NavigationFailureType[NavigationFailureType["cancelled"] = 8] = "cancelled";
|
|
/**
|
|
* A duplicated navigation is a navigation that failed because it was
|
|
* initiated while already being at the exact same location.
|
|
*/
|
|
NavigationFailureType[NavigationFailureType["duplicated"] = 16] = "duplicated";
|
|
})(NavigationFailureType || (NavigationFailureType = {}));
|
|
// DEV only debug messages
|
|
const ErrorTypeMessages = {
|
|
[1 /* MATCHER_NOT_FOUND */]({ location, currentLocation }) {
|
|
return `No match for\n ${JSON.stringify(location)}${currentLocation
|
|
? '\nwhile being at\n' + JSON.stringify(currentLocation)
|
|
: ''}`;
|
|
},
|
|
[2 /* NAVIGATION_GUARD_REDIRECT */]({ from, to, }) {
|
|
return `Redirected from "${from.fullPath}" to "${stringifyRoute(to)}" via a navigation guard.`;
|
|
},
|
|
[4 /* NAVIGATION_ABORTED */]({ from, to }) {
|
|
return `Navigation aborted from "${from.fullPath}" to "${to.fullPath}" via a navigation guard.`;
|
|
},
|
|
[8 /* NAVIGATION_CANCELLED */]({ from, to }) {
|
|
return `Navigation cancelled from "${from.fullPath}" to "${to.fullPath}" with a new navigation.`;
|
|
},
|
|
[16 /* NAVIGATION_DUPLICATED */]({ from, to }) {
|
|
return `Avoided redundant navigation to current location: "${from.fullPath}".`;
|
|
},
|
|
};
|
|
function createRouterError(type, params) {
|
|
// keep full error messages in cjs versions
|
|
if (true) {
|
|
return assign(new Error(ErrorTypeMessages[type](params)), {
|
|
type,
|
|
[NavigationFailureSymbol]: true,
|
|
}, params);
|
|
}
|
|
else {}
|
|
}
|
|
function isNavigationFailure(error, type) {
|
|
return (error instanceof Error &&
|
|
NavigationFailureSymbol in error &&
|
|
(type == null || !!(error.type & type)));
|
|
}
|
|
const propertiesToLog = ['params', 'query', 'hash'];
|
|
function stringifyRoute(to) {
|
|
if (typeof to === 'string')
|
|
return to;
|
|
if ('path' in to)
|
|
return to.path;
|
|
const location = {};
|
|
for (const key of propertiesToLog) {
|
|
if (key in to)
|
|
location[key] = to[key];
|
|
}
|
|
return JSON.stringify(location, null, 2);
|
|
}
|
|
|
|
// default pattern for a param: non greedy everything but /
|
|
const BASE_PARAM_PATTERN = '[^/]+?';
|
|
const BASE_PATH_PARSER_OPTIONS = {
|
|
sensitive: false,
|
|
strict: false,
|
|
start: true,
|
|
end: true,
|
|
};
|
|
// Special Regex characters that must be escaped in static tokens
|
|
const REGEX_CHARS_RE = /[.+*?^${}()[\]/\\]/g;
|
|
/**
|
|
* Creates a path parser from an array of Segments (a segment is an array of Tokens)
|
|
*
|
|
* @param segments - array of segments returned by tokenizePath
|
|
* @param extraOptions - optional options for the regexp
|
|
* @returns a PathParser
|
|
*/
|
|
function tokensToParser(segments, extraOptions) {
|
|
const options = assign({}, BASE_PATH_PARSER_OPTIONS, extraOptions);
|
|
// the amount of scores is the same as the length of segments except for the root segment "/"
|
|
const score = [];
|
|
// the regexp as a string
|
|
let pattern = options.start ? '^' : '';
|
|
// extracted keys
|
|
const keys = [];
|
|
for (const segment of segments) {
|
|
// the root segment needs special treatment
|
|
const segmentScores = segment.length ? [] : [90 /* Root */];
|
|
// allow trailing slash
|
|
if (options.strict && !segment.length)
|
|
pattern += '/';
|
|
for (let tokenIndex = 0; tokenIndex < segment.length; tokenIndex++) {
|
|
const token = segment[tokenIndex];
|
|
// resets the score if we are inside a sub segment /:a-other-:b
|
|
let subSegmentScore = 40 /* Segment */ +
|
|
(options.sensitive ? 0.25 /* BonusCaseSensitive */ : 0);
|
|
if (token.type === 0 /* Static */) {
|
|
// prepend the slash if we are starting a new segment
|
|
if (!tokenIndex)
|
|
pattern += '/';
|
|
pattern += token.value.replace(REGEX_CHARS_RE, '\\$&');
|
|
subSegmentScore += 40 /* Static */;
|
|
}
|
|
else if (token.type === 1 /* Param */) {
|
|
const { value, repeatable, optional, regexp } = token;
|
|
keys.push({
|
|
name: value,
|
|
repeatable,
|
|
optional,
|
|
});
|
|
const re = regexp ? regexp : BASE_PARAM_PATTERN;
|
|
// the user provided a custom regexp /:id(\\d+)
|
|
if (re !== BASE_PARAM_PATTERN) {
|
|
subSegmentScore += 10 /* BonusCustomRegExp */;
|
|
// make sure the regexp is valid before using it
|
|
try {
|
|
new RegExp(`(${re})`);
|
|
}
|
|
catch (err) {
|
|
throw new Error(`Invalid custom RegExp for param "${value}" (${re}): ` +
|
|
err.message);
|
|
}
|
|
}
|
|
// when we repeat we must take care of the repeating leading slash
|
|
let subPattern = repeatable ? `((?:${re})(?:/(?:${re}))*)` : `(${re})`;
|
|
// prepend the slash if we are starting a new segment
|
|
if (!tokenIndex)
|
|
subPattern =
|
|
// avoid an optional / if there are more segments e.g. /:p?-static
|
|
// or /:p?-:p2
|
|
optional && segment.length < 2
|
|
? `(?:/${subPattern})`
|
|
: '/' + subPattern;
|
|
if (optional)
|
|
subPattern += '?';
|
|
pattern += subPattern;
|
|
subSegmentScore += 20 /* Dynamic */;
|
|
if (optional)
|
|
subSegmentScore += -8 /* BonusOptional */;
|
|
if (repeatable)
|
|
subSegmentScore += -20 /* BonusRepeatable */;
|
|
if (re === '.*')
|
|
subSegmentScore += -50 /* BonusWildcard */;
|
|
}
|
|
segmentScores.push(subSegmentScore);
|
|
}
|
|
// an empty array like /home/ -> [[{home}], []]
|
|
// if (!segment.length) pattern += '/'
|
|
score.push(segmentScores);
|
|
}
|
|
// only apply the strict bonus to the last score
|
|
if (options.strict && options.end) {
|
|
const i = score.length - 1;
|
|
score[i][score[i].length - 1] += 0.7000000000000001 /* BonusStrict */;
|
|
}
|
|
// TODO: dev only warn double trailing slash
|
|
if (!options.strict)
|
|
pattern += '/?';
|
|
if (options.end)
|
|
pattern += '$';
|
|
// allow paths like /dynamic to only match dynamic or dynamic/... but not dynamic_something_else
|
|
else if (options.strict)
|
|
pattern += '(?:/|$)';
|
|
const re = new RegExp(pattern, options.sensitive ? '' : 'i');
|
|
function parse(path) {
|
|
const match = path.match(re);
|
|
const params = {};
|
|
if (!match)
|
|
return null;
|
|
for (let i = 1; i < match.length; i++) {
|
|
const value = match[i] || '';
|
|
const key = keys[i - 1];
|
|
params[key.name] = value && key.repeatable ? value.split('/') : value;
|
|
}
|
|
return params;
|
|
}
|
|
function stringify(params) {
|
|
let path = '';
|
|
// for optional parameters to allow to be empty
|
|
let avoidDuplicatedSlash = false;
|
|
for (const segment of segments) {
|
|
if (!avoidDuplicatedSlash || !path.endsWith('/'))
|
|
path += '/';
|
|
avoidDuplicatedSlash = false;
|
|
for (const token of segment) {
|
|
if (token.type === 0 /* Static */) {
|
|
path += token.value;
|
|
}
|
|
else if (token.type === 1 /* Param */) {
|
|
const { value, repeatable, optional } = token;
|
|
const param = value in params ? params[value] : '';
|
|
if (Array.isArray(param) && !repeatable)
|
|
throw new Error(`Provided param "${value}" is an array but it is not repeatable (* or + modifiers)`);
|
|
const text = Array.isArray(param) ? param.join('/') : param;
|
|
if (!text) {
|
|
if (optional) {
|
|
// if we have more than one optional param like /:a?-static we
|
|
// don't need to care about the optional param
|
|
if (segment.length < 2) {
|
|
// remove the last slash as we could be at the end
|
|
if (path.endsWith('/'))
|
|
path = path.slice(0, -1);
|
|
// do not append a slash on the next iteration
|
|
else
|
|
avoidDuplicatedSlash = true;
|
|
}
|
|
}
|
|
else
|
|
throw new Error(`Missing required param "${value}"`);
|
|
}
|
|
path += text;
|
|
}
|
|
}
|
|
}
|
|
return path;
|
|
}
|
|
return {
|
|
re,
|
|
score,
|
|
keys,
|
|
parse,
|
|
stringify,
|
|
};
|
|
}
|
|
/**
|
|
* Compares an array of numbers as used in PathParser.score and returns a
|
|
* number. This function can be used to `sort` an array
|
|
*
|
|
* @param a - first array of numbers
|
|
* @param b - second array of numbers
|
|
* @returns 0 if both are equal, < 0 if a should be sorted first, > 0 if b
|
|
* should be sorted first
|
|
*/
|
|
function compareScoreArray(a, b) {
|
|
let i = 0;
|
|
while (i < a.length && i < b.length) {
|
|
const diff = b[i] - a[i];
|
|
// only keep going if diff === 0
|
|
if (diff)
|
|
return diff;
|
|
i++;
|
|
}
|
|
// if the last subsegment was Static, the shorter segments should be sorted first
|
|
// otherwise sort the longest segment first
|
|
if (a.length < b.length) {
|
|
return a.length === 1 && a[0] === 40 /* Static */ + 40 /* Segment */
|
|
? -1
|
|
: 1;
|
|
}
|
|
else if (a.length > b.length) {
|
|
return b.length === 1 && b[0] === 40 /* Static */ + 40 /* Segment */
|
|
? 1
|
|
: -1;
|
|
}
|
|
return 0;
|
|
}
|
|
/**
|
|
* Compare function that can be used with `sort` to sort an array of PathParser
|
|
*
|
|
* @param a - first PathParser
|
|
* @param b - second PathParser
|
|
* @returns 0 if both are equal, < 0 if a should be sorted first, > 0 if b
|
|
*/
|
|
function comparePathParserScore(a, b) {
|
|
let i = 0;
|
|
const aScore = a.score;
|
|
const bScore = b.score;
|
|
while (i < aScore.length && i < bScore.length) {
|
|
const comp = compareScoreArray(aScore[i], bScore[i]);
|
|
// do not return if both are equal
|
|
if (comp)
|
|
return comp;
|
|
i++;
|
|
}
|
|
// if a and b share the same score entries but b has more, sort b first
|
|
return bScore.length - aScore.length;
|
|
// this is the ternary version
|
|
// return aScore.length < bScore.length
|
|
// ? 1
|
|
// : aScore.length > bScore.length
|
|
// ? -1
|
|
// : 0
|
|
}
|
|
|
|
const ROOT_TOKEN = {
|
|
type: 0 /* Static */,
|
|
value: '',
|
|
};
|
|
const VALID_PARAM_RE = /[a-zA-Z0-9_]/;
|
|
// After some profiling, the cache seems to be unnecessary because tokenizePath
|
|
// (the slowest part of adding a route) is very fast
|
|
// const tokenCache = new Map<string, Token[][]>()
|
|
function tokenizePath(path) {
|
|
if (!path)
|
|
return [[]];
|
|
if (path === '/')
|
|
return [[ROOT_TOKEN]];
|
|
if (!path.startsWith('/')) {
|
|
throw new Error(( true)
|
|
? `Route paths should start with a "/": "${path}" should be "/${path}".`
|
|
: 0);
|
|
}
|
|
// if (tokenCache.has(path)) return tokenCache.get(path)!
|
|
function crash(message) {
|
|
throw new Error(`ERR (${state})/"${buffer}": ${message}`);
|
|
}
|
|
let state = 0 /* Static */;
|
|
let previousState = state;
|
|
const tokens = [];
|
|
// the segment will always be valid because we get into the initial state
|
|
// with the leading /
|
|
let segment;
|
|
function finalizeSegment() {
|
|
if (segment)
|
|
tokens.push(segment);
|
|
segment = [];
|
|
}
|
|
// index on the path
|
|
let i = 0;
|
|
// char at index
|
|
let char;
|
|
// buffer of the value read
|
|
let buffer = '';
|
|
// custom regexp for a param
|
|
let customRe = '';
|
|
function consumeBuffer() {
|
|
if (!buffer)
|
|
return;
|
|
if (state === 0 /* Static */) {
|
|
segment.push({
|
|
type: 0 /* Static */,
|
|
value: buffer,
|
|
});
|
|
}
|
|
else if (state === 1 /* Param */ ||
|
|
state === 2 /* ParamRegExp */ ||
|
|
state === 3 /* ParamRegExpEnd */) {
|
|
if (segment.length > 1 && (char === '*' || char === '+'))
|
|
crash(`A repeatable param (${buffer}) must be alone in its segment. eg: '/:ids+.`);
|
|
segment.push({
|
|
type: 1 /* Param */,
|
|
value: buffer,
|
|
regexp: customRe,
|
|
repeatable: char === '*' || char === '+',
|
|
optional: char === '*' || char === '?',
|
|
});
|
|
}
|
|
else {
|
|
crash('Invalid state to consume buffer');
|
|
}
|
|
buffer = '';
|
|
}
|
|
function addCharToBuffer() {
|
|
buffer += char;
|
|
}
|
|
while (i < path.length) {
|
|
char = path[i++];
|
|
if (char === '\\' && state !== 2 /* ParamRegExp */) {
|
|
previousState = state;
|
|
state = 4 /* EscapeNext */;
|
|
continue;
|
|
}
|
|
switch (state) {
|
|
case 0 /* Static */:
|
|
if (char === '/') {
|
|
if (buffer) {
|
|
consumeBuffer();
|
|
}
|
|
finalizeSegment();
|
|
}
|
|
else if (char === ':') {
|
|
consumeBuffer();
|
|
state = 1 /* Param */;
|
|
}
|
|
else {
|
|
addCharToBuffer();
|
|
}
|
|
break;
|
|
case 4 /* EscapeNext */:
|
|
addCharToBuffer();
|
|
state = previousState;
|
|
break;
|
|
case 1 /* Param */:
|
|
if (char === '(') {
|
|
state = 2 /* ParamRegExp */;
|
|
}
|
|
else if (VALID_PARAM_RE.test(char)) {
|
|
addCharToBuffer();
|
|
}
|
|
else {
|
|
consumeBuffer();
|
|
state = 0 /* Static */;
|
|
// go back one character if we were not modifying
|
|
if (char !== '*' && char !== '?' && char !== '+')
|
|
i--;
|
|
}
|
|
break;
|
|
case 2 /* ParamRegExp */:
|
|
// TODO: is it worth handling nested regexp? like :p(?:prefix_([^/]+)_suffix)
|
|
// it already works by escaping the closing )
|
|
// https://paths.esm.dev/?p=AAMeJbiAwQEcDKbAoAAkP60PG2R6QAvgNaA6AFACM2ABuQBB#
|
|
// is this really something people need since you can also write
|
|
// /prefix_:p()_suffix
|
|
if (char === ')') {
|
|
// handle the escaped )
|
|
if (customRe[customRe.length - 1] == '\\')
|
|
customRe = customRe.slice(0, -1) + char;
|
|
else
|
|
state = 3 /* ParamRegExpEnd */;
|
|
}
|
|
else {
|
|
customRe += char;
|
|
}
|
|
break;
|
|
case 3 /* ParamRegExpEnd */:
|
|
// same as finalizing a param
|
|
consumeBuffer();
|
|
state = 0 /* Static */;
|
|
// go back one character if we were not modifying
|
|
if (char !== '*' && char !== '?' && char !== '+')
|
|
i--;
|
|
customRe = '';
|
|
break;
|
|
default:
|
|
crash('Unknown state');
|
|
break;
|
|
}
|
|
}
|
|
if (state === 2 /* ParamRegExp */)
|
|
crash(`Unfinished custom RegExp for param "${buffer}"`);
|
|
consumeBuffer();
|
|
finalizeSegment();
|
|
// tokenCache.set(path, tokens)
|
|
return tokens;
|
|
}
|
|
|
|
function createRouteRecordMatcher(record, parent, options) {
|
|
const parser = tokensToParser(tokenizePath(record.path), options);
|
|
// warn against params with the same name
|
|
if ((true)) {
|
|
const existingKeys = new Set();
|
|
for (const key of parser.keys) {
|
|
if (existingKeys.has(key.name))
|
|
warn(`Found duplicated params with name "${key.name}" for path "${record.path}". Only the last one will be available on "$route.params".`);
|
|
existingKeys.add(key.name);
|
|
}
|
|
}
|
|
const matcher = assign(parser, {
|
|
record,
|
|
parent,
|
|
// these needs to be populated by the parent
|
|
children: [],
|
|
alias: [],
|
|
});
|
|
if (parent) {
|
|
// both are aliases or both are not aliases
|
|
// we don't want to mix them because the order is used when
|
|
// passing originalRecord in Matcher.addRoute
|
|
if (!matcher.record.aliasOf === !parent.record.aliasOf)
|
|
parent.children.push(matcher);
|
|
}
|
|
return matcher;
|
|
}
|
|
|
|
/**
|
|
* Creates a Router Matcher.
|
|
*
|
|
* @internal
|
|
* @param routes - array of initial routes
|
|
* @param globalOptions - global route options
|
|
*/
|
|
function createRouterMatcher(routes, globalOptions) {
|
|
// normalized ordered array of matchers
|
|
const matchers = [];
|
|
const matcherMap = new Map();
|
|
globalOptions = mergeOptions({ strict: false, end: true, sensitive: false }, globalOptions);
|
|
function getRecordMatcher(name) {
|
|
return matcherMap.get(name);
|
|
}
|
|
function addRoute(record, parent, originalRecord) {
|
|
// used later on to remove by name
|
|
const isRootAdd = !originalRecord;
|
|
const mainNormalizedRecord = normalizeRouteRecord(record);
|
|
// we might be the child of an alias
|
|
mainNormalizedRecord.aliasOf = originalRecord && originalRecord.record;
|
|
const options = mergeOptions(globalOptions, record);
|
|
// generate an array of records to correctly handle aliases
|
|
const normalizedRecords = [
|
|
mainNormalizedRecord,
|
|
];
|
|
if ('alias' in record) {
|
|
const aliases = typeof record.alias === 'string' ? [record.alias] : record.alias;
|
|
for (const alias of aliases) {
|
|
normalizedRecords.push(assign({}, mainNormalizedRecord, {
|
|
// this allows us to hold a copy of the `components` option
|
|
// so that async components cache is hold on the original record
|
|
components: originalRecord
|
|
? originalRecord.record.components
|
|
: mainNormalizedRecord.components,
|
|
path: alias,
|
|
// we might be the child of an alias
|
|
aliasOf: originalRecord
|
|
? originalRecord.record
|
|
: mainNormalizedRecord,
|
|
// the aliases are always of the same kind as the original since they
|
|
// are defined on the same record
|
|
}));
|
|
}
|
|
}
|
|
let matcher;
|
|
let originalMatcher;
|
|
for (const normalizedRecord of normalizedRecords) {
|
|
const { path } = normalizedRecord;
|
|
// Build up the path for nested routes if the child isn't an absolute
|
|
// route. Only add the / delimiter if the child path isn't empty and if the
|
|
// parent path doesn't have a trailing slash
|
|
if (parent && path[0] !== '/') {
|
|
const parentPath = parent.record.path;
|
|
const connectingSlash = parentPath[parentPath.length - 1] === '/' ? '' : '/';
|
|
normalizedRecord.path =
|
|
parent.record.path + (path && connectingSlash + path);
|
|
}
|
|
if (( true) && normalizedRecord.path === '*') {
|
|
throw new Error('Catch all routes ("*") must now be defined using a param with a custom regexp.\n' +
|
|
'See more at https://next.router.vuejs.org/guide/migration/#removed-star-or-catch-all-routes.');
|
|
}
|
|
// create the object before hand so it can be passed to children
|
|
matcher = createRouteRecordMatcher(normalizedRecord, parent, options);
|
|
if (( true) && parent && path[0] === '/')
|
|
checkMissingParamsInAbsolutePath(matcher, parent);
|
|
// if we are an alias we must tell the original record that we exist
|
|
// so we can be removed
|
|
if (originalRecord) {
|
|
originalRecord.alias.push(matcher);
|
|
if ((true)) {
|
|
checkSameParams(originalRecord, matcher);
|
|
}
|
|
}
|
|
else {
|
|
// otherwise, the first record is the original and others are aliases
|
|
originalMatcher = originalMatcher || matcher;
|
|
if (originalMatcher !== matcher)
|
|
originalMatcher.alias.push(matcher);
|
|
// remove the route if named and only for the top record (avoid in nested calls)
|
|
// this works because the original record is the first one
|
|
if (isRootAdd && record.name && !isAliasRecord(matcher))
|
|
removeRoute(record.name);
|
|
}
|
|
if ('children' in mainNormalizedRecord) {
|
|
const children = mainNormalizedRecord.children;
|
|
for (let i = 0; i < children.length; i++) {
|
|
addRoute(children[i], matcher, originalRecord && originalRecord.children[i]);
|
|
}
|
|
}
|
|
// if there was no original record, then the first one was not an alias and all
|
|
// other alias (if any) need to reference this record when adding children
|
|
originalRecord = originalRecord || matcher;
|
|
// TODO: add normalized records for more flexibility
|
|
// if (parent && isAliasRecord(originalRecord)) {
|
|
// parent.children.push(originalRecord)
|
|
// }
|
|
insertMatcher(matcher);
|
|
}
|
|
return originalMatcher
|
|
? () => {
|
|
// since other matchers are aliases, they should be removed by the original matcher
|
|
removeRoute(originalMatcher);
|
|
}
|
|
: noop;
|
|
}
|
|
function removeRoute(matcherRef) {
|
|
if (isRouteName(matcherRef)) {
|
|
const matcher = matcherMap.get(matcherRef);
|
|
if (matcher) {
|
|
matcherMap.delete(matcherRef);
|
|
matchers.splice(matchers.indexOf(matcher), 1);
|
|
matcher.children.forEach(removeRoute);
|
|
matcher.alias.forEach(removeRoute);
|
|
}
|
|
}
|
|
else {
|
|
const index = matchers.indexOf(matcherRef);
|
|
if (index > -1) {
|
|
matchers.splice(index, 1);
|
|
if (matcherRef.record.name)
|
|
matcherMap.delete(matcherRef.record.name);
|
|
matcherRef.children.forEach(removeRoute);
|
|
matcherRef.alias.forEach(removeRoute);
|
|
}
|
|
}
|
|
}
|
|
function getRoutes() {
|
|
return matchers;
|
|
}
|
|
function insertMatcher(matcher) {
|
|
let i = 0;
|
|
// console.log('i is', { i })
|
|
while (i < matchers.length &&
|
|
comparePathParserScore(matcher, matchers[i]) >= 0)
|
|
i++;
|
|
// console.log('END i is', { i })
|
|
// while (i < matchers.length && matcher.score <= matchers[i].score) i++
|
|
matchers.splice(i, 0, matcher);
|
|
// only add the original record to the name map
|
|
if (matcher.record.name && !isAliasRecord(matcher))
|
|
matcherMap.set(matcher.record.name, matcher);
|
|
}
|
|
function resolve(location, currentLocation) {
|
|
let matcher;
|
|
let params = {};
|
|
let path;
|
|
let name;
|
|
if ('name' in location && location.name) {
|
|
matcher = matcherMap.get(location.name);
|
|
if (!matcher)
|
|
throw createRouterError(1 /* MATCHER_NOT_FOUND */, {
|
|
location,
|
|
});
|
|
name = matcher.record.name;
|
|
params = assign(
|
|
// paramsFromLocation is a new object
|
|
paramsFromLocation(currentLocation.params,
|
|
// only keep params that exist in the resolved location
|
|
// TODO: only keep optional params coming from a parent record
|
|
matcher.keys.filter(k => !k.optional).map(k => k.name)), location.params);
|
|
// throws if cannot be stringified
|
|
path = matcher.stringify(params);
|
|
}
|
|
else if ('path' in location) {
|
|
// no need to resolve the path with the matcher as it was provided
|
|
// this also allows the user to control the encoding
|
|
path = location.path;
|
|
if (( true) && !path.startsWith('/')) {
|
|
warn(`The Matcher cannot resolve relative paths but received "${path}". Unless you directly called \`matcher.resolve("${path}")\`, this is probably a bug in vue-router. Please open an issue at https://new-issue.vuejs.org/?repo=vuejs/vue-router-next.`);
|
|
}
|
|
matcher = matchers.find(m => m.re.test(path));
|
|
// matcher should have a value after the loop
|
|
if (matcher) {
|
|
// TODO: dev warning of unused params if provided
|
|
// we know the matcher works because we tested the regexp
|
|
params = matcher.parse(path);
|
|
name = matcher.record.name;
|
|
}
|
|
// location is a relative path
|
|
}
|
|
else {
|
|
// match by name or path of current route
|
|
matcher = currentLocation.name
|
|
? matcherMap.get(currentLocation.name)
|
|
: matchers.find(m => m.re.test(currentLocation.path));
|
|
if (!matcher)
|
|
throw createRouterError(1 /* MATCHER_NOT_FOUND */, {
|
|
location,
|
|
currentLocation,
|
|
});
|
|
name = matcher.record.name;
|
|
// since we are navigating to the same location, we don't need to pick the
|
|
// params like when `name` is provided
|
|
params = assign({}, currentLocation.params, location.params);
|
|
path = matcher.stringify(params);
|
|
}
|
|
const matched = [];
|
|
let parentMatcher = matcher;
|
|
while (parentMatcher) {
|
|
// reversed order so parents are at the beginning
|
|
matched.unshift(parentMatcher.record);
|
|
parentMatcher = parentMatcher.parent;
|
|
}
|
|
return {
|
|
name,
|
|
path,
|
|
params,
|
|
matched,
|
|
meta: mergeMetaFields(matched),
|
|
};
|
|
}
|
|
// add initial routes
|
|
routes.forEach(route => addRoute(route));
|
|
return { addRoute, resolve, removeRoute, getRoutes, getRecordMatcher };
|
|
}
|
|
function paramsFromLocation(params, keys) {
|
|
const newParams = {};
|
|
for (const key of keys) {
|
|
if (key in params)
|
|
newParams[key] = params[key];
|
|
}
|
|
return newParams;
|
|
}
|
|
/**
|
|
* Normalizes a RouteRecordRaw. Creates a copy
|
|
*
|
|
* @param record
|
|
* @returns the normalized version
|
|
*/
|
|
function normalizeRouteRecord(record) {
|
|
return {
|
|
path: record.path,
|
|
redirect: record.redirect,
|
|
name: record.name,
|
|
meta: record.meta || {},
|
|
aliasOf: undefined,
|
|
beforeEnter: record.beforeEnter,
|
|
props: normalizeRecordProps(record),
|
|
children: record.children || [],
|
|
instances: {},
|
|
leaveGuards: new Set(),
|
|
updateGuards: new Set(),
|
|
enterCallbacks: {},
|
|
components: 'components' in record
|
|
? record.components || {}
|
|
: { default: record.component },
|
|
};
|
|
}
|
|
/**
|
|
* Normalize the optional `props` in a record to always be an object similar to
|
|
* components. Also accept a boolean for components.
|
|
* @param record
|
|
*/
|
|
function normalizeRecordProps(record) {
|
|
const propsObject = {};
|
|
// props does not exist on redirect records but we can set false directly
|
|
const props = record.props || false;
|
|
if ('component' in record) {
|
|
propsObject.default = props;
|
|
}
|
|
else {
|
|
// NOTE: we could also allow a function to be applied to every component.
|
|
// Would need user feedback for use cases
|
|
for (const name in record.components)
|
|
propsObject[name] = typeof props === 'boolean' ? props : props[name];
|
|
}
|
|
return propsObject;
|
|
}
|
|
/**
|
|
* Checks if a record or any of its parent is an alias
|
|
* @param record
|
|
*/
|
|
function isAliasRecord(record) {
|
|
while (record) {
|
|
if (record.record.aliasOf)
|
|
return true;
|
|
record = record.parent;
|
|
}
|
|
return false;
|
|
}
|
|
/**
|
|
* Merge meta fields of an array of records
|
|
*
|
|
* @param matched - array of matched records
|
|
*/
|
|
function mergeMetaFields(matched) {
|
|
return matched.reduce((meta, record) => assign(meta, record.meta), {});
|
|
}
|
|
function mergeOptions(defaults, partialOptions) {
|
|
const options = {};
|
|
for (const key in defaults) {
|
|
options[key] = key in partialOptions ? partialOptions[key] : defaults[key];
|
|
}
|
|
return options;
|
|
}
|
|
function isSameParam(a, b) {
|
|
return (a.name === b.name &&
|
|
a.optional === b.optional &&
|
|
a.repeatable === b.repeatable);
|
|
}
|
|
/**
|
|
* Check if a path and its alias have the same required params
|
|
*
|
|
* @param a - original record
|
|
* @param b - alias record
|
|
*/
|
|
function checkSameParams(a, b) {
|
|
for (const key of a.keys) {
|
|
if (!key.optional && !b.keys.find(isSameParam.bind(null, key)))
|
|
return warn(`Alias "${b.record.path}" and the original record: "${a.record.path}" should have the exact same param named "${key.name}"`);
|
|
}
|
|
for (const key of b.keys) {
|
|
if (!key.optional && !a.keys.find(isSameParam.bind(null, key)))
|
|
return warn(`Alias "${b.record.path}" and the original record: "${a.record.path}" should have the exact same param named "${key.name}"`);
|
|
}
|
|
}
|
|
function checkMissingParamsInAbsolutePath(record, parent) {
|
|
for (const key of parent.keys) {
|
|
if (!record.keys.find(isSameParam.bind(null, key)))
|
|
return warn(`Absolute path "${record.record.path}" should have the exact same param named "${key.name}" as its parent "${parent.record.path}".`);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Encoding Rules ␣ = Space Path: ␣ " < > # ? { } Query: ␣ " < > # & = Hash: ␣ "
|
|
* < > `
|
|
*
|
|
* On top of that, the RFC3986 (https://tools.ietf.org/html/rfc3986#section-2.2)
|
|
* defines some extra characters to be encoded. Most browsers do not encode them
|
|
* in encodeURI https://github.com/whatwg/url/issues/369, so it may be safer to
|
|
* also encode `!'()*`. Leaving unencoded only ASCII alphanumeric(`a-zA-Z0-9`)
|
|
* plus `-._~`. This extra safety should be applied to query by patching the
|
|
* string returned by encodeURIComponent encodeURI also encodes `[\]^`. `\`
|
|
* should be encoded to avoid ambiguity. Browsers (IE, FF, C) transform a `\`
|
|
* into a `/` if directly typed in. The _backtick_ (`````) should also be
|
|
* encoded everywhere because some browsers like FF encode it when directly
|
|
* written while others don't. Safari and IE don't encode ``"<>{}``` in hash.
|
|
*/
|
|
// const EXTRA_RESERVED_RE = /[!'()*]/g
|
|
// const encodeReservedReplacer = (c: string) => '%' + c.charCodeAt(0).toString(16)
|
|
const HASH_RE = /#/g; // %23
|
|
const AMPERSAND_RE = /&/g; // %26
|
|
const SLASH_RE = /\//g; // %2F
|
|
const EQUAL_RE = /=/g; // %3D
|
|
const IM_RE = /\?/g; // %3F
|
|
const PLUS_RE = /\+/g; // %2B
|
|
/**
|
|
* NOTE: It's not clear to me if we should encode the + symbol in queries, it
|
|
* seems to be less flexible than not doing so and I can't find out the legacy
|
|
* systems requiring this for regular requests like text/html. In the standard,
|
|
* the encoding of the plus character is only mentioned for
|
|
* application/x-www-form-urlencoded
|
|
* (https://url.spec.whatwg.org/#urlencoded-parsing) and most browsers seems lo
|
|
* leave the plus character as is in queries. To be more flexible, we allow the
|
|
* plus character on the query but it can also be manually encoded by the user.
|
|
*
|
|
* Resources:
|
|
* - https://url.spec.whatwg.org/#urlencoded-parsing
|
|
* - https://stackoverflow.com/questions/1634271/url-encoding-the-space-character-or-20
|
|
*/
|
|
const ENC_BRACKET_OPEN_RE = /%5B/g; // [
|
|
const ENC_BRACKET_CLOSE_RE = /%5D/g; // ]
|
|
const ENC_CARET_RE = /%5E/g; // ^
|
|
const ENC_BACKTICK_RE = /%60/g; // `
|
|
const ENC_CURLY_OPEN_RE = /%7B/g; // {
|
|
const ENC_PIPE_RE = /%7C/g; // |
|
|
const ENC_CURLY_CLOSE_RE = /%7D/g; // }
|
|
const ENC_SPACE_RE = /%20/g; // }
|
|
/**
|
|
* Encode characters that need to be encoded on the path, search and hash
|
|
* sections of the URL.
|
|
*
|
|
* @internal
|
|
* @param text - string to encode
|
|
* @returns encoded string
|
|
*/
|
|
function commonEncode(text) {
|
|
return encodeURI('' + text)
|
|
.replace(ENC_PIPE_RE, '|')
|
|
.replace(ENC_BRACKET_OPEN_RE, '[')
|
|
.replace(ENC_BRACKET_CLOSE_RE, ']');
|
|
}
|
|
/**
|
|
* Encode characters that need to be encoded on the hash section of the URL.
|
|
*
|
|
* @param text - string to encode
|
|
* @returns encoded string
|
|
*/
|
|
function encodeHash(text) {
|
|
return commonEncode(text)
|
|
.replace(ENC_CURLY_OPEN_RE, '{')
|
|
.replace(ENC_CURLY_CLOSE_RE, '}')
|
|
.replace(ENC_CARET_RE, '^');
|
|
}
|
|
/**
|
|
* Encode characters that need to be encoded query values on the query
|
|
* section of the URL.
|
|
*
|
|
* @param text - string to encode
|
|
* @returns encoded string
|
|
*/
|
|
function encodeQueryValue(text) {
|
|
return (commonEncode(text)
|
|
// Encode the space as +, encode the + to differentiate it from the space
|
|
.replace(PLUS_RE, '%2B')
|
|
.replace(ENC_SPACE_RE, '+')
|
|
.replace(HASH_RE, '%23')
|
|
.replace(AMPERSAND_RE, '%26')
|
|
.replace(ENC_BACKTICK_RE, '`')
|
|
.replace(ENC_CURLY_OPEN_RE, '{')
|
|
.replace(ENC_CURLY_CLOSE_RE, '}')
|
|
.replace(ENC_CARET_RE, '^'));
|
|
}
|
|
/**
|
|
* Like `encodeQueryValue` but also encodes the `=` character.
|
|
*
|
|
* @param text - string to encode
|
|
*/
|
|
function encodeQueryKey(text) {
|
|
return encodeQueryValue(text).replace(EQUAL_RE, '%3D');
|
|
}
|
|
/**
|
|
* Encode characters that need to be encoded on the path section of the URL.
|
|
*
|
|
* @param text - string to encode
|
|
* @returns encoded string
|
|
*/
|
|
function encodePath(text) {
|
|
return commonEncode(text).replace(HASH_RE, '%23').replace(IM_RE, '%3F');
|
|
}
|
|
/**
|
|
* Encode characters that need to be encoded on the path section of the URL as a
|
|
* param. This function encodes everything {@link encodePath} does plus the
|
|
* slash (`/`) character. If `text` is `null` or `undefined`, returns an empty
|
|
* string instead.
|
|
*
|
|
* @param text - string to encode
|
|
* @returns encoded string
|
|
*/
|
|
function encodeParam(text) {
|
|
return text == null ? '' : encodePath(text).replace(SLASH_RE, '%2F');
|
|
}
|
|
/**
|
|
* Decode text using `decodeURIComponent`. Returns the original text if it
|
|
* fails.
|
|
*
|
|
* @param text - string to decode
|
|
* @returns decoded string
|
|
*/
|
|
function decode(text) {
|
|
try {
|
|
return decodeURIComponent('' + text);
|
|
}
|
|
catch (err) {
|
|
( true) && warn(`Error decoding "${text}". Using original value`);
|
|
}
|
|
return '' + text;
|
|
}
|
|
|
|
/**
|
|
* Transforms a queryString into a {@link LocationQuery} object. Accept both, a
|
|
* version with the leading `?` and without Should work as URLSearchParams
|
|
|
|
* @internal
|
|
*
|
|
* @param search - search string to parse
|
|
* @returns a query object
|
|
*/
|
|
function parseQuery(search) {
|
|
const query = {};
|
|
// avoid creating an object with an empty key and empty value
|
|
// because of split('&')
|
|
if (search === '' || search === '?')
|
|
return query;
|
|
const hasLeadingIM = search[0] === '?';
|
|
const searchParams = (hasLeadingIM ? search.slice(1) : search).split('&');
|
|
for (let i = 0; i < searchParams.length; ++i) {
|
|
// pre decode the + into space
|
|
const searchParam = searchParams[i].replace(PLUS_RE, ' ');
|
|
// allow the = character
|
|
const eqPos = searchParam.indexOf('=');
|
|
const key = decode(eqPos < 0 ? searchParam : searchParam.slice(0, eqPos));
|
|
const value = eqPos < 0 ? null : decode(searchParam.slice(eqPos + 1));
|
|
if (key in query) {
|
|
// an extra variable for ts types
|
|
let currentValue = query[key];
|
|
if (!Array.isArray(currentValue)) {
|
|
currentValue = query[key] = [currentValue];
|
|
}
|
|
currentValue.push(value);
|
|
}
|
|
else {
|
|
query[key] = value;
|
|
}
|
|
}
|
|
return query;
|
|
}
|
|
/**
|
|
* Stringifies a {@link LocationQueryRaw} object. Like `URLSearchParams`, it
|
|
* doesn't prepend a `?`
|
|
*
|
|
* @internal
|
|
*
|
|
* @param query - query object to stringify
|
|
* @returns string version of the query without the leading `?`
|
|
*/
|
|
function stringifyQuery(query) {
|
|
let search = '';
|
|
for (let key in query) {
|
|
const value = query[key];
|
|
key = encodeQueryKey(key);
|
|
if (value == null) {
|
|
// only null adds the value
|
|
if (value !== undefined) {
|
|
search += (search.length ? '&' : '') + key;
|
|
}
|
|
continue;
|
|
}
|
|
// keep null values
|
|
const values = Array.isArray(value)
|
|
? value.map(v => v && encodeQueryValue(v))
|
|
: [value && encodeQueryValue(value)];
|
|
values.forEach(value => {
|
|
// skip undefined values in arrays as if they were not present
|
|
// smaller code than using filter
|
|
if (value !== undefined) {
|
|
// only append & with non-empty search
|
|
search += (search.length ? '&' : '') + key;
|
|
if (value != null)
|
|
search += '=' + value;
|
|
}
|
|
});
|
|
}
|
|
return search;
|
|
}
|
|
/**
|
|
* Transforms a {@link LocationQueryRaw} into a {@link LocationQuery} by casting
|
|
* numbers into strings, removing keys with an undefined value and replacing
|
|
* undefined with null in arrays
|
|
*
|
|
* @param query - query object to normalize
|
|
* @returns a normalized query object
|
|
*/
|
|
function normalizeQuery(query) {
|
|
const normalizedQuery = {};
|
|
for (const key in query) {
|
|
const value = query[key];
|
|
if (value !== undefined) {
|
|
normalizedQuery[key] = Array.isArray(value)
|
|
? value.map(v => (v == null ? null : '' + v))
|
|
: value == null
|
|
? value
|
|
: '' + value;
|
|
}
|
|
}
|
|
return normalizedQuery;
|
|
}
|
|
|
|
/**
|
|
* Create a list of callbacks that can be reset. Used to create before and after navigation guards list
|
|
*/
|
|
function useCallbacks() {
|
|
let handlers = [];
|
|
function add(handler) {
|
|
handlers.push(handler);
|
|
return () => {
|
|
const i = handlers.indexOf(handler);
|
|
if (i > -1)
|
|
handlers.splice(i, 1);
|
|
};
|
|
}
|
|
function reset() {
|
|
handlers = [];
|
|
}
|
|
return {
|
|
add,
|
|
list: () => handlers,
|
|
reset,
|
|
};
|
|
}
|
|
|
|
function registerGuard(record, name, guard) {
|
|
const removeFromList = () => {
|
|
record[name].delete(guard);
|
|
};
|
|
(0,vue__WEBPACK_IMPORTED_MODULE_0__.onUnmounted)(removeFromList);
|
|
(0,vue__WEBPACK_IMPORTED_MODULE_0__.onDeactivated)(removeFromList);
|
|
(0,vue__WEBPACK_IMPORTED_MODULE_0__.onActivated)(() => {
|
|
record[name].add(guard);
|
|
});
|
|
record[name].add(guard);
|
|
}
|
|
/**
|
|
* Add a navigation guard that triggers whenever the component for the current
|
|
* location is about to be left. Similar to {@link beforeRouteLeave} but can be
|
|
* used in any component. The guard is removed when the component is unmounted.
|
|
*
|
|
* @param leaveGuard - {@link NavigationGuard}
|
|
*/
|
|
function onBeforeRouteLeave(leaveGuard) {
|
|
if (( true) && !(0,vue__WEBPACK_IMPORTED_MODULE_0__.getCurrentInstance)()) {
|
|
warn('getCurrentInstance() returned null. onBeforeRouteLeave() must be called at the top of a setup function');
|
|
return;
|
|
}
|
|
const activeRecord = (0,vue__WEBPACK_IMPORTED_MODULE_0__.inject)(matchedRouteKey,
|
|
// to avoid warning
|
|
{}).value;
|
|
if (!activeRecord) {
|
|
( true) &&
|
|
warn('No active route record was found. Are you missing a <router-view> component?');
|
|
return;
|
|
}
|
|
registerGuard(activeRecord, 'leaveGuards', leaveGuard);
|
|
}
|
|
/**
|
|
* Add a navigation guard that triggers whenever the current location is about
|
|
* to be updated. Similar to {@link beforeRouteUpdate} but can be used in any
|
|
* component. The guard is removed when the component is unmounted.
|
|
*
|
|
* @param updateGuard - {@link NavigationGuard}
|
|
*/
|
|
function onBeforeRouteUpdate(updateGuard) {
|
|
if (( true) && !(0,vue__WEBPACK_IMPORTED_MODULE_0__.getCurrentInstance)()) {
|
|
warn('getCurrentInstance() returned null. onBeforeRouteUpdate() must be called at the top of a setup function');
|
|
return;
|
|
}
|
|
const activeRecord = (0,vue__WEBPACK_IMPORTED_MODULE_0__.inject)(matchedRouteKey,
|
|
// to avoid warning
|
|
{}).value;
|
|
if (!activeRecord) {
|
|
( true) &&
|
|
warn('No active route record was found. Are you missing a <router-view> component?');
|
|
return;
|
|
}
|
|
registerGuard(activeRecord, 'updateGuards', updateGuard);
|
|
}
|
|
function guardToPromiseFn(guard, to, from, record, name) {
|
|
// keep a reference to the enterCallbackArray to prevent pushing callbacks if a new navigation took place
|
|
const enterCallbackArray = record &&
|
|
// name is defined if record is because of the function overload
|
|
(record.enterCallbacks[name] = record.enterCallbacks[name] || []);
|
|
return () => new Promise((resolve, reject) => {
|
|
const next = (valid) => {
|
|
if (valid === false)
|
|
reject(createRouterError(4 /* NAVIGATION_ABORTED */, {
|
|
from,
|
|
to,
|
|
}));
|
|
else if (valid instanceof Error) {
|
|
reject(valid);
|
|
}
|
|
else if (isRouteLocation(valid)) {
|
|
reject(createRouterError(2 /* NAVIGATION_GUARD_REDIRECT */, {
|
|
from: to,
|
|
to: valid,
|
|
}));
|
|
}
|
|
else {
|
|
if (enterCallbackArray &&
|
|
// since enterCallbackArray is truthy, both record and name also are
|
|
record.enterCallbacks[name] === enterCallbackArray &&
|
|
typeof valid === 'function')
|
|
enterCallbackArray.push(valid);
|
|
resolve();
|
|
}
|
|
};
|
|
// wrapping with Promise.resolve allows it to work with both async and sync guards
|
|
const guardReturn = guard.call(record && record.instances[name], to, from, ( true) ? canOnlyBeCalledOnce(next, to, from) : 0);
|
|
let guardCall = Promise.resolve(guardReturn);
|
|
if (guard.length < 3)
|
|
guardCall = guardCall.then(next);
|
|
if (( true) && guard.length > 2) {
|
|
const message = `The "next" callback was never called inside of ${guard.name ? '"' + guard.name + '"' : ''}:\n${guard.toString()}\n. If you are returning a value instead of calling "next", make sure to remove the "next" parameter from your function.`;
|
|
if (typeof guardReturn === 'object' && 'then' in guardReturn) {
|
|
guardCall = guardCall.then(resolvedValue => {
|
|
// @ts-expect-error: _called is added at canOnlyBeCalledOnce
|
|
if (!next._called) {
|
|
warn(message);
|
|
return Promise.reject(new Error('Invalid navigation guard'));
|
|
}
|
|
return resolvedValue;
|
|
});
|
|
// TODO: test me!
|
|
}
|
|
else if (guardReturn !== undefined) {
|
|
// @ts-expect-error: _called is added at canOnlyBeCalledOnce
|
|
if (!next._called) {
|
|
warn(message);
|
|
reject(new Error('Invalid navigation guard'));
|
|
return;
|
|
}
|
|
}
|
|
}
|
|
guardCall.catch(err => reject(err));
|
|
});
|
|
}
|
|
function canOnlyBeCalledOnce(next, to, from) {
|
|
let called = 0;
|
|
return function () {
|
|
if (called++ === 1)
|
|
warn(`The "next" callback was called more than once in one navigation guard when going from "${from.fullPath}" to "${to.fullPath}". It should be called exactly one time in each navigation guard. This will fail in production.`);
|
|
// @ts-expect-error: we put it in the original one because it's easier to check
|
|
next._called = true;
|
|
if (called === 1)
|
|
next.apply(null, arguments);
|
|
};
|
|
}
|
|
function extractComponentsGuards(matched, guardType, to, from) {
|
|
const guards = [];
|
|
for (const record of matched) {
|
|
for (const name in record.components) {
|
|
let rawComponent = record.components[name];
|
|
if ((true)) {
|
|
if (!rawComponent ||
|
|
(typeof rawComponent !== 'object' &&
|
|
typeof rawComponent !== 'function')) {
|
|
warn(`Component "${name}" in record with path "${record.path}" is not` +
|
|
` a valid component. Received "${String(rawComponent)}".`);
|
|
// throw to ensure we stop here but warn to ensure the message isn't
|
|
// missed by the user
|
|
throw new Error('Invalid route component');
|
|
}
|
|
else if ('then' in rawComponent) {
|
|
// warn if user wrote import('/component.vue') instead of () =>
|
|
// import('./component.vue')
|
|
warn(`Component "${name}" in record with path "${record.path}" is a ` +
|
|
`Promise instead of a function that returns a Promise. Did you ` +
|
|
`write "import('./MyPage.vue')" instead of ` +
|
|
`"() => import('./MyPage.vue')" ? This will break in ` +
|
|
`production if not fixed.`);
|
|
const promise = rawComponent;
|
|
rawComponent = () => promise;
|
|
}
|
|
else if (rawComponent.__asyncLoader &&
|
|
// warn only once per component
|
|
!rawComponent.__warnedDefineAsync) {
|
|
rawComponent.__warnedDefineAsync = true;
|
|
warn(`Component "${name}" in record with path "${record.path}" is defined ` +
|
|
`using "defineAsyncComponent()". ` +
|
|
`Write "() => import('./MyPage.vue')" instead of ` +
|
|
`"defineAsyncComponent(() => import('./MyPage.vue'))".`);
|
|
}
|
|
}
|
|
// skip update and leave guards if the route component is not mounted
|
|
if (guardType !== 'beforeRouteEnter' && !record.instances[name])
|
|
continue;
|
|
if (isRouteComponent(rawComponent)) {
|
|
// __vccOpts is added by vue-class-component and contain the regular options
|
|
const options = rawComponent.__vccOpts || rawComponent;
|
|
const guard = options[guardType];
|
|
guard && guards.push(guardToPromiseFn(guard, to, from, record, name));
|
|
}
|
|
else {
|
|
// start requesting the chunk already
|
|
let componentPromise = rawComponent();
|
|
if (( true) && !('catch' in componentPromise)) {
|
|
warn(`Component "${name}" in record with path "${record.path}" is a function that does not return a Promise. If you were passing a functional component, make sure to add a "displayName" to the component. This will break in production if not fixed.`);
|
|
componentPromise = Promise.resolve(componentPromise);
|
|
}
|
|
guards.push(() => componentPromise.then(resolved => {
|
|
if (!resolved)
|
|
return Promise.reject(new Error(`Couldn't resolve component "${name}" at "${record.path}"`));
|
|
const resolvedComponent = isESModule(resolved)
|
|
? resolved.default
|
|
: resolved;
|
|
// replace the function with the resolved component
|
|
record.components[name] = resolvedComponent;
|
|
// __vccOpts is added by vue-class-component and contain the regular options
|
|
const options = resolvedComponent.__vccOpts || resolvedComponent;
|
|
const guard = options[guardType];
|
|
return guard && guardToPromiseFn(guard, to, from, record, name)();
|
|
}));
|
|
}
|
|
}
|
|
}
|
|
return guards;
|
|
}
|
|
/**
|
|
* Allows differentiating lazy components from functional components and vue-class-component
|
|
*
|
|
* @param component
|
|
*/
|
|
function isRouteComponent(component) {
|
|
return (typeof component === 'object' ||
|
|
'displayName' in component ||
|
|
'props' in component ||
|
|
'__vccOpts' in component);
|
|
}
|
|
|
|
// TODO: we could allow currentRoute as a prop to expose `isActive` and
|
|
// `isExactActive` behavior should go through an RFC
|
|
function useLink(props) {
|
|
const router = (0,vue__WEBPACK_IMPORTED_MODULE_0__.inject)(routerKey);
|
|
const currentRoute = (0,vue__WEBPACK_IMPORTED_MODULE_0__.inject)(routeLocationKey);
|
|
const route = (0,vue__WEBPACK_IMPORTED_MODULE_0__.computed)(() => router.resolve((0,vue__WEBPACK_IMPORTED_MODULE_0__.unref)(props.to)));
|
|
const activeRecordIndex = (0,vue__WEBPACK_IMPORTED_MODULE_0__.computed)(() => {
|
|
const { matched } = route.value;
|
|
const { length } = matched;
|
|
const routeMatched = matched[length - 1];
|
|
const currentMatched = currentRoute.matched;
|
|
if (!routeMatched || !currentMatched.length)
|
|
return -1;
|
|
const index = currentMatched.findIndex(isSameRouteRecord.bind(null, routeMatched));
|
|
if (index > -1)
|
|
return index;
|
|
// possible parent record
|
|
const parentRecordPath = getOriginalPath(matched[length - 2]);
|
|
return (
|
|
// we are dealing with nested routes
|
|
length > 1 &&
|
|
// if the parent and matched route have the same path, this link is
|
|
// referring to the empty child. Or we currently are on a different
|
|
// child of the same parent
|
|
getOriginalPath(routeMatched) === parentRecordPath &&
|
|
// avoid comparing the child with its parent
|
|
currentMatched[currentMatched.length - 1].path !== parentRecordPath
|
|
? currentMatched.findIndex(isSameRouteRecord.bind(null, matched[length - 2]))
|
|
: index);
|
|
});
|
|
const isActive = (0,vue__WEBPACK_IMPORTED_MODULE_0__.computed)(() => activeRecordIndex.value > -1 &&
|
|
includesParams(currentRoute.params, route.value.params));
|
|
const isExactActive = (0,vue__WEBPACK_IMPORTED_MODULE_0__.computed)(() => activeRecordIndex.value > -1 &&
|
|
activeRecordIndex.value === currentRoute.matched.length - 1 &&
|
|
isSameRouteLocationParams(currentRoute.params, route.value.params));
|
|
function navigate(e = {}) {
|
|
if (guardEvent(e)) {
|
|
return router[(0,vue__WEBPACK_IMPORTED_MODULE_0__.unref)(props.replace) ? 'replace' : 'push']((0,vue__WEBPACK_IMPORTED_MODULE_0__.unref)(props.to)
|
|
// avoid uncaught errors are they are logged anyway
|
|
).catch(noop);
|
|
}
|
|
return Promise.resolve();
|
|
}
|
|
// devtools only
|
|
if (( true) && isBrowser) {
|
|
const instance = (0,vue__WEBPACK_IMPORTED_MODULE_0__.getCurrentInstance)();
|
|
if (instance) {
|
|
const linkContextDevtools = {
|
|
route: route.value,
|
|
isActive: isActive.value,
|
|
isExactActive: isExactActive.value,
|
|
};
|
|
// @ts-expect-error: this is internal
|
|
instance.__vrl_devtools = instance.__vrl_devtools || [];
|
|
// @ts-expect-error: this is internal
|
|
instance.__vrl_devtools.push(linkContextDevtools);
|
|
(0,vue__WEBPACK_IMPORTED_MODULE_0__.watchEffect)(() => {
|
|
linkContextDevtools.route = route.value;
|
|
linkContextDevtools.isActive = isActive.value;
|
|
linkContextDevtools.isExactActive = isExactActive.value;
|
|
}, { flush: 'post' });
|
|
}
|
|
}
|
|
return {
|
|
route,
|
|
href: (0,vue__WEBPACK_IMPORTED_MODULE_0__.computed)(() => route.value.href),
|
|
isActive,
|
|
isExactActive,
|
|
navigate,
|
|
};
|
|
}
|
|
const RouterLinkImpl = /*#__PURE__*/ (0,vue__WEBPACK_IMPORTED_MODULE_0__.defineComponent)({
|
|
name: 'RouterLink',
|
|
props: {
|
|
to: {
|
|
type: [String, Object],
|
|
required: true,
|
|
},
|
|
replace: Boolean,
|
|
activeClass: String,
|
|
// inactiveClass: String,
|
|
exactActiveClass: String,
|
|
custom: Boolean,
|
|
ariaCurrentValue: {
|
|
type: String,
|
|
default: 'page',
|
|
},
|
|
},
|
|
useLink,
|
|
setup(props, { slots }) {
|
|
const link = (0,vue__WEBPACK_IMPORTED_MODULE_0__.reactive)(useLink(props));
|
|
const { options } = (0,vue__WEBPACK_IMPORTED_MODULE_0__.inject)(routerKey);
|
|
const elClass = (0,vue__WEBPACK_IMPORTED_MODULE_0__.computed)(() => ({
|
|
[getLinkClass(props.activeClass, options.linkActiveClass, 'router-link-active')]: link.isActive,
|
|
// [getLinkClass(
|
|
// props.inactiveClass,
|
|
// options.linkInactiveClass,
|
|
// 'router-link-inactive'
|
|
// )]: !link.isExactActive,
|
|
[getLinkClass(props.exactActiveClass, options.linkExactActiveClass, 'router-link-exact-active')]: link.isExactActive,
|
|
}));
|
|
return () => {
|
|
const children = slots.default && slots.default(link);
|
|
return props.custom
|
|
? children
|
|
: (0,vue__WEBPACK_IMPORTED_MODULE_0__.h)('a', {
|
|
'aria-current': link.isExactActive
|
|
? props.ariaCurrentValue
|
|
: null,
|
|
href: link.href,
|
|
// this would override user added attrs but Vue will still add
|
|
// the listener so we end up triggering both
|
|
onClick: link.navigate,
|
|
class: elClass.value,
|
|
}, children);
|
|
};
|
|
},
|
|
});
|
|
// export the public type for h/tsx inference
|
|
// also to avoid inline import() in generated d.ts files
|
|
/**
|
|
* Component to render a link that triggers a navigation on click.
|
|
*/
|
|
const RouterLink = RouterLinkImpl;
|
|
function guardEvent(e) {
|
|
// don't redirect with control keys
|
|
if (e.metaKey || e.altKey || e.ctrlKey || e.shiftKey)
|
|
return;
|
|
// don't redirect when preventDefault called
|
|
if (e.defaultPrevented)
|
|
return;
|
|
// don't redirect on right click
|
|
if (e.button !== undefined && e.button !== 0)
|
|
return;
|
|
// don't redirect if `target="_blank"`
|
|
// @ts-expect-error getAttribute does exist
|
|
if (e.currentTarget && e.currentTarget.getAttribute) {
|
|
// @ts-expect-error getAttribute exists
|
|
const target = e.currentTarget.getAttribute('target');
|
|
if (/\b_blank\b/i.test(target))
|
|
return;
|
|
}
|
|
// this may be a Weex event which doesn't have this method
|
|
if (e.preventDefault)
|
|
e.preventDefault();
|
|
return true;
|
|
}
|
|
function includesParams(outer, inner) {
|
|
for (const key in inner) {
|
|
const innerValue = inner[key];
|
|
const outerValue = outer[key];
|
|
if (typeof innerValue === 'string') {
|
|
if (innerValue !== outerValue)
|
|
return false;
|
|
}
|
|
else {
|
|
if (!Array.isArray(outerValue) ||
|
|
outerValue.length !== innerValue.length ||
|
|
innerValue.some((value, i) => value !== outerValue[i]))
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
/**
|
|
* Get the original path value of a record by following its aliasOf
|
|
* @param record
|
|
*/
|
|
function getOriginalPath(record) {
|
|
return record ? (record.aliasOf ? record.aliasOf.path : record.path) : '';
|
|
}
|
|
/**
|
|
* Utility class to get the active class based on defaults.
|
|
* @param propClass
|
|
* @param globalClass
|
|
* @param defaultClass
|
|
*/
|
|
const getLinkClass = (propClass, globalClass, defaultClass) => propClass != null
|
|
? propClass
|
|
: globalClass != null
|
|
? globalClass
|
|
: defaultClass;
|
|
|
|
const RouterViewImpl = /*#__PURE__*/ (0,vue__WEBPACK_IMPORTED_MODULE_0__.defineComponent)({
|
|
name: 'RouterView',
|
|
// #674 we manually inherit them
|
|
inheritAttrs: false,
|
|
props: {
|
|
name: {
|
|
type: String,
|
|
default: 'default',
|
|
},
|
|
route: Object,
|
|
},
|
|
setup(props, { attrs, slots }) {
|
|
( true) && warnDeprecatedUsage();
|
|
const injectedRoute = (0,vue__WEBPACK_IMPORTED_MODULE_0__.inject)(routerViewLocationKey);
|
|
const routeToDisplay = (0,vue__WEBPACK_IMPORTED_MODULE_0__.computed)(() => props.route || injectedRoute.value);
|
|
const depth = (0,vue__WEBPACK_IMPORTED_MODULE_0__.inject)(viewDepthKey, 0);
|
|
const matchedRouteRef = (0,vue__WEBPACK_IMPORTED_MODULE_0__.computed)(() => routeToDisplay.value.matched[depth]);
|
|
(0,vue__WEBPACK_IMPORTED_MODULE_0__.provide)(viewDepthKey, depth + 1);
|
|
(0,vue__WEBPACK_IMPORTED_MODULE_0__.provide)(matchedRouteKey, matchedRouteRef);
|
|
(0,vue__WEBPACK_IMPORTED_MODULE_0__.provide)(routerViewLocationKey, routeToDisplay);
|
|
const viewRef = (0,vue__WEBPACK_IMPORTED_MODULE_0__.ref)();
|
|
// watch at the same time the component instance, the route record we are
|
|
// rendering, and the name
|
|
(0,vue__WEBPACK_IMPORTED_MODULE_0__.watch)(() => [viewRef.value, matchedRouteRef.value, props.name], ([instance, to, name], [oldInstance, from, oldName]) => {
|
|
// copy reused instances
|
|
if (to) {
|
|
// this will update the instance for new instances as well as reused
|
|
// instances when navigating to a new route
|
|
to.instances[name] = instance;
|
|
// the component instance is reused for a different route or name so
|
|
// we copy any saved update or leave guards. With async setup, the
|
|
// mounting component will mount before the matchedRoute changes,
|
|
// making instance === oldInstance, so we check if guards have been
|
|
// added before. This works because we remove guards when
|
|
// unmounting/deactivating components
|
|
if (from && from !== to && instance && instance === oldInstance) {
|
|
if (!to.leaveGuards.size) {
|
|
to.leaveGuards = from.leaveGuards;
|
|
}
|
|
if (!to.updateGuards.size) {
|
|
to.updateGuards = from.updateGuards;
|
|
}
|
|
}
|
|
}
|
|
// trigger beforeRouteEnter next callbacks
|
|
if (instance &&
|
|
to &&
|
|
// if there is no instance but to and from are the same this might be
|
|
// the first visit
|
|
(!from || !isSameRouteRecord(to, from) || !oldInstance)) {
|
|
(to.enterCallbacks[name] || []).forEach(callback => callback(instance));
|
|
}
|
|
}, { flush: 'post' });
|
|
return () => {
|
|
const route = routeToDisplay.value;
|
|
const matchedRoute = matchedRouteRef.value;
|
|
const ViewComponent = matchedRoute && matchedRoute.components[props.name];
|
|
// we need the value at the time we render because when we unmount, we
|
|
// navigated to a different location so the value is different
|
|
const currentName = props.name;
|
|
if (!ViewComponent) {
|
|
return normalizeSlot(slots.default, { Component: ViewComponent, route });
|
|
}
|
|
// props from route configuration
|
|
const routePropsOption = matchedRoute.props[props.name];
|
|
const routeProps = routePropsOption
|
|
? routePropsOption === true
|
|
? route.params
|
|
: typeof routePropsOption === 'function'
|
|
? routePropsOption(route)
|
|
: routePropsOption
|
|
: null;
|
|
const onVnodeUnmounted = vnode => {
|
|
// remove the instance reference to prevent leak
|
|
if (vnode.component.isUnmounted) {
|
|
matchedRoute.instances[currentName] = null;
|
|
}
|
|
};
|
|
const component = (0,vue__WEBPACK_IMPORTED_MODULE_0__.h)(ViewComponent, assign({}, routeProps, attrs, {
|
|
onVnodeUnmounted,
|
|
ref: viewRef,
|
|
}));
|
|
return (
|
|
// pass the vnode to the slot as a prop.
|
|
// h and <component :is="..."> both accept vnodes
|
|
normalizeSlot(slots.default, { Component: component, route }) ||
|
|
component);
|
|
};
|
|
},
|
|
});
|
|
function normalizeSlot(slot, data) {
|
|
if (!slot)
|
|
return null;
|
|
const slotContent = slot(data);
|
|
return slotContent.length === 1 ? slotContent[0] : slotContent;
|
|
}
|
|
// export the public type for h/tsx inference
|
|
// also to avoid inline import() in generated d.ts files
|
|
/**
|
|
* Component to display the current route the user is at.
|
|
*/
|
|
const RouterView = RouterViewImpl;
|
|
// warn against deprecated usage with <transition> & <keep-alive>
|
|
// due to functional component being no longer eager in Vue 3
|
|
function warnDeprecatedUsage() {
|
|
const instance = (0,vue__WEBPACK_IMPORTED_MODULE_0__.getCurrentInstance)();
|
|
const parentName = instance.parent && instance.parent.type.name;
|
|
if (parentName &&
|
|
(parentName === 'KeepAlive' || parentName.includes('Transition'))) {
|
|
const comp = parentName === 'KeepAlive' ? 'keep-alive' : 'transition';
|
|
warn(`<router-view> can no longer be used directly inside <transition> or <keep-alive>.\n` +
|
|
`Use slot props instead:\n\n` +
|
|
`<router-view v-slot="{ Component }">\n` +
|
|
` <${comp}>\n` +
|
|
` <component :is="Component" />\n` +
|
|
` </${comp}>\n` +
|
|
`</router-view>`);
|
|
}
|
|
}
|
|
|
|
function formatRouteLocation(routeLocation, tooltip) {
|
|
const copy = assign({}, routeLocation, {
|
|
// remove variables that can contain vue instances
|
|
matched: routeLocation.matched.map(matched => omit(matched, ['instances', 'children', 'aliasOf'])),
|
|
});
|
|
return {
|
|
_custom: {
|
|
type: null,
|
|
readOnly: true,
|
|
display: routeLocation.fullPath,
|
|
tooltip,
|
|
value: copy,
|
|
},
|
|
};
|
|
}
|
|
function formatDisplay(display) {
|
|
return {
|
|
_custom: {
|
|
display,
|
|
},
|
|
};
|
|
}
|
|
// to support multiple router instances
|
|
let routerId = 0;
|
|
function addDevtools(app, router, matcher) {
|
|
// Take over router.beforeEach and afterEach
|
|
// make sure we are not registering the devtool twice
|
|
if (router.__hasDevtools)
|
|
return;
|
|
router.__hasDevtools = true;
|
|
// increment to support multiple router instances
|
|
const id = routerId++;
|
|
(0,_vue_devtools_api__WEBPACK_IMPORTED_MODULE_1__.setupDevtoolsPlugin)({
|
|
id: 'org.vuejs.router' + (id ? '.' + id : ''),
|
|
label: 'Vue Router',
|
|
packageName: 'vue-router',
|
|
homepage: 'https://next.router.vuejs.org/',
|
|
logo: 'https://vuejs.org/images/icons/favicon-96x96.png',
|
|
componentStateTypes: ['Routing'],
|
|
app,
|
|
}, api => {
|
|
// display state added by the router
|
|
api.on.inspectComponent((payload, ctx) => {
|
|
if (payload.instanceData) {
|
|
payload.instanceData.state.push({
|
|
type: 'Routing',
|
|
key: '$route',
|
|
editable: false,
|
|
value: formatRouteLocation(router.currentRoute.value, 'Current Route'),
|
|
});
|
|
}
|
|
});
|
|
// mark router-link as active
|
|
api.on.visitComponentTree(({ treeNode: node, componentInstance }) => {
|
|
// if multiple useLink are used
|
|
if (Array.isArray(componentInstance.__vrl_devtools)) {
|
|
componentInstance.__devtoolsApi = api;
|
|
componentInstance.__vrl_devtools.forEach(devtoolsData => {
|
|
let backgroundColor = ORANGE_400;
|
|
let tooltip = '';
|
|
if (devtoolsData.isExactActive) {
|
|
backgroundColor = LIME_500;
|
|
tooltip = 'This is exactly active';
|
|
}
|
|
else if (devtoolsData.isActive) {
|
|
backgroundColor = BLUE_600;
|
|
tooltip = 'This link is active';
|
|
}
|
|
node.tags.push({
|
|
label: devtoolsData.route.path,
|
|
textColor: 0,
|
|
tooltip,
|
|
backgroundColor,
|
|
});
|
|
});
|
|
}
|
|
});
|
|
(0,vue__WEBPACK_IMPORTED_MODULE_0__.watch)(router.currentRoute, () => {
|
|
// refresh active state
|
|
refreshRoutesView();
|
|
api.notifyComponentUpdate();
|
|
api.sendInspectorTree(routerInspectorId);
|
|
api.sendInspectorState(routerInspectorId);
|
|
});
|
|
const navigationsLayerId = 'router:navigations:' + id;
|
|
api.addTimelineLayer({
|
|
id: navigationsLayerId,
|
|
label: `Router${id ? ' ' + id : ''} Navigations`,
|
|
color: 0x40a8c4,
|
|
});
|
|
// const errorsLayerId = 'router:errors'
|
|
// api.addTimelineLayer({
|
|
// id: errorsLayerId,
|
|
// label: 'Router Errors',
|
|
// color: 0xea5455,
|
|
// })
|
|
router.onError((error, to) => {
|
|
api.addTimelineEvent({
|
|
layerId: navigationsLayerId,
|
|
event: {
|
|
title: 'Error during Navigation',
|
|
subtitle: to.fullPath,
|
|
logType: 'error',
|
|
time: Date.now(),
|
|
data: { error },
|
|
groupId: to.meta.__navigationId,
|
|
},
|
|
});
|
|
});
|
|
// attached to `meta` and used to group events
|
|
let navigationId = 0;
|
|
router.beforeEach((to, from) => {
|
|
const data = {
|
|
guard: formatDisplay('beforeEach'),
|
|
from: formatRouteLocation(from, 'Current Location during this navigation'),
|
|
to: formatRouteLocation(to, 'Target location'),
|
|
};
|
|
// Used to group navigations together, hide from devtools
|
|
Object.defineProperty(to.meta, '__navigationId', {
|
|
value: navigationId++,
|
|
});
|
|
api.addTimelineEvent({
|
|
layerId: navigationsLayerId,
|
|
event: {
|
|
time: Date.now(),
|
|
title: 'Start of navigation',
|
|
subtitle: to.fullPath,
|
|
data,
|
|
groupId: to.meta.__navigationId,
|
|
},
|
|
});
|
|
});
|
|
router.afterEach((to, from, failure) => {
|
|
const data = {
|
|
guard: formatDisplay('afterEach'),
|
|
};
|
|
if (failure) {
|
|
data.failure = {
|
|
_custom: {
|
|
type: Error,
|
|
readOnly: true,
|
|
display: failure ? failure.message : '',
|
|
tooltip: 'Navigation Failure',
|
|
value: failure,
|
|
},
|
|
};
|
|
data.status = formatDisplay('❌');
|
|
}
|
|
else {
|
|
data.status = formatDisplay('✅');
|
|
}
|
|
// we set here to have the right order
|
|
data.from = formatRouteLocation(from, 'Current Location during this navigation');
|
|
data.to = formatRouteLocation(to, 'Target location');
|
|
api.addTimelineEvent({
|
|
layerId: navigationsLayerId,
|
|
event: {
|
|
title: 'End of navigation',
|
|
subtitle: to.fullPath,
|
|
time: Date.now(),
|
|
data,
|
|
logType: failure ? 'warning' : 'default',
|
|
groupId: to.meta.__navigationId,
|
|
},
|
|
});
|
|
});
|
|
/**
|
|
* Inspector of Existing routes
|
|
*/
|
|
const routerInspectorId = 'router-inspector:' + id;
|
|
api.addInspector({
|
|
id: routerInspectorId,
|
|
label: 'Routes' + (id ? ' ' + id : ''),
|
|
icon: 'book',
|
|
treeFilterPlaceholder: 'Search routes',
|
|
});
|
|
function refreshRoutesView() {
|
|
// the routes view isn't active
|
|
if (!activeRoutesPayload)
|
|
return;
|
|
const payload = activeRoutesPayload;
|
|
// children routes will appear as nested
|
|
let routes = matcher.getRoutes().filter(route => !route.parent);
|
|
// reset match state to false
|
|
routes.forEach(resetMatchStateOnRouteRecord);
|
|
// apply a match state if there is a payload
|
|
if (payload.filter) {
|
|
routes = routes.filter(route =>
|
|
// save matches state based on the payload
|
|
isRouteMatching(route, payload.filter.toLowerCase()));
|
|
}
|
|
// mark active routes
|
|
routes.forEach(route => markRouteRecordActive(route, router.currentRoute.value));
|
|
payload.rootNodes = routes.map(formatRouteRecordForInspector);
|
|
}
|
|
let activeRoutesPayload;
|
|
api.on.getInspectorTree(payload => {
|
|
activeRoutesPayload = payload;
|
|
if (payload.app === app && payload.inspectorId === routerInspectorId) {
|
|
refreshRoutesView();
|
|
}
|
|
});
|
|
/**
|
|
* Display information about the currently selected route record
|
|
*/
|
|
api.on.getInspectorState(payload => {
|
|
if (payload.app === app && payload.inspectorId === routerInspectorId) {
|
|
const routes = matcher.getRoutes();
|
|
const route = routes.find(route => route.record.__vd_id === payload.nodeId);
|
|
if (route) {
|
|
payload.state = {
|
|
options: formatRouteRecordMatcherForStateInspector(route),
|
|
};
|
|
}
|
|
}
|
|
});
|
|
api.sendInspectorTree(routerInspectorId);
|
|
api.sendInspectorState(routerInspectorId);
|
|
});
|
|
}
|
|
function modifierForKey(key) {
|
|
if (key.optional) {
|
|
return key.repeatable ? '*' : '?';
|
|
}
|
|
else {
|
|
return key.repeatable ? '+' : '';
|
|
}
|
|
}
|
|
function formatRouteRecordMatcherForStateInspector(route) {
|
|
const { record } = route;
|
|
const fields = [
|
|
{ editable: false, key: 'path', value: record.path },
|
|
];
|
|
if (record.name != null) {
|
|
fields.push({
|
|
editable: false,
|
|
key: 'name',
|
|
value: record.name,
|
|
});
|
|
}
|
|
fields.push({ editable: false, key: 'regexp', value: route.re });
|
|
if (route.keys.length) {
|
|
fields.push({
|
|
editable: false,
|
|
key: 'keys',
|
|
value: {
|
|
_custom: {
|
|
type: null,
|
|
readOnly: true,
|
|
display: route.keys
|
|
.map(key => `${key.name}${modifierForKey(key)}`)
|
|
.join(' '),
|
|
tooltip: 'Param keys',
|
|
value: route.keys,
|
|
},
|
|
},
|
|
});
|
|
}
|
|
if (record.redirect != null) {
|
|
fields.push({
|
|
editable: false,
|
|
key: 'redirect',
|
|
value: record.redirect,
|
|
});
|
|
}
|
|
if (route.alias.length) {
|
|
fields.push({
|
|
editable: false,
|
|
key: 'aliases',
|
|
value: route.alias.map(alias => alias.record.path),
|
|
});
|
|
}
|
|
fields.push({
|
|
key: 'score',
|
|
editable: false,
|
|
value: {
|
|
_custom: {
|
|
type: null,
|
|
readOnly: true,
|
|
display: route.score.map(score => score.join(', ')).join(' | '),
|
|
tooltip: 'Score used to sort routes',
|
|
value: route.score,
|
|
},
|
|
},
|
|
});
|
|
return fields;
|
|
}
|
|
/**
|
|
* Extracted from tailwind palette
|
|
*/
|
|
const PINK_500 = 0xec4899;
|
|
const BLUE_600 = 0x2563eb;
|
|
const LIME_500 = 0x84cc16;
|
|
const CYAN_400 = 0x22d3ee;
|
|
const ORANGE_400 = 0xfb923c;
|
|
// const GRAY_100 = 0xf4f4f5
|
|
const DARK = 0x666666;
|
|
function formatRouteRecordForInspector(route) {
|
|
const tags = [];
|
|
const { record } = route;
|
|
if (record.name != null) {
|
|
tags.push({
|
|
label: String(record.name),
|
|
textColor: 0,
|
|
backgroundColor: CYAN_400,
|
|
});
|
|
}
|
|
if (record.aliasOf) {
|
|
tags.push({
|
|
label: 'alias',
|
|
textColor: 0,
|
|
backgroundColor: ORANGE_400,
|
|
});
|
|
}
|
|
if (route.__vd_match) {
|
|
tags.push({
|
|
label: 'matches',
|
|
textColor: 0,
|
|
backgroundColor: PINK_500,
|
|
});
|
|
}
|
|
if (route.__vd_exactActive) {
|
|
tags.push({
|
|
label: 'exact',
|
|
textColor: 0,
|
|
backgroundColor: LIME_500,
|
|
});
|
|
}
|
|
if (route.__vd_active) {
|
|
tags.push({
|
|
label: 'active',
|
|
textColor: 0,
|
|
backgroundColor: BLUE_600,
|
|
});
|
|
}
|
|
if (record.redirect) {
|
|
tags.push({
|
|
label: 'redirect: ' +
|
|
(typeof record.redirect === 'string' ? record.redirect : 'Object'),
|
|
textColor: 0xffffff,
|
|
backgroundColor: DARK,
|
|
});
|
|
}
|
|
// add an id to be able to select it. Using the `path` is not possible because
|
|
// empty path children would collide with their parents
|
|
let id = record.__vd_id;
|
|
if (id == null) {
|
|
id = String(routeRecordId++);
|
|
record.__vd_id = id;
|
|
}
|
|
return {
|
|
id,
|
|
label: record.path,
|
|
tags,
|
|
children: route.children.map(formatRouteRecordForInspector),
|
|
};
|
|
}
|
|
// incremental id for route records and inspector state
|
|
let routeRecordId = 0;
|
|
const EXTRACT_REGEXP_RE = /^\/(.*)\/([a-z]*)$/;
|
|
function markRouteRecordActive(route, currentRoute) {
|
|
// no route will be active if matched is empty
|
|
// reset the matching state
|
|
const isExactActive = currentRoute.matched.length &&
|
|
isSameRouteRecord(currentRoute.matched[currentRoute.matched.length - 1], route.record);
|
|
route.__vd_exactActive = route.__vd_active = isExactActive;
|
|
if (!isExactActive) {
|
|
route.__vd_active = currentRoute.matched.some(match => isSameRouteRecord(match, route.record));
|
|
}
|
|
route.children.forEach(childRoute => markRouteRecordActive(childRoute, currentRoute));
|
|
}
|
|
function resetMatchStateOnRouteRecord(route) {
|
|
route.__vd_match = false;
|
|
route.children.forEach(resetMatchStateOnRouteRecord);
|
|
}
|
|
function isRouteMatching(route, filter) {
|
|
const found = String(route.re).match(EXTRACT_REGEXP_RE);
|
|
route.__vd_match = false;
|
|
if (!found || found.length < 3) {
|
|
return false;
|
|
}
|
|
// use a regexp without $ at the end to match nested routes better
|
|
const nonEndingRE = new RegExp(found[1].replace(/\$$/, ''), found[2]);
|
|
if (nonEndingRE.test(filter)) {
|
|
// mark children as matches
|
|
route.children.forEach(child => isRouteMatching(child, filter));
|
|
// exception case: `/`
|
|
if (route.record.path !== '/' || filter === '/') {
|
|
route.__vd_match = route.re.test(filter);
|
|
return true;
|
|
}
|
|
// hide the / route
|
|
return false;
|
|
}
|
|
const path = route.record.path.toLowerCase();
|
|
const decodedPath = decode(path);
|
|
// also allow partial matching on the path
|
|
if (!filter.startsWith('/') &&
|
|
(decodedPath.includes(filter) || path.includes(filter)))
|
|
return true;
|
|
if (decodedPath.startsWith(filter) || path.startsWith(filter))
|
|
return true;
|
|
if (route.record.name && String(route.record.name).includes(filter))
|
|
return true;
|
|
return route.children.some(child => isRouteMatching(child, filter));
|
|
}
|
|
function omit(obj, keys) {
|
|
const ret = {};
|
|
for (const key in obj) {
|
|
if (!keys.includes(key)) {
|
|
// @ts-expect-error
|
|
ret[key] = obj[key];
|
|
}
|
|
}
|
|
return ret;
|
|
}
|
|
|
|
/**
|
|
* Creates a Router instance that can be used by a Vue app.
|
|
*
|
|
* @param options - {@link RouterOptions}
|
|
*/
|
|
function createRouter(options) {
|
|
const matcher = createRouterMatcher(options.routes, options);
|
|
const parseQuery$1 = options.parseQuery || parseQuery;
|
|
const stringifyQuery$1 = options.stringifyQuery || stringifyQuery;
|
|
const routerHistory = options.history;
|
|
if (( true) && !routerHistory)
|
|
throw new Error('Provide the "history" option when calling "createRouter()":' +
|
|
' https://next.router.vuejs.org/api/#history.');
|
|
const beforeGuards = useCallbacks();
|
|
const beforeResolveGuards = useCallbacks();
|
|
const afterGuards = useCallbacks();
|
|
const currentRoute = (0,vue__WEBPACK_IMPORTED_MODULE_0__.shallowRef)(START_LOCATION_NORMALIZED);
|
|
let pendingLocation = START_LOCATION_NORMALIZED;
|
|
// leave the scrollRestoration if no scrollBehavior is provided
|
|
if (isBrowser && options.scrollBehavior && 'scrollRestoration' in history) {
|
|
history.scrollRestoration = 'manual';
|
|
}
|
|
const normalizeParams = applyToParams.bind(null, paramValue => '' + paramValue);
|
|
const encodeParams = applyToParams.bind(null, encodeParam);
|
|
const decodeParams =
|
|
// @ts-expect-error: intentionally avoid the type check
|
|
applyToParams.bind(null, decode);
|
|
function addRoute(parentOrRoute, route) {
|
|
let parent;
|
|
let record;
|
|
if (isRouteName(parentOrRoute)) {
|
|
parent = matcher.getRecordMatcher(parentOrRoute);
|
|
record = route;
|
|
}
|
|
else {
|
|
record = parentOrRoute;
|
|
}
|
|
return matcher.addRoute(record, parent);
|
|
}
|
|
function removeRoute(name) {
|
|
const recordMatcher = matcher.getRecordMatcher(name);
|
|
if (recordMatcher) {
|
|
matcher.removeRoute(recordMatcher);
|
|
}
|
|
else if ((true)) {
|
|
warn(`Cannot remove non-existent route "${String(name)}"`);
|
|
}
|
|
}
|
|
function getRoutes() {
|
|
return matcher.getRoutes().map(routeMatcher => routeMatcher.record);
|
|
}
|
|
function hasRoute(name) {
|
|
return !!matcher.getRecordMatcher(name);
|
|
}
|
|
function resolve(rawLocation, currentLocation) {
|
|
// const objectLocation = routerLocationAsObject(rawLocation)
|
|
// we create a copy to modify it later
|
|
currentLocation = assign({}, currentLocation || currentRoute.value);
|
|
if (typeof rawLocation === 'string') {
|
|
const locationNormalized = parseURL(parseQuery$1, rawLocation, currentLocation.path);
|
|
const matchedRoute = matcher.resolve({ path: locationNormalized.path }, currentLocation);
|
|
const href = routerHistory.createHref(locationNormalized.fullPath);
|
|
if ((true)) {
|
|
if (href.startsWith('//'))
|
|
warn(`Location "${rawLocation}" resolved to "${href}". A resolved location cannot start with multiple slashes.`);
|
|
else if (!matchedRoute.matched.length) {
|
|
warn(`No match found for location with path "${rawLocation}"`);
|
|
}
|
|
}
|
|
// locationNormalized is always a new object
|
|
return assign(locationNormalized, matchedRoute, {
|
|
params: decodeParams(matchedRoute.params),
|
|
hash: decode(locationNormalized.hash),
|
|
redirectedFrom: undefined,
|
|
href,
|
|
});
|
|
}
|
|
let matcherLocation;
|
|
// path could be relative in object as well
|
|
if ('path' in rawLocation) {
|
|
if (( true) &&
|
|
'params' in rawLocation &&
|
|
!('name' in rawLocation) &&
|
|
Object.keys(rawLocation.params).length) {
|
|
warn(`Path "${rawLocation.path}" was passed with params but they will be ignored. Use a named route alongside params instead.`);
|
|
}
|
|
matcherLocation = assign({}, rawLocation, {
|
|
path: parseURL(parseQuery$1, rawLocation.path, currentLocation.path).path,
|
|
});
|
|
}
|
|
else {
|
|
// remove any nullish param
|
|
const targetParams = assign({}, rawLocation.params);
|
|
for (const key in targetParams) {
|
|
if (targetParams[key] == null) {
|
|
delete targetParams[key];
|
|
}
|
|
}
|
|
// pass encoded values to the matcher so it can produce encoded path and fullPath
|
|
matcherLocation = assign({}, rawLocation, {
|
|
params: encodeParams(rawLocation.params),
|
|
});
|
|
// current location params are decoded, we need to encode them in case the
|
|
// matcher merges the params
|
|
currentLocation.params = encodeParams(currentLocation.params);
|
|
}
|
|
const matchedRoute = matcher.resolve(matcherLocation, currentLocation);
|
|
const hash = rawLocation.hash || '';
|
|
if (( true) && hash && !hash.startsWith('#')) {
|
|
warn(`A \`hash\` should always start with the character "#". Replace "${hash}" with "#${hash}".`);
|
|
}
|
|
// decoding them) the matcher might have merged current location params so
|
|
// we need to run the decoding again
|
|
matchedRoute.params = normalizeParams(decodeParams(matchedRoute.params));
|
|
const fullPath = stringifyURL(stringifyQuery$1, assign({}, rawLocation, {
|
|
hash: encodeHash(hash),
|
|
path: matchedRoute.path,
|
|
}));
|
|
const href = routerHistory.createHref(fullPath);
|
|
if ((true)) {
|
|
if (href.startsWith('//')) {
|
|
warn(`Location "${rawLocation}" resolved to "${href}". A resolved location cannot start with multiple slashes.`);
|
|
}
|
|
else if (!matchedRoute.matched.length) {
|
|
warn(`No match found for location with path "${'path' in rawLocation ? rawLocation.path : rawLocation}"`);
|
|
}
|
|
}
|
|
return assign({
|
|
fullPath,
|
|
// keep the hash encoded so fullPath is effectively path + encodedQuery +
|
|
// hash
|
|
hash,
|
|
query:
|
|
// if the user is using a custom query lib like qs, we might have
|
|
// nested objects, so we keep the query as is, meaning it can contain
|
|
// numbers at `$route.query`, but at the point, the user will have to
|
|
// use their own type anyway.
|
|
// https://github.com/vuejs/vue-router-next/issues/328#issuecomment-649481567
|
|
stringifyQuery$1 === stringifyQuery
|
|
? normalizeQuery(rawLocation.query)
|
|
: (rawLocation.query || {}),
|
|
}, matchedRoute, {
|
|
redirectedFrom: undefined,
|
|
href,
|
|
});
|
|
}
|
|
function locationAsObject(to) {
|
|
return typeof to === 'string'
|
|
? parseURL(parseQuery$1, to, currentRoute.value.path)
|
|
: assign({}, to);
|
|
}
|
|
function checkCanceledNavigation(to, from) {
|
|
if (pendingLocation !== to) {
|
|
return createRouterError(8 /* NAVIGATION_CANCELLED */, {
|
|
from,
|
|
to,
|
|
});
|
|
}
|
|
}
|
|
function push(to) {
|
|
return pushWithRedirect(to);
|
|
}
|
|
function replace(to) {
|
|
return push(assign(locationAsObject(to), { replace: true }));
|
|
}
|
|
function handleRedirectRecord(to) {
|
|
const lastMatched = to.matched[to.matched.length - 1];
|
|
if (lastMatched && lastMatched.redirect) {
|
|
const { redirect } = lastMatched;
|
|
let newTargetLocation = typeof redirect === 'function' ? redirect(to) : redirect;
|
|
if (typeof newTargetLocation === 'string') {
|
|
newTargetLocation =
|
|
newTargetLocation.includes('?') || newTargetLocation.includes('#')
|
|
? (newTargetLocation = locationAsObject(newTargetLocation))
|
|
: // force empty params
|
|
{ path: newTargetLocation };
|
|
// @ts-expect-error: force empty params when a string is passed to let
|
|
// the router parse them again
|
|
newTargetLocation.params = {};
|
|
}
|
|
if (( true) &&
|
|
!('path' in newTargetLocation) &&
|
|
!('name' in newTargetLocation)) {
|
|
warn(`Invalid redirect found:\n${JSON.stringify(newTargetLocation, null, 2)}\n when navigating to "${to.fullPath}". A redirect must contain a name or path. This will break in production.`);
|
|
throw new Error('Invalid redirect');
|
|
}
|
|
return assign({
|
|
query: to.query,
|
|
hash: to.hash,
|
|
params: to.params,
|
|
}, newTargetLocation);
|
|
}
|
|
}
|
|
function pushWithRedirect(to, redirectedFrom) {
|
|
const targetLocation = (pendingLocation = resolve(to));
|
|
const from = currentRoute.value;
|
|
const data = to.state;
|
|
const force = to.force;
|
|
// to could be a string where `replace` is a function
|
|
const replace = to.replace === true;
|
|
const shouldRedirect = handleRedirectRecord(targetLocation);
|
|
if (shouldRedirect)
|
|
return pushWithRedirect(assign(locationAsObject(shouldRedirect), {
|
|
state: data,
|
|
force,
|
|
replace,
|
|
}),
|
|
// keep original redirectedFrom if it exists
|
|
redirectedFrom || targetLocation);
|
|
// if it was a redirect we already called `pushWithRedirect` above
|
|
const toLocation = targetLocation;
|
|
toLocation.redirectedFrom = redirectedFrom;
|
|
let failure;
|
|
if (!force && isSameRouteLocation(stringifyQuery$1, from, targetLocation)) {
|
|
failure = createRouterError(16 /* NAVIGATION_DUPLICATED */, { to: toLocation, from });
|
|
// trigger scroll to allow scrolling to the same anchor
|
|
handleScroll(from, from,
|
|
// this is a push, the only way for it to be triggered from a
|
|
// history.listen is with a redirect, which makes it become a push
|
|
true,
|
|
// This cannot be the first navigation because the initial location
|
|
// cannot be manually navigated to
|
|
false);
|
|
}
|
|
return (failure ? Promise.resolve(failure) : navigate(toLocation, from))
|
|
.catch((error) => isNavigationFailure(error)
|
|
? error
|
|
: // reject any unknown error
|
|
triggerError(error, toLocation, from))
|
|
.then((failure) => {
|
|
if (failure) {
|
|
if (isNavigationFailure(failure, 2 /* NAVIGATION_GUARD_REDIRECT */)) {
|
|
if (( true) &&
|
|
// we are redirecting to the same location we were already at
|
|
isSameRouteLocation(stringifyQuery$1, resolve(failure.to), toLocation) &&
|
|
// and we have done it a couple of times
|
|
redirectedFrom &&
|
|
// @ts-expect-error: added only in dev
|
|
(redirectedFrom._count = redirectedFrom._count
|
|
? // @ts-expect-error
|
|
redirectedFrom._count + 1
|
|
: 1) > 10) {
|
|
warn(`Detected an infinite redirection in a navigation guard when going from "${from.fullPath}" to "${toLocation.fullPath}". Aborting to avoid a Stack Overflow. This will break in production if not fixed.`);
|
|
return Promise.reject(new Error('Infinite redirect in navigation guard'));
|
|
}
|
|
return pushWithRedirect(
|
|
// keep options
|
|
assign(locationAsObject(failure.to), {
|
|
state: data,
|
|
force,
|
|
replace,
|
|
}),
|
|
// preserve the original redirectedFrom if any
|
|
redirectedFrom || toLocation);
|
|
}
|
|
}
|
|
else {
|
|
// if we fail we don't finalize the navigation
|
|
failure = finalizeNavigation(toLocation, from, true, replace, data);
|
|
}
|
|
triggerAfterEach(toLocation, from, failure);
|
|
return failure;
|
|
});
|
|
}
|
|
/**
|
|
* Helper to reject and skip all navigation guards if a new navigation happened
|
|
* @param to
|
|
* @param from
|
|
*/
|
|
function checkCanceledNavigationAndReject(to, from) {
|
|
const error = checkCanceledNavigation(to, from);
|
|
return error ? Promise.reject(error) : Promise.resolve();
|
|
}
|
|
// TODO: refactor the whole before guards by internally using router.beforeEach
|
|
function navigate(to, from) {
|
|
let guards;
|
|
const [leavingRecords, updatingRecords, enteringRecords] = extractChangingRecords(to, from);
|
|
// all components here have been resolved once because we are leaving
|
|
guards = extractComponentsGuards(leavingRecords.reverse(), 'beforeRouteLeave', to, from);
|
|
// leavingRecords is already reversed
|
|
for (const record of leavingRecords) {
|
|
record.leaveGuards.forEach(guard => {
|
|
guards.push(guardToPromiseFn(guard, to, from));
|
|
});
|
|
}
|
|
const canceledNavigationCheck = checkCanceledNavigationAndReject.bind(null, to, from);
|
|
guards.push(canceledNavigationCheck);
|
|
// run the queue of per route beforeRouteLeave guards
|
|
return (runGuardQueue(guards)
|
|
.then(() => {
|
|
// check global guards beforeEach
|
|
guards = [];
|
|
for (const guard of beforeGuards.list()) {
|
|
guards.push(guardToPromiseFn(guard, to, from));
|
|
}
|
|
guards.push(canceledNavigationCheck);
|
|
return runGuardQueue(guards);
|
|
})
|
|
.then(() => {
|
|
// check in components beforeRouteUpdate
|
|
guards = extractComponentsGuards(updatingRecords, 'beforeRouteUpdate', to, from);
|
|
for (const record of updatingRecords) {
|
|
record.updateGuards.forEach(guard => {
|
|
guards.push(guardToPromiseFn(guard, to, from));
|
|
});
|
|
}
|
|
guards.push(canceledNavigationCheck);
|
|
// run the queue of per route beforeEnter guards
|
|
return runGuardQueue(guards);
|
|
})
|
|
.then(() => {
|
|
// check the route beforeEnter
|
|
guards = [];
|
|
for (const record of to.matched) {
|
|
// do not trigger beforeEnter on reused views
|
|
if (record.beforeEnter && !from.matched.includes(record)) {
|
|
if (Array.isArray(record.beforeEnter)) {
|
|
for (const beforeEnter of record.beforeEnter)
|
|
guards.push(guardToPromiseFn(beforeEnter, to, from));
|
|
}
|
|
else {
|
|
guards.push(guardToPromiseFn(record.beforeEnter, to, from));
|
|
}
|
|
}
|
|
}
|
|
guards.push(canceledNavigationCheck);
|
|
// run the queue of per route beforeEnter guards
|
|
return runGuardQueue(guards);
|
|
})
|
|
.then(() => {
|
|
// NOTE: at this point to.matched is normalized and does not contain any () => Promise<Component>
|
|
// clear existing enterCallbacks, these are added by extractComponentsGuards
|
|
to.matched.forEach(record => (record.enterCallbacks = {}));
|
|
// check in-component beforeRouteEnter
|
|
guards = extractComponentsGuards(enteringRecords, 'beforeRouteEnter', to, from);
|
|
guards.push(canceledNavigationCheck);
|
|
// run the queue of per route beforeEnter guards
|
|
return runGuardQueue(guards);
|
|
})
|
|
.then(() => {
|
|
// check global guards beforeResolve
|
|
guards = [];
|
|
for (const guard of beforeResolveGuards.list()) {
|
|
guards.push(guardToPromiseFn(guard, to, from));
|
|
}
|
|
guards.push(canceledNavigationCheck);
|
|
return runGuardQueue(guards);
|
|
})
|
|
// catch any navigation canceled
|
|
.catch(err => isNavigationFailure(err, 8 /* NAVIGATION_CANCELLED */)
|
|
? err
|
|
: Promise.reject(err)));
|
|
}
|
|
function triggerAfterEach(to, from, failure) {
|
|
// navigation is confirmed, call afterGuards
|
|
// TODO: wrap with error handlers
|
|
for (const guard of afterGuards.list())
|
|
guard(to, from, failure);
|
|
}
|
|
/**
|
|
* - Cleans up any navigation guards
|
|
* - Changes the url if necessary
|
|
* - Calls the scrollBehavior
|
|
*/
|
|
function finalizeNavigation(toLocation, from, isPush, replace, data) {
|
|
// a more recent navigation took place
|
|
const error = checkCanceledNavigation(toLocation, from);
|
|
if (error)
|
|
return error;
|
|
// only consider as push if it's not the first navigation
|
|
const isFirstNavigation = from === START_LOCATION_NORMALIZED;
|
|
const state = !isBrowser ? {} : history.state;
|
|
// change URL only if the user did a push/replace and if it's not the initial navigation because
|
|
// it's just reflecting the url
|
|
if (isPush) {
|
|
// on the initial navigation, we want to reuse the scroll position from
|
|
// history state if it exists
|
|
if (replace || isFirstNavigation)
|
|
routerHistory.replace(toLocation.fullPath, assign({
|
|
scroll: isFirstNavigation && state && state.scroll,
|
|
}, data));
|
|
else
|
|
routerHistory.push(toLocation.fullPath, data);
|
|
}
|
|
// accept current navigation
|
|
currentRoute.value = toLocation;
|
|
handleScroll(toLocation, from, isPush, isFirstNavigation);
|
|
markAsReady();
|
|
}
|
|
let removeHistoryListener;
|
|
// attach listener to history to trigger navigations
|
|
function setupListeners() {
|
|
removeHistoryListener = routerHistory.listen((to, _from, info) => {
|
|
// cannot be a redirect route because it was in history
|
|
const toLocation = resolve(to);
|
|
// due to dynamic routing, and to hash history with manual navigation
|
|
// (manually changing the url or calling history.hash = '#/somewhere'),
|
|
// there could be a redirect record in history
|
|
const shouldRedirect = handleRedirectRecord(toLocation);
|
|
if (shouldRedirect) {
|
|
pushWithRedirect(assign(shouldRedirect, { replace: true }), toLocation).catch(noop);
|
|
return;
|
|
}
|
|
pendingLocation = toLocation;
|
|
const from = currentRoute.value;
|
|
// TODO: should be moved to web history?
|
|
if (isBrowser) {
|
|
saveScrollPosition(getScrollKey(from.fullPath, info.delta), computeScrollPosition());
|
|
}
|
|
navigate(toLocation, from)
|
|
.catch((error) => {
|
|
if (isNavigationFailure(error, 4 /* NAVIGATION_ABORTED */ | 8 /* NAVIGATION_CANCELLED */)) {
|
|
return error;
|
|
}
|
|
if (isNavigationFailure(error, 2 /* NAVIGATION_GUARD_REDIRECT */)) {
|
|
// Here we could call if (info.delta) routerHistory.go(-info.delta,
|
|
// false) but this is bug prone as we have no way to wait the
|
|
// navigation to be finished before calling pushWithRedirect. Using
|
|
// a setTimeout of 16ms seems to work but there is not guarantee for
|
|
// it to work on every browser. So Instead we do not restore the
|
|
// history entry and trigger a new navigation as requested by the
|
|
// navigation guard.
|
|
// the error is already handled by router.push we just want to avoid
|
|
// logging the error
|
|
pushWithRedirect(error.to, toLocation
|
|
// avoid an uncaught rejection, let push call triggerError
|
|
)
|
|
.then(failure => {
|
|
// manual change in hash history #916 ending up in the URL not
|
|
// changing but it was changed by the manual url change, so we
|
|
// need to manually change it ourselves
|
|
if (isNavigationFailure(failure, 4 /* NAVIGATION_ABORTED */ |
|
|
16 /* NAVIGATION_DUPLICATED */) &&
|
|
!info.delta &&
|
|
info.type === NavigationType.pop) {
|
|
routerHistory.go(-1, false);
|
|
}
|
|
})
|
|
.catch(noop);
|
|
// avoid the then branch
|
|
return Promise.reject();
|
|
}
|
|
// do not restore history on unknown direction
|
|
if (info.delta)
|
|
routerHistory.go(-info.delta, false);
|
|
// unrecognized error, transfer to the global handler
|
|
return triggerError(error, toLocation, from);
|
|
})
|
|
.then((failure) => {
|
|
failure =
|
|
failure ||
|
|
finalizeNavigation(
|
|
// after navigation, all matched components are resolved
|
|
toLocation, from, false);
|
|
// revert the navigation
|
|
if (failure) {
|
|
if (info.delta) {
|
|
routerHistory.go(-info.delta, false);
|
|
}
|
|
else if (info.type === NavigationType.pop &&
|
|
isNavigationFailure(failure, 4 /* NAVIGATION_ABORTED */ | 16 /* NAVIGATION_DUPLICATED */)) {
|
|
// manual change in hash history #916
|
|
// it's like a push but lacks the information of the direction
|
|
routerHistory.go(-1, false);
|
|
}
|
|
}
|
|
triggerAfterEach(toLocation, from, failure);
|
|
})
|
|
.catch(noop);
|
|
});
|
|
}
|
|
// Initialization and Errors
|
|
let readyHandlers = useCallbacks();
|
|
let errorHandlers = useCallbacks();
|
|
let ready;
|
|
/**
|
|
* Trigger errorHandlers added via onError and throws the error as well
|
|
*
|
|
* @param error - error to throw
|
|
* @param to - location we were navigating to when the error happened
|
|
* @param from - location we were navigating from when the error happened
|
|
* @returns the error as a rejected promise
|
|
*/
|
|
function triggerError(error, to, from) {
|
|
markAsReady(error);
|
|
const list = errorHandlers.list();
|
|
if (list.length) {
|
|
list.forEach(handler => handler(error, to, from));
|
|
}
|
|
else {
|
|
if ((true)) {
|
|
warn('uncaught error during route navigation:');
|
|
}
|
|
console.error(error);
|
|
}
|
|
return Promise.reject(error);
|
|
}
|
|
function isReady() {
|
|
if (ready && currentRoute.value !== START_LOCATION_NORMALIZED)
|
|
return Promise.resolve();
|
|
return new Promise((resolve, reject) => {
|
|
readyHandlers.add([resolve, reject]);
|
|
});
|
|
}
|
|
/**
|
|
* Mark the router as ready, resolving the promised returned by isReady(). Can
|
|
* only be called once, otherwise does nothing.
|
|
* @param err - optional error
|
|
*/
|
|
function markAsReady(err) {
|
|
if (ready)
|
|
return;
|
|
ready = true;
|
|
setupListeners();
|
|
readyHandlers
|
|
.list()
|
|
.forEach(([resolve, reject]) => (err ? reject(err) : resolve()));
|
|
readyHandlers.reset();
|
|
}
|
|
// Scroll behavior
|
|
function handleScroll(to, from, isPush, isFirstNavigation) {
|
|
const { scrollBehavior } = options;
|
|
if (!isBrowser || !scrollBehavior)
|
|
return Promise.resolve();
|
|
const scrollPosition = (!isPush && getSavedScrollPosition(getScrollKey(to.fullPath, 0))) ||
|
|
((isFirstNavigation || !isPush) &&
|
|
history.state &&
|
|
history.state.scroll) ||
|
|
null;
|
|
return (0,vue__WEBPACK_IMPORTED_MODULE_0__.nextTick)()
|
|
.then(() => scrollBehavior(to, from, scrollPosition))
|
|
.then(position => position && scrollToPosition(position))
|
|
.catch(err => triggerError(err, to, from));
|
|
}
|
|
const go = (delta) => routerHistory.go(delta);
|
|
let started;
|
|
const installedApps = new Set();
|
|
const router = {
|
|
currentRoute,
|
|
addRoute,
|
|
removeRoute,
|
|
hasRoute,
|
|
getRoutes,
|
|
resolve,
|
|
options,
|
|
push,
|
|
replace,
|
|
go,
|
|
back: () => go(-1),
|
|
forward: () => go(1),
|
|
beforeEach: beforeGuards.add,
|
|
beforeResolve: beforeResolveGuards.add,
|
|
afterEach: afterGuards.add,
|
|
onError: errorHandlers.add,
|
|
isReady,
|
|
install(app) {
|
|
const router = this;
|
|
app.component('RouterLink', RouterLink);
|
|
app.component('RouterView', RouterView);
|
|
app.config.globalProperties.$router = router;
|
|
Object.defineProperty(app.config.globalProperties, '$route', {
|
|
enumerable: true,
|
|
get: () => (0,vue__WEBPACK_IMPORTED_MODULE_0__.unref)(currentRoute),
|
|
});
|
|
// this initial navigation is only necessary on client, on server it doesn't
|
|
// make sense because it will create an extra unnecessary navigation and could
|
|
// lead to problems
|
|
if (isBrowser &&
|
|
// used for the initial navigation client side to avoid pushing
|
|
// multiple times when the router is used in multiple apps
|
|
!started &&
|
|
currentRoute.value === START_LOCATION_NORMALIZED) {
|
|
// see above
|
|
started = true;
|
|
push(routerHistory.location).catch(err => {
|
|
if ((true))
|
|
warn('Unexpected error when starting the router:', err);
|
|
});
|
|
}
|
|
const reactiveRoute = {};
|
|
for (const key in START_LOCATION_NORMALIZED) {
|
|
// @ts-expect-error: the key matches
|
|
reactiveRoute[key] = (0,vue__WEBPACK_IMPORTED_MODULE_0__.computed)(() => currentRoute.value[key]);
|
|
}
|
|
app.provide(routerKey, router);
|
|
app.provide(routeLocationKey, (0,vue__WEBPACK_IMPORTED_MODULE_0__.reactive)(reactiveRoute));
|
|
app.provide(routerViewLocationKey, currentRoute);
|
|
const unmountApp = app.unmount;
|
|
installedApps.add(app);
|
|
app.unmount = function () {
|
|
installedApps.delete(app);
|
|
// the router is not attached to an app anymore
|
|
if (installedApps.size < 1) {
|
|
// invalidate the current navigation
|
|
pendingLocation = START_LOCATION_NORMALIZED;
|
|
removeHistoryListener && removeHistoryListener();
|
|
currentRoute.value = START_LOCATION_NORMALIZED;
|
|
started = false;
|
|
ready = false;
|
|
}
|
|
unmountApp();
|
|
};
|
|
if (( true) && isBrowser) {
|
|
addDevtools(app, router, matcher);
|
|
}
|
|
},
|
|
};
|
|
return router;
|
|
}
|
|
function runGuardQueue(guards) {
|
|
return guards.reduce((promise, guard) => promise.then(() => guard()), Promise.resolve());
|
|
}
|
|
function extractChangingRecords(to, from) {
|
|
const leavingRecords = [];
|
|
const updatingRecords = [];
|
|
const enteringRecords = [];
|
|
const len = Math.max(from.matched.length, to.matched.length);
|
|
for (let i = 0; i < len; i++) {
|
|
const recordFrom = from.matched[i];
|
|
if (recordFrom) {
|
|
if (to.matched.find(record => isSameRouteRecord(record, recordFrom)))
|
|
updatingRecords.push(recordFrom);
|
|
else
|
|
leavingRecords.push(recordFrom);
|
|
}
|
|
const recordTo = to.matched[i];
|
|
if (recordTo) {
|
|
// the type doesn't matter because we are comparing per reference
|
|
if (!from.matched.find(record => isSameRouteRecord(record, recordTo))) {
|
|
enteringRecords.push(recordTo);
|
|
}
|
|
}
|
|
}
|
|
return [leavingRecords, updatingRecords, enteringRecords];
|
|
}
|
|
|
|
/**
|
|
* Returns the router instance. Equivalent to using `$router` inside
|
|
* templates.
|
|
*/
|
|
function useRouter() {
|
|
return (0,vue__WEBPACK_IMPORTED_MODULE_0__.inject)(routerKey);
|
|
}
|
|
/**
|
|
* Returns the current route location. Equivalent to using `$route` inside
|
|
* templates.
|
|
*/
|
|
function useRoute() {
|
|
return (0,vue__WEBPACK_IMPORTED_MODULE_0__.inject)(routeLocationKey);
|
|
}
|
|
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "./node_modules/vue/dist/vue.esm-bundler.js":
|
|
/*!**************************************************!*\
|
|
!*** ./node_modules/vue/dist/vue.esm-bundler.js ***!
|
|
\**************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ "BaseTransition": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.BaseTransition),
|
|
/* harmony export */ "Comment": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.Comment),
|
|
/* harmony export */ "EffectScope": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.EffectScope),
|
|
/* harmony export */ "Fragment": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.Fragment),
|
|
/* harmony export */ "KeepAlive": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.KeepAlive),
|
|
/* harmony export */ "ReactiveEffect": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.ReactiveEffect),
|
|
/* harmony export */ "Static": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.Static),
|
|
/* harmony export */ "Suspense": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.Suspense),
|
|
/* harmony export */ "Teleport": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.Teleport),
|
|
/* harmony export */ "Text": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.Text),
|
|
/* harmony export */ "Transition": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.Transition),
|
|
/* harmony export */ "TransitionGroup": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.TransitionGroup),
|
|
/* harmony export */ "VueElement": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.VueElement),
|
|
/* harmony export */ "callWithAsyncErrorHandling": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.callWithAsyncErrorHandling),
|
|
/* harmony export */ "callWithErrorHandling": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.callWithErrorHandling),
|
|
/* harmony export */ "camelize": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.camelize),
|
|
/* harmony export */ "capitalize": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.capitalize),
|
|
/* harmony export */ "cloneVNode": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.cloneVNode),
|
|
/* harmony export */ "compatUtils": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.compatUtils),
|
|
/* harmony export */ "computed": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.computed),
|
|
/* harmony export */ "createApp": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.createApp),
|
|
/* harmony export */ "createBlock": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.createBlock),
|
|
/* harmony export */ "createCommentVNode": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.createCommentVNode),
|
|
/* harmony export */ "createElementBlock": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.createElementBlock),
|
|
/* harmony export */ "createElementVNode": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.createElementVNode),
|
|
/* harmony export */ "createHydrationRenderer": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.createHydrationRenderer),
|
|
/* harmony export */ "createRenderer": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.createRenderer),
|
|
/* harmony export */ "createSSRApp": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.createSSRApp),
|
|
/* harmony export */ "createSlots": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.createSlots),
|
|
/* harmony export */ "createStaticVNode": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.createStaticVNode),
|
|
/* harmony export */ "createTextVNode": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.createTextVNode),
|
|
/* harmony export */ "createVNode": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.createVNode),
|
|
/* harmony export */ "customRef": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.customRef),
|
|
/* harmony export */ "defineAsyncComponent": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.defineAsyncComponent),
|
|
/* harmony export */ "defineComponent": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.defineComponent),
|
|
/* harmony export */ "defineCustomElement": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.defineCustomElement),
|
|
/* harmony export */ "defineEmits": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.defineEmits),
|
|
/* harmony export */ "defineExpose": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.defineExpose),
|
|
/* harmony export */ "defineProps": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.defineProps),
|
|
/* harmony export */ "defineSSRCustomElement": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.defineSSRCustomElement),
|
|
/* harmony export */ "devtools": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.devtools),
|
|
/* harmony export */ "effect": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.effect),
|
|
/* harmony export */ "effectScope": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.effectScope),
|
|
/* harmony export */ "getCurrentInstance": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.getCurrentInstance),
|
|
/* harmony export */ "getCurrentScope": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.getCurrentScope),
|
|
/* harmony export */ "getTransitionRawChildren": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.getTransitionRawChildren),
|
|
/* harmony export */ "guardReactiveProps": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.guardReactiveProps),
|
|
/* harmony export */ "h": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.h),
|
|
/* harmony export */ "handleError": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.handleError),
|
|
/* harmony export */ "hydrate": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.hydrate),
|
|
/* harmony export */ "initCustomFormatter": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.initCustomFormatter),
|
|
/* harmony export */ "inject": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.inject),
|
|
/* harmony export */ "isMemoSame": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.isMemoSame),
|
|
/* harmony export */ "isProxy": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.isProxy),
|
|
/* harmony export */ "isReactive": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.isReactive),
|
|
/* harmony export */ "isReadonly": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.isReadonly),
|
|
/* harmony export */ "isRef": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.isRef),
|
|
/* harmony export */ "isRuntimeOnly": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.isRuntimeOnly),
|
|
/* harmony export */ "isVNode": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.isVNode),
|
|
/* harmony export */ "markRaw": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.markRaw),
|
|
/* harmony export */ "mergeDefaults": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.mergeDefaults),
|
|
/* harmony export */ "mergeProps": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.mergeProps),
|
|
/* harmony export */ "nextTick": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.nextTick),
|
|
/* harmony export */ "normalizeClass": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.normalizeClass),
|
|
/* harmony export */ "normalizeProps": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.normalizeProps),
|
|
/* harmony export */ "normalizeStyle": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.normalizeStyle),
|
|
/* harmony export */ "onActivated": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onActivated),
|
|
/* harmony export */ "onBeforeMount": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onBeforeMount),
|
|
/* harmony export */ "onBeforeUnmount": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onBeforeUnmount),
|
|
/* harmony export */ "onBeforeUpdate": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onBeforeUpdate),
|
|
/* harmony export */ "onDeactivated": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onDeactivated),
|
|
/* harmony export */ "onErrorCaptured": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onErrorCaptured),
|
|
/* harmony export */ "onMounted": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onMounted),
|
|
/* harmony export */ "onRenderTracked": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onRenderTracked),
|
|
/* harmony export */ "onRenderTriggered": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onRenderTriggered),
|
|
/* harmony export */ "onScopeDispose": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onScopeDispose),
|
|
/* harmony export */ "onServerPrefetch": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onServerPrefetch),
|
|
/* harmony export */ "onUnmounted": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onUnmounted),
|
|
/* harmony export */ "onUpdated": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.onUpdated),
|
|
/* harmony export */ "openBlock": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.openBlock),
|
|
/* harmony export */ "popScopeId": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.popScopeId),
|
|
/* harmony export */ "provide": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.provide),
|
|
/* harmony export */ "proxyRefs": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.proxyRefs),
|
|
/* harmony export */ "pushScopeId": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.pushScopeId),
|
|
/* harmony export */ "queuePostFlushCb": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.queuePostFlushCb),
|
|
/* harmony export */ "reactive": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.reactive),
|
|
/* harmony export */ "readonly": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.readonly),
|
|
/* harmony export */ "ref": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.ref),
|
|
/* harmony export */ "registerRuntimeCompiler": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.registerRuntimeCompiler),
|
|
/* harmony export */ "render": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.render),
|
|
/* harmony export */ "renderList": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.renderList),
|
|
/* harmony export */ "renderSlot": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.renderSlot),
|
|
/* harmony export */ "resolveComponent": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.resolveComponent),
|
|
/* harmony export */ "resolveDirective": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.resolveDirective),
|
|
/* harmony export */ "resolveDynamicComponent": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.resolveDynamicComponent),
|
|
/* harmony export */ "resolveFilter": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.resolveFilter),
|
|
/* harmony export */ "resolveTransitionHooks": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.resolveTransitionHooks),
|
|
/* harmony export */ "setBlockTracking": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.setBlockTracking),
|
|
/* harmony export */ "setDevtoolsHook": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.setDevtoolsHook),
|
|
/* harmony export */ "setTransitionHooks": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.setTransitionHooks),
|
|
/* harmony export */ "shallowReactive": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.shallowReactive),
|
|
/* harmony export */ "shallowReadonly": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.shallowReadonly),
|
|
/* harmony export */ "shallowRef": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.shallowRef),
|
|
/* harmony export */ "ssrContextKey": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.ssrContextKey),
|
|
/* harmony export */ "ssrUtils": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.ssrUtils),
|
|
/* harmony export */ "stop": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.stop),
|
|
/* harmony export */ "toDisplayString": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.toDisplayString),
|
|
/* harmony export */ "toHandlerKey": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.toHandlerKey),
|
|
/* harmony export */ "toHandlers": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.toHandlers),
|
|
/* harmony export */ "toRaw": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.toRaw),
|
|
/* harmony export */ "toRef": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.toRef),
|
|
/* harmony export */ "toRefs": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.toRefs),
|
|
/* harmony export */ "transformVNodeArgs": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.transformVNodeArgs),
|
|
/* harmony export */ "triggerRef": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.triggerRef),
|
|
/* harmony export */ "unref": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.unref),
|
|
/* harmony export */ "useAttrs": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.useAttrs),
|
|
/* harmony export */ "useCssModule": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.useCssModule),
|
|
/* harmony export */ "useCssVars": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.useCssVars),
|
|
/* harmony export */ "useSSRContext": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.useSSRContext),
|
|
/* harmony export */ "useSlots": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.useSlots),
|
|
/* harmony export */ "useTransitionState": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.useTransitionState),
|
|
/* harmony export */ "vModelCheckbox": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.vModelCheckbox),
|
|
/* harmony export */ "vModelDynamic": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.vModelDynamic),
|
|
/* harmony export */ "vModelRadio": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.vModelRadio),
|
|
/* harmony export */ "vModelSelect": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.vModelSelect),
|
|
/* harmony export */ "vModelText": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.vModelText),
|
|
/* harmony export */ "vShow": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.vShow),
|
|
/* harmony export */ "version": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.version),
|
|
/* harmony export */ "warn": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.warn),
|
|
/* harmony export */ "watch": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.watch),
|
|
/* harmony export */ "watchEffect": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.watchEffect),
|
|
/* harmony export */ "watchPostEffect": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.watchPostEffect),
|
|
/* harmony export */ "watchSyncEffect": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.watchSyncEffect),
|
|
/* harmony export */ "withAsyncContext": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.withAsyncContext),
|
|
/* harmony export */ "withCtx": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.withCtx),
|
|
/* harmony export */ "withDefaults": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.withDefaults),
|
|
/* harmony export */ "withDirectives": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.withDirectives),
|
|
/* harmony export */ "withKeys": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.withKeys),
|
|
/* harmony export */ "withMemo": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.withMemo),
|
|
/* harmony export */ "withModifiers": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.withModifiers),
|
|
/* harmony export */ "withScopeId": () => (/* reexport safe */ _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__.withScopeId),
|
|
/* harmony export */ "compile": () => (/* binding */ compileToFunction)
|
|
/* harmony export */ });
|
|
/* harmony import */ var _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @vue/runtime-dom */ "./node_modules/@vue/runtime-dom/dist/runtime-dom.esm-bundler.js");
|
|
/* harmony import */ var _vue_runtime_dom__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! @vue/runtime-dom */ "./node_modules/@vue/runtime-core/dist/runtime-core.esm-bundler.js");
|
|
/* harmony import */ var _vue_compiler_dom__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! @vue/compiler-dom */ "./node_modules/@vue/compiler-dom/dist/compiler-dom.esm-bundler.js");
|
|
/* harmony import */ var _vue_shared__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @vue/shared */ "./node_modules/@vue/shared/dist/shared.esm-bundler.js");
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function initDev() {
|
|
{
|
|
(0,_vue_runtime_dom__WEBPACK_IMPORTED_MODULE_2__.initCustomFormatter)();
|
|
}
|
|
}
|
|
|
|
// This entry is the "full-build" that includes both the runtime
|
|
if ((true)) {
|
|
initDev();
|
|
}
|
|
const compileCache = Object.create(null);
|
|
function compileToFunction(template, options) {
|
|
if (!(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.isString)(template)) {
|
|
if (template.nodeType) {
|
|
template = template.innerHTML;
|
|
}
|
|
else {
|
|
( true) && (0,_vue_runtime_dom__WEBPACK_IMPORTED_MODULE_2__.warn)(`invalid template option: `, template);
|
|
return _vue_shared__WEBPACK_IMPORTED_MODULE_1__.NOOP;
|
|
}
|
|
}
|
|
const key = template;
|
|
const cached = compileCache[key];
|
|
if (cached) {
|
|
return cached;
|
|
}
|
|
if (template[0] === '#') {
|
|
const el = document.querySelector(template);
|
|
if (( true) && !el) {
|
|
(0,_vue_runtime_dom__WEBPACK_IMPORTED_MODULE_2__.warn)(`Template element not found or is empty: ${template}`);
|
|
}
|
|
// __UNSAFE__
|
|
// Reason: potential execution of JS expressions in in-DOM template.
|
|
// The user must make sure the in-DOM template is trusted. If it's rendered
|
|
// by the server, the template should not contain any user data.
|
|
template = el ? el.innerHTML : ``;
|
|
}
|
|
const { code } = (0,_vue_compiler_dom__WEBPACK_IMPORTED_MODULE_3__.compile)(template, (0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.extend)({
|
|
hoistStatic: true,
|
|
onError: ( true) ? onError : 0,
|
|
onWarn: ( true) ? e => onError(e, true) : 0
|
|
}, options));
|
|
function onError(err, asWarning = false) {
|
|
const message = asWarning
|
|
? err.message
|
|
: `Template compilation error: ${err.message}`;
|
|
const codeFrame = err.loc &&
|
|
(0,_vue_shared__WEBPACK_IMPORTED_MODULE_1__.generateCodeFrame)(template, err.loc.start.offset, err.loc.end.offset);
|
|
(0,_vue_runtime_dom__WEBPACK_IMPORTED_MODULE_2__.warn)(codeFrame ? `${message}\n${codeFrame}` : message);
|
|
}
|
|
// The wildcard import results in a huge object with every export
|
|
// with keys that cannot be mangled, and can be quite heavy size-wise.
|
|
// In the global build we know `Vue` is available globally so we can avoid
|
|
// the wildcard object.
|
|
const render = (new Function('Vue', code)(_vue_runtime_dom__WEBPACK_IMPORTED_MODULE_0__));
|
|
render._rc = true;
|
|
return (compileCache[key] = render);
|
|
}
|
|
(0,_vue_runtime_dom__WEBPACK_IMPORTED_MODULE_2__.registerRuntimeCompiler)(compileToFunction);
|
|
|
|
|
|
|
|
|
|
/***/ })
|
|
|
|
/******/ });
|
|
/************************************************************************/
|
|
/******/ // The module cache
|
|
/******/ var __webpack_module_cache__ = {};
|
|
/******/
|
|
/******/ // The require function
|
|
/******/ function __webpack_require__(moduleId) {
|
|
/******/ // Check if module is in cache
|
|
/******/ var cachedModule = __webpack_module_cache__[moduleId];
|
|
/******/ if (cachedModule !== undefined) {
|
|
/******/ return cachedModule.exports;
|
|
/******/ }
|
|
/******/ // Create a new module (and put it into the cache)
|
|
/******/ var module = __webpack_module_cache__[moduleId] = {
|
|
/******/ id: moduleId,
|
|
/******/ loaded: false,
|
|
/******/ exports: {}
|
|
/******/ };
|
|
/******/
|
|
/******/ // Execute the module function
|
|
/******/ __webpack_modules__[moduleId].call(module.exports, module, module.exports, __webpack_require__);
|
|
/******/
|
|
/******/ // Flag the module as loaded
|
|
/******/ module.loaded = true;
|
|
/******/
|
|
/******/ // Return the exports of the module
|
|
/******/ return module.exports;
|
|
/******/ }
|
|
/******/
|
|
/******/ // expose the modules object (__webpack_modules__)
|
|
/******/ __webpack_require__.m = __webpack_modules__;
|
|
/******/
|
|
/************************************************************************/
|
|
/******/ /* webpack/runtime/chunk loaded */
|
|
/******/ (() => {
|
|
/******/ var deferred = [];
|
|
/******/ __webpack_require__.O = (result, chunkIds, fn, priority) => {
|
|
/******/ if(chunkIds) {
|
|
/******/ priority = priority || 0;
|
|
/******/ for(var i = deferred.length; i > 0 && deferred[i - 1][2] > priority; i--) deferred[i] = deferred[i - 1];
|
|
/******/ deferred[i] = [chunkIds, fn, priority];
|
|
/******/ return;
|
|
/******/ }
|
|
/******/ var notFulfilled = Infinity;
|
|
/******/ for (var i = 0; i < deferred.length; i++) {
|
|
/******/ var [chunkIds, fn, priority] = deferred[i];
|
|
/******/ var fulfilled = true;
|
|
/******/ for (var j = 0; j < chunkIds.length; j++) {
|
|
/******/ if ((priority & 1 === 0 || notFulfilled >= priority) && Object.keys(__webpack_require__.O).every((key) => (__webpack_require__.O[key](chunkIds[j])))) {
|
|
/******/ chunkIds.splice(j--, 1);
|
|
/******/ } else {
|
|
/******/ fulfilled = false;
|
|
/******/ if(priority < notFulfilled) notFulfilled = priority;
|
|
/******/ }
|
|
/******/ }
|
|
/******/ if(fulfilled) {
|
|
/******/ deferred.splice(i--, 1)
|
|
/******/ var r = fn();
|
|
/******/ if (r !== undefined) result = r;
|
|
/******/ }
|
|
/******/ }
|
|
/******/ return result;
|
|
/******/ };
|
|
/******/ })();
|
|
/******/
|
|
/******/ /* webpack/runtime/compat get default export */
|
|
/******/ (() => {
|
|
/******/ // getDefaultExport function for compatibility with non-harmony modules
|
|
/******/ __webpack_require__.n = (module) => {
|
|
/******/ var getter = module && module.__esModule ?
|
|
/******/ () => (module['default']) :
|
|
/******/ () => (module);
|
|
/******/ __webpack_require__.d(getter, { a: getter });
|
|
/******/ return getter;
|
|
/******/ };
|
|
/******/ })();
|
|
/******/
|
|
/******/ /* webpack/runtime/define property getters */
|
|
/******/ (() => {
|
|
/******/ // define getter functions for harmony exports
|
|
/******/ __webpack_require__.d = (exports, definition) => {
|
|
/******/ for(var key in definition) {
|
|
/******/ if(__webpack_require__.o(definition, key) && !__webpack_require__.o(exports, key)) {
|
|
/******/ Object.defineProperty(exports, key, { enumerable: true, get: definition[key] });
|
|
/******/ }
|
|
/******/ }
|
|
/******/ };
|
|
/******/ })();
|
|
/******/
|
|
/******/ /* webpack/runtime/global */
|
|
/******/ (() => {
|
|
/******/ __webpack_require__.g = (function() {
|
|
/******/ if (typeof globalThis === 'object') return globalThis;
|
|
/******/ try {
|
|
/******/ return this || new Function('return this')();
|
|
/******/ } catch (e) {
|
|
/******/ if (typeof window === 'object') return window;
|
|
/******/ }
|
|
/******/ })();
|
|
/******/ })();
|
|
/******/
|
|
/******/ /* webpack/runtime/hasOwnProperty shorthand */
|
|
/******/ (() => {
|
|
/******/ __webpack_require__.o = (obj, prop) => (Object.prototype.hasOwnProperty.call(obj, prop))
|
|
/******/ })();
|
|
/******/
|
|
/******/ /* webpack/runtime/make namespace object */
|
|
/******/ (() => {
|
|
/******/ // define __esModule on exports
|
|
/******/ __webpack_require__.r = (exports) => {
|
|
/******/ if(typeof Symbol !== 'undefined' && Symbol.toStringTag) {
|
|
/******/ Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });
|
|
/******/ }
|
|
/******/ Object.defineProperty(exports, '__esModule', { value: true });
|
|
/******/ };
|
|
/******/ })();
|
|
/******/
|
|
/******/ /* webpack/runtime/node module decorator */
|
|
/******/ (() => {
|
|
/******/ __webpack_require__.nmd = (module) => {
|
|
/******/ module.paths = [];
|
|
/******/ if (!module.children) module.children = [];
|
|
/******/ return module;
|
|
/******/ };
|
|
/******/ })();
|
|
/******/
|
|
/******/ /* webpack/runtime/jsonp chunk loading */
|
|
/******/ (() => {
|
|
/******/ // no baseURI
|
|
/******/
|
|
/******/ // object to store loaded and loading chunks
|
|
/******/ // undefined = chunk not loaded, null = chunk preloaded/prefetched
|
|
/******/ // [resolve, reject, Promise] = chunk loading, 0 = chunk loaded
|
|
/******/ var installedChunks = {
|
|
/******/ "/js/app": 0,
|
|
/******/ "css/app": 0
|
|
/******/ };
|
|
/******/
|
|
/******/ // no chunk on demand loading
|
|
/******/
|
|
/******/ // no prefetching
|
|
/******/
|
|
/******/ // no preloaded
|
|
/******/
|
|
/******/ // no HMR
|
|
/******/
|
|
/******/ // no HMR manifest
|
|
/******/
|
|
/******/ __webpack_require__.O.j = (chunkId) => (installedChunks[chunkId] === 0);
|
|
/******/
|
|
/******/ // install a JSONP callback for chunk loading
|
|
/******/ var webpackJsonpCallback = (parentChunkLoadingFunction, data) => {
|
|
/******/ var [chunkIds, moreModules, runtime] = data;
|
|
/******/ // add "moreModules" to the modules object,
|
|
/******/ // then flag all "chunkIds" as loaded and fire callback
|
|
/******/ var moduleId, chunkId, i = 0;
|
|
/******/ if(chunkIds.some((id) => (installedChunks[id] !== 0))) {
|
|
/******/ for(moduleId in moreModules) {
|
|
/******/ if(__webpack_require__.o(moreModules, moduleId)) {
|
|
/******/ __webpack_require__.m[moduleId] = moreModules[moduleId];
|
|
/******/ }
|
|
/******/ }
|
|
/******/ if(runtime) var result = runtime(__webpack_require__);
|
|
/******/ }
|
|
/******/ if(parentChunkLoadingFunction) parentChunkLoadingFunction(data);
|
|
/******/ for(;i < chunkIds.length; i++) {
|
|
/******/ chunkId = chunkIds[i];
|
|
/******/ if(__webpack_require__.o(installedChunks, chunkId) && installedChunks[chunkId]) {
|
|
/******/ installedChunks[chunkId][0]();
|
|
/******/ }
|
|
/******/ installedChunks[chunkIds[i]] = 0;
|
|
/******/ }
|
|
/******/ return __webpack_require__.O(result);
|
|
/******/ }
|
|
/******/
|
|
/******/ var chunkLoadingGlobal = self["webpackChunk"] = self["webpackChunk"] || [];
|
|
/******/ chunkLoadingGlobal.forEach(webpackJsonpCallback.bind(null, 0));
|
|
/******/ chunkLoadingGlobal.push = webpackJsonpCallback.bind(null, chunkLoadingGlobal.push.bind(chunkLoadingGlobal));
|
|
/******/ })();
|
|
/******/
|
|
/************************************************************************/
|
|
/******/
|
|
/******/ // startup
|
|
/******/ // Load entry module and return exports
|
|
/******/ // This entry module depends on other loaded chunks and execution need to be delayed
|
|
/******/ __webpack_require__.O(undefined, ["css/app"], () => (__webpack_require__("./resources/js/app.js")))
|
|
/******/ var __webpack_exports__ = __webpack_require__.O(undefined, ["css/app"], () => (__webpack_require__("./resources/scss/app.scss")))
|
|
/******/ __webpack_exports__ = __webpack_require__.O(__webpack_exports__);
|
|
/******/
|
|
/******/ })()
|
|
; |